diff --git a/rmgpy/molecule/draw.py b/rmgpy/molecule/draw.py index ad6f0e60701..89aa83d6f2e 100644 --- a/rmgpy/molecule/draw.py +++ b/rmgpy/molecule/draw.py @@ -155,7 +155,7 @@ def clear(self): self.surface = None self.cr = None - def draw(self, molecule, file_format, target=None): + def draw(self, molecule, file_format, target=None, use_rdkit=True): """ Draw the given `molecule` using the given image `file_format` - pdf, svg, ps, or png. If `path` is given, the drawing is saved to that location on disk. The @@ -165,6 +165,9 @@ def draw(self, molecule, file_format, target=None): This function returns the Cairo surface and context used to create the drawing, as well as a bounding box for the molecule being drawn as the tuple (`left`, `top`, `width`, `height`). + + If `use_rdkit` is True, then the RDKit 2D coordinate generation is used to generate the coordinates. + If `use_rdkit` is False, then the molecule is drawn using our (deprecated) original algorithm. """ # The Cairo 2D graphics library (and its Python wrapper) is required for @@ -219,13 +222,13 @@ def draw(self, molecule, file_format, target=None): if molecule.contains_surface_site(): try: self._connect_surface_sites() - self._generate_coordinates() + self._generate_coordinates(use_rdkit=use_rdkit) self._disconnect_surface_sites() except AdsorbateDrawingError as e: self._disconnect_surface_sites() - self._generate_coordinates(fix_surface_sites=False) + self._generate_coordinates(fix_surface_sites=False, use_rdkit=use_rdkit) else: - self._generate_coordinates() + self._generate_coordinates(use_rdkit=use_rdkit) self._replace_bonds(old_bond_dictionary) # Generate labels to use @@ -341,7 +344,7 @@ def _find_ring_groups(self): if not found: self.ringSystems.append([cycle]) - def _generate_coordinates(self, fix_surface_sites=True): + def _generate_coordinates(self, fix_surface_sites=True, use_rdkit=True): """ Generate the 2D coordinates to be used when drawing the current molecule. The function uses rdKits 2D coordinate generation. @@ -372,15 +375,34 @@ def _generate_coordinates(self, fix_surface_sites=True): self.coordinates[1, :] = [0.5, 0.0] return self.coordinates - # Decide whether we can use RDKit or have to generate coordinates ourselves - for atom in self.molecule.atoms: - if atom.charge != 0: - use_rdkit = False - break - else: # didn't break - use_rdkit = True + if use_rdkit == True: + # Use RDKit 2D coordinate generation: + + # Generate the RDkit molecule from the RDkit molecule, use geometry + # in order to match the atoms in the rdmol with the atoms in the + # RMG molecule (which is required to extract coordinates). + self.geometry = Geometry(None, None, self.molecule, None) + + rdmol, rd_atom_idx = self.geometry.rd_build() + AllChem.Compute2DCoords(rdmol) + + # Extract the coordinates from each atom. + for atom in atoms: + index = rd_atom_idx[atom] + point = rdmol.GetConformer(0).GetAtomPosition(index) + coordinates[index, :] = [point.x * 0.6, point.y * 0.6] + + # RDKit generates some molecules more vertically than horizontally, + # Especially linear ones. This will reflect any molecule taller than + # it is wide across the line y=x + ranges = np.ptp(coordinates, axis=0) + if ranges[1] > ranges[0]: + temp = np.copy(coordinates) + coordinates[:, 0] = temp[:, 1] + coordinates[:, 1] = temp[:, 0] - if not use_rdkit: + else: + logging.warning("Using deprecated molecule drawing algorithm; undesired behavior may occur. Consider using use_rdkit=True.") if len(self.cycles) > 0: # Cyclic molecule backbone = self._find_cyclic_backbone() @@ -438,32 +460,6 @@ def _generate_coordinates(self, fix_surface_sites=True): # minimize likelihood of overlap self._generate_neighbor_coordinates(backbone) - else: - # Use RDKit 2D coordinate generation: - - # Generate the RDkit molecule from the RDkit molecule, use geometry - # in order to match the atoms in the rdmol with the atoms in the - # RMG molecule (which is required to extract coordinates). - self.geometry = Geometry(None, None, self.molecule, None) - - rdmol, rd_atom_idx = self.geometry.rd_build() - AllChem.Compute2DCoords(rdmol) - - # Extract the coordinates from each atom. - for atom in atoms: - index = rd_atom_idx[atom] - point = rdmol.GetConformer(0).GetAtomPosition(index) - coordinates[index, :] = [point.x * 0.6, point.y * 0.6] - - # RDKit generates some molecules more vertically than horizontally, - # Especially linear ones. This will reflect any molecule taller than - # it is wide across the line y=x - ranges = np.ptp(coordinates, axis=0) - if ranges[1] > ranges[0]: - temp = np.copy(coordinates) - coordinates[:, 0] = temp[:, 1] - coordinates[:, 1] = temp[:, 0] - # For surface species if fix_surface_sites and self.molecule.contains_surface_site(): if len(self.molecule.atoms) == 1: diff --git a/test/rmgpy/molecule/drawTest.py b/test/rmgpy/molecule/drawTest.py index 6c416f171d8..dec288ab79a 100644 --- a/test/rmgpy/molecule/drawTest.py +++ b/test/rmgpy/molecule/drawTest.py @@ -297,4 +297,102 @@ def test_draw_bidentate_adsorbate(self): surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(molecule, file_format="png", target=path) assert os.path.exists(path), "File doesn't exist" os.unlink(path) - assert isinstance(surface, ImageSurface) \ No newline at end of file + assert isinstance(surface, ImageSurface) + + def test_draw_bidentate_with_charge_separation(self): + molecule = Molecule().from_adjacency_list( + """ +1 X u0 p0 c0 {3,S} +2 X u0 p0 c0 {4,D} +3 O u0 p2 c0 {1,S} {4,S} +4 N u0 p0 c+1 {3,S} {2,D} {5,S} +5 O u0 p3 c-1 {4,S} + """ + ) + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + surface, _cr, (_xoff, _yoff, _width, _height) = self.drawer.draw(molecule, file_format="pdf") + assert isinstance(surface, PDFSurface) + + def test_draw_cation(self): + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + polycycle = Molecule(smiles="C1=NC2=C(N1)C(=O)[NH2+]C(=N2)N") + surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(polycycle, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + assert width > height + os.unlink(path) + + def test_draw_anion(self): + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + polycycle = Molecule(smiles="c1ccc2c3ccccc3[CH-]c2c1") + surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(polycycle, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + assert width > height + os.unlink(path) + + def test_draw_zwitterion(self): + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + polycycle = Molecule(smiles="[NH3+]CC(=O)[O-]") + surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(polycycle, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + assert width > height + os.unlink(path) + + def test_draw_cation_on_surface(self): + molecule = Molecule().from_adjacency_list( + """ +1 X u0 p0 c0 {3,S} +2 X u0 p0 c0 {3,S} +3 O u0 p1 c+1 {1,S} {2,S} {4,S} +4 H u0 p0 c0 {3,S} + """ + ) + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + surface, _cr, (_xoff, _yoff, _width, _height) = self.drawer.draw(molecule, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + os.unlink(path) + + + def test_draw_anion_on_surface(self): + molecule = Molecule().from_adjacency_list( + """ +1 X u0 p0 c0 {2,S} +2 O u0 p3 c-1 {1,S} + """ + ) + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + surface, _cr, (_xoff, _yoff, _width, _height) = self.drawer.draw(molecule, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + os.unlink(path)