From dab327c9df8bf50b10d8c3f8c731ec7afb9aafa0 Mon Sep 17 00:00:00 2001 From: Kirk Badger Date: Thu, 24 Jul 2025 12:01:08 -0400 Subject: [PATCH 1/3] added a test for drawing bidentates with charge separation --- test/rmgpy/molecule/drawTest.py | 19 ++++++++++++++++++- 1 file changed, 18 insertions(+), 1 deletion(-) diff --git a/test/rmgpy/molecule/drawTest.py b/test/rmgpy/molecule/drawTest.py index 6c416f171d8..5cc69b86909 100644 --- a/test/rmgpy/molecule/drawTest.py +++ b/test/rmgpy/molecule/drawTest.py @@ -297,4 +297,21 @@ def test_draw_bidentate_adsorbate(self): surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(molecule, file_format="png", target=path) assert os.path.exists(path), "File doesn't exist" os.unlink(path) - assert isinstance(surface, ImageSurface) \ No newline at end of file + assert isinstance(surface, ImageSurface) + + def test_draw_bidentate_with_charge_separation(self): + molecule = Molecule().from_adjacency_list( + """ +1 X u0 p0 c0 {3,S} +2 X u0 p0 c0 {4,D} +3 O u0 p2 c0 {1,S} {4,S} +4 N u0 p0 c+1 {3,S} {2,D} {5,S} +5 O u0 p3 c-1 {4,S} + """ + ) + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + surface, _cr, (_xoff, _yoff, _width, _height) = self.drawer.draw(molecule, file_format="pdf") + assert isinstance(surface, PDFSurface) From c0c27bc6122220a0a8a14db6d395cad61488ab9e Mon Sep 17 00:00:00 2001 From: jonwzheng Date: Fri, 25 Jul 2025 10:47:40 -0400 Subject: [PATCH 2/3] Make rdkit default for draw coordinate generation In #2744 and #2796 it was found that charge-separated bidentate species can have issues due to ring perception conflicts. The previous implementation also by default did not use the rdkit backend for charged species, but this was decided many years ago (~10 years!) In the meantime, RDKit conformer generation has improved and likely this we can just use RDKit by default, which would avoid the pesky edge-case issues for ions/zwitterions. In case the old behavior is desired, use_rdkit can be set to False. --- rmgpy/molecule/draw.py | 74 ++++++++++++++++++++---------------------- 1 file changed, 35 insertions(+), 39 deletions(-) diff --git a/rmgpy/molecule/draw.py b/rmgpy/molecule/draw.py index ad6f0e60701..89aa83d6f2e 100644 --- a/rmgpy/molecule/draw.py +++ b/rmgpy/molecule/draw.py @@ -155,7 +155,7 @@ def clear(self): self.surface = None self.cr = None - def draw(self, molecule, file_format, target=None): + def draw(self, molecule, file_format, target=None, use_rdkit=True): """ Draw the given `molecule` using the given image `file_format` - pdf, svg, ps, or png. If `path` is given, the drawing is saved to that location on disk. The @@ -165,6 +165,9 @@ def draw(self, molecule, file_format, target=None): This function returns the Cairo surface and context used to create the drawing, as well as a bounding box for the molecule being drawn as the tuple (`left`, `top`, `width`, `height`). + + If `use_rdkit` is True, then the RDKit 2D coordinate generation is used to generate the coordinates. + If `use_rdkit` is False, then the molecule is drawn using our (deprecated) original algorithm. """ # The Cairo 2D graphics library (and its Python wrapper) is required for @@ -219,13 +222,13 @@ def draw(self, molecule, file_format, target=None): if molecule.contains_surface_site(): try: self._connect_surface_sites() - self._generate_coordinates() + self._generate_coordinates(use_rdkit=use_rdkit) self._disconnect_surface_sites() except AdsorbateDrawingError as e: self._disconnect_surface_sites() - self._generate_coordinates(fix_surface_sites=False) + self._generate_coordinates(fix_surface_sites=False, use_rdkit=use_rdkit) else: - self._generate_coordinates() + self._generate_coordinates(use_rdkit=use_rdkit) self._replace_bonds(old_bond_dictionary) # Generate labels to use @@ -341,7 +344,7 @@ def _find_ring_groups(self): if not found: self.ringSystems.append([cycle]) - def _generate_coordinates(self, fix_surface_sites=True): + def _generate_coordinates(self, fix_surface_sites=True, use_rdkit=True): """ Generate the 2D coordinates to be used when drawing the current molecule. The function uses rdKits 2D coordinate generation. @@ -372,15 +375,34 @@ def _generate_coordinates(self, fix_surface_sites=True): self.coordinates[1, :] = [0.5, 0.0] return self.coordinates - # Decide whether we can use RDKit or have to generate coordinates ourselves - for atom in self.molecule.atoms: - if atom.charge != 0: - use_rdkit = False - break - else: # didn't break - use_rdkit = True + if use_rdkit == True: + # Use RDKit 2D coordinate generation: + + # Generate the RDkit molecule from the RDkit molecule, use geometry + # in order to match the atoms in the rdmol with the atoms in the + # RMG molecule (which is required to extract coordinates). + self.geometry = Geometry(None, None, self.molecule, None) + + rdmol, rd_atom_idx = self.geometry.rd_build() + AllChem.Compute2DCoords(rdmol) + + # Extract the coordinates from each atom. + for atom in atoms: + index = rd_atom_idx[atom] + point = rdmol.GetConformer(0).GetAtomPosition(index) + coordinates[index, :] = [point.x * 0.6, point.y * 0.6] + + # RDKit generates some molecules more vertically than horizontally, + # Especially linear ones. This will reflect any molecule taller than + # it is wide across the line y=x + ranges = np.ptp(coordinates, axis=0) + if ranges[1] > ranges[0]: + temp = np.copy(coordinates) + coordinates[:, 0] = temp[:, 1] + coordinates[:, 1] = temp[:, 0] - if not use_rdkit: + else: + logging.warning("Using deprecated molecule drawing algorithm; undesired behavior may occur. Consider using use_rdkit=True.") if len(self.cycles) > 0: # Cyclic molecule backbone = self._find_cyclic_backbone() @@ -438,32 +460,6 @@ def _generate_coordinates(self, fix_surface_sites=True): # minimize likelihood of overlap self._generate_neighbor_coordinates(backbone) - else: - # Use RDKit 2D coordinate generation: - - # Generate the RDkit molecule from the RDkit molecule, use geometry - # in order to match the atoms in the rdmol with the atoms in the - # RMG molecule (which is required to extract coordinates). - self.geometry = Geometry(None, None, self.molecule, None) - - rdmol, rd_atom_idx = self.geometry.rd_build() - AllChem.Compute2DCoords(rdmol) - - # Extract the coordinates from each atom. - for atom in atoms: - index = rd_atom_idx[atom] - point = rdmol.GetConformer(0).GetAtomPosition(index) - coordinates[index, :] = [point.x * 0.6, point.y * 0.6] - - # RDKit generates some molecules more vertically than horizontally, - # Especially linear ones. This will reflect any molecule taller than - # it is wide across the line y=x - ranges = np.ptp(coordinates, axis=0) - if ranges[1] > ranges[0]: - temp = np.copy(coordinates) - coordinates[:, 0] = temp[:, 1] - coordinates[:, 1] = temp[:, 0] - # For surface species if fix_surface_sites and self.molecule.contains_surface_site(): if len(self.molecule.atoms) == 1: From de4fa63a9de4ae6dc7d1b1e8b3c50351966d5250 Mon Sep 17 00:00:00 2001 From: jonwzheng Date: Fri, 25 Jul 2025 11:16:43 -0400 Subject: [PATCH 3/3] add ion test cases to drawTest Accompanies changes to `draw.py` to use `rdkit` backend, which traditionally was not well-supported for ions (but now might be a better option than the default drawing algorithm). --- test/rmgpy/molecule/drawTest.py | 81 +++++++++++++++++++++++++++++++++ 1 file changed, 81 insertions(+) diff --git a/test/rmgpy/molecule/drawTest.py b/test/rmgpy/molecule/drawTest.py index 5cc69b86909..dec288ab79a 100644 --- a/test/rmgpy/molecule/drawTest.py +++ b/test/rmgpy/molecule/drawTest.py @@ -315,3 +315,84 @@ def test_draw_bidentate_with_charge_separation(self): from cairo import PDFSurface surface, _cr, (_xoff, _yoff, _width, _height) = self.drawer.draw(molecule, file_format="pdf") assert isinstance(surface, PDFSurface) + + def test_draw_cation(self): + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + polycycle = Molecule(smiles="C1=NC2=C(N1)C(=O)[NH2+]C(=N2)N") + surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(polycycle, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + assert width > height + os.unlink(path) + + def test_draw_anion(self): + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + polycycle = Molecule(smiles="c1ccc2c3ccccc3[CH-]c2c1") + surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(polycycle, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + assert width > height + os.unlink(path) + + def test_draw_zwitterion(self): + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + polycycle = Molecule(smiles="[NH3+]CC(=O)[O-]") + surface, _cr, (_xoff, _yoff, width, height) = self.drawer.draw(polycycle, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + assert width > height + os.unlink(path) + + def test_draw_cation_on_surface(self): + molecule = Molecule().from_adjacency_list( + """ +1 X u0 p0 c0 {3,S} +2 X u0 p0 c0 {3,S} +3 O u0 p1 c+1 {1,S} {2,S} {4,S} +4 H u0 p0 c0 {3,S} + """ + ) + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + surface, _cr, (_xoff, _yoff, _width, _height) = self.drawer.draw(molecule, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + os.unlink(path) + + + def test_draw_anion_on_surface(self): + molecule = Molecule().from_adjacency_list( + """ +1 X u0 p0 c0 {2,S} +2 O u0 p3 c-1 {1,S} + """ + ) + try: + from cairocffi import PDFSurface + except ImportError: + from cairo import PDFSurface + path = "test_molecule.pdf" + if os.path.exists(path): + os.unlink(path) + surface, _cr, (_xoff, _yoff, _width, _height) = self.drawer.draw(molecule, file_format="pdf", target=path) + assert isinstance(surface, PDFSurface) + os.unlink(path)