From 113b5cb8a419fc8f55589f68972ec4a6c3caafc4 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Mon, 13 Oct 2025 16:54:55 +0200 Subject: [PATCH 01/19] Add proprietary license for software usage Added a proprietary license to the repository outlining permitted and prohibited actions regarding the software. --- LICENSE | 23 + backend/Cargo.lock | 4270 ++++++++++++++++++++++++++++++++ backend/Cargo.toml | 75 + backend/conf/default.toml | 16 + backend/src/config.rs | 54 + backend/src/main.rs | 113 + backend/src/processes/echo.rs | 143 ++ backend/src/processes/hello.rs | 52 + backend/src/processes/mod.rs | 5 + rust-toolchain.toml | 3 + test-client/.python-version | 1 + test-client/call-process.ipynb | 384 +++ test.http | 44 + 13 files changed, 5183 insertions(+) create mode 100644 LICENSE create mode 100644 backend/Cargo.lock create mode 100644 backend/Cargo.toml create mode 100644 backend/conf/default.toml create mode 100644 backend/src/config.rs create mode 100644 backend/src/main.rs create mode 100644 backend/src/processes/echo.rs create mode 100644 backend/src/processes/hello.rs create mode 100644 backend/src/processes/mod.rs create mode 100644 rust-toolchain.toml create mode 100644 test-client/.python-version create mode 100644 test-client/call-process.ipynb create mode 100644 test.http diff --git a/LICENSE b/LICENSE new file mode 100644 index 0000000..974f73e --- /dev/null +++ b/LICENSE @@ -0,0 +1,23 @@ +PROPRIETARY LICENSE + +Copyright (c) 2025 Geo Engine GmbH. All rights reserved. + +This repository and its entire content, including all code, documentation, and related assets (collectively, the "Software"), are the proprietary intellectual property of Geo Engine GmbH. + +The Software is not licensed under an Open Source initiative. + +Permitted Actions: +Users of this public GitHub repository are hereby granted a limited, non-exclusive right to: +1. View the Software and its history via the GitHub web interface. +2. Fork the repository for the sole purpose of viewing and personal study within the GitHub platform. +3. Clone the repository for the sole purpose of viewing and personal study. + +Prohibited Actions: +Any unauthorized use, reproduction, modification, distribution, commercial exploitation, or public performance of the Software, or any derivative works based on the Software, is strictly prohibited without the express prior written permission of Geo Engine GmbH. + +This includes, but is not limited to: +* Using any part of the code in a software application, service, or product. +* Distributing copies of the code, in original or modified form. +* Reverse engineering the Software. + +Geo Engine GmbH reserves all rights not expressly granted in this document. The Software is provided "AS IS," without warranty of any kind, express or implied. diff --git a/backend/Cargo.lock b/backend/Cargo.lock new file mode 100644 index 0000000..aeef73c --- /dev/null +++ b/backend/Cargo.lock @@ -0,0 +1,4270 @@ +# This file is automatically @generated by Cargo. +# It is not intended for manual editing. +version = 4 + +[[package]] +name = "BioIS" +version = "0.1.0" +dependencies = [ + "anyhow", + "async-trait", + "axum", + "axum-extra", + "clap", + "clap_derive", + "config", + "ogcapi", + "schemars 1.0.4", + "serde", + "serde_json", + "tokio", + "tower", + "tower-http", + "tracing", + "tracing-subscriber", + "url", + "utoipa", + "utoipa-axum", +] + +[[package]] +name = "addr2line" +version = "0.25.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1b5d307320b3181d6d7954e663bd7c774a838b8220fe0593c86d9fb09f498b4b" +dependencies = [ + "gimli", +] + +[[package]] +name = "adler2" +version = "2.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "320119579fcad9c21884f5c4861d16174d0e06250625266f50fe6898340abefa" + +[[package]] +name = "ahash" +version = "0.8.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5a15f179cd60c4584b8a8c596927aadc462e27f2ca70c04e0071964a73ba7a75" +dependencies = [ + "cfg-if", + "const-random", + "getrandom 0.3.3", + "once_cell", + "version_check", + "zerocopy", +] + +[[package]] +name = "aho-corasick" +version = "1.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8e60d3430d3a69478ad0993f19238d2df97c507009a52b3c10addcd7f6bcb916" +dependencies = [ + "memchr", +] + +[[package]] +name = "allocator-api2" +version = "0.2.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "683d7910e743518b0e34f1186f92494becacb047c7b6bf616c96772180fef923" + +[[package]] +name = "android_system_properties" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "819e7219dbd41043ac279b19830f2efc897156490d7fd6ea916720117ee66311" +dependencies = [ + "libc", +] + +[[package]] +name = "anstream" +version = "0.6.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3ae563653d1938f79b1ab1b5e668c87c76a9930414574a6583a7b7e11a8e6192" +dependencies = [ + "anstyle", + "anstyle-parse", + "anstyle-query", + "anstyle-wincon", + "colorchoice", + "is_terminal_polyfill", + "utf8parse", +] + +[[package]] +name = "anstyle" +version = "1.0.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5192cca8006f1fd4f7237516f40fa183bb07f8fbdfedaa0036de5ea9b0b45e78" + +[[package]] +name = "anstyle-parse" +version = "0.2.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4e7644824f0aa2c7b9384579234ef10eb7efb6a0deb83f9630a49594dd9c15c2" +dependencies = [ + "utf8parse", +] + +[[package]] +name = "anstyle-query" +version = "1.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9e231f6134f61b71076a3eab506c379d4f36122f2af15a9ff04415ea4c3339e2" +dependencies = [ + "windows-sys 0.60.2", +] + +[[package]] +name = "anstyle-wincon" +version = "3.0.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3e0633414522a32ffaac8ac6cc8f748e090c5717661fddeea04219e2344f5f2a" +dependencies = [ + "anstyle", + "once_cell_polyfill", + "windows-sys 0.60.2", +] + +[[package]] +name = "anyhow" +version = "1.0.100" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a23eb6b1614318a8071c9b2521f36b424b2c83db5eb3a0fead4a6c0809af6e61" + +[[package]] +name = "approx" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cab112f0a86d568ea0e627cc1d6be74a1e9cd55214684db5561995f6dad897c6" +dependencies = [ + "num-traits", +] + +[[package]] +name = "arraydeque" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7d902e3d592a523def97af8f317b08ce16b7ab854c1985a0c671e6f15cebc236" + +[[package]] +name = "arrow" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b5ec52ba94edeed950e4a41f75d35376df196e8cb04437f7280a5aa49f20f796" +dependencies = [ + "arrow-arith", + "arrow-array", + "arrow-buffer", + "arrow-cast", + "arrow-data", + "arrow-json", + "arrow-ord", + "arrow-row", + "arrow-schema", + "arrow-select", + "arrow-string", +] + +[[package]] +name = "arrow-arith" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8fc766fdacaf804cb10c7c70580254fcdb5d55cdfda2bc57b02baf5223a3af9e" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "chrono", + "num", +] + +[[package]] +name = "arrow-array" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a12fcdb3f1d03f69d3ec26ac67645a8fe3f878d77b5ebb0b15d64a116c212985" +dependencies = [ + "ahash", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "chrono", + "half", + "hashbrown 0.15.5", + "num", +] + +[[package]] +name = "arrow-buffer" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "263f4801ff1839ef53ebd06f99a56cecd1dbaf314ec893d93168e2e860e0291c" +dependencies = [ + "bytes", + "half", + "num", +] + +[[package]] +name = "arrow-cast" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ede6175fbc039dfc946a61c1b6d42fd682fcecf5ab5d148fbe7667705798cac9" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "arrow-select", + "atoi", + "base64 0.22.1", + "chrono", + "half", + "lexical-core", + "num", + "ryu", +] + +[[package]] +name = "arrow-data" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "61cfdd7d99b4ff618f167e548b2411e5dd2c98c0ddebedd7df433d34c20a4429" +dependencies = [ + "arrow-buffer", + "arrow-schema", + "half", + "num", +] + +[[package]] +name = "arrow-json" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0ee5b4ca98a7fb2efb9ab3309a5d1c88b5116997ff93f3147efdc1062a6158e9" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-cast", + "arrow-data", + "arrow-schema", + "chrono", + "half", + "indexmap 2.11.4", + "lexical-core", + "memchr", + "num", + "serde", + "serde_json", + "simdutf8", +] + +[[package]] +name = "arrow-ord" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f0a3334a743bd2a1479dbc635540617a3923b4b2f6870f37357339e6b5363c21" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "arrow-select", +] + +[[package]] +name = "arrow-row" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8d1d7a7291d2c5107e92140f75257a99343956871f3d3ab33a7b41532f79cb68" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "half", +] + +[[package]] +name = "arrow-schema" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "39cfaf5e440be44db5413b75b72c2a87c1f8f0627117d110264048f2969b99e9" +dependencies = [ + "bitflags", +] + +[[package]] +name = "arrow-select" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "69efcd706420e52cd44f5c4358d279801993846d1c2a8e52111853d61d55a619" +dependencies = [ + "ahash", + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "num", +] + +[[package]] +name = "arrow-string" +version = "54.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a21546b337ab304a32cfc0770f671db7411787586b45b78b4593ae78e64e2b03" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "arrow-select", + "memchr", + "num", + "regex", + "regex-syntax", +] + +[[package]] +name = "async-compression" +version = "0.4.32" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5a89bce6054c720275ac2432fbba080a66a2106a44a1b804553930ca6909f4e0" +dependencies = [ + "compression-codecs", + "compression-core", + "futures-core", + "pin-project-lite", + "tokio", +] + +[[package]] +name = "async-trait" +version = "0.1.89" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9035ad2d096bed7955a320ee7e2230574d28fd3c3a0f186cbea1ff3c7eed5dbb" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "atoi" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f28d99ec8bfea296261ca1af174f24225171fea9664ba9003cbebee704810528" +dependencies = [ + "num-traits", +] + +[[package]] +name = "atomic-waker" +version = "1.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1505bd5d3d116872e7271a6d4e16d81d0c8570876c8de68093a09ac269d8aac0" + +[[package]] +name = "autocfg" +version = "1.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c08606f8c3cbf4ce6ec8e28fb0014a2c086708fe954eaa885384a6165172e7e8" + +[[package]] +name = "axum" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8a18ed336352031311f4e0b4dd2ff392d4fbb370777c9d18d7fc9d7359f73871" +dependencies = [ + "axum-core", + "bytes", + "form_urlencoded", + "futures-util", + "http", + "http-body", + "http-body-util", + "hyper", + "hyper-util", + "itoa", + "matchit", + "memchr", + "mime", + "multer", + "percent-encoding", + "pin-project-lite", + "serde_core", + "serde_json", + "serde_path_to_error", + "serde_urlencoded", + "sync_wrapper", + "tokio", + "tower", + "tower-layer", + "tower-service", + "tracing", +] + +[[package]] +name = "axum-core" +version = "0.5.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "59446ce19cd142f8833f856eb31f3eb097812d1479ab224f54d72428ca21ea22" +dependencies = [ + "bytes", + "futures-core", + "http", + "http-body", + "http-body-util", + "mime", + "pin-project-lite", + "sync_wrapper", + "tower-layer", + "tower-service", + "tracing", +] + +[[package]] +name = "axum-extra" +version = "0.10.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9963ff19f40c6102c76756ef0a46004c0d58957d87259fc9208ff8441c12ab96" +dependencies = [ + "axum", + "axum-core", + "bytes", + "futures-util", + "http", + "http-body", + "http-body-util", + "mime", + "pin-project-lite", + "rustversion", + "serde_core", + "tower-layer", + "tower-service", + "tracing", +] + +[[package]] +name = "backtrace" +version = "0.3.76" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bb531853791a215d7c62a30daf0dde835f381ab5de4589cfe7c649d2cbe92bd6" +dependencies = [ + "addr2line", + "cfg-if", + "libc", + "miniz_oxide", + "object", + "rustc-demangle", + "windows-link", +] + +[[package]] +name = "base64" +version = "0.21.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9d297deb1925b89f2ccc13d7635fa0714f12c87adce1c75356b39ca9b7178567" + +[[package]] +name = "base64" +version = "0.22.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "72b3254f16251a8381aa12e40e3c4d2f0199f8c6508fbecb9d91f575e0fbb8c6" + +[[package]] +name = "base64ct" +version = "1.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "55248b47b0caf0546f7988906588779981c43bb1bc9d0c44087278f80cdb44ba" + +[[package]] +name = "bindgen" +version = "0.71.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5f58bf3d7db68cfbac37cfc485a8d711e87e064c3d0fe0435b92f7a407f9d6b3" +dependencies = [ + "bitflags", + "cexpr", + "clang-sys", + "itertools", + "log", + "prettyplease", + "proc-macro2", + "quote", + "regex", + "rustc-hash", + "shlex", + "syn", +] + +[[package]] +name = "bitflags" +version = "2.9.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2261d10cca569e4643e526d8dc2e62e433cc8aba21ab764233731f8d369bf394" +dependencies = [ + "serde", +] + +[[package]] +name = "block-buffer" +version = "0.10.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3078c7629b62d3f0439517fa394996acacc5cbc91c5a20d8c658e77abd503a71" +dependencies = [ + "generic-array", +] + +[[package]] +name = "bumpalo" +version = "3.19.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "46c5e41b57b8bba42a04676d81cb89e9ee8e859a1a66f80a5a72e1cb76b34d43" + +[[package]] +name = "byteorder" +version = "1.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1fd0f2584146f6f2ef48085050886acf353beff7305ebd1ae69500e27c67f64b" + +[[package]] +name = "bytes" +version = "1.10.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d71b6127be86fdcfddb610f7182ac57211d4b18a3e9c82eb2d17662f2227ad6a" + +[[package]] +name = "cc" +version = "1.2.39" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e1354349954c6fc9cb0deab020f27f783cf0b604e8bb754dc4658ecf0d29c35f" +dependencies = [ + "find-msvc-tools", + "shlex", +] + +[[package]] +name = "cexpr" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6fac387a98bb7c37292057cffc56d62ecb629900026402633ae9160df93a8766" +dependencies = [ + "nom", +] + +[[package]] +name = "cfg-if" +version = "1.0.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2fd1289c04a9ea8cb22300a459a72a385d7c73d3259e2ed7dcb2af674838cfa9" + +[[package]] +name = "chrono" +version = "0.4.42" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "145052bdd345b87320e369255277e3fb5152762ad123a901ef5c262dd38fe8d2" +dependencies = [ + "iana-time-zone", + "js-sys", + "num-traits", + "serde", + "wasm-bindgen", + "windows-link", +] + +[[package]] +name = "chrono-humanize" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8164ae3089baf04ff71f32aeb70213283dcd236dce8bc976d00b17a458f5f71c" +dependencies = [ + "chrono", +] + +[[package]] +name = "chrono-tz" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2554a3155fec064362507487171dcc4edc3df60cb10f3a1fb10ed8094822b120" +dependencies = [ + "chrono", + "parse-zoneinfo", +] + +[[package]] +name = "clang-sys" +version = "1.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b023947811758c97c59bf9d1c188fd619ad4718dcaa767947df1cadb14f39f4" +dependencies = [ + "glob", + "libc", + "libloading", +] + +[[package]] +name = "clap" +version = "4.5.48" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e2134bb3ea021b78629caa971416385309e0131b351b25e01dc16fb54e1b5fae" +dependencies = [ + "clap_builder", + "clap_derive", +] + +[[package]] +name = "clap_builder" +version = "4.5.48" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c2ba64afa3c0a6df7fa517765e31314e983f51dda798ffba27b988194fb65dc9" +dependencies = [ + "anstream", + "anstyle", + "clap_lex", + "strsim 0.11.1", +] + +[[package]] +name = "clap_derive" +version = "4.5.47" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbfd7eae0b0f1a6e63d4b13c9c478de77c2eb546fba158ad50b4203dc24b9f9c" +dependencies = [ + "heck", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "clap_lex" +version = "0.7.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b94f61472cee1439c0b966b47e3aca9ae07e45d070759512cd390ea2bebc6675" + +[[package]] +name = "colorchoice" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b05b61dc5112cbb17e4b6cd61790d9845d13888356391624cbe7e41efeac1e75" + +[[package]] +name = "compression-codecs" +version = "0.4.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ef8a506ec4b81c460798f572caead636d57d3d7e940f998160f52bd254bf2d23" +dependencies = [ + "compression-core", + "flate2", + "memchr", +] + +[[package]] +name = "compression-core" +version = "0.4.29" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e47641d3deaf41fb1538ac1f54735925e275eaf3bf4d55c81b137fba797e5cbb" + +[[package]] +name = "concurrent-queue" +version = "2.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4ca0197aee26d1ae37445ee532fefce43251d24cc7c166799f4d46817f1d3973" +dependencies = [ + "crossbeam-utils", +] + +[[package]] +name = "config" +version = "0.15.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "180e549344080374f9b32ed41bf3b6b57885ff6a289367b3dbc10eea8acc1918" +dependencies = [ + "async-trait", + "convert_case", + "json5", + "pathdiff", + "ron", + "rust-ini", + "serde-untagged", + "serde_core", + "serde_json", + "toml", + "winnow", + "yaml-rust2", +] + +[[package]] +name = "const-oid" +version = "0.9.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c2459377285ad874054d797f3ccebf984978aa39129f6eafde5cdc8315b612f8" + +[[package]] +name = "const-random" +version = "0.1.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "87e00182fe74b066627d63b85fd550ac2998d4b0bd86bfed477a0ae4c7c71359" +dependencies = [ + "const-random-macro", +] + +[[package]] +name = "const-random-macro" +version = "0.1.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f9d839f2a20b0aee515dc581a6172f2321f96cab76c1a38a4c584a194955390e" +dependencies = [ + "getrandom 0.2.16", + "once_cell", + "tiny-keccak", +] + +[[package]] +name = "convert_case" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ec182b0ca2f35d8fc196cf3404988fd8b8c739a4d270ff118a398feb0cbec1ca" +dependencies = [ + "unicode-segmentation", +] + +[[package]] +name = "core-foundation-sys" +version = "0.8.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "773648b94d0e5d620f64f280777445740e61fe701025087ec8b57f45c791888b" + +[[package]] +name = "cpufeatures" +version = "0.2.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "59ed5838eebb26a2bb2e58f6d5b5316989ae9d08bab10e0e6d103e656d1b0280" +dependencies = [ + "libc", +] + +[[package]] +name = "crc" +version = "3.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9710d3b3739c2e349eb44fe848ad0b7c8cb1e42bd87ee49371df2f7acaf3e675" +dependencies = [ + "crc-catalog", +] + +[[package]] +name = "crc-catalog" +version = "2.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "19d374276b40fb8bbdee95aef7c7fa6b5316ec764510eb64b8dd0e2ed0d7e7f5" + +[[package]] +name = "crc32fast" +version = "1.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9481c1c90cbf2ac953f07c8d4a58aa3945c425b7185c9154d67a65e4230da511" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "crossbeam-queue" +version = "0.3.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0f58bbc28f91df819d0aa2a2c00cd19754769c2fad90579b3592b1c9ba7a3115" +dependencies = [ + "crossbeam-utils", +] + +[[package]] +name = "crossbeam-utils" +version = "0.8.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d0a5c400df2834b80a4c3327b3aad3a4c4cd4de0629063962b03235697506a28" + +[[package]] +name = "crunchy" +version = "0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "460fbee9c2c2f33933d720630a6a0bac33ba7053db5344fac858d4b8952d77d5" + +[[package]] +name = "crypto-common" +version = "0.1.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1bfb12502f3fc46cca1bb51ac28df9d618d813cdc3d2f25b9fe775a34af26bb3" +dependencies = [ + "generic-array", + "typenum", +] + +[[package]] +name = "darling" +version = "0.21.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9cdf337090841a411e2a7f3deb9187445851f91b309c0c0a29e05f74a00a48c0" +dependencies = [ + "darling_core", + "darling_macro", +] + +[[package]] +name = "darling_core" +version = "0.21.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1247195ecd7e3c85f83c8d2a366e4210d588e802133e1e355180a9870b517ea4" +dependencies = [ + "fnv", + "ident_case", + "proc-macro2", + "quote", + "strsim 0.11.1", + "syn", +] + +[[package]] +name = "darling_macro" +version = "0.21.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d38308df82d1080de0afee5d069fa14b0326a88c14f15c5ccda35b4a6c414c81" +dependencies = [ + "darling_core", + "quote", + "syn", +] + +[[package]] +name = "der" +version = "0.7.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e7c1832837b905bbfb5101e07cc24c8deddf52f93225eee6ead5f4d63d53ddcb" +dependencies = [ + "const-oid", + "pem-rfc7468", + "zeroize", +] + +[[package]] +name = "deranged" +version = "0.5.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a41953f86f8a05768a6cda24def994fd2f424b04ec5c719cf89989779f199071" +dependencies = [ + "powerfmt", + "serde_core", +] + +[[package]] +name = "digest" +version = "0.10.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9ed9a281f7bc9b7576e61468ba615a66a5c8cfdff42420a70aa82701a3b1e292" +dependencies = [ + "block-buffer", + "const-oid", + "crypto-common", + "subtle", +] + +[[package]] +name = "displaydoc" +version = "0.2.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "97369cbbc041bc366949bc74d34658d6cda5621039731c6310521892a3a20ae0" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "dlv-list" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "442039f5147480ba31067cb00ada1adae6892028e40e45fc5de7b7df6dcc1b5f" +dependencies = [ + "const-random", +] + +[[package]] +name = "dotenvy" +version = "0.15.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1aaf95b3e5c8f23aa320147307562d361db0ae0d51242340f558153b4eb2439b" + +[[package]] +name = "dyn-clone" +version = "1.0.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d0881ea181b1df73ff77ffaaf9c7544ecc11e82fba9b5f27b262a3c73a332555" + +[[package]] +name = "either" +version = "1.15.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "48c757948c5ede0e46177b7add2e67155f70e33c07fea8284df6576da70b3719" +dependencies = [ + "serde", +] + +[[package]] +name = "encoding_rs" +version = "0.8.35" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "75030f3c4f45dafd7586dd6780965a8c7e8e285a5ecb86713e63a79c5b2766f3" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "equivalent" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "877a4ace8713b0bcf2a4e7eec82529c029f1d0619886d18145fea96c3ffe5c0f" + +[[package]] +name = "erased-serde" +version = "0.4.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "259d404d09818dec19332e31d94558aeb442fea04c817006456c24b5460bbd4b" +dependencies = [ + "serde", + "serde_core", + "typeid", +] + +[[package]] +name = "etcetera" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "136d1b5283a1ab77bd9257427ffd09d8667ced0570b6f938942bc7568ed5b943" +dependencies = [ + "cfg-if", + "home", + "windows-sys 0.48.0", +] + +[[package]] +name = "event-listener" +version = "5.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e13b66accf52311f30a0db42147dadea9850cb48cd070028831ae5f5d4b856ab" +dependencies = [ + "concurrent-queue", + "parking", + "pin-project-lite", +] + +[[package]] +name = "find-msvc-tools" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1ced73b1dacfc750a6db6c0a0c3a3853c8b41997e2e2c563dc90804ae6867959" + +[[package]] +name = "flate2" +version = "1.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4a3d7db9596fecd151c5f638c0ee5d5bd487b6e0ea232e5dc96d5250f6f94b1d" +dependencies = [ + "crc32fast", + "miniz_oxide", +] + +[[package]] +name = "float_next_after" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8bf7cc16383c4b8d58b9905a8509f02926ce3058053c056376248d958c9df1e8" + +[[package]] +name = "flume" +version = "0.11.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "da0e4dd2a88388a1f4ccc7c9ce104604dab68d9f408dc34cd45823d5a9069095" +dependencies = [ + "futures-core", + "futures-sink", + "spin", +] + +[[package]] +name = "fnv" +version = "1.0.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1" + +[[package]] +name = "foldhash" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d9c4f5dac5e15c24eb999c26181a6ca40b39fe946cbe4c263c7209467bc83af2" + +[[package]] +name = "form_urlencoded" +version = "1.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb4cb245038516f5f85277875cdaa4f7d2c9a0fa0468de06ed190163b1581fcf" +dependencies = [ + "percent-encoding", +] + +[[package]] +name = "futures-channel" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2dff15bf788c671c1934e366d07e30c1814a8ef514e1af724a602e8a2fbe1b10" +dependencies = [ + "futures-core", + "futures-sink", +] + +[[package]] +name = "futures-core" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05f29059c0c2090612e8d742178b0580d2dc940c837851ad723096f87af6663e" + +[[package]] +name = "futures-executor" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e28d1d997f585e54aebc3f97d39e72338912123a67330d723fdbb564d646c9f" +dependencies = [ + "futures-core", + "futures-task", + "futures-util", +] + +[[package]] +name = "futures-intrusive" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d930c203dd0b6ff06e0201a4a2fe9149b43c684fd4420555b26d21b1a02956f" +dependencies = [ + "futures-core", + "lock_api", + "parking_lot", +] + +[[package]] +name = "futures-io" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9e5c1b78ca4aae1ac06c48a526a655760685149f0d465d21f37abfe57ce075c6" + +[[package]] +name = "futures-sink" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e575fab7d1e0dcb8d0c7bcf9a63ee213816ab51902e6d244a95819acacf1d4f7" + +[[package]] +name = "futures-task" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f90f7dce0722e95104fcb095585910c0977252f286e354b5e3bd38902cd99988" + +[[package]] +name = "futures-util" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9fa08315bb612088cc391249efdc3bc77536f16c91f6cf495e6fbe85b20a4a81" +dependencies = [ + "futures-core", + "futures-io", + "futures-sink", + "futures-task", + "memchr", + "pin-project-lite", + "pin-utils", + "slab", +] + +[[package]] +name = "gdal" +version = "0.18.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e721cea67b420fd4b5cb15ba8145f2f1d3a6931a27fdbfadb46cff02015e1cde" +dependencies = [ + "bitflags", + "chrono", + "gdal-sys", + "geo-types", + "semver", + "thiserror 2.0.17", +] + +[[package]] +name = "gdal-sys" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "febef67dc08a956a9ecb04de2b40dbd15ad56be49421aad9ae0cdcbe9a24166c" +dependencies = [ + "bindgen", + "pkg-config", + "semver", +] + +[[package]] +name = "generic-array" +version = "0.14.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "85649ca51fd72272d7821adaf274ad91c288277713d9c18820d8499a7ff69e9a" +dependencies = [ + "typenum", + "version_check", +] + +[[package]] +name = "geo" +version = "0.30.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4416397671d8997e9a3e7ad99714f4f00a22e9eaa9b966a5985d2194fc9e02e1" +dependencies = [ + "float_next_after", + "geo-types", + "geographiclib-rs", + "i_overlay", + "log", + "num-traits", + "robust", + "rstar", +] + +[[package]] +name = "geo-traits" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b018fc19fa58202b03f1c809aebe654f7d70fd3887dace34c3d05c11aeb474b5" +dependencies = [ + "geo-types", +] + +[[package]] +name = "geo-types" +version = "0.7.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "75a4dcd69d35b2c87a7c83bce9af69fd65c9d68d3833a0ded568983928f3fc99" +dependencies = [ + "approx", + "num-traits", + "rstar", + "serde", +] + +[[package]] +name = "geographiclib-rs" +version = "0.2.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f611040a2bb37eaa29a78a128d1e92a378a03e0b6e66ae27398d42b1ba9a7841" +dependencies = [ + "libm", +] + +[[package]] +name = "geojson" +version = "0.24.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e26f3c45b36fccc9cf2805e61d4da6bc4bbd5a3a9589b01afa3a40eff703bd79" +dependencies = [ + "geo-types", + "log", + "serde", + "serde_json", + "thiserror 2.0.17", +] + +[[package]] +name = "getrandom" +version = "0.2.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "335ff9f135e4384c8150d6f27c6daed433577f86b4750418338c01a1a2528592" +dependencies = [ + "cfg-if", + "libc", + "wasi 0.11.1+wasi-snapshot-preview1", +] + +[[package]] +name = "getrandom" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "26145e563e54f2cadc477553f1ec5ee650b00862f0a58bcd12cbdc5f0ea2d2f4" +dependencies = [ + "cfg-if", + "libc", + "r-efi", + "wasi 0.14.7+wasi-0.2.4", +] + +[[package]] +name = "gimli" +version = "0.32.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e629b9b98ef3dd8afe6ca2bd0f89306cec16d43d907889945bc5d6687f2f13c7" + +[[package]] +name = "glob" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a8d1add55171497b4705a648c6b583acafb01d58050a51727785f0b2c8e0a2b2" + +[[package]] +name = "h2" +version = "0.4.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f3c0b69cfcb4e1b9f1bf2f53f95f766e4661169728ec61cd3fe5a0166f2d1386" +dependencies = [ + "atomic-waker", + "bytes", + "fnv", + "futures-core", + "futures-sink", + "http", + "indexmap 2.11.4", + "slab", + "tokio", + "tokio-util", + "tracing", +] + +[[package]] +name = "half" +version = "2.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "459196ed295495a68f7d7fe1d84f6c4b7ff0e21fe3017b2f283c6fac3ad803c9" +dependencies = [ + "cfg-if", + "crunchy", + "num-traits", +] + +[[package]] +name = "hash32" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "47d60b12902ba28e2730cd37e95b8c9223af2808df9e902d4df49588d1470606" +dependencies = [ + "byteorder", +] + +[[package]] +name = "hashbrown" +version = "0.12.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888" + +[[package]] +name = "hashbrown" +version = "0.14.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e5274423e17b7c9fc20b6e7e208532f9b19825d82dfd615708b70edd83df41f1" + +[[package]] +name = "hashbrown" +version = "0.15.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9229cfe53dfd69f0609a49f65461bd93001ea1ef889cd5529dd176593f5338a1" +dependencies = [ + "allocator-api2", + "equivalent", + "foldhash", +] + +[[package]] +name = "hashbrown" +version = "0.16.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5419bdc4f6a9207fbeba6d11b604d481addf78ecd10c11ad51e76c2f6482748d" + +[[package]] +name = "hashlink" +version = "0.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7382cf6263419f2d8df38c55d7da83da5c18aef87fc7a7fc1fb1e344edfe14c1" +dependencies = [ + "hashbrown 0.15.5", +] + +[[package]] +name = "heapless" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0bfb9eb618601c89945a70e254898da93b13be0388091d42117462b265bb3fad" +dependencies = [ + "hash32", + "stable_deref_trait", +] + +[[package]] +name = "heck" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2304e00983f87ffb38b55b444b5e3b60a884b5d30c0fca7d82fe33449bbe55ea" + +[[package]] +name = "hex" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f24254aa9a54b5c858eaee2f5bccdb46aaf0e486a595ed5fd8f86ba55232a70" + +[[package]] +name = "hkdf" +version = "0.12.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7b5f8eb2ad728638ea2c7d47a21db23b7b58a72ed6a38256b8a1849f15fbbdf7" +dependencies = [ + "hmac", +] + +[[package]] +name = "hmac" +version = "0.12.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6c49c37c09c17a53d937dfbb742eb3a961d65a994e6bcdcf37e7399d0cc8ab5e" +dependencies = [ + "digest", +] + +[[package]] +name = "home" +version = "0.5.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "589533453244b0995c858700322199b2becb13b627df2851f64a2775d024abcf" +dependencies = [ + "windows-sys 0.59.0", +] + +[[package]] +name = "http" +version = "1.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f4a85d31aea989eead29a3aaf9e1115a180df8282431156e533de47660892565" +dependencies = [ + "bytes", + "fnv", + "itoa", +] + +[[package]] +name = "http-body" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1efedce1fb8e6913f23e0c92de8e62cd5b772a67e7b3946df930a62566c93184" +dependencies = [ + "bytes", + "http", +] + +[[package]] +name = "http-body-util" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b021d93e26becf5dc7e1b75b1bed1fd93124b374ceb73f43d4d4eafec896a64a" +dependencies = [ + "bytes", + "futures-core", + "http", + "http-body", + "pin-project-lite", +] + +[[package]] +name = "httparse" +version = "1.10.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6dbf3de79e51f3d586ab4cb9d5c3e2c14aa28ed23d180cf89b4df0454a69cc87" + +[[package]] +name = "httpdate" +version = "1.0.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "df3b46402a9d5adb4c86a0cf463f42e19994e3ee891101b1841f30a545cb49a9" + +[[package]] +name = "hyper" +version = "1.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "eb3aa54a13a0dfe7fbe3a59e0c76093041720fdc77b110cc0fc260fafb4dc51e" +dependencies = [ + "atomic-waker", + "bytes", + "futures-channel", + "futures-core", + "h2", + "http", + "http-body", + "httparse", + "httpdate", + "itoa", + "pin-project-lite", + "pin-utils", + "smallvec", + "tokio", + "want", +] + +[[package]] +name = "hyper-util" +version = "0.1.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3c6995591a8f1380fcb4ba966a252a4b29188d51d2b89e3a252f5305be65aea8" +dependencies = [ + "bytes", + "futures-core", + "http", + "http-body", + "hyper", + "pin-project-lite", + "tokio", + "tower-service", +] + +[[package]] +name = "i_float" +version = "1.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "85df3a416829bb955fdc2416c7b73680c8dcea8d731f2c7aa23e1042fe1b8343" +dependencies = [ + "serde", +] + +[[package]] +name = "i_key_sort" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "347c253b4748a1a28baf94c9ce133b6b166f08573157e05afe718812bc599fcd" + +[[package]] +name = "i_overlay" +version = "2.0.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0542dfef184afdd42174a03dcc0625b6147fb73e1b974b1a08a2a42ac35cee49" +dependencies = [ + "i_float", + "i_key_sort", + "i_shape", + "i_tree", +] + +[[package]] +name = "i_shape" +version = "1.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0a38f5a42678726718ff924f6d4a0e79b129776aeed298f71de4ceedbd091bce" +dependencies = [ + "i_float", + "serde", +] + +[[package]] +name = "i_tree" +version = "0.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "155181bc97d770181cf9477da51218a19ee92a8e5be642e796661aee2b601139" + +[[package]] +name = "iana-time-zone" +version = "0.1.64" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "33e57f83510bb73707521ebaffa789ec8caf86f9657cad665b092b581d40e9fb" +dependencies = [ + "android_system_properties", + "core-foundation-sys", + "iana-time-zone-haiku", + "js-sys", + "log", + "wasm-bindgen", + "windows-core", +] + +[[package]] +name = "iana-time-zone-haiku" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f31827a206f56af32e590ba56d5d2d085f558508192593743f16b2306495269f" +dependencies = [ + "cc", +] + +[[package]] +name = "icu_collections" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "200072f5d0e3614556f94a9930d5dc3e0662a652823904c3a75dc3b0af7fee47" +dependencies = [ + "displaydoc", + "potential_utf", + "yoke", + "zerofrom", + "zerovec", +] + +[[package]] +name = "icu_locale_core" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0cde2700ccaed3872079a65fb1a78f6c0a36c91570f28755dda67bc8f7d9f00a" +dependencies = [ + "displaydoc", + "litemap", + "tinystr", + "writeable", + "zerovec", +] + +[[package]] +name = "icu_normalizer" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "436880e8e18df4d7bbc06d58432329d6458cc84531f7ac5f024e93deadb37979" +dependencies = [ + "displaydoc", + "icu_collections", + "icu_normalizer_data", + "icu_properties", + "icu_provider", + "smallvec", + "zerovec", +] + +[[package]] +name = "icu_normalizer_data" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "00210d6893afc98edb752b664b8890f0ef174c8adbb8d0be9710fa66fbbf72d3" + +[[package]] +name = "icu_properties" +version = "2.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "016c619c1eeb94efb86809b015c58f479963de65bdb6253345c1a1276f22e32b" +dependencies = [ + "displaydoc", + "icu_collections", + "icu_locale_core", + "icu_properties_data", + "icu_provider", + "potential_utf", + "zerotrie", + "zerovec", +] + +[[package]] +name = "icu_properties_data" +version = "2.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "298459143998310acd25ffe6810ed544932242d3f07083eee1084d83a71bd632" + +[[package]] +name = "icu_provider" +version = "2.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "03c80da27b5f4187909049ee2d72f276f0d9f99a42c306bd0131ecfe04d8e5af" +dependencies = [ + "displaydoc", + "icu_locale_core", + "stable_deref_trait", + "tinystr", + "writeable", + "yoke", + "zerofrom", + "zerotrie", + "zerovec", +] + +[[package]] +name = "ident_case" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39" + +[[package]] +name = "idna" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3b0875f23caa03898994f6ddc501886a45c7d3d62d04d2d90788d47be1b1e4de" +dependencies = [ + "idna_adapter", + "smallvec", + "utf8_iter", +] + +[[package]] +name = "idna_adapter" +version = "1.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3acae9609540aa318d1bc588455225fb2085b9ed0c4f6bd0d9d5bcd86f1a0344" +dependencies = [ + "icu_normalizer", + "icu_properties", +] + +[[package]] +name = "indexmap" +version = "1.9.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bd070e393353796e801d209ad339e89596eb4c8d430d18ede6a1cced8fafbd99" +dependencies = [ + "autocfg", + "hashbrown 0.12.3", + "serde", +] + +[[package]] +name = "indexmap" +version = "2.11.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4b0f83760fb341a774ed326568e19f5a863af4a952def8c39f9ab92fd95b88e5" +dependencies = [ + "equivalent", + "hashbrown 0.16.0", + "serde", + "serde_core", +] + +[[package]] +name = "io-uring" +version = "0.7.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "046fa2d4d00aea763528b4950358d0ead425372445dc8ff86312b3c69ff7727b" +dependencies = [ + "bitflags", + "cfg-if", + "libc", +] + +[[package]] +name = "is_terminal_polyfill" +version = "1.70.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7943c866cc5cd64cbc25b2e01621d07fa8eb2a1a23160ee81ce38704e97b8ecf" + +[[package]] +name = "itertools" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "413ee7dfc52ee1a4949ceeb7dbc8a33f2d6c088194d9f922fb8318faf1f01186" +dependencies = [ + "either", +] + +[[package]] +name = "itoa" +version = "1.0.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4a5f13b858c8d314ee3e8f639011f7ccefe71f97f96e50151fb991f267928e2c" + +[[package]] +name = "js-sys" +version = "0.3.81" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ec48937a97411dcb524a265206ccd4c90bb711fca92b2792c407f268825b9305" +dependencies = [ + "once_cell", + "wasm-bindgen", +] + +[[package]] +name = "json5" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "96b0db21af676c1ce64250b5f40f3ce2cf27e4e47cb91ed91eb6fe9350b430c1" +dependencies = [ + "pest", + "pest_derive", + "serde", +] + +[[package]] +name = "lazy_static" +version = "1.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbd2bcb4c963f2ddae06a2efc7e9f3591312473c50c6685e1f298068316e66fe" +dependencies = [ + "spin", +] + +[[package]] +name = "lexical-core" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7d8d125a277f807e55a77304455eb7b1cb52f2b18c143b60e766c120bd64a594" +dependencies = [ + "lexical-parse-float", + "lexical-parse-integer", + "lexical-util", + "lexical-write-float", + "lexical-write-integer", +] + +[[package]] +name = "lexical-parse-float" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "52a9f232fbd6f550bc0137dcb5f99ab674071ac2d690ac69704593cb4abbea56" +dependencies = [ + "lexical-parse-integer", + "lexical-util", +] + +[[package]] +name = "lexical-parse-integer" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9a7a039f8fb9c19c996cd7b2fcce303c1b2874fe1aca544edc85c4a5f8489b34" +dependencies = [ + "lexical-util", +] + +[[package]] +name = "lexical-util" +version = "1.0.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2604dd126bb14f13fb5d1bd6a66155079cb9fa655b37f875b3a742c705dbed17" + +[[package]] +name = "lexical-write-float" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50c438c87c013188d415fbabbb1dceb44249ab81664efbd31b14ae55dabb6361" +dependencies = [ + "lexical-util", + "lexical-write-integer", +] + +[[package]] +name = "lexical-write-integer" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "409851a618475d2d5796377cad353802345cba92c867d9fbcde9cf4eac4e14df" +dependencies = [ + "lexical-util", +] + +[[package]] +name = "libc" +version = "0.2.176" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "58f929b4d672ea937a23a1ab494143d968337a5f47e56d0815df1e0890ddf174" + +[[package]] +name = "libloading" +version = "0.8.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d7c4b02199fee7c5d21a5ae7d8cfa79a6ef5bb2fc834d6e9058e89c825efdc55" +dependencies = [ + "cfg-if", + "windows-link", +] + +[[package]] +name = "libm" +version = "0.2.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f9fbbcab51052fe104eb5e5d351cf728d30a5be1fe14d9be8a3b097481fb97de" + +[[package]] +name = "libredox" +version = "0.1.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "416f7e718bdb06000964960ffa43b4335ad4012ae8b99060261aa4a8088d5ccb" +dependencies = [ + "bitflags", + "libc", + "redox_syscall", +] + +[[package]] +name = "libsqlite3-sys" +version = "0.30.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2e99fb7a497b1e3339bc746195567ed8d3e24945ecd636e3619d20b9de9e9149" +dependencies = [ + "pkg-config", + "vcpkg", +] + +[[package]] +name = "litemap" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "241eaef5fd12c88705a01fc1066c48c4b36e0dd4377dcdc7ec3942cea7a69956" + +[[package]] +name = "lock_api" +version = "0.4.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "96936507f153605bddfcda068dd804796c84324ed2510809e5b2a624c81da765" +dependencies = [ + "autocfg", + "scopeguard", +] + +[[package]] +name = "log" +version = "0.4.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "34080505efa8e45a4b816c349525ebe327ceaa8559756f0356cba97ef3bf7432" + +[[package]] +name = "matchers" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d1525a2a28c7f4fa0fc98bb91ae755d1e2d1505079e05539e35bc876b5d65ae9" +dependencies = [ + "regex-automata", +] + +[[package]] +name = "matchit" +version = "0.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "47e1ffaa40ddd1f3ed91f717a33c8c0ee23fff369e3aa8772b9605cc1d22f4c3" + +[[package]] +name = "md-5" +version = "0.10.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d89e7ee0cfbedfc4da3340218492196241d89eefb6dab27de5df917a6d2e78cf" +dependencies = [ + "cfg-if", + "digest", +] + +[[package]] +name = "memchr" +version = "2.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f52b00d39961fc5b2736ea853c9cc86238e165017a493d1d5c8eac6bdc4cc273" + +[[package]] +name = "mime" +version = "0.3.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6877bb514081ee2a7ff5ef9de3281f14a4dd4bceac4c09388074a6b5df8a139a" + +[[package]] +name = "minimal-lexical" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "68354c5c6bd36d73ff3feceb05efa59b6acb7626617f4962be322a825e61f79a" + +[[package]] +name = "miniz_oxide" +version = "0.8.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1fa76a2c86f704bdb222d66965fb3d63269ce38518b83cb0575fca855ebb6316" +dependencies = [ + "adler2", +] + +[[package]] +name = "mio" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "78bed444cc8a2160f01cbcf811ef18cac863ad68ae8ca62092e8db51d51c761c" +dependencies = [ + "libc", + "wasi 0.11.1+wasi-snapshot-preview1", + "windows-sys 0.59.0", +] + +[[package]] +name = "multer" +version = "3.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "83e87776546dc87511aa5ee218730c92b666d7264ab6ed41f9d215af9cd5224b" +dependencies = [ + "bytes", + "encoding_rs", + "futures-util", + "http", + "httparse", + "memchr", + "mime", + "spin", + "version_check", +] + +[[package]] +name = "nom" +version = "7.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d273983c5a657a70a3e8f2a01329822f3b8c8172b73826411a55751e404a0a4a" +dependencies = [ + "memchr", + "minimal-lexical", +] + +[[package]] +name = "nu-ansi-term" +version = "0.50.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d4a28e057d01f97e61255210fcff094d74ed0466038633e95017f5beb68e4399" +dependencies = [ + "windows-sys 0.52.0", +] + +[[package]] +name = "num" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "35bd024e8b2ff75562e5f34e7f4905839deb4b22955ef5e73d2fea1b9813cb23" +dependencies = [ + "num-bigint", + "num-complex", + "num-integer", + "num-iter", + "num-rational", + "num-traits", +] + +[[package]] +name = "num-bigint" +version = "0.4.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a5e44f723f1133c9deac646763579fdb3ac745e418f2a7af9cd0c431da1f20b9" +dependencies = [ + "num-integer", + "num-traits", + "serde", +] + +[[package]] +name = "num-bigint-dig" +version = "0.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc84195820f291c7697304f3cbdadd1cb7199c0efc917ff5eafd71225c136151" +dependencies = [ + "byteorder", + "lazy_static", + "libm", + "num-integer", + "num-iter", + "num-traits", + "rand", + "smallvec", + "zeroize", +] + +[[package]] +name = "num-complex" +version = "0.4.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "73f88a1307638156682bada9d7604135552957b7818057dcef22705b4d509495" +dependencies = [ + "num-traits", +] + +[[package]] +name = "num-conv" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51d515d32fb182ee37cda2ccdcb92950d6a3c2893aa280e540671c2cd0f3b1d9" + +[[package]] +name = "num-integer" +version = "0.1.46" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7969661fd2958a5cb096e56c8e1ad0444ac2bbcd0061bd28660485a44879858f" +dependencies = [ + "num-traits", +] + +[[package]] +name = "num-iter" +version = "0.1.45" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1429034a0490724d0075ebb2bc9e875d6503c3cf69e235a8941aa757d83ef5bf" +dependencies = [ + "autocfg", + "num-integer", + "num-traits", +] + +[[package]] +name = "num-rational" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f83d14da390562dca69fc84082e73e548e1ad308d24accdedd2720017cb37824" +dependencies = [ + "num-bigint", + "num-integer", + "num-traits", + "serde", +] + +[[package]] +name = "num-traits" +version = "0.2.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "071dfc062690e90b734c0b2273ce72ad0ffa95f0c74596bc250dcfd960262841" +dependencies = [ + "autocfg", + "libm", +] + +[[package]] +name = "num_enum" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4e613fc340b2220f734a8595782c551f1250e969d87d3be1ae0579e8d4065179" +dependencies = [ + "num_enum_derive", +] + +[[package]] +name = "num_enum_derive" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "af1844ef2428cc3e1cb900be36181049ef3d3193c63e43026cfe202983b27a56" +dependencies = [ + "proc-macro-crate", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "object" +version = "0.37.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ff76201f031d8863c38aa7f905eca4f53abbfa15f609db4277d44cd8938f33fe" +dependencies = [ + "memchr", +] + +[[package]] +name = "ogcapi" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2222a7f7cd930536f54190272ee3d868b75d7c27ec2fabc342d0ed176b83681c" +dependencies = [ + "ogcapi-drivers", + "ogcapi-processes", + "ogcapi-services", + "ogcapi-types", +] + +[[package]] +name = "ogcapi-drivers" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "86e9f6d39df85ac17bb34accf6ad05ef07874489ed00e163416ee278db8aba10" +dependencies = [ + "anyhow", + "async-trait", + "http", + "ogcapi-types", + "rink-core", + "serde_json", + "sqlx", + "url", +] + +[[package]] +name = "ogcapi-processes" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fc8c4e5784d3ea50911dbae1755f24bbe42f33270e016833d58aa1198cf34589" +dependencies = [ + "anyhow", + "arrow", + "async-trait", + "dyn-clone", + "gdal", + "geo", + "geojson", + "http-body", + "ogcapi-drivers", + "ogcapi-types", + "schemars 0.8.22", + "serde", + "serde_json", + "sqlx", + "tokio", + "url", + "wkb", +] + +[[package]] +name = "ogcapi-services" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bff3a972b6fa71bfb06d8cd2ebcf5d706c79cb04076804d763b97b0702182535" +dependencies = [ + "anyhow", + "axum", + "axum-extra", + "clap", + "dotenvy", + "dyn-clone", + "hyper", + "ogcapi-drivers", + "ogcapi-processes", + "ogcapi-types", + "openapiv3", + "schemars 0.8.22", + "serde", + "serde_json", + "serde_qs", + "serde_yaml", + "thiserror 2.0.17", + "tokio", + "tower", + "tower-http", + "tracing", + "tracing-subscriber", + "url", +] + +[[package]] +name = "ogcapi-types" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e07c6bed7690347372eba07c3b864eb3f3408e08e63127b3a35df2827d4d29be" +dependencies = [ + "chrono", + "geojson", + "log", + "serde", + "serde_json", + "serde_repr", + "serde_with", + "url", +] + +[[package]] +name = "once_cell" +version = "1.21.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "42f5e15c9953c5e4ccceeb2e7382a716482c34515315f7b03532b8b4e8393d2d" + +[[package]] +name = "once_cell_polyfill" +version = "1.70.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a4895175b425cb1f87721b59f0f286c2092bd4af812243672510e1ac53e2e0ad" + +[[package]] +name = "openapiv3" +version = "2.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c8d427828b22ae1fff2833a03d8486c2c881367f1c336349f307f321e7f4d05" +dependencies = [ + "indexmap 2.11.4", + "serde", + "serde_json", +] + +[[package]] +name = "ordered-multimap" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "49203cdcae0030493bad186b28da2fa25645fa276a51b6fec8010d281e02ef79" +dependencies = [ + "dlv-list", + "hashbrown 0.14.5", +] + +[[package]] +name = "parking" +version = "2.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f38d5652c16fde515bb1ecef450ab0f6a219d619a7274976324d5e377f7dceba" + +[[package]] +name = "parking_lot" +version = "0.12.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "70d58bf43669b5795d1576d0641cfb6fbb2057bf629506267a92807158584a13" +dependencies = [ + "lock_api", + "parking_lot_core", +] + +[[package]] +name = "parking_lot_core" +version = "0.9.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc838d2a56b5b1a6c25f55575dfc605fabb63bb2365f6c2353ef9159aa69e4a5" +dependencies = [ + "cfg-if", + "libc", + "redox_syscall", + "smallvec", + "windows-targets 0.52.6", +] + +[[package]] +name = "parse-zoneinfo" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1f2a05b18d44e2957b88f96ba460715e295bc1d7510468a2f3d3b44535d26c24" +dependencies = [ + "regex", +] + +[[package]] +name = "paste" +version = "1.0.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "57c0d7b74b563b49d38dae00a0c37d4d6de9b432382b2892f0574ddcae73fd0a" + +[[package]] +name = "pathdiff" +version = "0.2.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "df94ce210e5bc13cb6651479fa48d14f601d9858cfe0467f43ae157023b938d3" + +[[package]] +name = "pem-rfc7468" +version = "0.7.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "88b39c9bfcfc231068454382784bb460aae594343fb030d46e9f50a645418412" +dependencies = [ + "base64ct", +] + +[[package]] +name = "percent-encoding" +version = "2.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9b4f627cb1b25917193a259e49bdad08f671f8d9708acfd5fe0a8c1455d87220" + +[[package]] +name = "pest" +version = "2.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "989e7521a040efde50c3ab6bbadafbe15ab6dc042686926be59ac35d74607df4" +dependencies = [ + "memchr", + "ucd-trie", +] + +[[package]] +name = "pest_derive" +version = "2.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "187da9a3030dbafabbbfb20cb323b976dc7b7ce91fcd84f2f74d6e31d378e2de" +dependencies = [ + "pest", + "pest_generator", +] + +[[package]] +name = "pest_generator" +version = "2.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "49b401d98f5757ebe97a26085998d6c0eecec4995cad6ab7fc30ffdf4b052843" +dependencies = [ + "pest", + "pest_meta", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "pest_meta" +version = "2.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "72f27a2cfee9f9039c4d86faa5af122a0ac3851441a34865b8a043b46be0065a" +dependencies = [ + "pest", + "sha2", +] + +[[package]] +name = "pin-project-lite" +version = "0.2.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3b3cff922bd51709b605d9ead9aa71031d81447142d828eb4a6eba76fe619f9b" + +[[package]] +name = "pin-utils" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" + +[[package]] +name = "pkcs1" +version = "0.7.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c8ffb9f10fa047879315e6625af03c164b16962a5368d724ed16323b68ace47f" +dependencies = [ + "der", + "pkcs8", + "spki", +] + +[[package]] +name = "pkcs8" +version = "0.10.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f950b2377845cebe5cf8b5165cb3cc1a5e0fa5cfa3e1f7f55707d8fd82e0a7b7" +dependencies = [ + "der", + "spki", +] + +[[package]] +name = "pkg-config" +version = "0.3.32" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7edddbd0b52d732b21ad9a5fab5c704c14cd949e5e9a1ec5929a24fded1b904c" + +[[package]] +name = "potential_utf" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "84df19adbe5b5a0782edcab45899906947ab039ccf4573713735ee7de1e6b08a" +dependencies = [ + "zerovec", +] + +[[package]] +name = "powerfmt" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "439ee305def115ba05938db6eb1644ff94165c5ab5e9420d1c1bcedbba909391" + +[[package]] +name = "ppv-lite86" +version = "0.2.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "85eae3c4ed2f50dcfe72643da4befc30deadb458a9b590d720cde2f2b1e97da9" +dependencies = [ + "zerocopy", +] + +[[package]] +name = "prettyplease" +version = "0.2.37" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "479ca8adacdd7ce8f1fb39ce9ecccbfe93a3f1344b3d0d97f20bc0196208f62b" +dependencies = [ + "proc-macro2", + "syn", +] + +[[package]] +name = "proc-macro-crate" +version = "3.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "edce586971a4dfaa28950c6f18ed55e0406c1ab88bbce2c6f6293a7aaba73d35" +dependencies = [ + "toml_edit", +] + +[[package]] +name = "proc-macro2" +version = "1.0.101" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "89ae43fd86e4158d6db51ad8e2b80f313af9cc74f5c0e03ccb87de09998732de" +dependencies = [ + "unicode-ident", +] + +[[package]] +name = "quote" +version = "1.0.41" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ce25767e7b499d1b604768e7cde645d14cc8584231ea6b295e9c9eb22c02e1d1" +dependencies = [ + "proc-macro2", +] + +[[package]] +name = "r-efi" +version = "5.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "69cdb34c158ceb288df11e18b4bd39de994f6657d83847bdffdbd7f346754b0f" + +[[package]] +name = "rand" +version = "0.8.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "34af8d1a0e25924bc5b7c43c079c942339d8f0a8b57c39049bef581b46327404" +dependencies = [ + "libc", + "rand_chacha", + "rand_core", +] + +[[package]] +name = "rand_chacha" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88" +dependencies = [ + "ppv-lite86", + "rand_core", +] + +[[package]] +name = "rand_core" +version = "0.6.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ec0be4795e2f6a28069bec0b5ff3e2ac9bafc99e6a9a7dc3547996c5c816922c" +dependencies = [ + "getrandom 0.2.16", +] + +[[package]] +name = "redox_syscall" +version = "0.5.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5407465600fb0548f1442edf71dd20683c6ed326200ace4b1ef0763521bb3b77" +dependencies = [ + "bitflags", +] + +[[package]] +name = "ref-cast" +version = "1.0.25" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f354300ae66f76f1c85c5f84693f0ce81d747e2c3f21a45fef496d89c960bf7d" +dependencies = [ + "ref-cast-impl", +] + +[[package]] +name = "ref-cast-impl" +version = "1.0.25" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b7186006dcb21920990093f30e3dea63b7d6e977bf1256be20c3563a5db070da" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "regex" +version = "1.11.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b5288124840bee7b386bc413c487869b360b2b4ec421ea56425128692f2a82c" +dependencies = [ + "aho-corasick", + "memchr", + "regex-automata", + "regex-syntax", +] + +[[package]] +name = "regex-automata" +version = "0.4.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "833eb9ce86d40ef33cb1306d8accf7bc8ec2bfea4355cbdebb3df68b40925cad" +dependencies = [ + "aho-corasick", + "memchr", + "regex-syntax", +] + +[[package]] +name = "regex-syntax" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "caf4aa5b0f434c91fe5c7f1ecb6a5ece2130b02ad2a590589dda5146df959001" + +[[package]] +name = "ring" +version = "0.17.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a4689e6c2294d81e88dc6261c768b63bc4fcdb852be6d1352498b114f61383b7" +dependencies = [ + "cc", + "cfg-if", + "getrandom 0.2.16", + "libc", + "untrusted", + "windows-sys 0.52.0", +] + +[[package]] +name = "rink-core" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d9e9fa5c0ca8683bca2f5d132f59cc2a121d38afe53c04789d821cc029d276c0" +dependencies = [ + "chrono", + "chrono-humanize", + "chrono-tz", + "indexmap 2.11.4", + "num-bigint", + "num-rational", + "num-traits", + "serde", + "serde_derive", + "strsim 0.10.0", +] + +[[package]] +name = "robust" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4e27ee8bb91ca0adcf0ecb116293afa12d393f9c2b9b9cd54d33e8078fe19839" + +[[package]] +name = "ron" +version = "0.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b91f7eff05f748767f183df4320a63d6936e9c6107d97c9e6bdd9784f4289c94" +dependencies = [ + "base64 0.21.7", + "bitflags", + "serde", + "serde_derive", +] + +[[package]] +name = "rsa" +version = "0.9.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "78928ac1ed176a5ca1d17e578a1825f3d81ca54cf41053a592584b020cfd691b" +dependencies = [ + "const-oid", + "digest", + "num-bigint-dig", + "num-integer", + "num-traits", + "pkcs1", + "pkcs8", + "rand_core", + "signature", + "spki", + "subtle", + "zeroize", +] + +[[package]] +name = "rstar" +version = "0.12.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "421400d13ccfd26dfa5858199c30a5d76f9c54e0dba7575273025b43c5175dbb" +dependencies = [ + "heapless", + "num-traits", + "smallvec", +] + +[[package]] +name = "rust-ini" +version = "0.21.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "796e8d2b6696392a43bea58116b667fb4c29727dc5abd27d6acf338bb4f688c7" +dependencies = [ + "cfg-if", + "ordered-multimap", +] + +[[package]] +name = "rustc-demangle" +version = "0.1.26" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56f7d92ca342cea22a06f2121d944b4fd82af56988c270852495420f961d4ace" + +[[package]] +name = "rustc-hash" +version = "2.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "357703d41365b4b27c590e3ed91eabb1b663f07c4c084095e60cbed4362dff0d" + +[[package]] +name = "rustls" +version = "0.23.32" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cd3c25631629d034ce7cd9940adc9d45762d46de2b0f57193c4443b92c6d4d40" +dependencies = [ + "once_cell", + "ring", + "rustls-pki-types", + "rustls-webpki", + "subtle", + "zeroize", +] + +[[package]] +name = "rustls-pki-types" +version = "1.12.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "229a4a4c221013e7e1f1a043678c5cc39fe5171437c88fb47151a21e6f5b5c79" +dependencies = [ + "zeroize", +] + +[[package]] +name = "rustls-webpki" +version = "0.103.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e10b3f4191e8a80e6b43eebabfac91e5dcecebb27a71f04e820c47ec41d314bf" +dependencies = [ + "ring", + "rustls-pki-types", + "untrusted", +] + +[[package]] +name = "rustversion" +version = "1.0.22" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b39cdef0fa800fc44525c84ccb54a029961a8215f9619753635a9c0d2538d46d" + +[[package]] +name = "ryu" +version = "1.0.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "28d3b2b1366ec20994f1fd18c3c594f05c5dd4bc44d8bb0c1c632c8d6829481f" + +[[package]] +name = "schemars" +version = "0.8.22" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3fbf2ae1b8bc8e02df939598064d22402220cd5bbcca1c76f7d6a310974d5615" +dependencies = [ + "dyn-clone", + "schemars_derive 0.8.22", + "serde", + "serde_json", +] + +[[package]] +name = "schemars" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4cd191f9397d57d581cddd31014772520aa448f65ef991055d7f61582c65165f" +dependencies = [ + "dyn-clone", + "ref-cast", + "serde", + "serde_json", +] + +[[package]] +name = "schemars" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "82d20c4491bc164fa2f6c5d44565947a52ad80b9505d8e36f8d54c27c739fcd0" +dependencies = [ + "dyn-clone", + "ref-cast", + "schemars_derive 1.0.4", + "serde", + "serde_json", +] + +[[package]] +name = "schemars_derive" +version = "0.8.22" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "32e265784ad618884abaea0600a9adf15393368d840e0222d101a072f3f7534d" +dependencies = [ + "proc-macro2", + "quote", + "serde_derive_internals", + "syn", +] + +[[package]] +name = "schemars_derive" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "33d020396d1d138dc19f1165df7545479dcd58d93810dc5d646a16e55abefa80" +dependencies = [ + "proc-macro2", + "quote", + "serde_derive_internals", + "syn", +] + +[[package]] +name = "scopeguard" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "94143f37725109f92c262ed2cf5e59bce7498c01bcc1502d7b9afe439a4e9f49" + +[[package]] +name = "semver" +version = "1.0.27" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d767eb0aabc880b29956c35734170f26ed551a859dbd361d140cdbeca61ab1e2" + +[[package]] +name = "serde" +version = "1.0.228" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9a8e94ea7f378bd32cbbd37198a4a91436180c5bb472411e48b5ec2e2124ae9e" +dependencies = [ + "serde_core", + "serde_derive", +] + +[[package]] +name = "serde-untagged" +version = "0.1.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f9faf48a4a2d2693be24c6289dbe26552776eb7737074e6722891fadbe6c5058" +dependencies = [ + "erased-serde", + "serde", + "serde_core", + "typeid", +] + +[[package]] +name = "serde_core" +version = "1.0.228" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "41d385c7d4ca58e59fc732af25c3983b67ac852c1a25000afe1175de458b67ad" +dependencies = [ + "serde_derive", +] + +[[package]] +name = "serde_derive" +version = "1.0.228" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d540f220d3187173da220f885ab66608367b6574e925011a9353e4badda91d79" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "serde_derive_internals" +version = "0.29.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "18d26a20a969b9e3fdf2fc2d9f21eda6c40e2de84c9408bb5d3b05d499aae711" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "serde_json" +version = "1.0.145" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "402a6f66d8c709116cf22f558eab210f5a50187f702eb4d7e5ef38d9a7f1c79c" +dependencies = [ + "itoa", + "memchr", + "ryu", + "serde", + "serde_core", +] + +[[package]] +name = "serde_path_to_error" +version = "0.1.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "10a9ff822e371bb5403e391ecd83e182e0e77ba7f6fe0160b795797109d1b457" +dependencies = [ + "itoa", + "serde", + "serde_core", +] + +[[package]] +name = "serde_qs" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b417bedc008acbdf6d6b4bc482d29859924114bbe2650b7921fb68a261d0aa6" +dependencies = [ + "percent-encoding", + "serde", + "thiserror 2.0.17", +] + +[[package]] +name = "serde_repr" +version = "0.1.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "175ee3e80ae9982737ca543e96133087cbd9a485eecc3bc4de9c1a37b47ea59c" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "serde_spanned" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5417783452c2be558477e104686f7de5dae53dba813c28435e0e70f82d9b04ee" +dependencies = [ + "serde_core", +] + +[[package]] +name = "serde_urlencoded" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d3491c14715ca2294c4d6a88f15e84739788c1d030eed8c110436aafdaa2f3fd" +dependencies = [ + "form_urlencoded", + "itoa", + "ryu", + "serde", +] + +[[package]] +name = "serde_with" +version = "3.14.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c522100790450cf78eeac1507263d0a350d4d5b30df0c8e1fe051a10c22b376e" +dependencies = [ + "base64 0.22.1", + "chrono", + "hex", + "indexmap 1.9.3", + "indexmap 2.11.4", + "schemars 0.9.0", + "schemars 1.0.4", + "serde", + "serde_derive", + "serde_json", + "serde_with_macros", + "time", +] + +[[package]] +name = "serde_with_macros" +version = "3.14.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "327ada00f7d64abaac1e55a6911e90cf665aa051b9a561c7006c157f4633135e" +dependencies = [ + "darling", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "serde_yaml" +version = "0.9.34+deprecated" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6a8b1a1a2ebf674015cc02edccce75287f1a0130d394307b36743c2f5d504b47" +dependencies = [ + "indexmap 2.11.4", + "itoa", + "ryu", + "serde", + "unsafe-libyaml", +] + +[[package]] +name = "sha1" +version = "0.10.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e3bf829a2d51ab4a5ddf1352d8470c140cadc8301b2ae1789db023f01cedd6ba" +dependencies = [ + "cfg-if", + "cpufeatures", + "digest", +] + +[[package]] +name = "sha2" +version = "0.10.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a7507d819769d01a365ab707794a4084392c824f54a7a6a7862f8c3d0892b283" +dependencies = [ + "cfg-if", + "cpufeatures", + "digest", +] + +[[package]] +name = "sharded-slab" +version = "0.1.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f40ca3c46823713e0d4209592e8d6e826aa57e928f09752619fc696c499637f6" +dependencies = [ + "lazy_static", +] + +[[package]] +name = "shlex" +version = "1.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0fda2ff0d084019ba4d7c6f371c95d8fd75ce3524c3cb8fb653a3023f6323e64" + +[[package]] +name = "signal-hook-registry" +version = "1.4.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2a4719bff48cee6b39d12c020eeb490953ad2443b7055bd0b21fca26bd8c28b" +dependencies = [ + "libc", +] + +[[package]] +name = "signature" +version = "2.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "77549399552de45a898a580c1b41d445bf730df867cc44e6c0233bbc4b8329de" +dependencies = [ + "digest", + "rand_core", +] + +[[package]] +name = "simdutf8" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e3a9fe34e3e7a50316060351f37187a3f546bce95496156754b601a5fa71b76e" + +[[package]] +name = "slab" +version = "0.4.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a2ae44ef20feb57a68b23d846850f861394c2e02dc425a50098ae8c90267589" + +[[package]] +name = "smallvec" +version = "1.15.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "67b1b7a3b5fe4f1376887184045fcf45c69e92af734b7aaddc05fb777b6fbd03" +dependencies = [ + "serde", +] + +[[package]] +name = "socket2" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "233504af464074f9d066d7b5416c5f9b894a5862a6506e306f7b816cdd6f1807" +dependencies = [ + "libc", + "windows-sys 0.59.0", +] + +[[package]] +name = "spin" +version = "0.9.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6980e8d7511241f8acf4aebddbb1ff938df5eebe98691418c4468d0b72a96a67" +dependencies = [ + "lock_api", +] + +[[package]] +name = "spki" +version = "0.7.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d91ed6c858b01f942cd56b37a94b3e0a1798290327d1236e4d9cf4eaca44d29d" +dependencies = [ + "base64ct", + "der", +] + +[[package]] +name = "sqlx" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1fefb893899429669dcdd979aff487bd78f4064e5e7907e4269081e0ef7d97dc" +dependencies = [ + "sqlx-core", + "sqlx-macros", + "sqlx-mysql", + "sqlx-postgres", + "sqlx-sqlite", +] + +[[package]] +name = "sqlx-core" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ee6798b1838b6a0f69c007c133b8df5866302197e404e8b6ee8ed3e3a5e68dc6" +dependencies = [ + "base64 0.22.1", + "bytes", + "crc", + "crossbeam-queue", + "either", + "event-listener", + "futures-core", + "futures-intrusive", + "futures-io", + "futures-util", + "hashbrown 0.15.5", + "hashlink", + "indexmap 2.11.4", + "log", + "memchr", + "once_cell", + "percent-encoding", + "rustls", + "serde", + "serde_json", + "sha2", + "smallvec", + "thiserror 2.0.17", + "tokio", + "tokio-stream", + "tracing", + "url", + "webpki-roots 0.26.11", +] + +[[package]] +name = "sqlx-macros" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2d452988ccaacfbf5e0bdbc348fb91d7c8af5bee192173ac3636b5fb6e6715d" +dependencies = [ + "proc-macro2", + "quote", + "sqlx-core", + "sqlx-macros-core", + "syn", +] + +[[package]] +name = "sqlx-macros-core" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "19a9c1841124ac5a61741f96e1d9e2ec77424bf323962dd894bdb93f37d5219b" +dependencies = [ + "dotenvy", + "either", + "heck", + "hex", + "once_cell", + "proc-macro2", + "quote", + "serde", + "serde_json", + "sha2", + "sqlx-core", + "sqlx-mysql", + "sqlx-postgres", + "sqlx-sqlite", + "syn", + "tokio", + "url", +] + +[[package]] +name = "sqlx-mysql" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aa003f0038df784eb8fecbbac13affe3da23b45194bd57dba231c8f48199c526" +dependencies = [ + "atoi", + "base64 0.22.1", + "bitflags", + "byteorder", + "bytes", + "crc", + "digest", + "dotenvy", + "either", + "futures-channel", + "futures-core", + "futures-io", + "futures-util", + "generic-array", + "hex", + "hkdf", + "hmac", + "itoa", + "log", + "md-5", + "memchr", + "once_cell", + "percent-encoding", + "rand", + "rsa", + "serde", + "sha1", + "sha2", + "smallvec", + "sqlx-core", + "stringprep", + "thiserror 2.0.17", + "tracing", + "whoami", +] + +[[package]] +name = "sqlx-postgres" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "db58fcd5a53cf07c184b154801ff91347e4c30d17a3562a635ff028ad5deda46" +dependencies = [ + "atoi", + "base64 0.22.1", + "bitflags", + "byteorder", + "crc", + "dotenvy", + "etcetera", + "futures-channel", + "futures-core", + "futures-util", + "hex", + "hkdf", + "hmac", + "home", + "itoa", + "log", + "md-5", + "memchr", + "once_cell", + "rand", + "serde", + "serde_json", + "sha2", + "smallvec", + "sqlx-core", + "stringprep", + "thiserror 2.0.17", + "tracing", + "whoami", +] + +[[package]] +name = "sqlx-sqlite" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c2d12fe70b2c1b4401038055f90f151b78208de1f9f89a7dbfd41587a10c3eea" +dependencies = [ + "atoi", + "flume", + "futures-channel", + "futures-core", + "futures-executor", + "futures-intrusive", + "futures-util", + "libsqlite3-sys", + "log", + "percent-encoding", + "serde", + "serde_urlencoded", + "sqlx-core", + "thiserror 2.0.17", + "tracing", + "url", +] + +[[package]] +name = "stable_deref_trait" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a8f112729512f8e442d81f95a8a7ddf2b7c6b8a1a6f509a95864142b30cab2d3" + +[[package]] +name = "stringprep" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7b4df3d392d81bd458a8a621b8bffbd2302a12ffe288a9d931670948749463b1" +dependencies = [ + "unicode-bidi", + "unicode-normalization", + "unicode-properties", +] + +[[package]] +name = "strsim" +version = "0.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "73473c0e59e6d5812c5dfe2a064a6444949f089e20eec9a2e5506596494e4623" + +[[package]] +name = "strsim" +version = "0.11.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7da8b5736845d9f2fcb837ea5d9e2628564b3b043a70948a3f0b778838c5fb4f" + +[[package]] +name = "subtle" +version = "2.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "13c2bddecc57b384dee18652358fb23172facb8a2c51ccc10d74c157bdea3292" + +[[package]] +name = "syn" +version = "2.0.106" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ede7c438028d4436d71104916910f5bb611972c5cfd7f89b8300a8186e6fada6" +dependencies = [ + "proc-macro2", + "quote", + "unicode-ident", +] + +[[package]] +name = "sync_wrapper" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0bf256ce5efdfa370213c1dabab5935a12e49f2c58d15e9eac2870d3b4f27263" + +[[package]] +name = "synstructure" +version = "0.13.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "728a70f3dbaf5bab7f0c4b1ac8d7ae5ea60a4b5549c8a5914361c99147a709d2" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "thiserror" +version = "1.0.69" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b6aaf5339b578ea85b50e080feb250a3e8ae8cfcdff9a461c9ec2904bc923f52" +dependencies = [ + "thiserror-impl 1.0.69", +] + +[[package]] +name = "thiserror" +version = "2.0.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f63587ca0f12b72a0600bcba1d40081f830876000bb46dd2337a3051618f4fc8" +dependencies = [ + "thiserror-impl 2.0.17", +] + +[[package]] +name = "thiserror-impl" +version = "1.0.69" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4fee6c4efc90059e10f81e6d42c60a18f76588c3d74cb83a0b242a2b6c7504c1" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "thiserror-impl" +version = "2.0.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3ff15c8ecd7de3849db632e14d18d2571fa09dfc5ed93479bc4485c7a517c913" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "thread_local" +version = "1.1.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f60246a4944f24f6e018aa17cdeffb7818b76356965d03b07d6a9886e8962185" +dependencies = [ + "cfg-if", +] + +[[package]] +name = "time" +version = "0.3.44" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "91e7d9e3bb61134e77bde20dd4825b97c010155709965fedf0f49bb138e52a9d" +dependencies = [ + "deranged", + "itoa", + "num-conv", + "powerfmt", + "serde", + "time-core", + "time-macros", +] + +[[package]] +name = "time-core" +version = "0.1.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "40868e7c1d2f0b8d73e4a8c7f0ff63af4f6d19be117e90bd73eb1d62cf831c6b" + +[[package]] +name = "time-macros" +version = "0.2.24" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "30cfb0125f12d9c277f35663a0a33f8c30190f4e4574868a330595412d34ebf3" +dependencies = [ + "num-conv", + "time-core", +] + +[[package]] +name = "tiny-keccak" +version = "2.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2c9d3793400a45f954c52e73d068316d76b6f4e36977e3fcebb13a2721e80237" +dependencies = [ + "crunchy", +] + +[[package]] +name = "tinystr" +version = "0.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5d4f6d1145dcb577acf783d4e601bc1d76a13337bb54e6233add580b07344c8b" +dependencies = [ + "displaydoc", + "zerovec", +] + +[[package]] +name = "tinyvec" +version = "1.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bfa5fdc3bce6191a1dbc8c02d5c8bffcf557bafa17c124c5264a458f1b0613fa" +dependencies = [ + "tinyvec_macros", +] + +[[package]] +name = "tinyvec_macros" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20" + +[[package]] +name = "tokio" +version = "1.47.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "89e49afdadebb872d3145a5638b59eb0691ea23e46ca484037cfab3b76b95038" +dependencies = [ + "backtrace", + "bytes", + "io-uring", + "libc", + "mio", + "parking_lot", + "pin-project-lite", + "signal-hook-registry", + "slab", + "socket2", + "tokio-macros", + "windows-sys 0.59.0", +] + +[[package]] +name = "tokio-macros" +version = "2.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e06d43f1345a3bcd39f6a56dbb7dcab2ba47e68e8ac134855e7e2bdbaf8cab8" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "tokio-stream" +version = "0.1.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "eca58d7bba4a75707817a2c44174253f9236b2d5fbd055602e9d5c07c139a047" +dependencies = [ + "futures-core", + "pin-project-lite", + "tokio", +] + +[[package]] +name = "tokio-util" +version = "0.7.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "14307c986784f72ef81c89db7d9e28d6ac26d16213b109ea501696195e6e3ce5" +dependencies = [ + "bytes", + "futures-core", + "futures-sink", + "pin-project-lite", + "tokio", +] + +[[package]] +name = "toml" +version = "0.9.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "00e5e5d9bf2475ac9d4f0d9edab68cc573dc2fd644b0dba36b0c30a92dd9eaa0" +dependencies = [ + "serde_core", + "serde_spanned", + "toml_datetime 0.7.2", + "toml_parser", + "winnow", +] + +[[package]] +name = "toml_datetime" +version = "0.6.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "22cddaf88f4fbc13c51aebbf5f8eceb5c7c5a9da2ac40a13519eb5b0a0e8f11c" + +[[package]] +name = "toml_datetime" +version = "0.7.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "32f1085dec27c2b6632b04c80b3bb1b4300d6495d1e129693bdda7d91e72eec1" +dependencies = [ + "serde_core", +] + +[[package]] +name = "toml_edit" +version = "0.22.27" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "41fe8c660ae4257887cf66394862d21dbca4a6ddd26f04a3560410406a2f819a" +dependencies = [ + "indexmap 2.11.4", + "toml_datetime 0.6.11", + "winnow", +] + +[[package]] +name = "toml_parser" +version = "1.0.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4cf893c33be71572e0e9aa6dd15e6677937abd686b066eac3f8cd3531688a627" +dependencies = [ + "winnow", +] + +[[package]] +name = "tower" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d039ad9159c98b70ecfd540b2573b97f7f52c3e8d9f8ad57a24b916a536975f9" +dependencies = [ + "futures-core", + "futures-util", + "pin-project-lite", + "sync_wrapper", + "tokio", + "tower-layer", + "tower-service", + "tracing", +] + +[[package]] +name = "tower-http" +version = "0.6.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "adc82fd73de2a9722ac5da747f12383d2bfdb93591ee6c58486e0097890f05f2" +dependencies = [ + "async-compression", + "bitflags", + "bytes", + "futures-core", + "futures-util", + "http", + "http-body", + "http-body-util", + "pin-project-lite", + "tokio", + "tokio-util", + "tower", + "tower-layer", + "tower-service", + "tracing", + "uuid", +] + +[[package]] +name = "tower-layer" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "121c2a6cda46980bb0fcd1647ffaf6cd3fc79a013de288782836f6df9c48780e" + +[[package]] +name = "tower-service" +version = "0.3.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8df9b6e13f2d32c91b9bd719c00d1958837bc7dec474d94952798cc8e69eeec3" + +[[package]] +name = "tracing" +version = "0.1.41" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "784e0ac535deb450455cbfa28a6f0df145ea1bb7ae51b821cf5e7927fdcfbdd0" +dependencies = [ + "log", + "pin-project-lite", + "tracing-attributes", + "tracing-core", +] + +[[package]] +name = "tracing-attributes" +version = "0.1.30" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "81383ab64e72a7a8b8e13130c49e3dab29def6d0c7d76a03087b3cf71c5c6903" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "tracing-core" +version = "0.1.34" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b9d12581f227e93f094d3af2ae690a574abb8a2b9b7a96e7cfe9647b2b617678" +dependencies = [ + "once_cell", + "valuable", +] + +[[package]] +name = "tracing-log" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ee855f1f400bd0e5c02d150ae5de3840039a3f54b025156404e34c23c03f47c3" +dependencies = [ + "log", + "once_cell", + "tracing-core", +] + +[[package]] +name = "tracing-subscriber" +version = "0.3.20" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2054a14f5307d601f88daf0553e1cbf472acc4f2c51afab632431cdcd72124d5" +dependencies = [ + "matchers", + "nu-ansi-term", + "once_cell", + "regex-automata", + "sharded-slab", + "smallvec", + "thread_local", + "tracing", + "tracing-core", + "tracing-log", +] + +[[package]] +name = "try-lock" +version = "0.2.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e421abadd41a4225275504ea4d6566923418b7f05506fbc9c0fe86ba7396114b" + +[[package]] +name = "typeid" +version = "1.0.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc7d623258602320d5c55d1bc22793b57daff0ec7efc270ea7d55ce1d5f5471c" + +[[package]] +name = "typenum" +version = "1.19.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "562d481066bde0658276a35467c4af00bdc6ee726305698a55b86e61d7ad82bb" + +[[package]] +name = "ucd-trie" +version = "0.1.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2896d95c02a80c6d6a5d6e953d479f5ddf2dfdb6a244441010e373ac0fb88971" + +[[package]] +name = "unicode-bidi" +version = "0.3.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c1cb5db39152898a79168971543b1cb5020dff7fe43c8dc468b0885f5e29df5" + +[[package]] +name = "unicode-ident" +version = "1.0.19" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f63a545481291138910575129486daeaf8ac54aee4387fe7906919f7830c7d9d" + +[[package]] +name = "unicode-normalization" +version = "0.1.24" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5033c97c4262335cded6d6fc3e5c18ab755e1a3dc96376350f3d8e9f009ad956" +dependencies = [ + "tinyvec", +] + +[[package]] +name = "unicode-properties" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e70f2a8b45122e719eb623c01822704c4e0907e7e426a05927e1a1cfff5b75d0" + +[[package]] +name = "unicode-segmentation" +version = "1.12.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f6ccf251212114b54433ec949fd6a7841275f9ada20dddd2f29e9ceea4501493" + +[[package]] +name = "unsafe-libyaml" +version = "0.2.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "673aac59facbab8a9007c7f6108d11f63b603f7cabff99fabf650fea5c32b861" + +[[package]] +name = "untrusted" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ecb6da28b8a351d773b68d5825ac39017e680750f980f3a1a85cd8dd28a47c1" + +[[package]] +name = "url" +version = "2.5.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "08bc136a29a3d1758e07a9cca267be308aeebf5cfd5a10f3f67ab2097683ef5b" +dependencies = [ + "form_urlencoded", + "idna", + "percent-encoding", + "serde", +] + +[[package]] +name = "utf8_iter" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b6c140620e7ffbb22c2dee59cafe6084a59b5ffc27a8859a5f0d494b5d52b6be" + +[[package]] +name = "utf8parse" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "06abde3611657adf66d383f00b093d7faecc7fa57071cce2578660c9f1010821" + +[[package]] +name = "utoipa" +version = "5.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2fcc29c80c21c31608227e0912b2d7fddba57ad76b606890627ba8ee7964e993" +dependencies = [ + "indexmap 2.11.4", + "serde", + "serde_json", + "utoipa-gen", +] + +[[package]] +name = "utoipa-axum" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7c25bae5bccc842449ec0c5ddc5cbb6a3a1eaeac4503895dc105a1138f8234a0" +dependencies = [ + "axum", + "paste", + "tower-layer", + "tower-service", + "utoipa", +] + +[[package]] +name = "utoipa-gen" +version = "5.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6d79d08d92ab8af4c5e8a6da20c47ae3f61a0f1dabc1997cdf2d082b757ca08b" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "uuid" +version = "1.18.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2f87b8aa10b915a06587d0dec516c282ff295b475d94abf425d62b57710070a2" +dependencies = [ + "getrandom 0.3.3", + "js-sys", + "wasm-bindgen", +] + +[[package]] +name = "valuable" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ba73ea9cf16a25df0c8caa16c51acb937d5712a8429db78a3ee29d5dcacd3a65" + +[[package]] +name = "vcpkg" +version = "0.2.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "accd4ea62f7bb7a82fe23066fb0957d48ef677f6eeb8215f372f52e48bb32426" + +[[package]] +name = "version_check" +version = "0.9.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b928f33d975fc6ad9f86c8f283853ad26bdd5b10b7f1542aa2fa15e2289105a" + +[[package]] +name = "want" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bfa7760aed19e106de2c7c0b581b509f2f25d3dacaf737cb82ac61bc6d760b0e" +dependencies = [ + "try-lock", +] + +[[package]] +name = "wasi" +version = "0.11.1+wasi-snapshot-preview1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ccf3ec651a847eb01de73ccad15eb7d99f80485de043efb2f370cd654f4ea44b" + +[[package]] +name = "wasi" +version = "0.14.7+wasi-0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "883478de20367e224c0090af9cf5f9fa85bed63a95c1abf3afc5c083ebc06e8c" +dependencies = [ + "wasip2", +] + +[[package]] +name = "wasip2" +version = "1.0.1+wasi-0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0562428422c63773dad2c345a1882263bbf4d65cf3f42e90921f787ef5ad58e7" +dependencies = [ + "wit-bindgen", +] + +[[package]] +name = "wasite" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b8dad83b4f25e74f184f64c43b150b91efe7647395b42289f38e50566d82855b" + +[[package]] +name = "wasm-bindgen" +version = "0.2.104" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c1da10c01ae9f1ae40cbfac0bac3b1e724b320abfcf52229f80b547c0d250e2d" +dependencies = [ + "cfg-if", + "once_cell", + "rustversion", + "wasm-bindgen-macro", + "wasm-bindgen-shared", +] + +[[package]] +name = "wasm-bindgen-backend" +version = "0.2.104" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "671c9a5a66f49d8a47345ab942e2cb93c7d1d0339065d4f8139c486121b43b19" +dependencies = [ + "bumpalo", + "log", + "proc-macro2", + "quote", + "syn", + "wasm-bindgen-shared", +] + +[[package]] +name = "wasm-bindgen-macro" +version = "0.2.104" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7ca60477e4c59f5f2986c50191cd972e3a50d8a95603bc9434501cf156a9a119" +dependencies = [ + "quote", + "wasm-bindgen-macro-support", +] + +[[package]] +name = "wasm-bindgen-macro-support" +version = "0.2.104" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9f07d2f20d4da7b26400c9f4a0511e6e0345b040694e8a75bd41d578fa4421d7" +dependencies = [ + "proc-macro2", + "quote", + "syn", + "wasm-bindgen-backend", + "wasm-bindgen-shared", +] + +[[package]] +name = "wasm-bindgen-shared" +version = "0.2.104" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bad67dc8b2a1a6e5448428adec4c3e84c43e561d8c9ee8a9e5aabeb193ec41d1" +dependencies = [ + "unicode-ident", +] + +[[package]] +name = "webpki-roots" +version = "0.26.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "521bc38abb08001b01866da9f51eb7c5d647a19260e00054a8c7fd5f9e57f7a9" +dependencies = [ + "webpki-roots 1.0.2", +] + +[[package]] +name = "webpki-roots" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7e8983c3ab33d6fb807cfcdad2491c4ea8cbc8ed839181c7dfd9c67c83e261b2" +dependencies = [ + "rustls-pki-types", +] + +[[package]] +name = "whoami" +version = "1.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5d4a4db5077702ca3015d3d02d74974948aba2ad9e12ab7df718ee64ccd7e97d" +dependencies = [ + "libredox", + "wasite", +] + +[[package]] +name = "windows-core" +version = "0.62.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6844ee5416b285084d3d3fffd743b925a6c9385455f64f6d4fa3031c4c2749a9" +dependencies = [ + "windows-implement", + "windows-interface", + "windows-link", + "windows-result", + "windows-strings", +] + +[[package]] +name = "windows-implement" +version = "0.60.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "edb307e42a74fb6de9bf3a02d9712678b22399c87e6fa869d6dfcd8c1b7754e0" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "windows-interface" +version = "0.59.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c0abd1ddbc6964ac14db11c7213d6532ef34bd9aa042c2e5935f59d7908b46a5" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "windows-link" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "45e46c0661abb7180e7b9c281db115305d49ca1709ab8242adf09666d2173c65" + +[[package]] +name = "windows-result" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7084dcc306f89883455a206237404d3eaf961e5bd7e0f312f7c91f57eb44167f" +dependencies = [ + "windows-link", +] + +[[package]] +name = "windows-strings" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7218c655a553b0bed4426cf54b20d7ba363ef543b52d515b3e48d7fd55318dda" +dependencies = [ + "windows-link", +] + +[[package]] +name = "windows-sys" +version = "0.48.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "677d2418bec65e3338edb076e806bc1ec15693c5d0104683f2efe857f61056a9" +dependencies = [ + "windows-targets 0.48.5", +] + +[[package]] +name = "windows-sys" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "282be5f36a8ce781fad8c8ae18fa3f9beff57ec1b52cb3de0789201425d9a33d" +dependencies = [ + "windows-targets 0.52.6", +] + +[[package]] +name = "windows-sys" +version = "0.59.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e38bc4d79ed67fd075bcc251a1c39b32a1776bbe92e5bef1f0bf1f8c531853b" +dependencies = [ + "windows-targets 0.52.6", +] + +[[package]] +name = "windows-sys" +version = "0.60.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f2f500e4d28234f72040990ec9d39e3a6b950f9f22d3dba18416c35882612bcb" +dependencies = [ + "windows-targets 0.53.4", +] + +[[package]] +name = "windows-targets" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9a2fa6e2155d7247be68c096456083145c183cbbbc2764150dda45a87197940c" +dependencies = [ + "windows_aarch64_gnullvm 0.48.5", + "windows_aarch64_msvc 0.48.5", + "windows_i686_gnu 0.48.5", + "windows_i686_msvc 0.48.5", + "windows_x86_64_gnu 0.48.5", + "windows_x86_64_gnullvm 0.48.5", + "windows_x86_64_msvc 0.48.5", +] + +[[package]] +name = "windows-targets" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9b724f72796e036ab90c1021d4780d4d3d648aca59e491e6b98e725b84e99973" +dependencies = [ + "windows_aarch64_gnullvm 0.52.6", + "windows_aarch64_msvc 0.52.6", + "windows_i686_gnu 0.52.6", + "windows_i686_gnullvm 0.52.6", + "windows_i686_msvc 0.52.6", + "windows_x86_64_gnu 0.52.6", + "windows_x86_64_gnullvm 0.52.6", + "windows_x86_64_msvc 0.52.6", +] + +[[package]] +name = "windows-targets" +version = "0.53.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2d42b7b7f66d2a06854650af09cfdf8713e427a439c97ad65a6375318033ac4b" +dependencies = [ + "windows-link", + "windows_aarch64_gnullvm 0.53.0", + "windows_aarch64_msvc 0.53.0", + "windows_i686_gnu 0.53.0", + "windows_i686_gnullvm 0.53.0", + "windows_i686_msvc 0.53.0", + "windows_x86_64_gnu 0.53.0", + "windows_x86_64_gnullvm 0.53.0", + "windows_x86_64_msvc 0.53.0", +] + +[[package]] +name = "windows_aarch64_gnullvm" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2b38e32f0abccf9987a4e3079dfb67dcd799fb61361e53e2882c3cbaf0d905d8" + +[[package]] +name = "windows_aarch64_gnullvm" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "32a4622180e7a0ec044bb555404c800bc9fd9ec262ec147edd5989ccd0c02cd3" + +[[package]] +name = "windows_aarch64_gnullvm" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "86b8d5f90ddd19cb4a147a5fa63ca848db3df085e25fee3cc10b39b6eebae764" + +[[package]] +name = "windows_aarch64_msvc" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc35310971f3b2dbbf3f0690a219f40e2d9afcf64f9ab7cc1be722937c26b4bc" + +[[package]] +name = "windows_aarch64_msvc" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09ec2a7bb152e2252b53fa7803150007879548bc709c039df7627cabbd05d469" + +[[package]] +name = "windows_aarch64_msvc" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c7651a1f62a11b8cbd5e0d42526e55f2c99886c77e007179efff86c2b137e66c" + +[[package]] +name = "windows_i686_gnu" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a75915e7def60c94dcef72200b9a8e58e5091744960da64ec734a6c6e9b3743e" + +[[package]] +name = "windows_i686_gnu" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8e9b5ad5ab802e97eb8e295ac6720e509ee4c243f69d781394014ebfe8bbfa0b" + +[[package]] +name = "windows_i686_gnu" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c1dc67659d35f387f5f6c479dc4e28f1d4bb90ddd1a5d3da2e5d97b42d6272c3" + +[[package]] +name = "windows_i686_gnullvm" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0eee52d38c090b3caa76c563b86c3a4bd71ef1a819287c19d586d7334ae8ed66" + +[[package]] +name = "windows_i686_gnullvm" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9ce6ccbdedbf6d6354471319e781c0dfef054c81fbc7cf83f338a4296c0cae11" + +[[package]] +name = "windows_i686_msvc" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8f55c233f70c4b27f66c523580f78f1004e8b5a8b659e05a4eb49d4166cca406" + +[[package]] +name = "windows_i686_msvc" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "240948bc05c5e7c6dabba28bf89d89ffce3e303022809e73deaefe4f6ec56c66" + +[[package]] +name = "windows_i686_msvc" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "581fee95406bb13382d2f65cd4a908ca7b1e4c2f1917f143ba16efe98a589b5d" + +[[package]] +name = "windows_x86_64_gnu" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "53d40abd2583d23e4718fddf1ebec84dbff8381c07cae67ff7768bbf19c6718e" + +[[package]] +name = "windows_x86_64_gnu" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "147a5c80aabfbf0c7d901cb5895d1de30ef2907eb21fbbab29ca94c5b08b1a78" + +[[package]] +name = "windows_x86_64_gnu" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2e55b5ac9ea33f2fc1716d1742db15574fd6fc8dadc51caab1c16a3d3b4190ba" + +[[package]] +name = "windows_x86_64_gnullvm" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0b7b52767868a23d5bab768e390dc5f5c55825b6d30b86c844ff2dc7414044cc" + +[[package]] +name = "windows_x86_64_gnullvm" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "24d5b23dc417412679681396f2b49f3de8c1473deb516bd34410872eff51ed0d" + +[[package]] +name = "windows_x86_64_gnullvm" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0a6e035dd0599267ce1ee132e51c27dd29437f63325753051e71dd9e42406c57" + +[[package]] +name = "windows_x86_64_msvc" +version = "0.48.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ed94fce61571a4006852b7389a063ab983c02eb1bb37b47f8272ce92d06d9538" + +[[package]] +name = "windows_x86_64_msvc" +version = "0.52.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "589f6da84c646204747d1270a2a5661ea66ed1cced2631d546fdfb155959f9ec" + +[[package]] +name = "windows_x86_64_msvc" +version = "0.53.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "271414315aff87387382ec3d271b52d7ae78726f5d44ac98b4f4030c91880486" + +[[package]] +name = "winnow" +version = "0.7.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "21a0236b59786fed61e2a80582dd500fe61f18b5dca67a4a067d0bc9039339cf" +dependencies = [ + "memchr", +] + +[[package]] +name = "wit-bindgen" +version = "0.46.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f17a85883d4e6d00e8a97c586de764dabcc06133f7f1d55dce5cdc070ad7fe59" + +[[package]] +name = "wkb" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b1e2c084338d6407d24c5a43208aca32128a5d62107eab5ca18314395c4aa3f0" +dependencies = [ + "byteorder", + "geo-traits", + "num_enum", + "thiserror 1.0.69", +] + +[[package]] +name = "writeable" +version = "0.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ea2f10b9bb0928dfb1b42b65e1f9e36f7f54dbdf08457afefb38afcdec4fa2bb" + +[[package]] +name = "yaml-rust2" +version = "0.10.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2462ea039c445496d8793d052e13787f2b90e750b833afee748e601c17621ed9" +dependencies = [ + "arraydeque", + "encoding_rs", + "hashlink", +] + +[[package]] +name = "yoke" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5f41bb01b8226ef4bfd589436a297c53d118f65921786300e427be8d487695cc" +dependencies = [ + "serde", + "stable_deref_trait", + "yoke-derive", + "zerofrom", +] + +[[package]] +name = "yoke-derive" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "38da3c9736e16c5d3c8c597a9aaa5d1fa565d0532ae05e27c24aa62fb32c0ab6" +dependencies = [ + "proc-macro2", + "quote", + "syn", + "synstructure", +] + +[[package]] +name = "zerocopy" +version = "0.8.27" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0894878a5fa3edfd6da3f88c4805f4c8558e2b996227a3d864f47fe11e38282c" +dependencies = [ + "zerocopy-derive", +] + +[[package]] +name = "zerocopy-derive" +version = "0.8.27" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "88d2b8d9c68ad2b9e4340d7832716a4d21a22a1154777ad56ea55c51a9cf3831" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "zerofrom" +version = "0.1.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50cc42e0333e05660c3587f3bf9d0478688e15d870fab3346451ce7f8c9fbea5" +dependencies = [ + "zerofrom-derive", +] + +[[package]] +name = "zerofrom-derive" +version = "0.1.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d71e5d6e06ab090c67b5e44993ec16b72dcbaabc526db883a360057678b48502" +dependencies = [ + "proc-macro2", + "quote", + "syn", + "synstructure", +] + +[[package]] +name = "zeroize" +version = "1.8.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b97154e67e32c85465826e8bcc1c59429aaaf107c1e4a9e53c8d8ccd5eff88d0" + +[[package]] +name = "zerotrie" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "36f0bbd478583f79edad978b407914f61b2972f5af6fa089686016be8f9af595" +dependencies = [ + "displaydoc", + "yoke", + "zerofrom", +] + +[[package]] +name = "zerovec" +version = "0.11.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e7aa2bd55086f1ab526693ecbe444205da57e25f4489879da80635a46d90e73b" +dependencies = [ + "yoke", + "zerofrom", + "zerovec-derive", +] + +[[package]] +name = "zerovec-derive" +version = "0.11.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b96237efa0c878c64bd89c436f661be4e46b2f3eff1ebb976f7ef2321d2f58f" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] diff --git a/backend/Cargo.toml b/backend/Cargo.toml new file mode 100644 index 0000000..4ea7698 --- /dev/null +++ b/backend/Cargo.toml @@ -0,0 +1,75 @@ +[package] +name = "BioIS" +version = "0.1.0" +publish = false +authors = [ + "Christian Beilschmidt ", + "Johannes Drönner ", + "Michael Mattig ", +] +license-file = "LICENSE" +# documentation = "https://docs.geoengine.io" +repository = "https://github.com/geo-engine/BioIS" +edition = "2024" + +[lints.clippy] +cargo = { level = "warn", priority = 0 } +complexity = { level = "warn", priority = 0 } +style = { level = "warn", priority = 0 } +perf = { level = "warn", priority = 0 } +pedantic = { level = "warn", priority = 0 } +correctness = "deny" + +# disable some pedantic lints +result_large_err = { level = "allow", priority = 1 } # TODO: investigate this +cast_possible_truncation = { level = "allow", priority = 1 } +cast_possible_wrap = { level = "allow", priority = 1 } +cast_precision_loss = { level = "allow", priority = 1 } +cast_sign_loss = { level = "allow", priority = 1 } +default_trait_access = { level = "allow", priority = 1 } +missing_errors_doc = { level = "allow", priority = 1 } +module_name_repetitions = { level = "allow", priority = 1 } +must_use_candidate = { level = "allow", priority = 1 } +non_ascii_literal = { level = "allow", priority = 1 } +option_if_let_else = { level = "allow", priority = 1 } +similar_names = { level = "allow", priority = 1 } +single_match_else = { level = "allow", priority = 1 } +type_repetition_in_bounds = { level = "allow", priority = 1 } +wildcard_imports = { level = "allow", priority = 1 } + +# enable some restriction lints +dbg_macro = { level = "warn", priority = 1 } +print_stderr = { level = "warn", priority = 1 } +print_stdout = { level = "warn", priority = 1 } +unimplemented = { level = "warn", priority = 1 } +unwrap_used = { level = "warn", priority = 1 } + +# disable some cargo lints +multiple_crate_versions = { level = "allow", priority = 1 } + +[dependencies] +anyhow = "1.0" +async-trait = "0.1" +axum = { version = "0.8.4", features = ["multipart"] } +axum-extra = { version = "0.10.1" } +clap = { version = "4.5", features = ["derive"] } +clap_derive = "4.5" +config = "0.15" +ogcapi = { version = "0.3.1", features = [ + "services", + "common", + "processes", + "greeter", + "types", +] } +schemars = "1.0" +serde = { version = "1.0", features = ["derive", "rc"] } +serde_json = "1.0" +tokio = { version = "1.47", features = ["full"] } +tracing = "0.1.41" +tracing-subscriber = { version = "0.3.19", features = ["env-filter"] } +url = "2.4" +utoipa = "5.3" +utoipa-axum = "0.2" +tower = "0.5" +tower-http = { version = "0.6", features = ["compression-gzip", "catch-panic", "cors", "request-id", "sensitive-headers", "trace", "util"] } diff --git a/backend/conf/default.toml b/backend/conf/default.toml new file mode 100644 index 0000000..81cee5e --- /dev/null +++ b/backend/conf/default.toml @@ -0,0 +1,16 @@ + +[server] +host = "0.0.0.0" +port = 4040 + +[database] +host = "localhost" +port = 5432 +database = "geoengine" +schema = "geoengine" +user = "geoengine" +password = "geoengine" +# Set to `true` to start with a fresh database each time. +# If this parameter is set to `false` at the first start, subsequent changes to `true` will result in an error. +# This helps to protect production environments from unwanted data loss. +clear_database_on_start = false diff --git a/backend/src/config.rs b/backend/src/config.rs new file mode 100644 index 0000000..e0e6a77 --- /dev/null +++ b/backend/src/config.rs @@ -0,0 +1,54 @@ +use anyhow::Context; +use std::sync::LazyLock; +use url::Url; + +pub static CONFIG: LazyLock = LazyLock::new(|| get_config().expect("config can be loaded")); + +#[derive(serde::Deserialize, Clone, Debug)] +pub struct Config { + pub server: Server, + pub database: Database, +} + +#[derive(serde::Deserialize, Clone, Debug)] +pub struct Server { + pub host: String, + pub port: u16, +} + +#[derive(serde::Deserialize, Clone, Debug)] +pub struct Database { + pub host: String, + pub port: u16, + #[allow(clippy::struct_field_names)] + pub database: String, + pub schema: String, + pub user: String, + pub password: String, + pub clear_database_on_start: bool, +} + +impl Database { + pub fn connection_string(&self) -> anyhow::Result { + Url::parse(&format!( + "postgresql://{}:{}@{}:{}/{}", + self.user, self.password, self.host, self.port, self.database + )) + .context("failed to parse database connection string") + } +} + +fn get_config() -> anyhow::Result { + let mut builder = config::Config::builder(); + + builder = builder.add_source(config::File::from_str( + include_str!("../conf/default.toml"), + config::FileFormat::Toml, + )); + + // TODO: other files + + // TODO: environment variables + + Ok(builder.build()?.try_deserialize()?) +} diff --git a/backend/src/main.rs b/backend/src/main.rs new file mode 100644 index 0000000..0e7ddef --- /dev/null +++ b/backend/src/main.rs @@ -0,0 +1,113 @@ +use axum::routing::get; +use config::CONFIG; +use ogcapi::{processes as ogcapi_processes, services as ogcapi_services}; +use processes::HelloProcess; +use tracing::level_filters::LevelFilter; +use tracing_subscriber::{EnvFilter, layer::SubscriberExt, util::SubscriberInitExt}; +use utoipa_axum::router::OpenApiRouter; + +use crate::processes::Echo; + +mod config; +mod processes; + +#[tokio::main] +async fn main() -> anyhow::Result<()> { + // setup tracing + tracing_subscriber::registry() + .with( + EnvFilter::builder() + .with_default_directive(LevelFilter::INFO.into()) + .from_env_lossy(), + ) + .with(tracing_subscriber::fmt::layer().pretty()) + .init(); + + // Application state + let ogcapi_config = ogcapi::services::Config { + host: CONFIG.server.host.clone(), + port: CONFIG.server.port, + openapi: None, + database_url: CONFIG.database.connection_string()?, + }; + let ogcapi_state = ogcapi_services::AppState::new_from(&ogcapi_config).await; + + // Register processes/processors + let ogcapi_state = ogcapi_state.processors(vec![ + Box::new(ogcapi_processes::greeter::Greeter), + Box::new(HelloProcess), + Box::new(Echo), + // Box::new(GeoJsonLoader), + // Box::new(GdalLoader), + ]); + + // Build & run with hyper + let mut ogcapi_service = ogcapi_services::Service::new_with(&ogcapi_config, ogcapi_state).await; + + // let router = OpenApiRouter::::with_openapi(ApiDoc::openapi()); + // let router = OpenApiRouter::::new(); + + let router = OpenApiRouter::::new(); + let (router, api) = router.split_for_parts(); + + let router = router.route("/", get(|| async { "Hello, World!" })); + + ogcapi_service.router = ogcapi_service + .router + .nest("/test", router.with_state(AppState {}.clone())); + + ogcapi_service.serve().await; + + // middleware stack + // let router = router.layer( + // ServiceBuilder::new() + // .set_x_request_id(MakeRequestUuid) + // .layer(SetSensitiveRequestHeadersLayer::new([ + // AUTHORIZATION, + // PROXY_AUTHORIZATION, + // COOKIE, + // SET_COOKIE, + // ])) + // .layer(TraceLayer::new_for_http().make_span_with(DefaultMakeSpan::new())) + // .layer(CompressionLayer::new()) + // .layer(CorsLayer::permissive()) + // // .layer(CatchPanicLayer::custom(handle_panic)) + // .propagate_x_request_id(), + // ); + + // let listener = TcpListener::bind((CONFIG.server.host.as_str(), CONFIG.server.port)) + // .await + // .expect("create listener"); + + // axum::serve::serve(listener, router.with_state(AppState {}.clone())) + // // .with_graceful_shutdown(shutdown_signal()) + // .await?; + + Ok(()) +} + +#[derive(Debug, Clone)] +struct AppState {} + +// /// Custom panic handler +// fn handle_panic(err: Box) -> Response { +// let details = if let Some(s) = err.downcast_ref::() { +// s.clone() +// } else if let Some(s) = err.downcast_ref::<&str>() { +// s.to_string() +// } else { +// "Unknown panic message".to_string() +// }; + +// // let body = +// // Exception::new_from_status(StatusCode::INTERNAL_SERVER_ERROR.as_u16()).detail(details); + +// // let body = serde_json::to_string(&body).unwrap(); + +// Response::builder() +// .status(StatusCode::INTERNAL_SERVER_ERROR) +// .header(CONTENT_TYPE, "application/json") +// // .body(Body::from(body)) +// .body(Body::from(details)) +// .unwrap() +// } diff --git a/backend/src/processes/echo.rs b/backend/src/processes/echo.rs new file mode 100644 index 0000000..b1accee --- /dev/null +++ b/backend/src/processes/echo.rs @@ -0,0 +1,143 @@ +use anyhow::Result; +use ogcapi::{ + processes::{ProcessResponseBody, Processor}, + types::processes::{Execute, Process}, +}; +use schemars::{JsonSchema, schema_for}; +use serde::{Deserialize, Serialize}; + +#[derive(Clone)] +pub struct Echo; + +#[derive(Deserialize, Debug, JsonSchema)] +pub struct EchoInputs { + pub string_input: Option, + pub measure_input: Option, + pub date_input: Option, + pub double_input: Option, + pub array_input: Option>, + pub complex_object_input: Option, + pub geometry_input: Option>, + pub bounding_box_input: Option, + pub images_input: Option>, + pub feature_collection_input: Option, +} + +#[derive(Clone, Deserialize, Serialize, Debug, JsonSchema)] +pub struct MeasureInput { + pub measurement: f64, + pub uom: String, + pub reference: Option, +} + +#[derive(Clone, Deserialize, Serialize, Debug, JsonSchema)] +pub struct ComplexObjectInput { + pub property1: String, + pub property2: Option, + pub property3: Option, + pub property4: Option, + pub property5: bool, +} + +#[derive(Clone, Deserialize, Serialize, Debug, JsonSchema)] +pub struct BoundingBoxInput { + pub bbox: Vec, +} + +// impl EchoInputs { +// pub fn execute_input(&self) -> HashMap { +// HashMap::from([( +// "name".to_string(), +// Input::InlineOrRefData(InlineOrRefData::InputValueNoObject( +// InputValueNoObject::String(self.name.to_owned()), +// )), +// )]) +// } +// } + +#[derive(Clone, Debug, JsonSchema, Serialize)] +pub struct EchoOutputs { + pub string_input: Option, + pub measure_input: Option, + pub date_input: Option, + pub double_input: Option, + pub array_input: Option>, + pub complex_object_input: Option, + pub geometry_input: Option>, + pub bounding_box_input: Option, + pub images_input: Option>, + pub feature_collection_input: Option, +} + +// impl EchoOutputs { +// pub fn execute_output() -> HashMap { +// HashMap::from([( +// "greeting".to_string(), +// Output { +// format: Some(Format { +// media_type: Some("text/plain".to_string()), +// encoding: Some("utf8".to_string()), +// schema: None, +// }), +// transmission_mode: TransmissionMode::Value, +// }, +// )]) +// } +// } + +// impl TryFrom for EchoOutputs { +// type Error = Exception; + +// fn try_from(value: ProcessResponseBody) -> Result { +// if let ProcessResponseBody::Requested(buf) = value { +// Ok(EchoOutputs { +// greeting: String::from_utf8(buf).unwrap(), +// }) +// } else { +// Err(Exception::new("500")) +// } +// } +// } + +#[async_trait::async_trait] +impl Processor for Echo { + fn id(&self) -> &'static str { + "echo" + } + + fn version(&self) -> &'static str { + "1.0.0" + } + + fn process(&self) -> Result { + Process::try_new( + self.id(), + self.version(), + &schema_for!(EchoInputs), + &schema_for!(EchoOutputs), + ) + .map_err(Into::into) + } + + async fn execute(&self, execute: Execute) -> Result { + let value = serde_json::to_value(execute.inputs).unwrap(); + let inputs: EchoInputs = serde_json::from_value(value).unwrap(); + + let outputs = EchoOutputs { + string_input: inputs.string_input, + measure_input: inputs.measure_input, + date_input: inputs.date_input, + double_input: inputs.double_input, + array_input: inputs.array_input, + complex_object_input: inputs.complex_object_input, + geometry_input: inputs.geometry_input, + bounding_box_input: inputs.bounding_box_input, + images_input: inputs.images_input, + feature_collection_input: inputs.feature_collection_input, + }; + + let response = serde_json::to_vec(&outputs)?; + + Ok(ProcessResponseBody::Requested(response)) + } +} diff --git a/backend/src/processes/hello.rs b/backend/src/processes/hello.rs new file mode 100644 index 0000000..911f6b3 --- /dev/null +++ b/backend/src/processes/hello.rs @@ -0,0 +1,52 @@ +use anyhow::Result; +use ogcapi::{ + processes::{ProcessResponseBody, Processor}, + types::processes::{Execute, Process}, +}; +use schemars::{JsonSchema, schema_for}; +use serde::{Deserialize, Serialize}; + +#[derive(Clone)] +pub struct HelloProcess; + +#[derive(Deserialize, Debug, JsonSchema)] +pub struct HelloInputs { + pub name: String, +} + +#[derive(Serialize, Clone, Debug, JsonSchema)] +pub struct HelloOutputs { + pub sentence: String, +} + +#[async_trait::async_trait] +impl Processor for HelloProcess { + fn id(&self) -> &'static str { + "hello" + } + + fn version(&self) -> &'static str { + "0.1.0" + } + + fn process(&self) -> Result { + Process::try_new( + self.id(), + self.version(), + &schema_for!(HelloInputs), + &schema_for!(HelloOutputs), + ) + .map_err(Into::into) + } + + async fn execute(&self, execute: Execute) -> Result { + let value = serde_json::to_value(execute.inputs)?; + let inputs: HelloInputs = serde_json::from_value(value)?; + let output = HelloOutputs { + sentence: format!("Hello, {}!", inputs.name), + }; + Ok(ProcessResponseBody::Requested(serde_json::to_vec_pretty( + &output, + )?)) + } +} diff --git a/backend/src/processes/mod.rs b/backend/src/processes/mod.rs new file mode 100644 index 0000000..6053c63 --- /dev/null +++ b/backend/src/processes/mod.rs @@ -0,0 +1,5 @@ +mod echo; +mod hello; + +pub use echo::Echo; +pub use hello::HelloProcess; diff --git a/rust-toolchain.toml b/rust-toolchain.toml new file mode 100644 index 0000000..970d460 --- /dev/null +++ b/rust-toolchain.toml @@ -0,0 +1,3 @@ +[toolchain] +channel = "1.90.0" +components = ["cargo", "rustfmt", "rust-src", "clippy", "llvm-tools"] diff --git a/test-client/.python-version b/test-client/.python-version new file mode 100644 index 0000000..c8cfe39 --- /dev/null +++ b/test-client/.python-version @@ -0,0 +1 @@ +3.10 diff --git a/test-client/call-process.ipynb b/test-client/call-process.ipynb new file mode 100644 index 0000000..9861289 --- /dev/null +++ b/test-client/call-process.ipynb @@ -0,0 +1,384 @@ +{ + "cells": [ + { + "cell_type": "code", + "execution_count": 12, + "id": "d941b7e8", + "metadata": {}, + "outputs": [], + "source": [ + "from owslib.ogcapi.processes import Processes\n", + "import numpy as np" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "461507b5", + "metadata": {}, + "outputs": [], + "source": [ + "# SERVICE_URL = \"http://localhost:4040/\"\n" + ] + }, + { + "cell_type": "code", + "execution_count": 24, + "id": "37d5d37a", + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "[{'id': 'greet',\n", + " 'version': '0.1.0',\n", + " 'outputTransmission': 'value',\n", + " 'links': [{'href': 'http://localhost:8484/processes/greet',\n", + " 'rel': 'self',\n", + " 'type': 'application/json',\n", + " 'title': 'process description'}]},\n", + " {'id': 'geojson-loader',\n", + " 'version': '0.1.0',\n", + " 'outputTransmission': 'value',\n", + " 'links': [{'href': 'http://localhost:8484/processes/geojson-loader',\n", + " 'rel': 'self',\n", + " 'type': 'application/json',\n", + " 'title': 'process description'}]},\n", + " {'id': 'gdal-loader',\n", + " 'version': '0.1.0',\n", + " 'outputTransmission': 'value',\n", + " 'links': [{'href': 'http://localhost:8484/processes/gdal-loader',\n", + " 'rel': 'self',\n", + " 'type': 'application/json',\n", + " 'title': 'process description'}]},\n", + " {'id': 'echo',\n", + " 'version': '1.0.0',\n", + " 'outputTransmission': 'value',\n", + " 'links': [{'href': 'http://localhost:8484/processes/echo',\n", + " 'rel': 'self',\n", + " 'type': 'application/json',\n", + " 'title': 'process description'}]}]\n", + "{'id': 'greet',\n", + " 'version': '0.1.0',\n", + " 'outputTransmission': 'value',\n", + " 'links': [{'href': 'http://localhost:8484/processes/greet',\n", + " 'rel': 'self',\n", + " 'type': 'application/json'}],\n", + " 'inputs': {'minOccurs': 1,\n", + " 'maxOccurs': 1,\n", + " 'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", + " 'description': 'Inputs for the `greet` process',\n", + " 'properties': {'name': {'description': 'Name to be '\n", + " 'greeted',\n", + " 'type': 'string'}},\n", + " 'required': ['name'],\n", + " 'title': 'GreeterInputs',\n", + " 'type': 'object'}},\n", + " 'outputs': {'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", + " 'description': 'Outputs for the `greet` process',\n", + " 'properties': {'greeting': {'type': 'string'}},\n", + " 'required': ['greeting'],\n", + " 'title': 'GreeterOutputs',\n", + " 'type': 'object'}}}\n" + ] + }, + { + "data": { + "text/plain": [ + "{'greeting': 'Hello, World!\\n'}" + ] + }, + "execution_count": 24, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "from owslib.ogcapi.processes import Processes\n", + "import pprint\n", + "\n", + "SERVICE_URL = \"http://localhost:8484/\"\n", + "\n", + "p = Processes(SERVICE_URL)\n", + "\n", + "pprint.pp(p.processes())\n", + "\n", + "greeter = p.process('greet')\n", + "pprint.pp(greeter)\n", + "\n", + "p.execute('greet', inputs={'name': 'World'})" + ] + }, + { + "cell_type": "code", + "execution_count": 27, + "id": "ab293305", + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "{'greeting': 'Hello, World!\\n'}" + ] + }, + "execution_count": 27, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "p.execute('greet', inputs={'name': 'World'}, async_=True)" + ] + }, + { + "cell_type": "code", + "execution_count": 28, + "id": "73ac3dbd", + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "{'jobs': [],\n", + " 'links': [{'href': 'http://localhost:8484/jobs',\n", + " 'rel': 'self',\n", + " 'type': 'application/json'}]}" + ] + }, + "execution_count": 28, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "import requests\n", + "\n", + "response = requests.get(f\"{SERVICE_URL}/jobs\")\n", + "response.json()" + ] + }, + { + "cell_type": "code", + "execution_count": 5, + "id": "e0f9de40", + "metadata": {}, + "outputs": [ + { + "ename": "RuntimeError", + "evalue": "Failed to deserialize the JSON body into the target type: response: data did not match any variant of untagged enum Response at line 1 column 53", + "output_type": "error", + "traceback": [ + "\u001b[0;31m---------------------------------------------------------------------------\u001b[0m", + "\u001b[0;31mRuntimeError\u001b[0m Traceback (most recent call last)", + "Cell \u001b[0;32mIn[5], line 1\u001b[0m\n\u001b[0;32m----> 1\u001b[0m result \u001b[38;5;241m=\u001b[39m \u001b[43mp\u001b[49m\u001b[38;5;241;43m.\u001b[39;49m\u001b[43mexecute\u001b[49m\u001b[43m(\u001b[49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mhello\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m,\u001b[49m\u001b[43m \u001b[49m\u001b[43minputs\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[43m{\u001b[49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mname\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m:\u001b[49m\u001b[43m \u001b[49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mWorld\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m}\u001b[49m\u001b[43m)\u001b[49m\n\u001b[1;32m 3\u001b[0m result\n", + "File \u001b[0;32m~/git/geo-engine/BioIS/.venv/lib/python3.10/site-packages/owslib/ogcapi/processes.py:83\u001b[0m, in \u001b[0;36mProcesses.execute\u001b[0;34m(self, process_id, inputs, outputs, response, async_)\u001b[0m\n\u001b[1;32m 79\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mheaders[\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mPrefer\u001b[39m\u001b[38;5;124m'\u001b[39m] \u001b[38;5;241m=\u001b[39m \u001b[38;5;124m'\u001b[39m\u001b[38;5;124mrespond-sync\u001b[39m\u001b[38;5;124m'\u001b[39m\n\u001b[1;32m 81\u001b[0m path \u001b[38;5;241m=\u001b[39m \u001b[38;5;124mf\u001b[39m\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mprocesses/\u001b[39m\u001b[38;5;132;01m{\u001b[39;00mprocess_id\u001b[38;5;132;01m}\u001b[39;00m\u001b[38;5;124m/execution\u001b[39m\u001b[38;5;124m'\u001b[39m\n\u001b[0;32m---> 83\u001b[0m \u001b[38;5;28;01mreturn\u001b[39;00m \u001b[38;5;28;43mself\u001b[39;49m\u001b[38;5;241;43m.\u001b[39;49m\u001b[43m_request\u001b[49m\u001b[43m(\u001b[49m\u001b[43mmethod\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mPOST\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m,\u001b[49m\u001b[43m \u001b[49m\u001b[43mpath\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[43mpath\u001b[49m\u001b[43m,\u001b[49m\u001b[43m \u001b[49m\u001b[43mdata\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[43mdata\u001b[49m\u001b[43m)\u001b[49m\n", + "File \u001b[0;32m~/git/geo-engine/BioIS/.venv/lib/python3.10/site-packages/owslib/ogcapi/__init__.py:196\u001b[0m, in \u001b[0;36mAPI._request\u001b[0;34m(self, method, path, data, as_dict, kwargs)\u001b[0m\n\u001b[1;32m 193\u001b[0m LOGGER\u001b[38;5;241m.\u001b[39mdebug(\u001b[38;5;124mf\u001b[39m\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mResponse status code: \u001b[39m\u001b[38;5;132;01m{\u001b[39;00mresponse\u001b[38;5;241m.\u001b[39mstatus_code\u001b[38;5;132;01m}\u001b[39;00m\u001b[38;5;124m'\u001b[39m)\n\u001b[1;32m 195\u001b[0m \u001b[38;5;28;01mif\u001b[39;00m \u001b[38;5;129;01mnot\u001b[39;00m response:\n\u001b[0;32m--> 196\u001b[0m \u001b[38;5;28;01mraise\u001b[39;00m \u001b[38;5;167;01mRuntimeError\u001b[39;00m(response\u001b[38;5;241m.\u001b[39mtext)\n\u001b[1;32m 198\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mrequest \u001b[38;5;241m=\u001b[39m response\u001b[38;5;241m.\u001b[39murl\n\u001b[1;32m 199\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mresponse_headers \u001b[38;5;241m=\u001b[39m response\u001b[38;5;241m.\u001b[39mheaders\n", + "\u001b[0;31mRuntimeError\u001b[0m: Failed to deserialize the JSON body into the target type: response: data did not match any variant of untagged enum Response at line 1 column 53" + ] + } + ], + "source": [ + "result = p.execute('hello', inputs={'name': 'World'})\n", + "\n", + "result" + ] + }, + { + "cell_type": "code", + "execution_count": 5, + "id": "94a5c0d9", + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "{'id': 'greet',\n", + " 'version': '0.1.0',\n", + " 'outputTransmission': 'value',\n", + " 'links': [{'href': 'http://localhost:8484/processes/greet',\n", + " 'rel': 'self',\n", + " 'type': 'application/json'}],\n", + " 'inputs': {'minOccurs': 1,\n", + " 'maxOccurs': 1,\n", + " 'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", + " 'description': 'Inputs for the `greet` process',\n", + " 'properties': {'name': {'description': 'Name to be greeted',\n", + " 'type': 'string'}},\n", + " 'required': ['name'],\n", + " 'title': 'GreeterInputs',\n", + " 'type': 'object'}},\n", + " 'outputs': {'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", + " 'description': 'Outputs for the `greet` process',\n", + " 'properties': {'greeting': {'type': 'string'}},\n", + " 'required': ['greeting'],\n", + " 'title': 'GreeterOutputs',\n", + " 'type': 'object'}}}" + ] + }, + "execution_count": 5, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "greeter = p.process('greet')\n", + "greeter" + ] + }, + { + "cell_type": "code", + "execution_count": 7, + "id": "62c93957", + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "{'id': 'echo',\n", + " 'version': '1.0.0',\n", + " 'outputTransmission': 'value',\n", + " 'links': [{'href': 'http://localhost:8484/processes/echo',\n", + " 'rel': 'self',\n", + " 'type': 'application/json'}],\n", + " 'inputs': {'minOccurs': 1,\n", + " 'maxOccurs': 1,\n", + " 'schema': {'$defs': {'BoundingBoxInput': {'properties': {'bbox': {'items': {'format': 'double',\n", + " 'type': 'number'},\n", + " 'type': 'array'}},\n", + " 'required': ['bbox'],\n", + " 'type': 'object'},\n", + " 'ComplexObjectInput': {'properties': {'property1': {'type': 'string'},\n", + " 'property2': {'type': ['string', 'null']},\n", + " 'property3': {'format': 'double', 'type': ['number', 'null']},\n", + " 'property4': {'type': ['string', 'null']},\n", + " 'property5': {'type': 'boolean'}},\n", + " 'required': ['property1', 'property5'],\n", + " 'type': 'object'},\n", + " 'MeasureInput': {'properties': {'measurement': {'format': 'double',\n", + " 'type': 'number'},\n", + " 'reference': {'type': ['string', 'null']},\n", + " 'uom': {'type': 'string'}},\n", + " 'required': ['measurement', 'uom'],\n", + " 'type': 'object'}},\n", + " '$schema': 'https://json-schema.org/draft/2020-12/schema',\n", + " 'properties': {'array_input': {'items': {'format': 'int32',\n", + " 'type': 'integer'},\n", + " 'type': ['array', 'null']},\n", + " 'bounding_box_input': {'anyOf': [{'$ref': '#/$defs/BoundingBoxInput'},\n", + " {'type': 'null'}]},\n", + " 'complex_object_input': {'anyOf': [{'$ref': '#/$defs/ComplexObjectInput'},\n", + " {'type': 'null'}]},\n", + " 'date_input': {'type': ['string', 'null']},\n", + " 'double_input': {'format': 'double', 'type': ['number', 'null']},\n", + " 'feature_collection_input': {'type': ['string', 'null']},\n", + " 'geometry_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", + " 'images_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", + " 'measure_input': {'anyOf': [{'$ref': '#/$defs/MeasureInput'},\n", + " {'type': 'null'}]},\n", + " 'string_input': {'type': ['string', 'null']}},\n", + " 'title': 'EchoInputs',\n", + " 'type': 'object'}},\n", + " 'outputs': {'schema': {'$defs': {'BoundingBoxInput': {'properties': {'bbox': {'items': {'format': 'double',\n", + " 'type': 'number'},\n", + " 'type': 'array'}},\n", + " 'required': ['bbox'],\n", + " 'type': 'object'},\n", + " 'ComplexObjectInput': {'properties': {'property1': {'type': 'string'},\n", + " 'property2': {'type': ['string', 'null']},\n", + " 'property3': {'format': 'double', 'type': ['number', 'null']},\n", + " 'property4': {'type': ['string', 'null']},\n", + " 'property5': {'type': 'boolean'}},\n", + " 'required': ['property1', 'property5'],\n", + " 'type': 'object'},\n", + " 'MeasureInput': {'properties': {'measurement': {'format': 'double',\n", + " 'type': 'number'},\n", + " 'reference': {'type': ['string', 'null']},\n", + " 'uom': {'type': 'string'}},\n", + " 'required': ['measurement', 'uom'],\n", + " 'type': 'object'}},\n", + " '$schema': 'https://json-schema.org/draft/2020-12/schema',\n", + " 'properties': {'array_input': {'items': {'format': 'int32',\n", + " 'type': 'integer'},\n", + " 'type': ['array', 'null']},\n", + " 'bounding_box_input': {'anyOf': [{'$ref': '#/$defs/BoundingBoxInput'},\n", + " {'type': 'null'}]},\n", + " 'complex_object_input': {'anyOf': [{'$ref': '#/$defs/ComplexObjectInput'},\n", + " {'type': 'null'}]},\n", + " 'date_input': {'type': ['string', 'null']},\n", + " 'double_input': {'format': 'double', 'type': ['number', 'null']},\n", + " 'feature_collection_input': {'type': ['string', 'null']},\n", + " 'geometry_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", + " 'images_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", + " 'measure_input': {'anyOf': [{'$ref': '#/$defs/MeasureInput'},\n", + " {'type': 'null'}]},\n", + " 'string_input': {'type': ['string', 'null']}},\n", + " 'title': 'EchoOutputs',\n", + " 'type': 'object'}}}" + ] + }, + "execution_count": 7, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "p.process('echo')" + ] + }, + { + "cell_type": "code", + "execution_count": 23, + "id": "672fa101", + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "{'string_input': 'Hello, World!',\n", + " 'measure_input': None,\n", + " 'date_input': None,\n", + " 'double_input': 3.14,\n", + " 'array_input': None,\n", + " 'complex_object_input': None,\n", + " 'geometry_input': None,\n", + " 'bounding_box_input': None,\n", + " 'images_input': None,\n", + " 'feature_collection_input': None}" + ] + }, + "execution_count": 23, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "p.execute('echo', inputs={\n", + " 'string_input': 'Hello, World!',\n", + " 'double_input': 3.14,\n", + "})" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "test-client", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.10.18" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/test.http b/test.http new file mode 100644 index 0000000..6c53e93 --- /dev/null +++ b/test.http @@ -0,0 +1,44 @@ +GET http://localhost:4040/ + +### + +GET http://localhost:4040/processes + +### + +GET http://localhost:4040/processes/hello + +### + +POST http://localhost:4040/processes/hello/execution +Content-Type: application/json + +{ + "inputs": { + "name": "foo" + }, + "outputs": { + "sentence": { + "format": { + "mediaType": "text/plain", + "encoding": "utf-8" + }, + "transmissionMode": "value" + } + } +} + +### + +GET http://localhost:4040/test + +### + +POST http://localhost:4040/processes/greet/execution +Content-Type: application/json + +{ + "inputs": { + "name": "World" + } +} From 461876e01e6280ca9b045950cb0a209d9ea370cc Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 14 Nov 2025 11:51:28 +0100 Subject: [PATCH 02/19] ndvi process --- backend/Cargo.lock | 1382 +++++++++++++------------- backend/Cargo.toml | 8 +- backend/clippy.toml | 7 + backend/conf/default.toml | 5 +- backend/examples/query-geo-engine.rs | 72 ++ backend/src/config.rs | 6 + backend/src/main.rs | 10 +- backend/src/processes/echo.rs | 143 --- backend/src/processes/hello.rs | 52 - backend/src/processes/mod.rs | 10 +- backend/src/processes/ndvi.rs | 545 ++++++++++ rust-toolchain.toml | 2 +- test-client/call-process.ipynb | 794 ++++++++++----- test-client/call.http | 63 ++ 14 files changed, 1930 insertions(+), 1169 deletions(-) create mode 100644 backend/clippy.toml create mode 100644 backend/examples/query-geo-engine.rs delete mode 100644 backend/src/processes/echo.rs delete mode 100644 backend/src/processes/hello.rs create mode 100644 backend/src/processes/ndvi.rs create mode 100644 test-client/call.http diff --git a/backend/Cargo.lock b/backend/Cargo.lock index aeef73c..9c2fd3e 100644 --- a/backend/Cargo.lock +++ b/backend/Cargo.lock @@ -13,8 +13,9 @@ dependencies = [ "clap", "clap_derive", "config", + "geoengine-openapi-client", "ogcapi", - "schemars 1.0.4", + "schemars 1.1.0", "serde", "serde_json", "tokio", @@ -27,35 +28,12 @@ dependencies = [ "utoipa-axum", ] -[[package]] -name = "addr2line" -version = "0.25.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1b5d307320b3181d6d7954e663bd7c774a838b8220fe0593c86d9fb09f498b4b" -dependencies = [ - "gimli", -] - [[package]] name = "adler2" version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "320119579fcad9c21884f5c4861d16174d0e06250625266f50fe6898340abefa" -[[package]] -name = "ahash" -version = "0.8.12" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5a15f179cd60c4584b8a8c596927aadc462e27f2ca70c04e0071964a73ba7a75" -dependencies = [ - "cfg-if", - "const-random", - "getrandom 0.3.3", - "once_cell", - "version_check", - "zerocopy", -] - [[package]] name = "aho-corasick" version = "1.1.3" @@ -146,190 +124,19 @@ dependencies = [ ] [[package]] -name = "arraydeque" -version = "0.5.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7d902e3d592a523def97af8f317b08ce16b7ab854c1985a0c671e6f15cebc236" - -[[package]] -name = "arrow" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b5ec52ba94edeed950e4a41f75d35376df196e8cb04437f7280a5aa49f20f796" -dependencies = [ - "arrow-arith", - "arrow-array", - "arrow-buffer", - "arrow-cast", - "arrow-data", - "arrow-json", - "arrow-ord", - "arrow-row", - "arrow-schema", - "arrow-select", - "arrow-string", -] - -[[package]] -name = "arrow-arith" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8fc766fdacaf804cb10c7c70580254fcdb5d55cdfda2bc57b02baf5223a3af9e" -dependencies = [ - "arrow-array", - "arrow-buffer", - "arrow-data", - "arrow-schema", - "chrono", - "num", -] - -[[package]] -name = "arrow-array" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a12fcdb3f1d03f69d3ec26ac67645a8fe3f878d77b5ebb0b15d64a116c212985" -dependencies = [ - "ahash", - "arrow-buffer", - "arrow-data", - "arrow-schema", - "chrono", - "half", - "hashbrown 0.15.5", - "num", -] - -[[package]] -name = "arrow-buffer" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "263f4801ff1839ef53ebd06f99a56cecd1dbaf314ec893d93168e2e860e0291c" -dependencies = [ - "bytes", - "half", - "num", -] - -[[package]] -name = "arrow-cast" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ede6175fbc039dfc946a61c1b6d42fd682fcecf5ab5d148fbe7667705798cac9" -dependencies = [ - "arrow-array", - "arrow-buffer", - "arrow-data", - "arrow-schema", - "arrow-select", - "atoi", - "base64 0.22.1", - "chrono", - "half", - "lexical-core", - "num", - "ryu", -] - -[[package]] -name = "arrow-data" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "61cfdd7d99b4ff618f167e548b2411e5dd2c98c0ddebedd7df433d34c20a4429" -dependencies = [ - "arrow-buffer", - "arrow-schema", - "half", - "num", -] - -[[package]] -name = "arrow-json" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0ee5b4ca98a7fb2efb9ab3309a5d1c88b5116997ff93f3147efdc1062a6158e9" -dependencies = [ - "arrow-array", - "arrow-buffer", - "arrow-cast", - "arrow-data", - "arrow-schema", - "chrono", - "half", - "indexmap 2.11.4", - "lexical-core", - "memchr", - "num", - "serde", - "serde_json", - "simdutf8", -] - -[[package]] -name = "arrow-ord" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f0a3334a743bd2a1479dbc635540617a3923b4b2f6870f37357339e6b5363c21" -dependencies = [ - "arrow-array", - "arrow-buffer", - "arrow-data", - "arrow-schema", - "arrow-select", -] - -[[package]] -name = "arrow-row" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8d1d7a7291d2c5107e92140f75257a99343956871f3d3ab33a7b41532f79cb68" -dependencies = [ - "arrow-array", - "arrow-buffer", - "arrow-data", - "arrow-schema", - "half", -] - -[[package]] -name = "arrow-schema" -version = "54.3.1" +name = "arbitrary" +version = "1.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "39cfaf5e440be44db5413b75b72c2a87c1f8f0627117d110264048f2969b99e9" +checksum = "c3d036a3c4ab069c7b410a2ce876bd74808d2d0888a82667669f8e783a898bf1" dependencies = [ - "bitflags", -] - -[[package]] -name = "arrow-select" -version = "54.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "69efcd706420e52cd44f5c4358d279801993846d1c2a8e52111853d61d55a619" -dependencies = [ - "ahash", - "arrow-array", - "arrow-buffer", - "arrow-data", - "arrow-schema", - "num", + "derive_arbitrary", ] [[package]] -name = "arrow-string" -version = "54.3.1" +name = "arraydeque" +version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a21546b337ab304a32cfc0770f671db7411787586b45b78b4593ae78e64e2b03" -dependencies = [ - "arrow-array", - "arrow-buffer", - "arrow-data", - "arrow-schema", - "arrow-select", - "memchr", - "num", - "regex", - "regex-syntax", -] +checksum = "7d902e3d592a523def97af8f317b08ce16b7ab854c1985a0c671e6f15cebc236" [[package]] name = "async-compression" @@ -451,21 +258,6 @@ dependencies = [ "tracing", ] -[[package]] -name = "backtrace" -version = "0.3.76" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bb531853791a215d7c62a30daf0dde835f381ab5de4589cfe7c649d2cbe92bd6" -dependencies = [ - "addr2line", - "cfg-if", - "libc", - "miniz_oxide", - "object", - "rustc-demangle", - "windows-link", -] - [[package]] name = "base64" version = "0.21.7" @@ -484,26 +276,6 @@ version = "1.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "55248b47b0caf0546f7988906588779981c43bb1bc9d0c44087278f80cdb44ba" -[[package]] -name = "bindgen" -version = "0.71.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5f58bf3d7db68cfbac37cfc485a8d711e87e064c3d0fe0435b92f7a407f9d6b3" -dependencies = [ - "bitflags", - "cexpr", - "clang-sys", - "itertools", - "log", - "prettyplease", - "proc-macro2", - "quote", - "regex", - "rustc-hash", - "shlex", - "syn", -] - [[package]] name = "bitflags" version = "2.9.4" @@ -550,21 +322,18 @@ dependencies = [ "shlex", ] -[[package]] -name = "cexpr" -version = "0.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6fac387a98bb7c37292057cffc56d62ecb629900026402633ae9160df93a8766" -dependencies = [ - "nom", -] - [[package]] name = "cfg-if" version = "1.0.3" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2fd1289c04a9ea8cb22300a459a72a385d7c73d3259e2ed7dcb2af674838cfa9" +[[package]] +name = "cfg_aliases" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "613afe47fcd5fac7ccf1db93babcb082c5994d996f20b8b159f2ad1658eb5724" + [[package]] name = "chrono" version = "0.4.42" @@ -598,17 +367,6 @@ dependencies = [ "parse-zoneinfo", ] -[[package]] -name = "clang-sys" -version = "1.8.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0b023947811758c97c59bf9d1c188fd619ad4718dcaa767947df1cadb14f39f4" -dependencies = [ - "glob", - "libc", - "libloading", -] - [[package]] name = "clap" version = "4.5.48" @@ -736,6 +494,16 @@ dependencies = [ "unicode-segmentation", ] +[[package]] +name = "core-foundation" +version = "0.9.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "91e195e091a93c46f7102ec7818a2aa394e1e1771c3ab4825963fa03e45afb8f" +dependencies = [ + "core-foundation-sys", + "libc", +] + [[package]] name = "core-foundation-sys" version = "0.8.7" @@ -862,6 +630,17 @@ dependencies = [ "serde_core", ] +[[package]] +name = "derive_arbitrary" +version = "1.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e567bd82dcff979e4b03460c307b3cdc9e96fde3d73bed1496d2bc75d9dd62a" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "digest" version = "0.10.7" @@ -941,6 +720,16 @@ dependencies = [ "typeid", ] +[[package]] +name = "errno" +version = "0.3.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "39cab71617ae0d63f51a36d69f866391735b51691dbda63cf6f96d042b63efeb" +dependencies = [ + "libc", + "windows-sys 0.60.2", +] + [[package]] name = "etcetera" version = "0.8.0" @@ -963,6 +752,12 @@ dependencies = [ "pin-project-lite", ] +[[package]] +name = "fastrand" +version = "2.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "37909eebbb50d72f9059c3b6d82c0463f2ff062c9e95845c43a6c9c0355411be" + [[package]] name = "find-msvc-tools" version = "0.1.2" @@ -976,15 +771,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "4a3d7db9596fecd151c5f638c0ee5d5bd487b6e0ea232e5dc96d5250f6f94b1d" dependencies = [ "crc32fast", + "libz-rs-sys", "miniz_oxide", ] -[[package]] -name = "float_next_after" -version = "1.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8bf7cc16383c4b8d58b9905a8509f02926ce3058053c056376248d958c9df1e8" - [[package]] name = "flume" version = "0.11.1" @@ -1008,6 +798,21 @@ version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d9c4f5dac5e15c24eb999c26181a6ca40b39fe946cbe4c263c7209467bc83af2" +[[package]] +name = "foreign-types" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f6f339eb8adc052cd2ca78910fda869aefa38d22d5cb648e6485e4d3fc06f3b1" +dependencies = [ + "foreign-types-shared", +] + +[[package]] +name = "foreign-types-shared" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b" + [[package]] name = "form_urlencoded" version = "1.2.2" @@ -1017,6 +822,21 @@ dependencies = [ "percent-encoding", ] +[[package]] +name = "futures" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "65bc07b1a8bc7c85c5f2e110c476c7389b4554ba72af57d8445ea63a576b0876" +dependencies = [ + "futures-channel", + "futures-core", + "futures-executor", + "futures-io", + "futures-sink", + "futures-task", + "futures-util", +] + [[package]] name = "futures-channel" version = "0.3.31" @@ -1061,6 +881,17 @@ version = "0.3.31" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9e5c1b78ca4aae1ac06c48a526a655760685149f0d465d21f37abfe57ce075c6" +[[package]] +name = "futures-macro" +version = "0.3.31" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "162ee34ebcb7c64a8abebc059ce0fee27c2262618d7b60ed8faf72fef13c3650" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "futures-sink" version = "0.3.31" @@ -1079,8 +910,10 @@ version = "0.3.31" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9fa08315bb612088cc391249efdc3bc77536f16c91f6cf495e6fbe85b20a4a81" dependencies = [ + "futures-channel", "futures-core", "futures-io", + "futures-macro", "futures-sink", "futures-task", "memchr", @@ -1089,31 +922,6 @@ dependencies = [ "slab", ] -[[package]] -name = "gdal" -version = "0.18.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e721cea67b420fd4b5cb15ba8145f2f1d3a6931a27fdbfadb46cff02015e1cde" -dependencies = [ - "bitflags", - "chrono", - "gdal-sys", - "geo-types", - "semver", - "thiserror 2.0.17", -] - -[[package]] -name = "gdal-sys" -version = "0.11.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "febef67dc08a956a9ecb04de2b40dbd15ad56be49421aad9ae0cdcbe9a24166c" -dependencies = [ - "bindgen", - "pkg-config", - "semver", -] - [[package]] name = "generic-array" version = "0.14.7" @@ -1124,31 +932,6 @@ dependencies = [ "version_check", ] -[[package]] -name = "geo" -version = "0.30.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4416397671d8997e9a3e7ad99714f4f00a22e9eaa9b966a5985d2194fc9e02e1" -dependencies = [ - "float_next_after", - "geo-types", - "geographiclib-rs", - "i_overlay", - "log", - "num-traits", - "robust", - "rstar", -] - -[[package]] -name = "geo-traits" -version = "0.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b018fc19fa58202b03f1c809aebe654f7d70fd3887dace34c3d05c11aeb474b5" -dependencies = [ - "geo-types", -] - [[package]] name = "geo-types" version = "0.7.17" @@ -1157,17 +940,21 @@ checksum = "75a4dcd69d35b2c87a7c83bce9af69fd65c9d68d3833a0ded568983928f3fc99" dependencies = [ "approx", "num-traits", - "rstar", "serde", ] [[package]] -name = "geographiclib-rs" -version = "0.2.5" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f611040a2bb37eaa29a78a128d1e92a378a03e0b6e66ae27398d42b1ba9a7841" +name = "geoengine-openapi-client" +version = "0.0.28" +source = "git+https://github.com/geo-engine/openapi-client?branch=rust#036c9d0ca843f3e349230ef8e6c88f136d793105" dependencies = [ - "libm", + "reqwest", + "serde", + "serde_json", + "serde_repr", + "serde_with", + "url", + "uuid", ] [[package]] @@ -1180,7 +967,17 @@ dependencies = [ "log", "serde", "serde_json", - "thiserror 2.0.17", + "thiserror", +] + +[[package]] +name = "gethostname" +version = "1.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fc257fdb4038301ce4b9cd1b3b51704509692bb3ff716a410cbd07925d9dae55" +dependencies = [ + "rustix", + "windows-targets 0.52.6", ] [[package]] @@ -1190,8 +987,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "335ff9f135e4384c8150d6f27c6daed433577f86b4750418338c01a1a2528592" dependencies = [ "cfg-if", + "js-sys", "libc", "wasi 0.11.1+wasi-snapshot-preview1", + "wasm-bindgen", ] [[package]] @@ -1201,23 +1000,13 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "26145e563e54f2cadc477553f1ec5ee650b00862f0a58bcd12cbdc5f0ea2d2f4" dependencies = [ "cfg-if", + "js-sys", "libc", "r-efi", "wasi 0.14.7+wasi-0.2.4", + "wasm-bindgen", ] -[[package]] -name = "gimli" -version = "0.32.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e629b9b98ef3dd8afe6ca2bd0f89306cec16d43d907889945bc5d6687f2f13c7" - -[[package]] -name = "glob" -version = "0.3.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a8d1add55171497b4705a648c6b583acafb01d58050a51727785f0b2c8e0a2b2" - [[package]] name = "h2" version = "0.4.12" @@ -1238,28 +1027,8 @@ dependencies = [ ] [[package]] -name = "half" -version = "2.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "459196ed295495a68f7d7fe1d84f6c4b7ff0e21fe3017b2f283c6fac3ad803c9" -dependencies = [ - "cfg-if", - "crunchy", - "num-traits", -] - -[[package]] -name = "hash32" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "47d60b12902ba28e2730cd37e95b8c9223af2808df9e902d4df49588d1470606" -dependencies = [ - "byteorder", -] - -[[package]] -name = "hashbrown" -version = "0.12.3" +name = "hashbrown" +version = "0.12.3" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888" @@ -1295,16 +1064,6 @@ dependencies = [ "hashbrown 0.15.5", ] -[[package]] -name = "heapless" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0bfb9eb618601c89945a70e254898da93b13be0388091d42117462b265bb3fad" -dependencies = [ - "hash32", - "stable_deref_trait", -] - [[package]] name = "heck" version = "0.5.0" @@ -1414,64 +1173,62 @@ dependencies = [ ] [[package]] -name = "hyper-util" -version = "0.1.17" +name = "hyper-rustls" +version = "0.27.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3c6995591a8f1380fcb4ba966a252a4b29188d51d2b89e3a252f5305be65aea8" +checksum = "e3c93eb611681b207e1fe55d5a71ecf91572ec8a6705cdb6857f7d8d5242cf58" dependencies = [ - "bytes", - "futures-core", "http", - "http-body", "hyper", - "pin-project-lite", + "hyper-util", + "rustls", + "rustls-pki-types", "tokio", + "tokio-rustls", "tower-service", + "webpki-roots 1.0.2", ] [[package]] -name = "i_float" -version = "1.7.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "85df3a416829bb955fdc2416c7b73680c8dcea8d731f2c7aa23e1042fe1b8343" -dependencies = [ - "serde", -] - -[[package]] -name = "i_key_sort" -version = "0.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "347c253b4748a1a28baf94c9ce133b6b166f08573157e05afe718812bc599fcd" - -[[package]] -name = "i_overlay" -version = "2.0.5" +name = "hyper-tls" +version = "0.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0542dfef184afdd42174a03dcc0625b6147fb73e1b974b1a08a2a42ac35cee49" +checksum = "70206fc6890eaca9fde8a0bf71caa2ddfc9fe045ac9e5c70df101a7dbde866e0" dependencies = [ - "i_float", - "i_key_sort", - "i_shape", - "i_tree", + "bytes", + "http-body-util", + "hyper", + "hyper-util", + "native-tls", + "tokio", + "tokio-native-tls", + "tower-service", ] [[package]] -name = "i_shape" -version = "1.7.0" +name = "hyper-util" +version = "0.1.17" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0a38f5a42678726718ff924f6d4a0e79b129776aeed298f71de4ceedbd091bce" +checksum = "3c6995591a8f1380fcb4ba966a252a4b29188d51d2b89e3a252f5305be65aea8" dependencies = [ - "i_float", - "serde", + "base64 0.22.1", + "bytes", + "futures-channel", + "futures-core", + "futures-util", + "http", + "http-body", + "hyper", + "ipnet", + "libc", + "percent-encoding", + "pin-project-lite", + "socket2", + "tokio", + "tower-service", + "tracing", ] -[[package]] -name = "i_tree" -version = "0.8.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "155181bc97d770181cf9477da51218a19ee92a8e5be642e796661aee2b601139" - [[package]] name = "iana-time-zone" version = "0.1.64" @@ -1633,14 +1390,19 @@ dependencies = [ ] [[package]] -name = "io-uring" -version = "0.7.10" +name = "ipnet" +version = "2.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "046fa2d4d00aea763528b4950358d0ead425372445dc8ff86312b3c69ff7727b" +checksum = "469fb0b9cefa57e3ef31275ee7cacb78f2fdca44e4765491884a2b119d4eb130" + +[[package]] +name = "iri-string" +version = "0.7.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4f867b9d1d896b67beb18518eda36fdb77a32ea590de864f1325b294a6d14397" dependencies = [ - "bitflags", - "cfg-if", - "libc", + "memchr", + "serde", ] [[package]] @@ -1649,15 +1411,6 @@ version = "1.70.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "7943c866cc5cd64cbc25b2e01621d07fa8eb2a1a23160ee81ce38704e97b8ecf" -[[package]] -name = "itertools" -version = "0.13.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "413ee7dfc52ee1a4949ceeb7dbc8a33f2d6c088194d9f922fb8318faf1f01186" -dependencies = [ - "either", -] - [[package]] name = "itoa" version = "1.0.15" @@ -1694,79 +1447,12 @@ dependencies = [ "spin", ] -[[package]] -name = "lexical-core" -version = "1.0.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7d8d125a277f807e55a77304455eb7b1cb52f2b18c143b60e766c120bd64a594" -dependencies = [ - "lexical-parse-float", - "lexical-parse-integer", - "lexical-util", - "lexical-write-float", - "lexical-write-integer", -] - -[[package]] -name = "lexical-parse-float" -version = "1.0.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "52a9f232fbd6f550bc0137dcb5f99ab674071ac2d690ac69704593cb4abbea56" -dependencies = [ - "lexical-parse-integer", - "lexical-util", -] - -[[package]] -name = "lexical-parse-integer" -version = "1.0.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9a7a039f8fb9c19c996cd7b2fcce303c1b2874fe1aca544edc85c4a5f8489b34" -dependencies = [ - "lexical-util", -] - -[[package]] -name = "lexical-util" -version = "1.0.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2604dd126bb14f13fb5d1bd6a66155079cb9fa655b37f875b3a742c705dbed17" - -[[package]] -name = "lexical-write-float" -version = "1.0.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "50c438c87c013188d415fbabbb1dceb44249ab81664efbd31b14ae55dabb6361" -dependencies = [ - "lexical-util", - "lexical-write-integer", -] - -[[package]] -name = "lexical-write-integer" -version = "1.0.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "409851a618475d2d5796377cad353802345cba92c867d9fbcde9cf4eac4e14df" -dependencies = [ - "lexical-util", -] - [[package]] name = "libc" version = "0.2.176" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "58f929b4d672ea937a23a1ab494143d968337a5f47e56d0815df1e0890ddf174" -[[package]] -name = "libloading" -version = "0.8.9" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d7c4b02199fee7c5d21a5ae7d8cfa79a6ef5bb2fc834d6e9058e89c825efdc55" -dependencies = [ - "cfg-if", - "windows-link", -] - [[package]] name = "libm" version = "0.2.15" @@ -1794,6 +1480,21 @@ dependencies = [ "vcpkg", ] +[[package]] +name = "libz-rs-sys" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "840db8cf39d9ec4dd794376f38acc40d0fc65eec2a8f484f7fd375b84602becd" +dependencies = [ + "zlib-rs", +] + +[[package]] +name = "linux-raw-sys" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "df1d3c3b53da64cf5760482273a98e575c651a67eec7f77df96b5b642de8f039" + [[package]] name = "litemap" version = "0.8.0" @@ -1816,6 +1517,21 @@ version = "0.4.28" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "34080505efa8e45a4b816c349525ebe327ceaa8559756f0356cba97ef3bf7432" +[[package]] +name = "lru-slab" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "112b39cec0b298b6c1999fee3e31427f74f676e4cb9879ed1a121b43661a4154" + +[[package]] +name = "mail-builder" +version = "0.4.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "900998f307338c4013a28ab14d760b784067324b164448c6d98a89e44810473b" +dependencies = [ + "gethostname", +] + [[package]] name = "matchers" version = "0.2.0" @@ -1854,10 +1570,14 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6877bb514081ee2a7ff5ef9de3281f14a4dd4bceac4c09388074a6b5df8a139a" [[package]] -name = "minimal-lexical" -version = "0.2.1" +name = "mime_guess" +version = "2.0.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "68354c5c6bd36d73ff3feceb05efa59b6acb7626617f4962be322a825e61f79a" +checksum = "f7c44f8e672c00fe5308fa235f821cb4198414e1c77935c1ab6948d3fd78550e" +dependencies = [ + "mime", + "unicase", +] [[package]] name = "miniz_oxide" @@ -1897,13 +1617,20 @@ dependencies = [ ] [[package]] -name = "nom" -version = "7.1.3" +name = "native-tls" +version = "0.2.14" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d273983c5a657a70a3e8f2a01329822f3b8c8172b73826411a55751e404a0a4a" +checksum = "87de3442987e9dbec73158d5c715e7ad9072fda936bb03d19d7fa10e00520f0e" dependencies = [ - "memchr", - "minimal-lexical", + "libc", + "log", + "openssl", + "openssl-probe", + "openssl-sys", + "schannel", + "security-framework", + "security-framework-sys", + "tempfile", ] [[package]] @@ -1915,20 +1642,6 @@ dependencies = [ "windows-sys 0.52.0", ] -[[package]] -name = "num" -version = "0.4.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "35bd024e8b2ff75562e5f34e7f4905839deb4b22955ef5e73d2fea1b9813cb23" -dependencies = [ - "num-bigint", - "num-complex", - "num-integer", - "num-iter", - "num-rational", - "num-traits", -] - [[package]] name = "num-bigint" version = "0.4.6" @@ -1952,20 +1665,11 @@ dependencies = [ "num-integer", "num-iter", "num-traits", - "rand", + "rand 0.8.5", "smallvec", "zeroize", ] -[[package]] -name = "num-complex" -version = "0.4.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "73f88a1307638156682bada9d7604135552957b7818057dcef22705b4d509495" -dependencies = [ - "num-traits", -] - [[package]] name = "num-conv" version = "0.1.0" @@ -2014,53 +1718,38 @@ dependencies = [ "libm", ] -[[package]] -name = "num_enum" -version = "0.7.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4e613fc340b2220f734a8595782c551f1250e969d87d3be1ae0579e8d4065179" -dependencies = [ - "num_enum_derive", -] - -[[package]] -name = "num_enum_derive" -version = "0.7.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "af1844ef2428cc3e1cb900be36181049ef3d3193c63e43026cfe202983b27a56" -dependencies = [ - "proc-macro-crate", - "proc-macro2", - "quote", - "syn", -] - -[[package]] -name = "object" -version = "0.37.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ff76201f031d8863c38aa7f905eca4f53abbfa15f609db4277d44cd8938f33fe" -dependencies = [ - "memchr", -] - [[package]] name = "ogcapi" version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2222a7f7cd930536f54190272ee3d868b75d7c27ec2fabc342d0ed176b83681c" +source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ + "ogcapi-client", "ogcapi-drivers", "ogcapi-processes", "ogcapi-services", "ogcapi-types", ] +[[package]] +name = "ogcapi-client" +version = "0.3.0" +source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" +dependencies = [ + "geojson", + "log", + "ogcapi-types", + "reqwest", + "serde", + "serde_json", + "serde_qs", + "thiserror", + "url", +] + [[package]] name = "ogcapi-drivers" version = "0.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "86e9f6d39df85ac17bb34accf6ad05ef07874489ed00e163416ee278db8aba10" +source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "anyhow", "async-trait", @@ -2075,33 +1764,24 @@ dependencies = [ [[package]] name = "ogcapi-processes" version = "0.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fc8c4e5784d3ea50911dbae1755f24bbe42f33270e016833d58aa1198cf34589" +source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "anyhow", - "arrow", "async-trait", "dyn-clone", - "gdal", - "geo", - "geojson", "http-body", - "ogcapi-drivers", "ogcapi-types", - "schemars 0.8.22", + "schemars 1.1.0", "serde", "serde_json", - "sqlx", "tokio", "url", - "wkb", ] [[package]] name = "ogcapi-services" version = "0.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bff3a972b6fa71bfb06d8cd2ebcf5d706c79cb04076804d763b97b0702182535" +source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "anyhow", "axum", @@ -2109,39 +1789,45 @@ dependencies = [ "clap", "dotenvy", "dyn-clone", + "futures", "hyper", + "mail-builder", "ogcapi-drivers", "ogcapi-processes", "ogcapi-types", "openapiv3", - "schemars 0.8.22", + "schemars 1.1.0", "serde", "serde_json", "serde_qs", "serde_yaml", - "thiserror 2.0.17", + "thiserror", "tokio", "tower", "tower-http", "tracing", "tracing-subscriber", "url", + "utoipa", + "utoipa-axum", + "utoipa-swagger-ui", ] [[package]] name = "ogcapi-types" version = "0.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e07c6bed7690347372eba07c3b864eb3f3408e08e63127b3a35df2827d4d29be" +source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "chrono", "geojson", "log", "serde", "serde_json", + "serde_qs", "serde_repr", "serde_with", "url", + "utoipa", ] [[package]] @@ -2167,6 +1853,50 @@ dependencies = [ "serde_json", ] +[[package]] +name = "openssl" +version = "0.10.75" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "08838db121398ad17ab8531ce9de97b244589089e290a384c900cb9ff7434328" +dependencies = [ + "bitflags", + "cfg-if", + "foreign-types", + "libc", + "once_cell", + "openssl-macros", + "openssl-sys", +] + +[[package]] +name = "openssl-macros" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a948666b637a0f465e8564c73e89d4dde00d72d4d473cc972f390fc3dcee7d9c" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "openssl-probe" +version = "0.1.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d05e27ee213611ffe7d6348b942e8f942b37114c00cc03cec254295a4a17852e" + +[[package]] +name = "openssl-sys" +version = "0.9.111" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "82cab2d520aa75e3c58898289429321eb788c3106963d0dc886ec7a5f4adc321" +dependencies = [ + "cc", + "libc", + "pkg-config", + "vcpkg", +] + [[package]] name = "ordered-multimap" version = "0.7.3" @@ -2349,31 +2079,67 @@ dependencies = [ ] [[package]] -name = "prettyplease" -version = "0.2.37" +name = "proc-macro2" +version = "1.0.101" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "479ca8adacdd7ce8f1fb39ce9ecccbfe93a3f1344b3d0d97f20bc0196208f62b" +checksum = "89ae43fd86e4158d6db51ad8e2b80f313af9cc74f5c0e03ccb87de09998732de" dependencies = [ - "proc-macro2", - "syn", + "unicode-ident", ] [[package]] -name = "proc-macro-crate" -version = "3.3.0" +name = "quinn" +version = "0.11.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b9e20a958963c291dc322d98411f541009df2ced7b5a4f2bd52337638cfccf20" +dependencies = [ + "bytes", + "cfg_aliases", + "pin-project-lite", + "quinn-proto", + "quinn-udp", + "rustc-hash", + "rustls", + "socket2", + "thiserror", + "tokio", + "tracing", + "web-time", +] + +[[package]] +name = "quinn-proto" +version = "0.11.13" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "edce586971a4dfaa28950c6f18ed55e0406c1ab88bbce2c6f6293a7aaba73d35" +checksum = "f1906b49b0c3bc04b5fe5d86a77925ae6524a19b816ae38ce1e426255f1d8a31" dependencies = [ - "toml_edit", + "bytes", + "getrandom 0.3.3", + "lru-slab", + "rand 0.9.2", + "ring", + "rustc-hash", + "rustls", + "rustls-pki-types", + "slab", + "thiserror", + "tinyvec", + "tracing", + "web-time", ] [[package]] -name = "proc-macro2" -version = "1.0.101" +name = "quinn-udp" +version = "0.5.14" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "89ae43fd86e4158d6db51ad8e2b80f313af9cc74f5c0e03ccb87de09998732de" +checksum = "addec6a0dcad8a8d96a771f815f0eaf55f9d1805756410b39f5fa81332574cbd" dependencies = [ - "unicode-ident", + "cfg_aliases", + "libc", + "once_cell", + "socket2", + "tracing", + "windows-sys 0.60.2", ] [[package]] @@ -2395,11 +2161,21 @@ checksum = "69cdb34c158ceb288df11e18b4bd39de994f6657d83847bdffdbd7f346754b0f" name = "rand" version = "0.8.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "34af8d1a0e25924bc5b7c43c079c942339d8f0a8b57c39049bef581b46327404" +checksum = "34af8d1a0e25924bc5b7c43c079c942339d8f0a8b57c39049bef581b46327404" +dependencies = [ + "libc", + "rand_chacha 0.3.1", + "rand_core 0.6.4", +] + +[[package]] +name = "rand" +version = "0.9.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6db2770f06117d490610c7488547d543617b21bfa07796d7a12f6f1bd53850d1" dependencies = [ - "libc", - "rand_chacha", - "rand_core", + "rand_chacha 0.9.0", + "rand_core 0.9.3", ] [[package]] @@ -2409,7 +2185,17 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88" dependencies = [ "ppv-lite86", - "rand_core", + "rand_core 0.6.4", +] + +[[package]] +name = "rand_chacha" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d3022b5f1df60f26e1ffddd6c66e8aa15de382ae63b3a0c1bfc0e4d3e3f325cb" +dependencies = [ + "ppv-lite86", + "rand_core 0.9.3", ] [[package]] @@ -2421,6 +2207,15 @@ dependencies = [ "getrandom 0.2.16", ] +[[package]] +name = "rand_core" +version = "0.9.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "99d9a13982dcf210057a8a78572b2217b667c3beacbf3a0d8b454f6f82837d38" +dependencies = [ + "getrandom 0.3.3", +] + [[package]] name = "redox_syscall" version = "0.5.17" @@ -2479,6 +2274,50 @@ version = "0.8.6" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "caf4aa5b0f434c91fe5c7f1ecb6a5ece2130b02ad2a590589dda5146df959001" +[[package]] +name = "reqwest" +version = "0.12.24" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9d0946410b9f7b082a427e4ef5c8ff541a88b357bc6c637c40db3a68ac70a36f" +dependencies = [ + "base64 0.22.1", + "bytes", + "futures-channel", + "futures-core", + "futures-util", + "http", + "http-body", + "http-body-util", + "hyper", + "hyper-rustls", + "hyper-tls", + "hyper-util", + "js-sys", + "log", + "mime_guess", + "native-tls", + "percent-encoding", + "pin-project-lite", + "quinn", + "rustls", + "rustls-pki-types", + "serde", + "serde_json", + "serde_urlencoded", + "sync_wrapper", + "tokio", + "tokio-native-tls", + "tokio-rustls", + "tower", + "tower-http", + "tower-service", + "url", + "wasm-bindgen", + "wasm-bindgen-futures", + "web-sys", + "webpki-roots 1.0.2", +] + [[package]] name = "ring" version = "0.17.14" @@ -2511,12 +2350,6 @@ dependencies = [ "strsim 0.10.0", ] -[[package]] -name = "robust" -version = "1.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4e27ee8bb91ca0adcf0ecb116293afa12d393f9c2b9b9cd54d33e8078fe19839" - [[package]] name = "ron" version = "0.8.1" @@ -2542,7 +2375,7 @@ dependencies = [ "num-traits", "pkcs1", "pkcs8", - "rand_core", + "rand_core 0.6.4", "signature", "spki", "subtle", @@ -2550,14 +2383,37 @@ dependencies = [ ] [[package]] -name = "rstar" -version = "0.12.2" +name = "rust-embed" +version = "8.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "421400d13ccfd26dfa5858199c30a5d76f9c54e0dba7575273025b43c5175dbb" +checksum = "947d7f3fad52b283d261c4c99a084937e2fe492248cb9a68a8435a861b8798ca" dependencies = [ - "heapless", - "num-traits", - "smallvec", + "rust-embed-impl", + "rust-embed-utils", + "walkdir", +] + +[[package]] +name = "rust-embed-impl" +version = "8.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5fa2c8c9e8711e10f9c4fd2d64317ef13feaab820a4c51541f1a8c8e2e851ab2" +dependencies = [ + "proc-macro2", + "quote", + "rust-embed-utils", + "syn", + "walkdir", +] + +[[package]] +name = "rust-embed-utils" +version = "8.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "60b161f275cb337fe0a44d924a5f4df0ed69c2c39519858f931ce61c779d3475" +dependencies = [ + "sha2", + "walkdir", ] [[package]] @@ -2570,18 +2426,25 @@ dependencies = [ "ordered-multimap", ] -[[package]] -name = "rustc-demangle" -version = "0.1.26" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "56f7d92ca342cea22a06f2121d944b4fd82af56988c270852495420f961d4ace" - [[package]] name = "rustc-hash" version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "357703d41365b4b27c590e3ed91eabb1b663f07c4c084095e60cbed4362dff0d" +[[package]] +name = "rustix" +version = "1.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cd15f8a2c5551a84d56efdc1cd049089e409ac19a3072d5037a17fd70719ff3e" +dependencies = [ + "bitflags", + "errno", + "libc", + "linux-raw-sys", + "windows-sys 0.60.2", +] + [[package]] name = "rustls" version = "0.23.32" @@ -2602,6 +2465,7 @@ version = "1.12.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "229a4a4c221013e7e1f1a043678c5cc39fe5171437c88fb47151a21e6f5b5c79" dependencies = [ + "web-time", "zeroize", ] @@ -2629,15 +2493,21 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "28d3b2b1366ec20994f1fd18c3c594f05c5dd4bc44d8bb0c1c632c8d6829481f" [[package]] -name = "schemars" -version = "0.8.22" +name = "same-file" +version = "1.0.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3fbf2ae1b8bc8e02df939598064d22402220cd5bbcca1c76f7d6a310974d5615" +checksum = "93fc1dc3aaa9bfed95e02e6eadabb4baf7e3078b0bd1b4d7b6b0b68378900502" dependencies = [ - "dyn-clone", - "schemars_derive 0.8.22", - "serde", - "serde_json", + "winapi-util", +] + +[[package]] +name = "schannel" +version = "0.1.28" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "891d81b926048e76efe18581bf793546b4c0eaf8448d72be8de2bbee5fd166e1" +dependencies = [ + "windows-sys 0.61.1", ] [[package]] @@ -2654,34 +2524,22 @@ dependencies = [ [[package]] name = "schemars" -version = "1.0.4" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "82d20c4491bc164fa2f6c5d44565947a52ad80b9505d8e36f8d54c27c739fcd0" +checksum = "9558e172d4e8533736ba97870c4b2cd63f84b382a3d6eb063da41b91cce17289" dependencies = [ "dyn-clone", "ref-cast", - "schemars_derive 1.0.4", + "schemars_derive", "serde", "serde_json", ] [[package]] name = "schemars_derive" -version = "0.8.22" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "32e265784ad618884abaea0600a9adf15393368d840e0222d101a072f3f7534d" -dependencies = [ - "proc-macro2", - "quote", - "serde_derive_internals", - "syn", -] - -[[package]] -name = "schemars_derive" -version = "1.0.4" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "33d020396d1d138dc19f1165df7545479dcd58d93810dc5d646a16e55abefa80" +checksum = "301858a4023d78debd2353c7426dc486001bddc91ae31a76fb1f55132f7e2633" dependencies = [ "proc-macro2", "quote", @@ -2696,10 +2554,27 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "94143f37725109f92c262ed2cf5e59bce7498c01bcc1502d7b9afe439a4e9f49" [[package]] -name = "semver" -version = "1.0.27" +name = "security-framework" +version = "2.11.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "897b2245f0b511c87893af39b033e5ca9cce68824c4d7e7630b5a1d339658d02" +dependencies = [ + "bitflags", + "core-foundation", + "core-foundation-sys", + "libc", + "security-framework-sys", +] + +[[package]] +name = "security-framework-sys" +version = "2.15.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d767eb0aabc880b29956c35734170f26ed551a859dbd361d140cdbeca61ab1e2" +checksum = "cc1f0cbffaac4852523ce30d8bd3c5cdc873501d96ff467ca09b6767bb8cd5c0" +dependencies = [ + "core-foundation-sys", + "libc", +] [[package]] name = "serde" @@ -2780,13 +2655,15 @@ dependencies = [ [[package]] name = "serde_qs" -version = "0.14.0" +version = "1.0.0-rc.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8b417bedc008acbdf6d6b4bc482d29859924114bbe2650b7921fb68a261d0aa6" +checksum = "4cb0b9062a400c31442e67d1f2b1e7746bebd691110ebee1b7d0c7293b04fab1" dependencies = [ + "itoa", "percent-encoding", + "ryu", "serde", - "thiserror 2.0.17", + "thiserror", ] [[package]] @@ -2833,7 +2710,7 @@ dependencies = [ "indexmap 1.9.3", "indexmap 2.11.4", "schemars 0.9.0", - "schemars 1.0.4", + "schemars 1.1.0", "serde", "serde_derive", "serde_json", @@ -2919,14 +2796,14 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "77549399552de45a898a580c1b41d445bf730df867cc44e6c0233bbc4b8329de" dependencies = [ "digest", - "rand_core", + "rand_core 0.6.4", ] [[package]] -name = "simdutf8" -version = "0.1.5" +name = "simd-adler32" +version = "0.3.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e3a9fe34e3e7a50316060351f37187a3f546bce95496156754b601a5fa71b76e" +checksum = "d66dc143e6b11c1eddc06d5c423cfc97062865baf299914ab64caa38182078fe" [[package]] name = "slab" @@ -3013,7 +2890,7 @@ dependencies = [ "serde_json", "sha2", "smallvec", - "thiserror 2.0.17", + "thiserror", "tokio", "tokio-stream", "tracing", @@ -3088,7 +2965,7 @@ dependencies = [ "memchr", "once_cell", "percent-encoding", - "rand", + "rand 0.8.5", "rsa", "serde", "sha1", @@ -3096,7 +2973,7 @@ dependencies = [ "smallvec", "sqlx-core", "stringprep", - "thiserror 2.0.17", + "thiserror", "tracing", "whoami", ] @@ -3126,14 +3003,14 @@ dependencies = [ "md-5", "memchr", "once_cell", - "rand", + "rand 0.8.5", "serde", "serde_json", "sha2", "smallvec", "sqlx-core", "stringprep", - "thiserror 2.0.17", + "thiserror", "tracing", "whoami", ] @@ -3157,7 +3034,7 @@ dependencies = [ "serde", "serde_urlencoded", "sqlx-core", - "thiserror 2.0.17", + "thiserror", "tracing", "url", ] @@ -3213,6 +3090,9 @@ name = "sync_wrapper" version = "1.0.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0bf256ce5efdfa370213c1dabab5935a12e49f2c58d15e9eac2870d3b4f27263" +dependencies = [ + "futures-core", +] [[package]] name = "synstructure" @@ -3226,12 +3106,16 @@ dependencies = [ ] [[package]] -name = "thiserror" -version = "1.0.69" +name = "tempfile" +version = "3.23.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b6aaf5339b578ea85b50e080feb250a3e8ae8cfcdff9a461c9ec2904bc923f52" +checksum = "2d31c77bdf42a745371d260a26ca7163f1e0924b64afa0b688e61b5a9fa02f16" dependencies = [ - "thiserror-impl 1.0.69", + "fastrand", + "getrandom 0.3.3", + "once_cell", + "rustix", + "windows-sys 0.52.0", ] [[package]] @@ -3240,18 +3124,7 @@ version = "2.0.17" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f63587ca0f12b72a0600bcba1d40081f830876000bb46dd2337a3051618f4fc8" dependencies = [ - "thiserror-impl 2.0.17", -] - -[[package]] -name = "thiserror-impl" -version = "1.0.69" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4fee6c4efc90059e10f81e6d42c60a18f76588c3d74cb83a0b242a2b6c7504c1" -dependencies = [ - "proc-macro2", - "quote", - "syn", + "thiserror-impl", ] [[package]] @@ -3341,35 +3214,52 @@ checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20" [[package]] name = "tokio" -version = "1.47.1" +version = "1.48.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "89e49afdadebb872d3145a5638b59eb0691ea23e46ca484037cfab3b76b95038" +checksum = "ff360e02eab121e0bc37a2d3b4d4dc622e6eda3a8e5253d5435ecf5bd4c68408" dependencies = [ - "backtrace", "bytes", - "io-uring", "libc", "mio", "parking_lot", "pin-project-lite", "signal-hook-registry", - "slab", "socket2", "tokio-macros", - "windows-sys 0.59.0", + "windows-sys 0.61.1", ] [[package]] name = "tokio-macros" -version = "2.5.0" +version = "2.6.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6e06d43f1345a3bcd39f6a56dbb7dcab2ba47e68e8ac134855e7e2bdbaf8cab8" +checksum = "af407857209536a95c8e56f8231ef2c2e2aff839b22e07a1ffcbc617e9db9fa5" dependencies = [ "proc-macro2", "quote", "syn", ] +[[package]] +name = "tokio-native-tls" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbae76ab933c85776efabc971569dd6119c580d8f5d448769dec1764bf796ef2" +dependencies = [ + "native-tls", + "tokio", +] + +[[package]] +name = "tokio-rustls" +version = "0.26.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1729aa945f29d91ba541258c8df89027d5792d85a8841fb65e8bf0f4ede4ef61" +dependencies = [ + "rustls", + "tokio", +] + [[package]] name = "tokio-stream" version = "0.1.17" @@ -3402,17 +3292,11 @@ checksum = "00e5e5d9bf2475ac9d4f0d9edab68cc573dc2fd644b0dba36b0c30a92dd9eaa0" dependencies = [ "serde_core", "serde_spanned", - "toml_datetime 0.7.2", + "toml_datetime", "toml_parser", "winnow", ] -[[package]] -name = "toml_datetime" -version = "0.6.11" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "22cddaf88f4fbc13c51aebbf5f8eceb5c7c5a9da2ac40a13519eb5b0a0e8f11c" - [[package]] name = "toml_datetime" version = "0.7.2" @@ -3422,17 +3306,6 @@ dependencies = [ "serde_core", ] -[[package]] -name = "toml_edit" -version = "0.22.27" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "41fe8c660ae4257887cf66394862d21dbca4a6ddd26f04a3560410406a2f819a" -dependencies = [ - "indexmap 2.11.4", - "toml_datetime 0.6.11", - "winnow", -] - [[package]] name = "toml_parser" version = "1.0.3" @@ -3472,6 +3345,7 @@ dependencies = [ "http", "http-body", "http-body-util", + "iri-string", "pin-project-lite", "tokio", "tokio-util", @@ -3580,6 +3454,12 @@ version = "0.1.7" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2896d95c02a80c6d6a5d6e953d479f5ddf2dfdb6a244441010e373ac0fb88971" +[[package]] +name = "unicase" +version = "2.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "75b844d17643ee918803943289730bec8aac480150456169e647ed0b576ba539" + [[package]] name = "unicode-bidi" version = "0.3.18" @@ -3682,7 +3562,27 @@ checksum = "6d79d08d92ab8af4c5e8a6da20c47ae3f61a0f1dabc1997cdf2d082b757ca08b" dependencies = [ "proc-macro2", "quote", + "regex", "syn", + "url", +] + +[[package]] +name = "utoipa-swagger-ui" +version = "9.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d047458f1b5b65237c2f6dc6db136945667f40a7668627b3490b9513a3d43a55" +dependencies = [ + "axum", + "base64 0.22.1", + "mime_guess", + "regex", + "rust-embed", + "serde", + "serde_json", + "url", + "utoipa", + "zip", ] [[package]] @@ -3693,6 +3593,7 @@ checksum = "2f87b8aa10b915a06587d0dec516c282ff295b475d94abf425d62b57710070a2" dependencies = [ "getrandom 0.3.3", "js-sys", + "serde", "wasm-bindgen", ] @@ -3714,6 +3615,16 @@ version = "0.9.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0b928f33d975fc6ad9f86c8f283853ad26bdd5b10b7f1542aa2fa15e2289105a" +[[package]] +name = "walkdir" +version = "2.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "29790946404f91d9c5d06f9874efddea1dc06c5efe94541a7d6863108e3a5e4b" +dependencies = [ + "same-file", + "winapi-util", +] + [[package]] name = "want" version = "0.3.1" @@ -3780,6 +3691,19 @@ dependencies = [ "wasm-bindgen-shared", ] +[[package]] +name = "wasm-bindgen-futures" +version = "0.4.54" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7e038d41e478cc73bae0ff9b36c60cff1c98b8f38f8d7e8061e79ee63608ac5c" +dependencies = [ + "cfg-if", + "js-sys", + "once_cell", + "wasm-bindgen", + "web-sys", +] + [[package]] name = "wasm-bindgen-macro" version = "0.2.104" @@ -3812,6 +3736,26 @@ dependencies = [ "unicode-ident", ] +[[package]] +name = "web-sys" +version = "0.3.81" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9367c417a924a74cae129e6a2ae3b47fabb1f8995595ab474029da749a8be120" +dependencies = [ + "js-sys", + "wasm-bindgen", +] + +[[package]] +name = "web-time" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5a6580f308b1fad9207618087a65c04e7a10bc77e02c8e84e9b00dd4b12fa0bb" +dependencies = [ + "js-sys", + "wasm-bindgen", +] + [[package]] name = "webpki-roots" version = "0.26.11" @@ -3840,6 +3784,15 @@ dependencies = [ "wasite", ] +[[package]] +name = "winapi-util" +version = "0.1.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c2a7b1c03c876122aa43f3020e6c3c3ee5c05081c9a00739faf7503aeba10d22" +dependencies = [ + "windows-sys 0.60.2", +] + [[package]] name = "windows-core" version = "0.62.1" @@ -3935,6 +3888,15 @@ dependencies = [ "windows-targets 0.53.4", ] +[[package]] +name = "windows-sys" +version = "0.61.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6f109e41dd4a3c848907eb83d5a42ea98b3769495597450cf6d153507b166f0f" +dependencies = [ + "windows-link", +] + [[package]] name = "windows-targets" version = "0.48.5" @@ -4136,18 +4098,6 @@ version = "0.46.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f17a85883d4e6d00e8a97c586de764dabcc06133f7f1d55dce5cdc070ad7fe59" -[[package]] -name = "wkb" -version = "0.8.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b1e2c084338d6407d24c5a43208aca32128a5d62107eab5ca18314395c4aa3f0" -dependencies = [ - "byteorder", - "geo-traits", - "num_enum", - "thiserror 1.0.69", -] - [[package]] name = "writeable" version = "0.6.1" @@ -4268,3 +4218,35 @@ dependencies = [ "quote", "syn", ] + +[[package]] +name = "zip" +version = "3.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "12598812502ed0105f607f941c386f43d441e00148fce9dec3ca5ffb0bde9308" +dependencies = [ + "arbitrary", + "crc32fast", + "flate2", + "indexmap 2.11.4", + "memchr", + "zopfli", +] + +[[package]] +name = "zlib-rs" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2f06ae92f42f5e5c42443fd094f245eb656abf56dd7cce9b8b263236565e00f2" + +[[package]] +name = "zopfli" +version = "0.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f05cd8797d63865425ff89b5c4a48804f35ba0ce8d125800027ad6017d2b5249" +dependencies = [ + "bumpalo", + "crc32fast", + "log", + "simd-adler32", +] diff --git a/backend/Cargo.toml b/backend/Cargo.toml index 4ea7698..2c0f125 100644 --- a/backend/Cargo.toml +++ b/backend/Cargo.toml @@ -55,17 +55,17 @@ axum-extra = { version = "0.10.1" } clap = { version = "4.5", features = ["derive"] } clap_derive = "4.5" config = "0.15" -ogcapi = { version = "0.3.1", features = [ +geoengine-openapi-client = { git = "https://github.com/geo-engine/openapi-client", branch = "rust" } +ogcapi = { git = "https://github.com/georust/ogcapi", branch = "changes-along-the-way", features = [ "services", "common", "processes", - "greeter", "types", ] } -schemars = "1.0" +schemars = "1.1" serde = { version = "1.0", features = ["derive", "rc"] } serde_json = "1.0" -tokio = { version = "1.47", features = ["full"] } +tokio = { version = "1.48", features = ["full"] } tracing = "0.1.41" tracing-subscriber = { version = "0.3.19", features = ["env-filter"] } url = "2.4" diff --git a/backend/clippy.toml b/backend/clippy.toml new file mode 100644 index 0000000..7e21e11 --- /dev/null +++ b/backend/clippy.toml @@ -0,0 +1,7 @@ +avoid-breaking-exported-api = false + +# Adding "OpenAPI" is necessary because the word is used in a doc string in geoengine_services::api. +doc-valid-idents = ["OpenAPI", "PostgreSQL", ".."] + +# It is okay to being able to easily write tests. +allow-unwrap-in-tests = true diff --git a/backend/conf/default.toml b/backend/conf/default.toml index 81cee5e..3b405d0 100644 --- a/backend/conf/default.toml +++ b/backend/conf/default.toml @@ -6,7 +6,7 @@ port = 4040 [database] host = "localhost" port = 5432 -database = "geoengine" +database = "biois" schema = "geoengine" user = "geoengine" password = "geoengine" @@ -14,3 +14,6 @@ password = "geoengine" # If this parameter is set to `false` at the first start, subsequent changes to `true` will result in an error. # This helps to protect production environments from unwanted data loss. clear_database_on_start = false + +[geoengine] +base_url = "http://localhost:3030/api" diff --git a/backend/examples/query-geo-engine.rs b/backend/examples/query-geo-engine.rs new file mode 100644 index 0000000..5838d2e --- /dev/null +++ b/backend/examples/query-geo-engine.rs @@ -0,0 +1,72 @@ +#![allow(clippy::unwrap_used, clippy::print_stderr)] // ok for example + +use geoengine_openapi_client::{ + apis::{ + configuration::Configuration, general_api::server_info_handler, + ogcwfs_api::wfs_feature_handler, session_api::anonymous_handler, + workflows_api::register_workflow_handler, + }, + models::{ + Coordinate2D, GetFeatureRequest, SpatialPartition2D, TypedOperatorOperator, WfsService, + Workflow, workflow::Type, + }, +}; + +#[tokio::main] +async fn main() { + let mut configuration = Configuration::new(); + configuration.base_path = "http://localhost:3030/api".into(); + let server_info = server_info_handler(&configuration).await.unwrap(); + eprintln!("{server_info:?}"); + + let session = anonymous_handler(&configuration).await.unwrap(); + eprintln!("{session:#?}"); + configuration.bearer_access_token = Some(session.id.to_string()); + + let workflow = Workflow { + operator: Box::new(TypedOperatorOperator { + params: Some(serde_json::json!({ + "data": "ne_10m_ports" + })), + sources: None, + r#type: "OgrSource".into(), + }), + r#type: Type::Vector, + }; + + let workflow_id = register_workflow_handler(&configuration, workflow) + .await + .unwrap(); + + eprintln!("{workflow_id:?}"); + + let workflow_id = workflow_id.id.to_string(); + + let bbox_germany = SpatialPartition2D::new( + Coordinate2D::new(15.016_995_883_9, 47.302_487_697_9), + Coordinate2D::new(5.988_658_074_58, 54.983_104_153), + ); + + let feature_collection = wfs_feature_handler( + &configuration, + &workflow_id, + WfsService::Wfs, + GetFeatureRequest::GetFeature, + &workflow_id, + &bbox_germany.to_string(), + None, + None, + Some("EPSG:4326"), + None, + None, + None, + None, + None, + None, + None, + ) + .await + .unwrap(); + + eprintln!("{feature_collection:#?}"); +} diff --git a/backend/src/config.rs b/backend/src/config.rs index e0e6a77..b118b93 100644 --- a/backend/src/config.rs +++ b/backend/src/config.rs @@ -8,6 +8,7 @@ pub static CONFIG: LazyLock = LazyLock::new(|| get_config().expect("conf pub struct Config { pub server: Server, pub database: Database, + pub geoengine: GeoEngineInstance, } #[derive(serde::Deserialize, Clone, Debug)] @@ -38,6 +39,11 @@ impl Database { } } +#[derive(serde::Deserialize, Clone, Debug)] +pub struct GeoEngineInstance { + pub base_url: Url, +} + fn get_config() -> anyhow::Result { let mut builder = config::Config::builder(); diff --git a/backend/src/main.rs b/backend/src/main.rs index 0e7ddef..d30dca3 100644 --- a/backend/src/main.rs +++ b/backend/src/main.rs @@ -1,13 +1,10 @@ use axum::routing::get; use config::CONFIG; use ogcapi::{processes as ogcapi_processes, services as ogcapi_services}; -use processes::HelloProcess; use tracing::level_filters::LevelFilter; use tracing_subscriber::{EnvFilter, layer::SubscriberExt, util::SubscriberInitExt}; use utoipa_axum::router::OpenApiRouter; -use crate::processes::Echo; - mod config; mod processes; @@ -34,9 +31,10 @@ async fn main() -> anyhow::Result<()> { // Register processes/processors let ogcapi_state = ogcapi_state.processors(vec![ - Box::new(ogcapi_processes::greeter::Greeter), - Box::new(HelloProcess), - Box::new(Echo), + Box::new(ogcapi_processes::echo::Echo), + Box::new(processes::NDVIProcess), + // Box::new(HelloProcess), + // Box::new(Echo), // Box::new(GeoJsonLoader), // Box::new(GdalLoader), ]); diff --git a/backend/src/processes/echo.rs b/backend/src/processes/echo.rs deleted file mode 100644 index b1accee..0000000 --- a/backend/src/processes/echo.rs +++ /dev/null @@ -1,143 +0,0 @@ -use anyhow::Result; -use ogcapi::{ - processes::{ProcessResponseBody, Processor}, - types::processes::{Execute, Process}, -}; -use schemars::{JsonSchema, schema_for}; -use serde::{Deserialize, Serialize}; - -#[derive(Clone)] -pub struct Echo; - -#[derive(Deserialize, Debug, JsonSchema)] -pub struct EchoInputs { - pub string_input: Option, - pub measure_input: Option, - pub date_input: Option, - pub double_input: Option, - pub array_input: Option>, - pub complex_object_input: Option, - pub geometry_input: Option>, - pub bounding_box_input: Option, - pub images_input: Option>, - pub feature_collection_input: Option, -} - -#[derive(Clone, Deserialize, Serialize, Debug, JsonSchema)] -pub struct MeasureInput { - pub measurement: f64, - pub uom: String, - pub reference: Option, -} - -#[derive(Clone, Deserialize, Serialize, Debug, JsonSchema)] -pub struct ComplexObjectInput { - pub property1: String, - pub property2: Option, - pub property3: Option, - pub property4: Option, - pub property5: bool, -} - -#[derive(Clone, Deserialize, Serialize, Debug, JsonSchema)] -pub struct BoundingBoxInput { - pub bbox: Vec, -} - -// impl EchoInputs { -// pub fn execute_input(&self) -> HashMap { -// HashMap::from([( -// "name".to_string(), -// Input::InlineOrRefData(InlineOrRefData::InputValueNoObject( -// InputValueNoObject::String(self.name.to_owned()), -// )), -// )]) -// } -// } - -#[derive(Clone, Debug, JsonSchema, Serialize)] -pub struct EchoOutputs { - pub string_input: Option, - pub measure_input: Option, - pub date_input: Option, - pub double_input: Option, - pub array_input: Option>, - pub complex_object_input: Option, - pub geometry_input: Option>, - pub bounding_box_input: Option, - pub images_input: Option>, - pub feature_collection_input: Option, -} - -// impl EchoOutputs { -// pub fn execute_output() -> HashMap { -// HashMap::from([( -// "greeting".to_string(), -// Output { -// format: Some(Format { -// media_type: Some("text/plain".to_string()), -// encoding: Some("utf8".to_string()), -// schema: None, -// }), -// transmission_mode: TransmissionMode::Value, -// }, -// )]) -// } -// } - -// impl TryFrom for EchoOutputs { -// type Error = Exception; - -// fn try_from(value: ProcessResponseBody) -> Result { -// if let ProcessResponseBody::Requested(buf) = value { -// Ok(EchoOutputs { -// greeting: String::from_utf8(buf).unwrap(), -// }) -// } else { -// Err(Exception::new("500")) -// } -// } -// } - -#[async_trait::async_trait] -impl Processor for Echo { - fn id(&self) -> &'static str { - "echo" - } - - fn version(&self) -> &'static str { - "1.0.0" - } - - fn process(&self) -> Result { - Process::try_new( - self.id(), - self.version(), - &schema_for!(EchoInputs), - &schema_for!(EchoOutputs), - ) - .map_err(Into::into) - } - - async fn execute(&self, execute: Execute) -> Result { - let value = serde_json::to_value(execute.inputs).unwrap(); - let inputs: EchoInputs = serde_json::from_value(value).unwrap(); - - let outputs = EchoOutputs { - string_input: inputs.string_input, - measure_input: inputs.measure_input, - date_input: inputs.date_input, - double_input: inputs.double_input, - array_input: inputs.array_input, - complex_object_input: inputs.complex_object_input, - geometry_input: inputs.geometry_input, - bounding_box_input: inputs.bounding_box_input, - images_input: inputs.images_input, - feature_collection_input: inputs.feature_collection_input, - }; - - let response = serde_json::to_vec(&outputs)?; - - Ok(ProcessResponseBody::Requested(response)) - } -} diff --git a/backend/src/processes/hello.rs b/backend/src/processes/hello.rs deleted file mode 100644 index 911f6b3..0000000 --- a/backend/src/processes/hello.rs +++ /dev/null @@ -1,52 +0,0 @@ -use anyhow::Result; -use ogcapi::{ - processes::{ProcessResponseBody, Processor}, - types::processes::{Execute, Process}, -}; -use schemars::{JsonSchema, schema_for}; -use serde::{Deserialize, Serialize}; - -#[derive(Clone)] -pub struct HelloProcess; - -#[derive(Deserialize, Debug, JsonSchema)] -pub struct HelloInputs { - pub name: String, -} - -#[derive(Serialize, Clone, Debug, JsonSchema)] -pub struct HelloOutputs { - pub sentence: String, -} - -#[async_trait::async_trait] -impl Processor for HelloProcess { - fn id(&self) -> &'static str { - "hello" - } - - fn version(&self) -> &'static str { - "0.1.0" - } - - fn process(&self) -> Result { - Process::try_new( - self.id(), - self.version(), - &schema_for!(HelloInputs), - &schema_for!(HelloOutputs), - ) - .map_err(Into::into) - } - - async fn execute(&self, execute: Execute) -> Result { - let value = serde_json::to_value(execute.inputs)?; - let inputs: HelloInputs = serde_json::from_value(value)?; - let output = HelloOutputs { - sentence: format!("Hello, {}!", inputs.name), - }; - Ok(ProcessResponseBody::Requested(serde_json::to_vec_pretty( - &output, - )?)) - } -} diff --git a/backend/src/processes/mod.rs b/backend/src/processes/mod.rs index 6053c63..2eab34a 100644 --- a/backend/src/processes/mod.rs +++ b/backend/src/processes/mod.rs @@ -1,5 +1,7 @@ -mod echo; -mod hello; +// mod echo; +// mod hello; +mod ndvi; -pub use echo::Echo; -pub use hello::HelloProcess; +// pub use echo::Echo; +// pub use hello::HelloProcess; +pub use ndvi::NDVIProcess; diff --git a/backend/src/processes/ndvi.rs b/backend/src/processes/ndvi.rs new file mode 100644 index 0000000..9beee4b --- /dev/null +++ b/backend/src/processes/ndvi.rs @@ -0,0 +1,545 @@ +use anyhow::{Context, Result}; +use geoengine_openapi_client::{ + apis::{ + configuration::Configuration, ogcwfs_api::wfs_feature_handler, + session_api::anonymous_handler, uploads_api::upload_handler, + workflows_api::register_workflow_handler, + }, + models::{ + GeoJson, GetFeatureRequest, SpatialPartition2D, TypedOperatorOperator, WfsService, + Workflow, workflow::Type as WorkflowType, + }, +}; +use ogcapi::{ + processes::Processor, + types::{ + common::Link, + processes::{ + Execute, ExecuteResult, ExecuteResults, InlineOrRefData, InputValueNoObject, + JobControlOptions, Output, Process, ProcessSummary, TransmissionMode, + description::{DescriptionType, InputDescription, Metadata, OutputDescription}, + }, + }, +}; +use schemars::{JsonSchema, generate::SchemaSettings}; +use serde::{Deserialize, Serialize}; +use std::collections::HashMap; + +use crate::config::CONFIG; + +/// Calculates the Normalized Difference Vegetation Index (NDVI) and the corrected NDVI (kNDVI) from satellite imagery. +#[derive(Debug, Clone)] +pub struct NDVIProcess; + +#[derive(Deserialize, Serialize, Debug, JsonSchema)] +struct NDVIProcessInputs { + pub coordinate: PointGeoJsonInput, + pub year: Year, + pub month: Month, +} + +type Coordinate = [f64; 2]; + +trait ToBbox { + fn to_bbox(&self, buffer: f64) -> SpatialPartition2D; +} + +impl ToBbox for Coordinate { + fn to_bbox(&self, buffer: f64) -> SpatialPartition2D { + use geoengine_openapi_client::models::Coordinate2D; + + let [x, y] = *self; + SpatialPartition2D::new( + Coordinate2D::new(x + buffer, y - buffer), + Coordinate2D::new(x - buffer, y + buffer), + ) + } +} + +#[derive(Deserialize, Serialize, Debug, JsonSchema)] +#[serde(rename_all = "camelCase")] +struct PointGeoJsonInput { + pub value: PointGeoJson, + pub media_type: PointGeoJsonInputMediaType, +} + +#[derive(Deserialize, Serialize, Debug, JsonSchema)] +#[serde(rename_all = "camelCase")] +enum PointGeoJsonInputMediaType { + #[serde(rename = "application/geo+json")] + GeoJson, +} + +#[derive(Deserialize, Serialize, Debug, JsonSchema)] +#[serde(rename_all = "camelCase")] +struct PointGeoJson { + pub r#type: PointGeoJsonType, + pub coordinates: Coordinate, +} + +#[derive(Deserialize, Serialize, Debug, JsonSchema)] +enum PointGeoJsonType { + Point, +} + +#[derive(Deserialize, Serialize, Debug, JsonSchema, Copy, Clone)] +struct Year(#[schemars(range(min = 2014, max = 2014))] u16); + +#[derive(Deserialize, Serialize, Debug, JsonSchema, Copy, Clone)] +struct Month(#[schemars(range(min = 1, max = 6))] u8); + +#[derive(Deserialize, Serialize, Debug, JsonSchema)] +struct NDVIProcessOutputs { + ndvi: Option, + k_ndvi: Option, +} + +impl From for ExecuteResults { + fn from(outputs: NDVIProcessOutputs) -> Self { + let mut result = ExecuteResults::default(); + if let Some(ndvi) = outputs.ndvi { + result.insert( + "ndvi".to_string(), + ExecuteResult { + output: Output { + format: None, + transmission_mode: Default::default(), + }, + data: InlineOrRefData::InputValueNoObject(InputValueNoObject::Number(ndvi)), + }, + ); + } + if let Some(k_ndvi) = outputs.k_ndvi { + result.insert( + "k_ndvi".to_string(), + ExecuteResult { + output: Output { + format: None, + transmission_mode: Default::default(), + }, + data: InlineOrRefData::InputValueNoObject(InputValueNoObject::Number(k_ndvi)), + }, + ); + } + result + } +} + +#[async_trait::async_trait] +impl Processor for NDVIProcess { + fn id(&self) -> &'static str { + "ndvi" + } + + fn version(&self) -> &'static str { + "0.1.0" + } + + fn process(&self) -> Result { + let mut settings = SchemaSettings::default(); + settings.meta_schema = None; + + let mut generator = settings.into_generator(); + Ok(Process { + summary: ProcessSummary { + id: self.id().into(), + version: self.version().into(), + job_control_options: vec![ + JobControlOptions::SyncExecute, + JobControlOptions::AsyncExecute, + // TODO: implement "dismiss extension" + // JobControlOptions::Dismiss, + ], + output_transmission: vec![TransmissionMode::Value], + links: vec![ + Link::new( + // TODO: ./ … does not work for some clients + format!("./{}/execution", self.id()), + "http://www.opengis.net/def/rel/ogc/1.0/execute", + ) + .title("Execution endpoint"), + ], + }, + inputs: HashMap::from([( + "coordinate".to_string(), + InputDescription { + description_type: DescriptionType { + title: Some("Coordinate in WGS84".to_string()), + description: Some( + "This is a POINT input in WGS84 (EPSG:4326) format.".to_string(), + ), + ..Default::default() + }, + schema: generator.root_schema_for::().to_value(), + ..Default::default() + }, + ), + ("year".to_string(), + InputDescription { + description_type: DescriptionType { + title: Some("Year of observation".to_string()), + description: Some( + "The year for which the NDVI/kNDVI should be calculated.".to_string(), + ), + ..Default::default() + }, + schema: generator.root_schema_for::().to_value(), + ..Default::default() + }, + ), + ("month".to_string(), + InputDescription { + description_type: DescriptionType { + title: Some("Month of observation".to_string()), + description: Some( + "The month (1-12) for which the NDVI/kNDVI should be calculated.".to_string(), + ), + ..Default::default() + }, + schema: generator.root_schema_for::().to_value(), + ..Default::default() + }, + ) + ]), + outputs: HashMap::from([ + ( + "ndvi".to_string(), + OutputDescription { + description_type: DescriptionType { + title: Some( + "Normalized Difference Vegetation Index (NDVI)".to_string(), + ), + description: Some( + "This is the normalized difference vegetation index (NDVI) value. \ + The NDVI is calculated using the formula: (NIR - Red) / (NIR + Red), where NIR is the near-infrared band value and Red is the red band value. \ + The NDVI value ranges from -1 to 1, where higher values indicate healthier vegetation. \ + Values close to -1 represent water bodies, values around 0 indicate barren areas, and values close to 1 signify dense vegetation. \ + The NDVI is calculated based on a static MODIS satellite image from 2014." // TODO: Sentinel-2 + .into(), + ), + metadata: vec![Metadata { + role: Some("citation".to_string()), + title: Some( + "Wikipedia, Normalized Difference Vegetation Index. Accessed on November 13th 2025." + .into() + ), + href: Some("https://en.wikipedia.org/wiki/Normalized_difference_vegetation_index".to_string()), + }], + ..Default::default() + }, + schema: generator.root_schema_for::().to_value(), + }, + ), + ( + "k_ndvi".to_string(), + OutputDescription { + description_type: DescriptionType { + title: Some( + "Kernel Normalized Difference Vegetation Index (kNDVI)".to_string(), + ), + description: Some( + "This is the kernel normalized difference vegetation index (kNDVI) value. \ + The kNDVI is calculated using the formula: (NIR - Red) / (NIR + Red), where NIR is the near-infrared band value and Red is the red band value. \ + The kNDVI value ranges from -1 to 1, where higher values indicate healthier vegetation. \ + Values close to -1 represent water bodies, values around 0 indicate barren areas, and values close to 1 signify dense vegetation. \ + The kNDVI is calculated based on a static MODIS satellite image from 2014." // TODO: Sentinel-2 + .into(), + ), + metadata: vec![Metadata { + role: Some("citation".to_string()), + title: Some( + "Gustau Camps-Valls et al., \ + A unified vegetation index for quantifying the terrestrial biosphere. \ + Sci. Adv.7,eabc7447(2021). DOI:10.1126/sciadv.abc7447" + .into() + ), + href: Some("https://doi.org/10.1126/sciadv.abc7447".to_string()), + }], + ..Default::default() + }, + schema: generator.root_schema_for::().to_value(), + }, + ), + ]), + }) + } + + async fn execute(&self, execute: Execute) -> Result { + let value = serde_json::to_value(execute.inputs)?; + let inputs: NDVIProcessInputs = serde_json::from_value(value)?; + + validate_date(inputs.year, inputs.month)?; + + let mut should_compute_ndvi = execute.outputs.is_empty(); + let mut should_compute_k_ndvi = execute.outputs.is_empty(); + for output_key in execute.outputs.keys() { + match output_key.as_str() { + "ndvi" => should_compute_ndvi = true, + "k_ndvi" => should_compute_k_ndvi = true, + other => anyhow::bail!("Unknown output requested: {other}"), + } + } + + compute_ndvi( + &inputs.coordinate.value.coordinates, + inputs.year, + inputs.month, + should_compute_ndvi, + should_compute_k_ndvi, + ) + .await + .map(Into::into) + } +} + +fn validate_date(Year(year): Year, Month(month): Month) -> Result<()> { + if year != 2014 { + anyhow::bail!("Year must be 2014"); + } + if !(1..=6).contains(&month) { + anyhow::bail!("Month must be between 1 and 6"); + } + Ok(()) +} + +async fn compute_ndvi( + coordinate: &Coordinate, + Year(year): Year, + Month(month): Month, + should_compute_ndvi: bool, + should_compute_k_ndvi: bool, +) -> Result { + const NDVI: &str = "NDVI"; + const K_NDVI: &str = "kNDVI"; + + let configuration = configuration().await?; + + // TODO: upload data instead of mocking it + // let upload_data_id: String = upload_data(&configuration, coordinate)?; + let vector_source = serde_json::json!({ + "type": "MockPointSource", + "params": { + "points": [coordinate] + } + }); + + let (names, inputs): (Vec<&str>, Vec) = + match (should_compute_ndvi, should_compute_k_ndvi) { + (true, true) => (vec![NDVI, K_NDVI], vec![ndvi_source(), k_ndvi_source()]), + (true, false) => (vec![NDVI], vec![ndvi_source()]), + (false, true) => (vec![K_NDVI], vec![k_ndvi_source()]), + (false, false) => { + return Ok(NDVIProcessOutputs { + ndvi: None, + k_ndvi: None, + }); + } + }; + let workflow = Workflow { + operator: Box::new(TypedOperatorOperator { + params: Some(serde_json::json!({ + "names": { + "type": "names", + "values": names, + }, + "featureAggregation": "first", + "temporalAggregation": "none", + "featureAggregationIgnoreNoData": true, + "temporalAggregationIgnoreNoData": true + })), + sources: Some(serde_json::json!({ + // "vector": { + // "type": "OgrSource", + // "params": { + // "data": upload_data_id + // } + // }, + "vector": vector_source, + "rasters": [{ + "type": "RasterStacker", + "params": { + "renameBands": { + "type": "rename", + "values": names + } + }, + "sources": { + "rasters": inputs + } + }] + })), + r#type: "RasterVectorJoin".into(), + }), + r#type: WorkflowType::Vector, + }; + + // eprintln!("{}", serde_json::to_string_pretty(&workflow).unwrap()); + + let workflow_id = register_workflow_handler(&configuration, workflow).await?; + let workflow_id = workflow_id.id.to_string(); + + // eprintln!("Registered workflow with ID: {workflow_id}"); + + let time_str = format!("{year}-{month:02}-01T00:00:00Z"); + + // eprintln!("Querying at time: {time_str}"); + + tracing::info!( + coordinate = ?coordinate, + time = time_str, + workflow_id = workflow_id, + "Requesting NDVI process" + ); + + let feature_collection = wfs_feature_handler( + &configuration, + &workflow_id, + WfsService::Wfs, + GetFeatureRequest::GetFeature, + &workflow_id, + &coordinate.to_bbox(0.0).to_string(), + None, + Some(&time_str), + Some("EPSG:4326"), + None, + None, + None, + None, + None, + None, + Some("0.1"), // TODO: adjust to source + ) + .await?; + + // dbg!(&feature_collection); + + outputs_from_feature_collection(&feature_collection, NDVI, K_NDVI) +} + +#[allow(unused)] // TODO: implement +async fn upload_data(configuration: &Configuration, coordinate: &Coordinate) -> Result { + upload_handler(configuration, vec![]).await?; + + anyhow::bail!("Not implemented: upload_data"); +} + +fn outputs_from_feature_collection( + feature_collection: &GeoJson, + ndvi_ref: &str, + k_ndvi_ref: &str, +) -> Result { + let mut result = NDVIProcessOutputs { + ndvi: None, + k_ndvi: None, + }; + + let first_feature = feature_collection + .features + .first() + .context("Feature collection is empty")?; + + let properties = first_feature + .get("properties") + .context("Feature has no properties")?; + + if let Some(features) = properties.get(ndvi_ref) + && let Some(value) = features.as_f64() + { + result.ndvi = Some(value); + } + + if let Some(features) = properties.get(k_ndvi_ref) + && let Some(value) = features.as_f64() + { + result.k_ndvi = Some(value); + } + + Ok(result) +} + +fn ndvi_source() -> serde_json::Value { + serde_json::json!({ + "type": "Expression", + "params": { + "expression": "min((A / (127.50)) - 1, 1)", + "outputType": "F64", + "outputBand": { + "name": "kNDVI", + "measurement": { + "type": "unitless" + } + }, + "mapNoData": false + }, + "sources": { + "raster": ndvi_u8_source() + } + }) +} + +fn ndvi_u8_source() -> serde_json::Value { + serde_json::json!( { + "type": "GdalSource", + "params": { + "data": "ndvi" + } + }) +} + +fn k_ndvi_source() -> serde_json::Value { + serde_json::json!({ + "type": "Expression", + "params": { + "expression": "let ndvi = min((A / (127.50)) - 1, 1);\ + tanh(pow(ndvi, 2))", + "outputType": "F64", + "outputBand": { + "name": "kNDVI", + "measurement": { + "type": "unitless" + } + }, + "mapNoData": false + }, + "sources": { + "raster": ndvi_u8_source() + } + }) +} + +async fn configuration() -> Result { + let mut configuration = Configuration::new(); + configuration.base_path = CONFIG.geoengine.base_url.to_string(); + + let session = anonymous_handler(&configuration).await?; + configuration.bearer_access_token = Some(session.id.to_string()); + + Ok(configuration) +} + +#[cfg(test)] +mod tests { + use super::*; + use ogcapi::types::processes::Input; + + #[test] + fn it_deserializes_the_input() { + let json = serde_json::json!({ + "coordinate": { + "value": { + "type": "Point", + "coordinates": [12.34, 56.78] + }, + "mediaType": "application/geo+json" + }, + "year": 2024, + "month": 3 + }); + + let inputs: HashMap = serde_json::from_value(json).unwrap(); + + let json = serde_json::to_value(&inputs).unwrap(); + + let _inputs: NDVIProcessInputs = serde_json::from_value(json).unwrap(); + } +} diff --git a/rust-toolchain.toml b/rust-toolchain.toml index 970d460..159e501 100644 --- a/rust-toolchain.toml +++ b/rust-toolchain.toml @@ -1,3 +1,3 @@ [toolchain] -channel = "1.90.0" +channel = "1.91.0" components = ["cargo", "rustfmt", "rust-src", "clippy", "llvm-tools"] diff --git a/test-client/call-process.ipynb b/test-client/call-process.ipynb index 9861289..87bd06c 100644 --- a/test-client/call-process.ipynb +++ b/test-client/call-process.ipynb @@ -2,28 +2,42 @@ "cells": [ { "cell_type": "code", - "execution_count": 12, + "execution_count": 55, "id": "d941b7e8", "metadata": {}, "outputs": [], "source": [ "from owslib.ogcapi.processes import Processes\n", - "import numpy as np" + "import json\n", + "from pygments import highlight, lexers, formatters\n", + "import requests" ] }, { "cell_type": "code", - "execution_count": null, + "execution_count": 42, + "id": "4b9feaee", + "metadata": {}, + "outputs": [], + "source": [ + "def pprint_json(json_dict: dict) -> None:\n", + " formatted_json = json.dumps(json_dict, sort_keys=True, indent=4)\n", + " print(highlight(formatted_json, lexers.JsonLexer(), formatters.TerminalFormatter()))\n" + ] + }, + { + "cell_type": "code", + "execution_count": 3, "id": "461507b5", "metadata": {}, "outputs": [], "source": [ - "# SERVICE_URL = \"http://localhost:4040/\"\n" + "SERVICE_URL = \"http://localhost:4040/\"\n" ] }, { "cell_type": "code", - "execution_count": 24, + "execution_count": null, "id": "37d5d37a", "metadata": {}, "outputs": [ @@ -31,332 +45,596 @@ "name": "stdout", "output_type": "stream", "text": [ - "[{'id': 'greet',\n", - " 'version': '0.1.0',\n", - " 'outputTransmission': 'value',\n", - " 'links': [{'href': 'http://localhost:8484/processes/greet',\n", - " 'rel': 'self',\n", - " 'type': 'application/json',\n", - " 'title': 'process description'}]},\n", - " {'id': 'geojson-loader',\n", - " 'version': '0.1.0',\n", - " 'outputTransmission': 'value',\n", - " 'links': [{'href': 'http://localhost:8484/processes/geojson-loader',\n", - " 'rel': 'self',\n", - " 'type': 'application/json',\n", - " 'title': 'process description'}]},\n", - " {'id': 'gdal-loader',\n", - " 'version': '0.1.0',\n", - " 'outputTransmission': 'value',\n", - " 'links': [{'href': 'http://localhost:8484/processes/gdal-loader',\n", - " 'rel': 'self',\n", - " 'type': 'application/json',\n", - " 'title': 'process description'}]},\n", - " {'id': 'echo',\n", - " 'version': '1.0.0',\n", - " 'outputTransmission': 'value',\n", - " 'links': [{'href': 'http://localhost:8484/processes/echo',\n", - " 'rel': 'self',\n", - " 'type': 'application/json',\n", - " 'title': 'process description'}]}]\n", - "{'id': 'greet',\n", - " 'version': '0.1.0',\n", - " 'outputTransmission': 'value',\n", - " 'links': [{'href': 'http://localhost:8484/processes/greet',\n", - " 'rel': 'self',\n", - " 'type': 'application/json'}],\n", - " 'inputs': {'minOccurs': 1,\n", - " 'maxOccurs': 1,\n", - " 'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", - " 'description': 'Inputs for the `greet` process',\n", - " 'properties': {'name': {'description': 'Name to be '\n", - " 'greeted',\n", - " 'type': 'string'}},\n", - " 'required': ['name'],\n", - " 'title': 'GreeterInputs',\n", - " 'type': 'object'}},\n", - " 'outputs': {'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", - " 'description': 'Outputs for the `greet` process',\n", - " 'properties': {'greeting': {'type': 'string'}},\n", - " 'required': ['greeting'],\n", - " 'title': 'GreeterOutputs',\n", - " 'type': 'object'}}}\n" + "[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"id\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobControlOptions\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"sync-execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"async-execute\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/processes/ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"self\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"process description\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputTransmission\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"value\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"version\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"0.1.0\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"id\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"echo\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobControlOptions\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"sync-execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"async-execute\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/processes/echo\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"self\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"process description\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputTransmission\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"value\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"version\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"1.0.0\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "]\u001b[37m\u001b[39;49;00m\n", + "\n" ] - }, - { - "data": { - "text/plain": [ - "{'greeting': 'Hello, World!\\n'}" - ] - }, - "execution_count": 24, - "metadata": {}, - "output_type": "execute_result" } ], "source": [ - "from owslib.ogcapi.processes import Processes\n", - "import pprint\n", - "\n", - "SERVICE_URL = \"http://localhost:8484/\"\n", - "\n", "p = Processes(SERVICE_URL)\n", "\n", - "pprint.pp(p.processes())\n", - "\n", - "greeter = p.process('greet')\n", - "pprint.pp(greeter)\n", - "\n", - "p.execute('greet', inputs={'name': 'World'})" + "pprint_json(p.processes())" ] }, { "cell_type": "code", - "execution_count": 27, - "id": "ab293305", + "execution_count": 47, + "id": "6c5e2d13", "metadata": {}, "outputs": [ { - "data": { - "text/plain": [ - "{'greeting': 'Hello, World!\\n'}" - ] - }, - "execution_count": 27, - "metadata": {}, - "output_type": "execute_result" + "name": "stdout", + "output_type": "stream", + "text": [ + "{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"id\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"echo\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"inputs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"doubleInput\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"This is an example of a DOUBLE literal input.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Double Literal Input Example\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"pause\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Optional pause duration in seconds before responding.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"uint64\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minimum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m0\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"uint64\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"integer\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Pause Duration\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"stringInput\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"This is an example of a STRING literal input.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"StringInput\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"String Literal Input Example\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobControlOptions\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"sync-execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"async-execute\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/processes/echo\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"self\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"./echo/execution\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://www.opengis.net/def/rel/ogc/1.0/execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Execution endpoint\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputTransmission\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"value\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"stringOutput\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"StringInput\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"version\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"1.0.0\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "}\u001b[37m\u001b[39;49;00m\n", + "\n", + "---\n", + "\n", + "{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"stringOutput\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"foo\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "}\u001b[37m\u001b[39;49;00m\n", + "\n" + ] } ], "source": [ - "p.execute('greet', inputs={'name': 'World'}, async_=True)" + "pprint_json(p.process('echo'))\n", + "\n", + "print(\"---\\n\")\n", + "\n", + "pprint_json(p.execute('echo', inputs={'stringInput': 'foo'}))" ] }, { "cell_type": "code", - "execution_count": 28, - "id": "73ac3dbd", + "execution_count": 48, + "id": "28fe4c46", "metadata": {}, "outputs": [ { - "data": { - "text/plain": [ - "{'jobs': [],\n", - " 'links': [{'href': 'http://localhost:8484/jobs',\n", - " 'rel': 'self',\n", - " 'type': 'application/json'}]}" - ] - }, - "execution_count": 28, - "metadata": {}, - "output_type": "execute_result" + "name": "stdout", + "output_type": "stream", + "text": [ + "{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"id\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"inputs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"coordinate\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"This is a POINT input in WGS84 (EPSG:4326) format.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$defs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJson\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"properties\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"coordinates\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"items\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"maxItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"array\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$ref\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"#/$defs/PointGeoJsonType\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"required\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"type\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"coordinates\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"object\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonInputMediaType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"application/geo+json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"Point\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"properties\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"mediaType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$ref\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"#/$defs/PointGeoJsonInputMediaType\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"value\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$ref\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"#/$defs/PointGeoJson\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"required\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"value\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"mediaType\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"PointGeoJsonInput\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"object\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Coordinate in WGS84\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"month\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"The month (1-12) for which the NDVI/kNDVI should be calculated.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$defs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJson\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"properties\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"coordinates\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"items\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"maxItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"array\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$ref\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"#/$defs/PointGeoJsonType\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"required\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"type\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"coordinates\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"object\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonInputMediaType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"application/geo+json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"Point\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"uint8\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"maximum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m6\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minimum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m1\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Month\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"integer\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Month of observation\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"year\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"The year for which the NDVI/kNDVI should be calculated.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$defs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJson\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"properties\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"coordinates\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"items\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"maxItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"array\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$ref\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"#/$defs/PointGeoJsonType\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"required\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"type\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"coordinates\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"object\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonInputMediaType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"application/geo+json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"Point\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"uint16\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"maximum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2014\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minimum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2014\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Year\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"integer\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Year of observation\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobControlOptions\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"sync-execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"async-execute\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/processes/ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"self\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"./ndvi/execution\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://www.opengis.net/def/rel/ogc/1.0/execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Execution endpoint\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputTransmission\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"value\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"k_ndvi\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"This is the kernel normalized difference vegetation index (kNDVI) value. The kNDVI is calculated using the formula: (NIR - Red) / (NIR + Red), where NIR is the near-infrared band value and Red is the red band value. The kNDVI value ranges from -1 to 1, where higher values indicate healthier vegetation. Values close to -1 represent water bodies, values around 0 indicate barren areas, and values close to 1 signify dense vegetation. The kNDVI is calculated based on a static MODIS satellite image from 2014.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"metadata\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"https://doi.org/10.1126/sciadv.abc7447\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"role\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"citation\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Gustau Camps-Valls et al., A unified vegetation index for quantifying the terrestrial biosphere. Sci. Adv.7,eabc7447(2021). DOI:10.1126/sciadv.abc7447\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$defs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJson\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"properties\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"coordinates\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"items\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"maxItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"array\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$ref\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"#/$defs/PointGeoJsonType\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"required\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"type\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"coordinates\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"object\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonInputMediaType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"application/geo+json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"Point\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Kernel Normalized Difference Vegetation Index (kNDVI)\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"ndvi\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"description\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"This is the normalized difference vegetation index (NDVI) value. The NDVI is calculated using the formula: (NIR - Red) / (NIR + Red), where NIR is the near-infrared band value and Red is the red band value. The NDVI value ranges from -1 to 1, where higher values indicate healthier vegetation. Values close to -1 represent water bodies, values around 0 indicate barren areas, and values close to 1 signify dense vegetation. The NDVI is calculated based on a static MODIS satellite image from 2014.\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"metadata\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"https://en.wikipedia.org/wiki/Normalized_difference_vegetation_index\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"role\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"citation\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Wikipedia, Normalized Difference Vegetation Index. Accessed on November 13th 2025.\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"schema\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$defs\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJson\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"properties\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"coordinates\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"items\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"maxItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"minItems\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m2\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"array\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"$ref\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"#/$defs/PointGeoJsonType\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"required\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"type\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"coordinates\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"object\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonInputMediaType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"application/geo+json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"PointGeoJsonType\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"enum\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[33m\"Point\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"string\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"format\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"double\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"number\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Normalized Difference Vegetation Index (NDVI)\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"version\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"0.1.0\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "}\u001b[37m\u001b[39;49;00m\n", + "\n" + ] } ], "source": [ - "import requests\n", - "\n", - "response = requests.get(f\"{SERVICE_URL}/jobs\")\n", - "response.json()" + "pprint_json(p.process('ndvi'))" ] }, { "cell_type": "code", - "execution_count": 5, - "id": "e0f9de40", + "execution_count": 50, + "id": "5f23cd96", "metadata": {}, "outputs": [ { - "ename": "RuntimeError", - "evalue": "Failed to deserialize the JSON body into the target type: response: data did not match any variant of untagged enum Response at line 1 column 53", - "output_type": "error", - "traceback": [ - "\u001b[0;31m---------------------------------------------------------------------------\u001b[0m", - "\u001b[0;31mRuntimeError\u001b[0m Traceback (most recent call last)", - "Cell \u001b[0;32mIn[5], line 1\u001b[0m\n\u001b[0;32m----> 1\u001b[0m result \u001b[38;5;241m=\u001b[39m \u001b[43mp\u001b[49m\u001b[38;5;241;43m.\u001b[39;49m\u001b[43mexecute\u001b[49m\u001b[43m(\u001b[49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mhello\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m,\u001b[49m\u001b[43m \u001b[49m\u001b[43minputs\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[43m{\u001b[49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mname\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m:\u001b[49m\u001b[43m \u001b[49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mWorld\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m}\u001b[49m\u001b[43m)\u001b[49m\n\u001b[1;32m 3\u001b[0m result\n", - "File \u001b[0;32m~/git/geo-engine/BioIS/.venv/lib/python3.10/site-packages/owslib/ogcapi/processes.py:83\u001b[0m, in \u001b[0;36mProcesses.execute\u001b[0;34m(self, process_id, inputs, outputs, response, async_)\u001b[0m\n\u001b[1;32m 79\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mheaders[\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mPrefer\u001b[39m\u001b[38;5;124m'\u001b[39m] \u001b[38;5;241m=\u001b[39m \u001b[38;5;124m'\u001b[39m\u001b[38;5;124mrespond-sync\u001b[39m\u001b[38;5;124m'\u001b[39m\n\u001b[1;32m 81\u001b[0m path \u001b[38;5;241m=\u001b[39m \u001b[38;5;124mf\u001b[39m\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mprocesses/\u001b[39m\u001b[38;5;132;01m{\u001b[39;00mprocess_id\u001b[38;5;132;01m}\u001b[39;00m\u001b[38;5;124m/execution\u001b[39m\u001b[38;5;124m'\u001b[39m\n\u001b[0;32m---> 83\u001b[0m \u001b[38;5;28;01mreturn\u001b[39;00m \u001b[38;5;28;43mself\u001b[39;49m\u001b[38;5;241;43m.\u001b[39;49m\u001b[43m_request\u001b[49m\u001b[43m(\u001b[49m\u001b[43mmethod\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[38;5;124;43mPOST\u001b[39;49m\u001b[38;5;124;43m'\u001b[39;49m\u001b[43m,\u001b[49m\u001b[43m \u001b[49m\u001b[43mpath\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[43mpath\u001b[49m\u001b[43m,\u001b[49m\u001b[43m \u001b[49m\u001b[43mdata\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[43mdata\u001b[49m\u001b[43m)\u001b[49m\n", - "File \u001b[0;32m~/git/geo-engine/BioIS/.venv/lib/python3.10/site-packages/owslib/ogcapi/__init__.py:196\u001b[0m, in \u001b[0;36mAPI._request\u001b[0;34m(self, method, path, data, as_dict, kwargs)\u001b[0m\n\u001b[1;32m 193\u001b[0m LOGGER\u001b[38;5;241m.\u001b[39mdebug(\u001b[38;5;124mf\u001b[39m\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mResponse status code: \u001b[39m\u001b[38;5;132;01m{\u001b[39;00mresponse\u001b[38;5;241m.\u001b[39mstatus_code\u001b[38;5;132;01m}\u001b[39;00m\u001b[38;5;124m'\u001b[39m)\n\u001b[1;32m 195\u001b[0m \u001b[38;5;28;01mif\u001b[39;00m \u001b[38;5;129;01mnot\u001b[39;00m response:\n\u001b[0;32m--> 196\u001b[0m \u001b[38;5;28;01mraise\u001b[39;00m \u001b[38;5;167;01mRuntimeError\u001b[39;00m(response\u001b[38;5;241m.\u001b[39mtext)\n\u001b[1;32m 198\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mrequest \u001b[38;5;241m=\u001b[39m response\u001b[38;5;241m.\u001b[39murl\n\u001b[1;32m 199\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mresponse_headers \u001b[38;5;241m=\u001b[39m response\u001b[38;5;241m.\u001b[39mheaders\n", - "\u001b[0;31mRuntimeError\u001b[0m: Failed to deserialize the JSON body into the target type: response: data did not match any variant of untagged enum Response at line 1 column 53" + "name": "stdout", + "output_type": "stream", + "text": [ + "{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"k_ndvi\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m0.26551630441320606\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"ndvi\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m0.5215686274509803\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "}\u001b[37m\u001b[39;49;00m\n", + "\n" ] } ], "source": [ - "result = p.execute('hello', inputs={'name': 'World'})\n", - "\n", - "result" + "pprint_json(p.execute('ndvi', inputs={\n", + " \"coordinate\": {\n", + " \"value\": {\n", + " \"type\": \"Point\",\n", + " \"coordinates\": [10.77, 49.54]\n", + " },\n", + " \"mediaType\": \"application/geo+json\"\n", + " },\n", + " \"year\": 2014,\n", + " \"month\": 5\n", + "}))" ] }, { "cell_type": "code", - "execution_count": 5, - "id": "94a5c0d9", + "execution_count": 53, + "id": "9ad4d352", "metadata": {}, "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Job status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"processID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"status\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"accepted\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"process\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "}\u001b[37m\u001b[39;49;00m\n", + "\n" + ] + }, { "data": { "text/plain": [ - "{'id': 'greet',\n", - " 'version': '0.1.0',\n", - " 'outputTransmission': 'value',\n", - " 'links': [{'href': 'http://localhost:8484/processes/greet',\n", - " 'rel': 'self',\n", - " 'type': 'application/json'}],\n", - " 'inputs': {'minOccurs': 1,\n", - " 'maxOccurs': 1,\n", - " 'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", - " 'description': 'Inputs for the `greet` process',\n", - " 'properties': {'name': {'description': 'Name to be greeted',\n", - " 'type': 'string'}},\n", - " 'required': ['name'],\n", - " 'title': 'GreeterInputs',\n", - " 'type': 'object'}},\n", - " 'outputs': {'schema': {'$schema': 'https://json-schema.org/draft/2020-12/schema',\n", - " 'description': 'Outputs for the `greet` process',\n", - " 'properties': {'greeting': {'type': 'string'}},\n", - " 'required': ['greeting'],\n", - " 'title': 'GreeterOutputs',\n", - " 'type': 'object'}}}" + "'8a0998d8-02fe-431f-b265-4d7c20bc259e'" ] }, - "execution_count": 5, + "execution_count": 53, "metadata": {}, "output_type": "execute_result" } ], "source": [ - "greeter = p.process('greet')\n", - "greeter" + "job = p.execute(\n", + " 'ndvi',\n", + " inputs={\n", + " \"coordinate\": {\n", + " \"value\": {\n", + " \"type\": \"Point\",\n", + " \"coordinates\": [10.77, 49.54]\n", + " },\n", + " \"mediaType\": \"application/geo+json\"\n", + " },\n", + " \"year\": 2014,\n", + " \"month\": 5\n", + " },\n", + " async_=True,\n", + ")\n", + "pprint_json(job)\n", + "\n", + "job_id = job['jobID']\n", + "job_id" ] }, { "cell_type": "code", - "execution_count": 7, - "id": "62c93957", + "execution_count": 57, + "id": "ab090a48", "metadata": {}, "outputs": [ { - "data": { - "text/plain": [ - "{'id': 'echo',\n", - " 'version': '1.0.0',\n", - " 'outputTransmission': 'value',\n", - " 'links': [{'href': 'http://localhost:8484/processes/echo',\n", - " 'rel': 'self',\n", - " 'type': 'application/json'}],\n", - " 'inputs': {'minOccurs': 1,\n", - " 'maxOccurs': 1,\n", - " 'schema': {'$defs': {'BoundingBoxInput': {'properties': {'bbox': {'items': {'format': 'double',\n", - " 'type': 'number'},\n", - " 'type': 'array'}},\n", - " 'required': ['bbox'],\n", - " 'type': 'object'},\n", - " 'ComplexObjectInput': {'properties': {'property1': {'type': 'string'},\n", - " 'property2': {'type': ['string', 'null']},\n", - " 'property3': {'format': 'double', 'type': ['number', 'null']},\n", - " 'property4': {'type': ['string', 'null']},\n", - " 'property5': {'type': 'boolean'}},\n", - " 'required': ['property1', 'property5'],\n", - " 'type': 'object'},\n", - " 'MeasureInput': {'properties': {'measurement': {'format': 'double',\n", - " 'type': 'number'},\n", - " 'reference': {'type': ['string', 'null']},\n", - " 'uom': {'type': 'string'}},\n", - " 'required': ['measurement', 'uom'],\n", - " 'type': 'object'}},\n", - " '$schema': 'https://json-schema.org/draft/2020-12/schema',\n", - " 'properties': {'array_input': {'items': {'format': 'int32',\n", - " 'type': 'integer'},\n", - " 'type': ['array', 'null']},\n", - " 'bounding_box_input': {'anyOf': [{'$ref': '#/$defs/BoundingBoxInput'},\n", - " {'type': 'null'}]},\n", - " 'complex_object_input': {'anyOf': [{'$ref': '#/$defs/ComplexObjectInput'},\n", - " {'type': 'null'}]},\n", - " 'date_input': {'type': ['string', 'null']},\n", - " 'double_input': {'format': 'double', 'type': ['number', 'null']},\n", - " 'feature_collection_input': {'type': ['string', 'null']},\n", - " 'geometry_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", - " 'images_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", - " 'measure_input': {'anyOf': [{'$ref': '#/$defs/MeasureInput'},\n", - " {'type': 'null'}]},\n", - " 'string_input': {'type': ['string', 'null']}},\n", - " 'title': 'EchoInputs',\n", - " 'type': 'object'}},\n", - " 'outputs': {'schema': {'$defs': {'BoundingBoxInput': {'properties': {'bbox': {'items': {'format': 'double',\n", - " 'type': 'number'},\n", - " 'type': 'array'}},\n", - " 'required': ['bbox'],\n", - " 'type': 'object'},\n", - " 'ComplexObjectInput': {'properties': {'property1': {'type': 'string'},\n", - " 'property2': {'type': ['string', 'null']},\n", - " 'property3': {'format': 'double', 'type': ['number', 'null']},\n", - " 'property4': {'type': ['string', 'null']},\n", - " 'property5': {'type': 'boolean'}},\n", - " 'required': ['property1', 'property5'],\n", - " 'type': 'object'},\n", - " 'MeasureInput': {'properties': {'measurement': {'format': 'double',\n", - " 'type': 'number'},\n", - " 'reference': {'type': ['string', 'null']},\n", - " 'uom': {'type': 'string'}},\n", - " 'required': ['measurement', 'uom'],\n", - " 'type': 'object'}},\n", - " '$schema': 'https://json-schema.org/draft/2020-12/schema',\n", - " 'properties': {'array_input': {'items': {'format': 'int32',\n", - " 'type': 'integer'},\n", - " 'type': ['array', 'null']},\n", - " 'bounding_box_input': {'anyOf': [{'$ref': '#/$defs/BoundingBoxInput'},\n", - " {'type': 'null'}]},\n", - " 'complex_object_input': {'anyOf': [{'$ref': '#/$defs/ComplexObjectInput'},\n", - " {'type': 'null'}]},\n", - " 'date_input': {'type': ['string', 'null']},\n", - " 'double_input': {'format': 'double', 'type': ['number', 'null']},\n", - " 'feature_collection_input': {'type': ['string', 'null']},\n", - " 'geometry_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", - " 'images_input': {'items': {'type': 'string'}, 'type': ['array', 'null']},\n", - " 'measure_input': {'anyOf': [{'$ref': '#/$defs/MeasureInput'},\n", - " {'type': 'null'}]},\n", - " 'string_input': {'type': ['string', 'null']}},\n", - " 'title': 'EchoOutputs',\n", - " 'type': 'object'}}}" - ] - }, - "execution_count": 7, - "metadata": {}, - "output_type": "execute_result" + "name": "stdout", + "output_type": "stream", + "text": [ + "{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"created\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-13T12:49:43.096513Z\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"finished\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-13T12:49:43.426696Z\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Job status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/8a0998d8-02fe-431f-b265-4d7c20bc259e/results\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://www.opengis.net/def/rel/ogc/1.0/results\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Job result\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"message\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"processID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"progress\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m100\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"status\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"successful\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"process\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"updated\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-13T12:49:43.426696Z\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "}\u001b[37m\u001b[39;49;00m\n", + "\n" + ] } ], "source": [ - "p.process('echo')" + "pprint_json(\n", + " requests.get(f\"{SERVICE_URL}/jobs/{job_id}\").json()\n", + ")" ] }, { "cell_type": "code", - "execution_count": 23, - "id": "672fa101", + "execution_count": 58, + "id": "e20973b7", "metadata": {}, "outputs": [ { - "data": { - "text/plain": [ - "{'string_input': 'Hello, World!',\n", - " 'measure_input': None,\n", - " 'date_input': None,\n", - " 'double_input': 3.14,\n", - " 'array_input': None,\n", - " 'complex_object_input': None,\n", - " 'geometry_input': None,\n", - " 'bounding_box_input': None,\n", - " 'images_input': None,\n", - " 'feature_collection_input': None}" - ] - }, - "execution_count": 23, - "metadata": {}, - "output_type": "execute_result" + "name": "stdout", + "output_type": "stream", + "text": [ + "{\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"k_ndvi\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m0.26551630441320606\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"ndvi\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m0.5215686274509803\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "}\u001b[37m\u001b[39;49;00m\n", + "\n" + ] } ], "source": [ - "p.execute('echo', inputs={\n", - " 'string_input': 'Hello, World!',\n", - " 'double_input': 3.14,\n", - "})" + "pprint_json(\n", + " requests.get(f\"{SERVICE_URL}/jobs/{job_id}/results\").json()\n", + ")" ] } ], diff --git a/test-client/call.http b/test-client/call.http new file mode 100644 index 0000000..b70d841 --- /dev/null +++ b/test-client/call.http @@ -0,0 +1,63 @@ +GET http://localhost:4040/processes/ndvi + +### + +POST http://localhost:4040/processes/ndvi/execution +Content-Type: application/json + +{ + "inputs": { + "coordinate": { + "value": { + "type": "Point", + "coordinates": [9.77, 49.54] + }, + "mediaType": "application/geo+json" + }, + "year": 2014, + "month": 3 + }, + "response": "document" +} + +### + +POST http://localhost:4040/processes/ndvi/execution +Content-Type: application/json + +{ + "inputs": { + "coordinate": { + "value": { + "type": "Point", + "coordinates": [9.77, 49.54] + }, + "mediaType": "application/geo+json" + }, + "year": 2014, + "month": 5 + }, + "response": "document" +} + +### + +POST http://localhost:4040/processes/ndvi/execution +Content-Type: application/json + +{ + "inputs": { + "coordinate": { + "value": { + "type": "Point", + "coordinates": [10.77, 49.54] + }, + "mediaType": "application/geo+json" + }, + "year": 2014, + "month": 5 + }, + "response": "document" +} + +### From 31d5c90598e1e4c54979bcee9c00d39fbaf674e7 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Tue, 2 Dec 2025 17:56:02 +0100 Subject: [PATCH 03/19] use geoengine library for building operators --- backend/Cargo.lock | 2947 ++++++++++++++++++++++++++++----- backend/Cargo.toml | 4 + backend/src/main.rs | 1 + backend/src/processes/ndvi.rs | 181 +- backend/src/util.rs | 93 ++ 5 files changed, 2703 insertions(+), 523 deletions(-) create mode 100644 backend/src/util.rs diff --git a/backend/Cargo.lock b/backend/Cargo.lock index 9c2fd3e..3e13d22 100644 --- a/backend/Cargo.lock +++ b/backend/Cargo.lock @@ -13,8 +13,12 @@ dependencies = [ "clap", "clap_derive", "config", + "geoengine-datatypes", "geoengine-openapi-client", + "geoengine-operators", + "indoc", "ogcapi", + "pretty_assertions", "schemars 1.1.0", "serde", "serde_json", @@ -34,15 +38,53 @@ version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "320119579fcad9c21884f5c4861d16174d0e06250625266f50fe6898340abefa" +[[package]] +name = "ahash" +version = "0.8.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5a15f179cd60c4584b8a8c596927aadc462e27f2ca70c04e0071964a73ba7a75" +dependencies = [ + "cfg-if", + "const-random", + "getrandom 0.3.4", + "once_cell", + "version_check", + "zerocopy", +] + [[package]] name = "aho-corasick" -version = "1.1.3" +version = "1.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8e60d3430d3a69478ad0993f19238d2df97c507009a52b3c10addcd7f6bcb916" +checksum = "ddd31a130427c27518df266943a5308ed92d4b226cc639f5a8f1002816174301" dependencies = [ "memchr", ] +[[package]] +name = "aliasable" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "250f629c0161ad8107cf89319e990051fae62832fd343083bea452d93e2205fd" + +[[package]] +name = "aligned" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "377e4c0ba83e4431b10df45c1d4666f178ea9c552cac93e60c3a88bf32785923" +dependencies = [ + "as-slice 0.2.1", +] + +[[package]] +name = "aligned-vec" +version = "0.6.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc890384c8602f339876ded803c97ad529f3842aba97f6392b3dba0dd171769b" +dependencies = [ + "equator", +] + [[package]] name = "allocator-api2" version = "0.2.21" @@ -60,9 +102,9 @@ dependencies = [ [[package]] name = "anstream" -version = "0.6.20" +version = "0.6.21" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3ae563653d1938f79b1ab1b5e668c87c76a9930414574a6583a7b7e11a8e6192" +checksum = "43d5b281e737544384e969a5ccad3f1cdd24b48086a0fc1b2a5262a26b8f4f4a" dependencies = [ "anstyle", "anstyle-parse", @@ -90,22 +132,22 @@ dependencies = [ [[package]] name = "anstyle-query" -version = "1.1.4" +version = "1.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9e231f6134f61b71076a3eab506c379d4f36122f2af15a9ff04415ea4c3339e2" +checksum = "40c48f72fd53cd289104fc64099abca73db4166ad86ea0b4341abe65af83dadc" dependencies = [ - "windows-sys 0.60.2", + "windows-sys 0.61.2", ] [[package]] name = "anstyle-wincon" -version = "3.0.10" +version = "3.0.11" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3e0633414522a32ffaac8ac6cc8f748e090c5717661fddeea04219e2344f5f2a" +checksum = "291e6a250ff86cd4a820112fb8898808a366d8f9f58ce16d1f538353ad55747d" dependencies = [ "anstyle", "once_cell_polyfill", - "windows-sys 0.60.2", + "windows-sys 0.61.2", ] [[package]] @@ -132,17 +174,282 @@ dependencies = [ "derive_arbitrary", ] +[[package]] +name = "arg_enum_proc_macro" +version = "0.3.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0ae92a5119aa49cdbcf6b9f893fe4e1d98b04ccbf82ee0584ad948a44a734dea" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "array-init" +version = "2.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3d62b7694a562cdf5a74227903507c56ab2cc8bdd1f781ed5cb4cf9c9f810bfc" + [[package]] name = "arraydeque" version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "7d902e3d592a523def97af8f317b08ce16b7ab854c1985a0c671e6f15cebc236" +[[package]] +name = "arrayvec" +version = "0.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7c02d123df017efcdfbd739ef81735b36c5ba83ec3c59c80a9d7ecc718f92e50" + +[[package]] +name = "arrow" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb372a7cbcac02a35d3fb7b3fc1f969ec078e871f9bb899bf00a2e1809bec8a3" +dependencies = [ + "arrow-arith", + "arrow-array", + "arrow-buffer", + "arrow-cast", + "arrow-csv", + "arrow-data", + "arrow-ipc", + "arrow-json", + "arrow-ord", + "arrow-row", + "arrow-schema", + "arrow-select", + "arrow-string", +] + +[[package]] +name = "arrow-arith" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0f377dcd19e440174596d83deb49cd724886d91060c07fec4f67014ef9d54049" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "chrono", + "num-traits", +] + +[[package]] +name = "arrow-array" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a23eaff85a44e9fa914660fb0d0bb00b79c4a3d888b5334adb3ea4330c84f002" +dependencies = [ + "ahash", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "chrono", + "half", + "hashbrown 0.16.1", + "num-complex", + "num-integer", + "num-traits", +] + +[[package]] +name = "arrow-buffer" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2819d893750cb3380ab31ebdc8c68874dd4429f90fd09180f3c93538bd21626" +dependencies = [ + "bytes", + "half", + "num-bigint", + "num-traits", +] + +[[package]] +name = "arrow-cast" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e3d131abb183f80c450d4591dc784f8d7750c50c6e2bc3fcaad148afc8361271" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-ord", + "arrow-schema", + "arrow-select", + "atoi", + "base64", + "chrono", + "half", + "lexical-core", + "num-traits", + "ryu", +] + +[[package]] +name = "arrow-csv" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2275877a0e5e7e7c76954669366c2aa1a829e340ab1f612e647507860906fb6b" +dependencies = [ + "arrow-array", + "arrow-cast", + "arrow-schema", + "chrono", + "csv", + "csv-core", + "regex", +] + +[[package]] +name = "arrow-data" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "05738f3d42cb922b9096f7786f606fcb8669260c2640df8490533bb2fa38c9d3" +dependencies = [ + "arrow-buffer", + "arrow-schema", + "half", + "num-integer", + "num-traits", +] + +[[package]] +name = "arrow-ipc" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3d09446e8076c4b3f235603d9ea7c5494e73d441b01cd61fb33d7254c11964b3" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "arrow-select", + "flatbuffers", + "lz4_flex 0.12.0", + "zstd", +] + +[[package]] +name = "arrow-json" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "371ffd66fa77f71d7628c63f209c9ca5341081051aa32f9c8020feb0def787c0" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-cast", + "arrow-data", + "arrow-schema", + "chrono", + "half", + "indexmap 2.12.1", + "itoa", + "lexical-core", + "memchr", + "num-traits", + "ryu", + "serde_core", + "serde_json", + "simdutf8", +] + +[[package]] +name = "arrow-ord" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cbc94fc7adec5d1ba9e8cd1b1e8d6f72423b33fe978bf1f46d970fafab787521" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "arrow-select", +] + +[[package]] +name = "arrow-row" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "169676f317157dc079cc5def6354d16db63d8861d61046d2f3883268ced6f99f" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "half", +] + +[[package]] +name = "arrow-schema" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d27609cd7dd45f006abae27995c2729ef6f4b9361cde1ddd019dc31a5aa017e0" +dependencies = [ + "serde", + "serde_core", +] + +[[package]] +name = "arrow-select" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ae980d021879ea119dd6e2a13912d81e64abed372d53163e804dfe84639d8010" +dependencies = [ + "ahash", + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "num-traits", +] + +[[package]] +name = "arrow-string" +version = "57.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cf35e8ef49dcf0c5f6d175edee6b8af7b45611805333129c541a8b89a0fc0534" +dependencies = [ + "arrow-array", + "arrow-buffer", + "arrow-data", + "arrow-schema", + "arrow-select", + "memchr", + "num-traits", + "regex", + "regex-syntax", +] + +[[package]] +name = "as-slice" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "45403b49e3954a4b8428a0ac21a4b7afadccf92bfd96273f1a58cd4812496ae0" +dependencies = [ + "generic-array 0.12.4", + "generic-array 0.13.3", + "generic-array 0.14.7", + "stable_deref_trait", +] + +[[package]] +name = "as-slice" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "516b6b4f0e40d50dcda9365d53964ec74560ad4284da2e7fc97122cd83174516" +dependencies = [ + "stable_deref_trait", +] + [[package]] name = "async-compression" -version = "0.4.32" +version = "0.4.34" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5a89bce6054c720275ac2432fbba080a66a2106a44a1b804553930ca6909f4e0" +checksum = "0e86f6d3dc9dc4352edeea6b8e499e13e3f5dc3b964d7ca5fd411415a3498473" dependencies = [ "compression-codecs", "compression-core", @@ -171,6 +478,15 @@ dependencies = [ "num-traits", ] +[[package]] +name = "atomic-polyfill" +version = "1.0.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8cf2bce30dfe09ef0bfaef228b9d414faaf7e563035494d7fe092dba54b300f4" +dependencies = [ + "critical-section", +] + [[package]] name = "atomic-waker" version = "1.1.2" @@ -184,10 +500,53 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "c08606f8c3cbf4ce6ec8e28fb0014a2c086708fe954eaa885384a6165172e7e8" [[package]] -name = "axum" +name = "av-scenechange" +version = "0.14.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0f321d77c20e19b92c39e7471cf986812cbb46659d2af674adc4331ef3f18394" +dependencies = [ + "aligned", + "anyhow", + "arg_enum_proc_macro", + "arrayvec", + "log", + "num-rational", + "num-traits", + "pastey", + "rayon", + "thiserror 2.0.17", + "v_frame", + "y4m", +] + +[[package]] +name = "av1-grain" +version = "0.2.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8cfddb07216410377231960af4fcab838eaa12e013417781b78bd95ee22077f8" +dependencies = [ + "anyhow", + "arrayvec", + "log", + "nom", + "num-rational", + "v_frame", +] + +[[package]] +name = "avif-serialize" version = "0.8.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8a18ed336352031311f4e0b4dd2ff392d4fbb370777c9d18d7fc9d7359f73871" +checksum = "47c8fbc0f831f4519fe8b810b6a7a91410ec83031b8233f730a0480029f6a23f" +dependencies = [ + "arrayvec", +] + +[[package]] +name = "axum" +version = "0.8.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b098575ebe77cb6d14fc7f32749631a6e44edbef6b796f89b020e99ba20d425" dependencies = [ "axum-core", "bytes", @@ -258,12 +617,6 @@ dependencies = [ "tracing", ] -[[package]] -name = "base64" -version = "0.21.7" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9d297deb1925b89f2ccc13d7635fa0714f12c87adce1c75356b39ca9b7178567" - [[package]] name = "base64" version = "0.22.1" @@ -276,13 +629,51 @@ version = "1.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "55248b47b0caf0546f7988906588779981c43bb1bc9d0c44087278f80cdb44ba" +[[package]] +name = "bb8" +version = "0.9.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "457d7ed3f888dfd2c7af56d4975cade43c622f74bdcddfed6d4352f57acc6310" +dependencies = [ + "futures-util", + "parking_lot", + "portable-atomic", + "tokio", +] + +[[package]] +name = "bb8-postgres" +version = "0.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e570e6557cd0f88d28d32afa76644873271a70dc22656df565b2021c4036aa9c" +dependencies = [ + "bb8", + "tokio", + "tokio-postgres", +] + +[[package]] +name = "bit_field" +version = "0.10.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e4b40c7323adcfc0a41c4b88143ed58346ff65a288fc144329c5c45e05d70c6" + [[package]] name = "bitflags" -version = "2.9.4" +version = "2.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2261d10cca569e4643e526d8dc2e62e433cc8aba21ab764233731f8d369bf394" +checksum = "812e12b5285cc515a9c72a5c1d3b6d46a19dac5acfef5265968c166106e31dd3" dependencies = [ - "serde", + "serde_core", +] + +[[package]] +name = "bitstream-io" +version = "4.9.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "60d4bd9d1db2c6bdf285e223a7fa369d5ce98ec767dec949c6ca62863ce61757" +dependencies = [ + "core2", ] [[package]] @@ -291,42 +682,62 @@ version = "0.10.4" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "3078c7629b62d3f0439517fa394996acacc5cbc91c5a20d8c658e77abd503a71" dependencies = [ - "generic-array", + "generic-array 0.14.7", ] +[[package]] +name = "built" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f4ad8f11f288f48ca24471bbd51ac257aaeaaa07adae295591266b792902ae64" + [[package]] name = "bumpalo" version = "3.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "46c5e41b57b8bba42a04676d81cb89e9ee8e859a1a66f80a5a72e1cb76b34d43" +[[package]] +name = "bytemuck" +version = "1.24.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1fbdf580320f38b612e485521afda1ee26d10cc9884efaaa750d383e13e3c5f4" + [[package]] name = "byteorder" version = "1.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1fd0f2584146f6f2ef48085050886acf353beff7305ebd1ae69500e27c67f64b" +[[package]] +name = "byteorder-lite" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8f1fe948ff07f4bd06c30984e69f5b4899c516a3ef74f34df92a2df2ab535495" + [[package]] name = "bytes" -version = "1.10.1" +version = "1.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d71b6127be86fdcfddb610f7182ac57211d4b18a3e9c82eb2d17662f2227ad6a" +checksum = "b35204fbdc0b3f4446b89fc1ac2cf84a8a68971995d0bf2e925ec7cd960f9cb3" [[package]] name = "cc" -version = "1.2.39" +version = "1.2.48" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e1354349954c6fc9cb0deab020f27f783cf0b604e8bb754dc4658ecf0d29c35f" +checksum = "c481bdbf0ed3b892f6f806287d72acd515b352a4ec27a208489b8c1bc839633a" dependencies = [ "find-msvc-tools", + "jobserver", + "libc", "shlex", ] [[package]] name = "cfg-if" -version = "1.0.3" +version = "1.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2fd1289c04a9ea8cb22300a459a72a385d7c73d3259e2ed7dcb2af674838cfa9" +checksum = "9330f8b2ff13f34540b44e946ef35111825727b38d33286ef986142615121801" [[package]] name = "cfg_aliases" @@ -369,9 +780,9 @@ dependencies = [ [[package]] name = "clap" -version = "4.5.48" +version = "4.5.53" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e2134bb3ea021b78629caa971416385309e0131b351b25e01dc16fb54e1b5fae" +checksum = "c9e340e012a1bf4935f5282ed1436d1489548e8f72308207ea5df0e23d2d03f8" dependencies = [ "clap_builder", "clap_derive", @@ -379,9 +790,9 @@ dependencies = [ [[package]] name = "clap_builder" -version = "4.5.48" +version = "4.5.53" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c2ba64afa3c0a6df7fa517765e31314e983f51dda798ffba27b988194fb65dc9" +checksum = "d76b5d13eaa18c901fd2f7fca939fefe3a0727a953561fefdf3b2922b8569d00" dependencies = [ "anstream", "anstyle", @@ -391,11 +802,11 @@ dependencies = [ [[package]] name = "clap_derive" -version = "4.5.47" +version = "4.5.49" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bbfd7eae0b0f1a6e63d4b13c9c478de77c2eb546fba158ad50b4203dc24b9f9c" +checksum = "2a0b5487afeab2deb2ff4e03a807ad1a03ac532ff5a2cee5d86884440c7f7671" dependencies = [ - "heck", + "heck 0.5.0", "proc-macro2", "quote", "syn", @@ -403,9 +814,24 @@ dependencies = [ [[package]] name = "clap_lex" -version = "0.7.5" +version = "0.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a1d728cc89cf3aee9ff92b05e62b19ee65a02b5702cff7d5a377e32c6ae29d8d" + +[[package]] +name = "cmake" +version = "0.1.54" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e7caa3f9de89ddbe2c607f4101924c5abec803763ae9534e4f4d7d8f84aa81f0" +dependencies = [ + "cc", +] + +[[package]] +name = "color_quant" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b94f61472cee1439c0b966b47e3aca9ae07e45d070759512cd390ea2bebc6675" +checksum = "3d7b894f5411737b7867f4827955924d7c254fc9f4d91a6aad6b097804b1018b" [[package]] name = "colorchoice" @@ -415,9 +841,9 @@ checksum = "b05b61dc5112cbb17e4b6cd61790d9845d13888356391624cbe7e41efeac1e75" [[package]] name = "compression-codecs" -version = "0.4.31" +version = "0.4.33" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ef8a506ec4b81c460798f572caead636d57d3d7e940f998160f52bd254bf2d23" +checksum = "302266479cb963552d11bd042013a58ef1adc56768016c8b82b4199488f2d4ad" dependencies = [ "compression-core", "flate2", @@ -426,9 +852,9 @@ dependencies = [ [[package]] name = "compression-core" -version = "0.4.29" +version = "0.4.31" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e47641d3deaf41fb1538ac1f54735925e275eaf3bf4d55c81b137fba797e5cbb" +checksum = "75984efb6ed102a0d42db99afb6c1948f0380d1d91808d5529916e6c08b49d8d" [[package]] name = "concurrent-queue" @@ -441,9 +867,9 @@ dependencies = [ [[package]] name = "config" -version = "0.15.18" +version = "0.15.19" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "180e549344080374f9b32ed41bf3b6b57885ff6a289367b3dbc10eea8acc1918" +checksum = "b30fa8254caad766fc03cb0ccae691e14bf3bd72bfff27f72802ce729551b3d6" dependencies = [ "async-trait", "convert_case", @@ -510,6 +936,15 @@ version = "0.8.7" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "773648b94d0e5d620f64f280777445740e61fe701025087ec8b57f45c791888b" +[[package]] +name = "core2" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b49ba7ef1ad6107f8824dbe97de947cbaac53c44e7f9756a1fba0d37c1eec505" +dependencies = [ + "memchr", +] + [[package]] name = "cpufeatures" version = "0.2.17" @@ -521,9 +956,9 @@ dependencies = [ [[package]] name = "crc" -version = "3.3.0" +version = "3.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9710d3b3739c2e349eb44fe848ad0b7c8cb1e42bd87ee49371df2f7acaf3e675" +checksum = "5eb8a2a1cd12ab0d987a5d5e825195d372001a4094a0376319d5a0ad71c1ba0d" dependencies = [ "crc-catalog", ] @@ -544,7 +979,32 @@ dependencies = [ ] [[package]] -name = "crossbeam-queue" +name = "critical-section" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "790eea4361631c5e7d22598ecd5723ff611904e3344ce8720784c93e3d83d40b" + +[[package]] +name = "crossbeam-deque" +version = "0.8.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9dd111b7b7f7d55b72c0a6ae361660ee5853c9af73f70c3c2ef6858b950e2e51" +dependencies = [ + "crossbeam-epoch", + "crossbeam-utils", +] + +[[package]] +name = "crossbeam-epoch" +version = "0.9.18" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b82ac4a3c2ca9c3460964f020e1402edd5753411d7737aa39c3714ad1b5420e" +dependencies = [ + "crossbeam-utils", +] + +[[package]] +name = "crossbeam-queue" version = "0.3.12" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0f58bbc28f91df819d0aa2a2c00cd19754769c2fad90579b3592b1c9ba7a3115" @@ -566,14 +1026,35 @@ checksum = "460fbee9c2c2f33933d720630a6a0bac33ba7053db5344fac858d4b8952d77d5" [[package]] name = "crypto-common" -version = "0.1.6" +version = "0.1.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1bfb12502f3fc46cca1bb51ac28df9d618d813cdc3d2f25b9fe775a34af26bb3" +checksum = "78c8292055d1c1df0cce5d180393dc8cce0abec0a7102adb6c7b1eef6016d60a" dependencies = [ - "generic-array", + "generic-array 0.14.7", "typenum", ] +[[package]] +name = "csv" +version = "1.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "52cd9d68cf7efc6ddfaaee42e7288d3a99d613d4b50f76ce9827ae0c6e14f938" +dependencies = [ + "csv-core", + "itoa", + "ryu", + "serde_core", +] + +[[package]] +name = "csv-core" +version = "0.1.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "704a3c26996a80471189265814dbc2c257598b96b8a7feae2d31ace646bb9782" +dependencies = [ + "memchr", +] + [[package]] name = "darling" version = "0.21.3" @@ -622,9 +1103,9 @@ dependencies = [ [[package]] name = "deranged" -version = "0.5.4" +version = "0.5.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a41953f86f8a05768a6cda24def994fd2f424b04ec5c719cf89989779f199071" +checksum = "ececcb659e7ba858fb4f10388c250a7252eb0a27373f1a72b8748afdd248e587" dependencies = [ "powerfmt", "serde_core", @@ -641,6 +1122,12 @@ dependencies = [ "syn", ] +[[package]] +name = "diff" +version = "0.1.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56254986775e3233ffa9c4d7d3faaf6d36a2c09d30b20687e9f88bc8bafc16c8" + [[package]] name = "digest" version = "0.10.7" @@ -685,6 +1172,16 @@ version = "1.0.20" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d0881ea181b1df73ff77ffaaf9c7544ecc11e82fba9b5f27b262a3c73a332555" +[[package]] +name = "earcutr" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "79127ed59a85d7687c409e9978547cffb7dc79675355ed22da6b66fd5f6ead01" +dependencies = [ + "itertools 0.11.0", + "num-traits", +] + [[package]] name = "either" version = "1.15.0" @@ -703,6 +1200,26 @@ dependencies = [ "cfg-if", ] +[[package]] +name = "equator" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4711b213838dfee0117e3be6ac926007d7f433d7bbe33595975d4190cb07e6fc" +dependencies = [ + "equator-macro", +] + +[[package]] +name = "equator-macro" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "44f23cf4b44bfce11a86ace86f8a73ffdec849c9fd00a386a53d278bd9e81fb3" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "equivalent" version = "1.0.2" @@ -711,9 +1228,9 @@ checksum = "877a4ace8713b0bcf2a4e7eec82529c029f1d0619886d18145fea96c3ffe5c0f" [[package]] name = "erased-serde" -version = "0.4.8" +version = "0.4.9" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "259d404d09818dec19332e31d94558aeb442fea04c817006456c24b5460bbd4b" +checksum = "89e8918065695684b2b0702da20382d5ae6065cf3327bc2d6436bd49a71ce9f3" dependencies = [ "serde", "serde_core", @@ -727,7 +1244,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "39cab71617ae0d63f51a36d69f866391735b51691dbda63cf6f96d042b63efeb" dependencies = [ "libc", - "windows-sys 0.60.2", + "windows-sys 0.61.2", ] [[package]] @@ -752,29 +1269,116 @@ dependencies = [ "pin-project-lite", ] +[[package]] +name = "exr" +version = "1.74.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4300e043a56aa2cb633c01af81ca8f699a321879a7854d3896a0ba89056363be" +dependencies = [ + "bit_field", + "half", + "lebe", + "miniz_oxide", + "rayon-core", + "smallvec 1.15.1", + "zune-inflate", +] + +[[package]] +name = "fallible-iterator" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4443176a9f2c162692bd3d352d745ef9413eec5782a80d8fd6f8a1ac692a07f7" + [[package]] name = "fastrand" version = "2.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "37909eebbb50d72f9059c3b6d82c0463f2ff062c9e95845c43a6c9c0355411be" +[[package]] +name = "fax" +version = "0.2.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f05de7d48f37cd6730705cbca900770cab77a89f413d23e100ad7fad7795a0ab" +dependencies = [ + "fax_derive", +] + +[[package]] +name = "fax_derive" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a0aca10fb742cb43f9e7bb8467c91aa9bcb8e3ffbc6a6f7389bb93ffc920577d" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "fdeflate" +version = "0.3.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e6853b52649d4ac5c0bd02320cddc5ba956bdb407c4b75a2c6b75bf51500f8c" +dependencies = [ + "simd-adler32", +] + +[[package]] +name = "filetime" +version = "0.2.26" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc0505cd1b6fa6580283f6bdf70a73fcf4aba1184038c90902b92b3dd0df63ed" +dependencies = [ + "cfg-if", + "libc", + "libredox", + "windows-sys 0.60.2", +] + [[package]] name = "find-msvc-tools" -version = "0.1.2" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3a3076410a55c90011c298b04d0cfa770b00fa04e1e3c97d3f6c9de105a03844" + +[[package]] +name = "flatbuffers" +version = "25.9.23" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1ced73b1dacfc750a6db6c0a0c3a3853c8b41997e2e2c563dc90804ae6867959" +checksum = "09b6620799e7340ebd9968d2e0708eb82cf1971e9a16821e2091b6d6e475eed5" +dependencies = [ + "bitflags", + "rustc_version", +] [[package]] name = "flate2" -version = "1.1.2" +version = "1.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4a3d7db9596fecd151c5f638c0ee5d5bd487b6e0ea232e5dc96d5250f6f94b1d" +checksum = "bfe33edd8e85a12a67454e37f8c75e730830d83e313556ab9ebf9ee7fbeb3bfb" dependencies = [ "crc32fast", "libz-rs-sys", "miniz_oxide", ] +[[package]] +name = "float-cmp" +version = "0.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b09cf3155332e944990140d967ff5eceb70df778b34f77d8075db46e4704e6d8" +dependencies = [ + "num-traits", +] + +[[package]] +name = "float_next_after" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8bf7cc16383c4b8d58b9905a8509f02926ce3058053c056376248d958c9df1e8" + [[package]] name = "flume" version = "0.11.1" @@ -798,6 +1402,12 @@ version = "0.1.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d9c4f5dac5e15c24eb999c26181a6ca40b39fe946cbe4c263c7209467bc83af2" +[[package]] +name = "foldhash" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "77ce24cb58228fbb8aa041425bb1050850ac19177686ea6e0f41a70416f56fdb" + [[package]] name = "foreign-types" version = "0.3.2" @@ -922,6 +1532,48 @@ dependencies = [ "slab", ] +[[package]] +name = "gdal" +version = "0.18.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e721cea67b420fd4b5cb15ba8145f2f1d3a6931a27fdbfadb46cff02015e1cde" +dependencies = [ + "bitflags", + "chrono", + "gdal-sys", + "geo-types", + "semver", + "thiserror 2.0.17", +] + +[[package]] +name = "gdal-sys" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "febef67dc08a956a9ecb04de2b40dbd15ad56be49421aad9ae0cdcbe9a24166c" +dependencies = [ + "pkg-config", + "semver", +] + +[[package]] +name = "generic-array" +version = "0.12.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffdf9f34f1447443d37393cc6c2b8313aebddcd96906caf34e54c68d8e57d7bd" +dependencies = [ + "typenum", +] + +[[package]] +name = "generic-array" +version = "0.13.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f797e67af32588215eaaab8327027ee8e71b9dd0b2b26996aedf20c030fce309" +dependencies = [ + "typenum", +] + [[package]] name = "generic-array" version = "0.14.7" @@ -932,15 +1584,110 @@ dependencies = [ "version_check", ] +[[package]] +name = "geo" +version = "0.31.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2fc1a1678e54befc9b4bcab6cd43b8e7f834ae8ea121118b0fd8c42747675b4a" +dependencies = [ + "earcutr", + "float_next_after", + "geo-types", + "geographiclib-rs", + "i_overlay", + "log", + "num-traits", + "robust", + "rstar 0.12.2", + "spade", +] + +[[package]] +name = "geo-traits" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2e7c353d12a704ccfab1ba8bfb1a7fe6cb18b665bf89d37f4f7890edcd260206" +dependencies = [ + "geo-types", +] + [[package]] name = "geo-types" -version = "0.7.17" +version = "0.7.18" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "75a4dcd69d35b2c87a7c83bce9af69fd65c9d68d3833a0ded568983928f3fc99" +checksum = "24f8647af4005fa11da47cd56252c6ef030be8fa97bdbf355e7dfb6348f0a82c" dependencies = [ "approx", "num-traits", + "rayon", + "rstar 0.10.0", + "rstar 0.11.0", + "rstar 0.12.2", + "rstar 0.8.4", + "rstar 0.9.3", + "serde", +] + +[[package]] +name = "geoengine-datatypes" +version = "0.8.0" +source = "git+https://github.com/geo-engine/geoengine?branch=main#8de4ad7e8efa267b528d71caa74b90aac2b43403" +dependencies = [ + "arrow", + "arrow-array", + "arrow-ord", + "arrow-schema", + "bytes", + "chrono", + "fallible-iterator", + "float-cmp", + "gdal", + "geo", + "geojson", + "image", + "num", + "num-traits", + "ordered-float", + "paste", + "postgres-protocol", + "postgres-types", + "proj", + "rayon", "serde", + "serde_json", + "serde_with", + "snafu", + "strum", + "tempfile", + "uuid", + "wkt", +] + +[[package]] +name = "geoengine-expression" +version = "0.8.0" +source = "git+https://github.com/geo-engine/geoengine?branch=main#8de4ad7e8efa267b528d71caa74b90aac2b43403" +dependencies = [ + "geoengine-expression-deps", + "libloading", + "pest", + "pest_derive", + "prettyplease", + "proc-macro2", + "quote", + "snafu", + "syn", + "tempfile", + "tracing", +] + +[[package]] +name = "geoengine-expression-deps" +version = "0.0.0" +source = "git+https://github.com/geo-engine/geoengine?branch=main#8de4ad7e8efa267b528d71caa74b90aac2b43403" +dependencies = [ + "geo", + "geo-types", ] [[package]] @@ -957,6 +1704,62 @@ dependencies = [ "uuid", ] +[[package]] +name = "geoengine-operators" +version = "0.8.0" +source = "git+https://github.com/geo-engine/geoengine?branch=main#8de4ad7e8efa267b528d71caa74b90aac2b43403" +dependencies = [ + "arrow", + "async-trait", + "bb8-postgres", + "bytes", + "chrono", + "csv", + "float-cmp", + "futures", + "gdal", + "gdal-sys", + "geo", + "geoengine-datatypes", + "geoengine-expression", + "itertools 0.14.0", + "libloading", + "lru", + "lz4_flex 0.11.5", + "ndarray", + "num", + "num-traits", + "ordered-float", + "ort", + "ouroboros", + "paste", + "pin-project", + "postgres-protocol", + "postgres-types", + "rayon", + "rustc-hash", + "serde", + "serde_json", + "snafu", + "stream-cancel", + "strum", + "tempfile", + "tokio", + "tokio-postgres", + "tracing", + "typetag", + "uuid", +] + +[[package]] +name = "geographiclib-rs" +version = "0.2.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f611040a2bb37eaa29a78a128d1e92a378a03e0b6e66ae27398d42b1ba9a7841" +dependencies = [ + "libm", +] + [[package]] name = "geojson" version = "0.24.2" @@ -967,17 +1770,17 @@ dependencies = [ "log", "serde", "serde_json", - "thiserror", + "thiserror 2.0.17", ] [[package]] name = "gethostname" -version = "1.0.2" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fc257fdb4038301ce4b9cd1b3b51704509692bb3ff716a410cbd07925d9dae55" +checksum = "1bd49230192a3797a9a4d6abe9b3eed6f7fa4c8a8a4947977c6f80025f92cbd8" dependencies = [ "rustix", - "windows-targets 0.52.6", + "windows-link", ] [[package]] @@ -989,24 +1792,34 @@ dependencies = [ "cfg-if", "js-sys", "libc", - "wasi 0.11.1+wasi-snapshot-preview1", + "wasi", "wasm-bindgen", ] [[package]] name = "getrandom" -version = "0.3.3" +version = "0.3.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "26145e563e54f2cadc477553f1ec5ee650b00862f0a58bcd12cbdc5f0ea2d2f4" +checksum = "899def5c37c4fd7b2664648c28120ecec138e4d395b459e5ca34f9cce2dd77fd" dependencies = [ "cfg-if", "js-sys", "libc", "r-efi", - "wasi 0.14.7+wasi-0.2.4", + "wasip2", "wasm-bindgen", ] +[[package]] +name = "gif" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f954a9e9159ec994f73a30a12b96a702dde78f5547bcb561174597924f7d4162" +dependencies = [ + "color_quant", + "weezl", +] + [[package]] name = "h2" version = "0.4.12" @@ -1019,7 +1832,7 @@ dependencies = [ "futures-core", "futures-sink", "http", - "indexmap 2.11.4", + "indexmap 2.12.1", "slab", "tokio", "tokio-util", @@ -1027,33 +1840,77 @@ dependencies = [ ] [[package]] -name = "hashbrown" -version = "0.12.3" +name = "half" +version = "2.7.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888" +checksum = "6ea2d84b969582b4b1864a92dc5d27cd2b77b622a8d79306834f1be5ba20d84b" +dependencies = [ + "cfg-if", + "crunchy", + "num-traits", + "zerocopy", +] [[package]] -name = "hashbrown" -version = "0.14.5" +name = "hash32" +version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e5274423e17b7c9fc20b6e7e208532f9b19825d82dfd615708b70edd83df41f1" +checksum = "d4041af86e63ac4298ce40e5cca669066e75b6f1aa3390fe2561ffa5e1d9f4cc" +dependencies = [ + "byteorder", +] [[package]] -name = "hashbrown" +name = "hash32" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b0c35f58762feb77d74ebe43bdbc3210f09be9fe6742234d573bacc26ed92b67" +dependencies = [ + "byteorder", +] + +[[package]] +name = "hash32" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "47d60b12902ba28e2730cd37e95b8c9223af2808df9e902d4df49588d1470606" +dependencies = [ + "byteorder", +] + +[[package]] +name = "hashbrown" +version = "0.12.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888" + +[[package]] +name = "hashbrown" +version = "0.14.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e5274423e17b7c9fc20b6e7e208532f9b19825d82dfd615708b70edd83df41f1" + +[[package]] +name = "hashbrown" version = "0.15.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9229cfe53dfd69f0609a49f65461bd93001ea1ef889cd5529dd176593f5338a1" dependencies = [ "allocator-api2", "equivalent", - "foldhash", + "foldhash 0.1.5", ] [[package]] name = "hashbrown" -version = "0.16.0" +version = "0.16.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5419bdc4f6a9207fbeba6d11b604d481addf78ecd10c11ad51e76c2f6482748d" +checksum = "841d1cc9bed7f9236f321df977030373f4a4163ae1a7dbfe1a51a2c1a51d9100" +dependencies = [ + "allocator-api2", + "equivalent", + "foldhash 0.2.0", +] [[package]] name = "hashlink" @@ -1064,6 +1921,47 @@ dependencies = [ "hashbrown 0.15.5", ] +[[package]] +name = "heapless" +version = "0.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "634bd4d29cbf24424d0a4bfcbf80c6960129dc24424752a7d1d1390607023422" +dependencies = [ + "as-slice 0.1.5", + "generic-array 0.14.7", + "hash32 0.1.1", + "stable_deref_trait", +] + +[[package]] +name = "heapless" +version = "0.7.17" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cdc6457c0eb62c71aac4bc17216026d8410337c4126773b9c5daba343f17964f" +dependencies = [ + "atomic-polyfill", + "hash32 0.2.1", + "rustc_version", + "spin", + "stable_deref_trait", +] + +[[package]] +name = "heapless" +version = "0.8.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0bfb9eb618601c89945a70e254898da93b13be0388091d42117462b265bb3fad" +dependencies = [ + "hash32 0.3.1", + "stable_deref_trait", +] + +[[package]] +name = "heck" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8" + [[package]] name = "heck" version = "0.5.0" @@ -1096,21 +1994,20 @@ dependencies = [ [[package]] name = "home" -version = "0.5.11" +version = "0.5.12" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "589533453244b0995c858700322199b2becb13b627df2851f64a2775d024abcf" +checksum = "cc627f471c528ff0c4a49e1d5e60450c8f6461dd6d10ba9dcd3a61d3dff7728d" dependencies = [ - "windows-sys 0.59.0", + "windows-sys 0.61.2", ] [[package]] name = "http" -version = "1.3.1" +version = "1.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f4a85d31aea989eead29a3aaf9e1115a180df8282431156e533de47660892565" +checksum = "e3ba2a386d7f85a81f119ad7498ebe444d2e22c2af0b86b069416ace48b3311a" dependencies = [ "bytes", - "fnv", "itoa", ] @@ -1151,9 +2048,9 @@ checksum = "df3b46402a9d5adb4c86a0cf463f42e19994e3ee891101b1841f30a545cb49a9" [[package]] name = "hyper" -version = "1.7.0" +version = "1.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "eb3aa54a13a0dfe7fbe3a59e0c76093041720fdc77b110cc0fc260fafb4dc51e" +checksum = "2ab2d4f250c3d7b1c9fcdff1cece94ea4e2dfbec68614f7b87cb205f24ca9d11" dependencies = [ "atomic-waker", "bytes", @@ -1167,7 +2064,7 @@ dependencies = [ "itoa", "pin-project-lite", "pin-utils", - "smallvec", + "smallvec 1.15.1", "tokio", "want", ] @@ -1186,7 +2083,7 @@ dependencies = [ "tokio", "tokio-rustls", "tower-service", - "webpki-roots 1.0.2", + "webpki-roots 1.0.4", ] [[package]] @@ -1207,11 +2104,11 @@ dependencies = [ [[package]] name = "hyper-util" -version = "0.1.17" +version = "0.1.18" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3c6995591a8f1380fcb4ba966a252a4b29188d51d2b89e3a252f5305be65aea8" +checksum = "52e9a2a24dc5c6821e71a7030e1e14b7b632acac55c40e9d2e082c621261bb56" dependencies = [ - "base64 0.22.1", + "base64", "bytes", "futures-channel", "futures-core", @@ -1229,6 +2126,49 @@ dependencies = [ "tracing", ] +[[package]] +name = "i_float" +version = "1.15.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "010025c2c532c8d82e42d0b8bb5184afa449fa6f06c709ea9adcb16c49ae405b" +dependencies = [ + "libm", +] + +[[package]] +name = "i_key_sort" +version = "0.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9190f86706ca38ac8add223b2aed8b1330002b5cdbbce28fb58b10914d38fc27" + +[[package]] +name = "i_overlay" +version = "4.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0fcccbd4e4274e0f80697f5fbc6540fdac533cce02f2081b328e68629cce24f9" +dependencies = [ + "i_float", + "i_key_sort", + "i_shape", + "i_tree", + "rayon", +] + +[[package]] +name = "i_shape" +version = "1.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1ea154b742f7d43dae2897fcd5ead86bc7b5eefcedd305a7ebf9f69d44d61082" +dependencies = [ + "i_float", +] + +[[package]] +name = "i_tree" +version = "0.16.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "35e6d558e6d4c7b82bc51d9c771e7a927862a161a7d87bf2b0541450e0e20915" + [[package]] name = "iana-time-zone" version = "0.1.64" @@ -1255,9 +2195,9 @@ dependencies = [ [[package]] name = "icu_collections" -version = "2.0.0" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "200072f5d0e3614556f94a9930d5dc3e0662a652823904c3a75dc3b0af7fee47" +checksum = "4c6b649701667bbe825c3b7e6388cb521c23d88644678e83c0c4d0a621a34b43" dependencies = [ "displaydoc", "potential_utf", @@ -1268,9 +2208,9 @@ dependencies = [ [[package]] name = "icu_locale_core" -version = "2.0.0" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0cde2700ccaed3872079a65fb1a78f6c0a36c91570f28755dda67bc8f7d9f00a" +checksum = "edba7861004dd3714265b4db54a3c390e880ab658fec5f7db895fae2046b5bb6" dependencies = [ "displaydoc", "litemap", @@ -1281,57 +2221,52 @@ dependencies = [ [[package]] name = "icu_normalizer" -version = "2.0.0" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "436880e8e18df4d7bbc06d58432329d6458cc84531f7ac5f024e93deadb37979" +checksum = "5f6c8828b67bf8908d82127b2054ea1b4427ff0230ee9141c54251934ab1b599" dependencies = [ - "displaydoc", "icu_collections", "icu_normalizer_data", "icu_properties", "icu_provider", - "smallvec", + "smallvec 1.15.1", "zerovec", ] [[package]] name = "icu_normalizer_data" -version = "2.0.0" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "00210d6893afc98edb752b664b8890f0ef174c8adbb8d0be9710fa66fbbf72d3" +checksum = "7aedcccd01fc5fe81e6b489c15b247b8b0690feb23304303a9e560f37efc560a" [[package]] name = "icu_properties" -version = "2.0.1" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "016c619c1eeb94efb86809b015c58f479963de65bdb6253345c1a1276f22e32b" +checksum = "e93fcd3157766c0c8da2f8cff6ce651a31f0810eaa1c51ec363ef790bbb5fb99" dependencies = [ - "displaydoc", "icu_collections", "icu_locale_core", "icu_properties_data", "icu_provider", - "potential_utf", "zerotrie", "zerovec", ] [[package]] name = "icu_properties_data" -version = "2.0.1" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "298459143998310acd25ffe6810ed544932242d3f07083eee1084d83a71bd632" +checksum = "02845b3647bb045f1100ecd6480ff52f34c35f82d9880e029d329c21d1054899" [[package]] name = "icu_provider" -version = "2.0.0" +version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "03c80da27b5f4187909049ee2d72f276f0d9f99a42c306bd0131ecfe04d8e5af" +checksum = "85962cf0ce02e1e0a629cc34e7ca3e373ce20dda4c4d7294bbd0bf1fdb59e614" dependencies = [ "displaydoc", "icu_locale_core", - "stable_deref_trait", - "tinystr", "writeable", "yoke", "zerofrom", @@ -1352,7 +2287,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "3b0875f23caa03898994f6ddc501886a45c7d3d62d04d2d90788d47be1b1e4de" dependencies = [ "idna_adapter", - "smallvec", + "smallvec 1.15.1", "utf8_iter", ] @@ -1366,6 +2301,46 @@ dependencies = [ "icu_properties", ] +[[package]] +name = "image" +version = "0.25.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e6506c6c10786659413faa717ceebcb8f70731c0a60cbae39795fdf114519c1a" +dependencies = [ + "bytemuck", + "byteorder-lite", + "color_quant", + "exr", + "gif", + "image-webp", + "moxcms", + "num-traits", + "png", + "qoi", + "ravif", + "rayon", + "rgb", + "tiff", + "zune-core 0.5.0", + "zune-jpeg 0.5.5", +] + +[[package]] +name = "image-webp" +version = "0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "525e9ff3e1a4be2fbea1fdf0e98686a6d98b4d8f937e1bf7402245af1909e8c3" +dependencies = [ + "byteorder-lite", + "quick-error", +] + +[[package]] +name = "imgref" +version = "1.12.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e7c5cedc30da3a610cac6b4ba17597bdf7152cf974e8aab3afb3d54455e371c8" + [[package]] name = "indexmap" version = "1.9.3" @@ -1379,16 +2354,45 @@ dependencies = [ [[package]] name = "indexmap" -version = "2.11.4" +version = "2.12.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4b0f83760fb341a774ed326568e19f5a863af4a952def8c39f9ab92fd95b88e5" +checksum = "0ad4bb2b565bca0645f4d68c5c9af97fba094e9791da685bf83cb5f3ce74acf2" dependencies = [ "equivalent", - "hashbrown 0.16.0", + "hashbrown 0.16.1", "serde", "serde_core", ] +[[package]] +name = "indoc" +version = "2.0.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "79cf5c93f93228cf8efb3ba362535fb11199ac548a09ce117c9b1adc3030d706" +dependencies = [ + "rustversion", +] + +[[package]] +name = "interpolate_name" +version = "0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c34819042dc3d3971c46c2190835914dfbe0c3c13f61449b2997f4e9722dfa60" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "inventory" +version = "0.3.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bc61209c082fbeb19919bee74b176221b27223e27b65d781eb91af24eb1fb46e" +dependencies = [ + "rustversion", +] + [[package]] name = "ipnet" version = "2.11.0" @@ -1407,9 +2411,27 @@ dependencies = [ [[package]] name = "is_terminal_polyfill" -version = "1.70.1" +version = "1.70.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a6cb138bb79a146c1bd460005623e142ef0181e3d0219cb493e02f7d08a35695" + +[[package]] +name = "itertools" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b1c173a5686ce8bfa551b3563d0c2170bf24ca44da99c7ca4bfdab5418c3fe57" +dependencies = [ + "either", +] + +[[package]] +name = "itertools" +version = "0.14.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7943c866cc5cd64cbc25b2e01621d07fa8eb2a1a23160ee81ce38704e97b8ecf" +checksum = "2b192c782037fadd9cfa75548310488aabdbf3d2da73885b31bd0abd03351285" +dependencies = [ + "either", +] [[package]] name = "itoa" @@ -1417,11 +2439,21 @@ version = "1.0.15" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "4a5f13b858c8d314ee3e8f639011f7ccefe71f97f96e50151fb991f267928e2c" +[[package]] +name = "jobserver" +version = "0.1.34" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9afb3de4395d6b3e67a780b6de64b51c978ecf11cb9a462c66be7d4ca9039d33" +dependencies = [ + "getrandom 0.3.4", + "libc", +] + [[package]] name = "js-sys" -version = "0.3.81" +version = "0.3.83" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ec48937a97411dcb524a265206ccd4c90bb711fca92b2792c407f268825b9305" +checksum = "464a3709c7f55f1f721e5389aa6ea4e3bc6aba669353300af094b29ffbdde1d8" dependencies = [ "once_cell", "wasm-bindgen", @@ -1447,11 +2479,94 @@ dependencies = [ "spin", ] +[[package]] +name = "lebe" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7a79a3332a6609480d7d0c9eab957bca6b455b91bb84e66d19f5ff66294b85b8" + +[[package]] +name = "lexical-core" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7d8d125a277f807e55a77304455eb7b1cb52f2b18c143b60e766c120bd64a594" +dependencies = [ + "lexical-parse-float", + "lexical-parse-integer", + "lexical-util", + "lexical-write-float", + "lexical-write-integer", +] + +[[package]] +name = "lexical-parse-float" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "52a9f232fbd6f550bc0137dcb5f99ab674071ac2d690ac69704593cb4abbea56" +dependencies = [ + "lexical-parse-integer", + "lexical-util", +] + +[[package]] +name = "lexical-parse-integer" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9a7a039f8fb9c19c996cd7b2fcce303c1b2874fe1aca544edc85c4a5f8489b34" +dependencies = [ + "lexical-util", +] + +[[package]] +name = "lexical-util" +version = "1.0.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2604dd126bb14f13fb5d1bd6a66155079cb9fa655b37f875b3a742c705dbed17" + +[[package]] +name = "lexical-write-float" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50c438c87c013188d415fbabbb1dceb44249ab81664efbd31b14ae55dabb6361" +dependencies = [ + "lexical-util", + "lexical-write-integer", +] + +[[package]] +name = "lexical-write-integer" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "409851a618475d2d5796377cad353802345cba92c867d9fbcde9cf4eac4e14df" +dependencies = [ + "lexical-util", +] + [[package]] name = "libc" -version = "0.2.176" +version = "0.2.178" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "37c93d8daa9d8a012fd8ab92f088405fb202ea0b6ab73ee2482ae66af4f42091" + +[[package]] +name = "libfuzzer-sys" +version = "0.4.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5037190e1f70cbeef565bd267599242926f724d3b8a9f510fd7e0b540cfa4404" +dependencies = [ + "arbitrary", + "cc", +] + +[[package]] +name = "libloading" +version = "0.8.9" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "58f929b4d672ea937a23a1ab494143d968337a5f47e56d0815df1e0890ddf174" +checksum = "d7c4b02199fee7c5d21a5ae7d8cfa79a6ef5bb2fc834d6e9058e89c825efdc55" +dependencies = [ + "cfg-if", + "windows-link", +] [[package]] name = "libm" @@ -1489,6 +2604,15 @@ dependencies = [ "zlib-rs", ] +[[package]] +name = "link-cplusplus" +version = "1.0.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f78c730aaa7d0b9336a299029ea49f9ee53b0ed06e9202e8cb7db9bae7b8c82" +dependencies = [ + "cc", +] + [[package]] name = "linux-raw-sys" version = "0.11.0" @@ -1497,17 +2621,16 @@ checksum = "df1d3c3b53da64cf5760482273a98e575c651a67eec7f77df96b5b642de8f039" [[package]] name = "litemap" -version = "0.8.0" +version = "0.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "241eaef5fd12c88705a01fc1066c48c4b36e0dd4377dcdc7ec3942cea7a69956" +checksum = "6373607a59f0be73a39b6fe456b8192fcc3585f602af20751600e974dd455e77" [[package]] name = "lock_api" -version = "0.4.13" +version = "0.4.14" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "96936507f153605bddfcda068dd804796c84324ed2510809e5b2a624c81da765" +checksum = "224399e74b87b5f3557511d98dff8b14089b3dadafcab6bb93eab67d3aace965" dependencies = [ - "autocfg", "scopeguard", ] @@ -1517,12 +2640,48 @@ version = "0.4.28" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "34080505efa8e45a4b816c349525ebe327ceaa8559756f0356cba97ef3bf7432" +[[package]] +name = "loop9" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0fae87c125b03c1d2c0150c90365d7d6bcc53fb73a9acaef207d2d065860f062" +dependencies = [ + "imgref", +] + +[[package]] +name = "lru" +version = "0.16.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "96051b46fc183dc9cd4a223960ef37b9af631b55191852a8274bfef064cda20f" +dependencies = [ + "hashbrown 0.16.1", +] + [[package]] name = "lru-slab" version = "0.1.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "112b39cec0b298b6c1999fee3e31427f74f676e4cb9879ed1a121b43661a4154" +[[package]] +name = "lz4_flex" +version = "0.11.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "08ab2867e3eeeca90e844d1940eab391c9dc5228783db2ed999acbc0a9ed375a" +dependencies = [ + "twox-hash", +] + +[[package]] +name = "lz4_flex" +version = "0.12.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ab6473172471198271ff72e9379150e9dfd70d8e533e0752a27e515b48dd375e" +dependencies = [ + "twox-hash", +] + [[package]] name = "mail-builder" version = "0.4.4" @@ -1548,18 +2707,38 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "47e1ffaa40ddd1f3ed91f717a33c8c0ee23fff369e3aa8772b9605cc1d22f4c3" [[package]] -name = "md-5" -version = "0.10.6" +name = "matrixmultiply" +version = "0.3.10" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d89e7ee0cfbedfc4da3340218492196241d89eefb6dab27de5df917a6d2e78cf" +checksum = "a06de3016e9fae57a36fd14dba131fccf49f74b40b7fbdb472f96e361ec71a08" dependencies = [ - "cfg-if", - "digest", + "autocfg", + "rawpointer", ] [[package]] -name = "memchr" -version = "2.7.6" +name = "maybe-rayon" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ea1f30cedd69f0a2954655f7188c6a834246d2bcf1e315e2ac40c4b24dc9519" +dependencies = [ + "cfg-if", + "rayon", +] + +[[package]] +name = "md-5" +version = "0.10.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d89e7ee0cfbedfc4da3340218492196241d89eefb6dab27de5df917a6d2e78cf" +dependencies = [ + "cfg-if", + "digest", +] + +[[package]] +name = "memchr" +version = "2.7.6" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f52b00d39961fc5b2736ea853c9cc86238e165017a493d1d5c8eac6bdc4cc273" @@ -1586,17 +2765,28 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1fa76a2c86f704bdb222d66965fb3d63269ce38518b83cb0575fca855ebb6316" dependencies = [ "adler2", + "simd-adler32", ] [[package]] name = "mio" -version = "1.0.4" +version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "78bed444cc8a2160f01cbcf811ef18cac863ad68ae8ca62092e8db51d51c761c" +checksum = "69d83b0086dc8ecf3ce9ae2874b2d1290252e2a30720bea58a5c6639b0092873" dependencies = [ "libc", - "wasi 0.11.1+wasi-snapshot-preview1", - "windows-sys 0.59.0", + "wasi", + "windows-sys 0.61.2", +] + +[[package]] +name = "moxcms" +version = "0.7.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "80986bbbcf925ebd3be54c26613d861255284584501595cf418320c078945608" +dependencies = [ + "num-traits", + "pxfm", ] [[package]] @@ -1633,13 +2823,64 @@ dependencies = [ "tempfile", ] +[[package]] +name = "ndarray" +version = "0.16.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "882ed72dce9365842bf196bdeedf5055305f11fc8c03dee7bb0194a6cad34841" +dependencies = [ + "approx", + "matrixmultiply", + "num-complex", + "num-integer", + "num-traits", + "portable-atomic", + "portable-atomic-util", + "rawpointer", +] + +[[package]] +name = "new_debug_unreachable" +version = "1.0.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "650eef8c711430f1a879fdd01d4745a7deea475becfb90269c06775983bbf086" + +[[package]] +name = "nom" +version = "8.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "df9761775871bdef83bee530e60050f7e54b1105350d6884eb0fb4f46c2f9405" +dependencies = [ + "memchr", +] + +[[package]] +name = "noop_proc_macro" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0676bb32a98c1a483ce53e500a81ad9c3d5b3f7c920c28c24e9cb0980d0b5bc8" + [[package]] name = "nu-ansi-term" -version = "0.50.1" +version = "0.50.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d4a28e057d01f97e61255210fcff094d74ed0466038633e95017f5beb68e4399" +checksum = "7957b9740744892f114936ab4a57b3f487491bbeafaf8083688b16841a4240e5" dependencies = [ - "windows-sys 0.52.0", + "windows-sys 0.61.2", +] + +[[package]] +name = "num" +version = "0.4.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "35bd024e8b2ff75562e5f34e7f4905839deb4b22955ef5e73d2fea1b9813cb23" +dependencies = [ + "num-bigint", + "num-complex", + "num-integer", + "num-iter", + "num-rational", + "num-traits", ] [[package]] @@ -1655,27 +2896,46 @@ dependencies = [ [[package]] name = "num-bigint-dig" -version = "0.8.4" +version = "0.8.6" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dc84195820f291c7697304f3cbdadd1cb7199c0efc917ff5eafd71225c136151" +checksum = "e661dda6640fad38e827a6d4a310ff4763082116fe217f279885c97f511bb0b7" dependencies = [ - "byteorder", "lazy_static", "libm", "num-integer", "num-iter", "num-traits", "rand 0.8.5", - "smallvec", + "smallvec 1.15.1", "zeroize", ] +[[package]] +name = "num-complex" +version = "0.4.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "73f88a1307638156682bada9d7604135552957b7818057dcef22705b4d509495" +dependencies = [ + "num-traits", +] + [[package]] name = "num-conv" version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "51d515d32fb182ee37cda2ccdcb92950d6a3c2893aa280e540671c2cd0f3b1d9" +[[package]] +name = "num-derive" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ed3955f1a9c7c0c15e092f9c887db08b1fc683305fdf6eb6684f22555355e202" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "num-integer" version = "0.1.46" @@ -1742,7 +3002,7 @@ dependencies = [ "serde", "serde_json", "serde_qs", - "thiserror", + "thiserror 2.0.17", "url", ] @@ -1801,7 +3061,7 @@ dependencies = [ "serde_json", "serde_qs", "serde_yaml", - "thiserror", + "thiserror 2.0.17", "tokio", "tower", "tower-http", @@ -1838,9 +3098,9 @@ checksum = "42f5e15c9953c5e4ccceeb2e7382a716482c34515315f7b03532b8b4e8393d2d" [[package]] name = "once_cell_polyfill" -version = "1.70.1" +version = "1.70.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a4895175b425cb1f87721b59f0f286c2092bd4af812243672510e1ac53e2e0ad" +checksum = "384b8ab6d37215f3c5301a95a4accb5d64aa607f1fcb26a11b5303878451b4fe" [[package]] name = "openapiv3" @@ -1848,7 +3108,7 @@ version = "2.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "5c8d427828b22ae1fff2833a03d8486c2c881367f1c336349f307f321e7f4d05" dependencies = [ - "indexmap 2.11.4", + "indexmap 2.12.1", "serde", "serde_json", ] @@ -1897,6 +3157,17 @@ dependencies = [ "vcpkg", ] +[[package]] +name = "ordered-float" +version = "5.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7f4779c6901a562440c3786d08192c6fbda7c1c2060edd10006b05ee35d10f2d" +dependencies = [ + "num-traits", + "rand 0.8.5", + "serde", +] + [[package]] name = "ordered-multimap" version = "0.7.3" @@ -1907,6 +3178,55 @@ dependencies = [ "hashbrown 0.14.5", ] +[[package]] +name = "ort" +version = "2.0.0-rc.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1fa7e49bd669d32d7bc2a15ec540a527e7764aec722a45467814005725bcd721" +dependencies = [ + "ndarray", + "ort-sys", + "smallvec 2.0.0-alpha.10", + "tracing", +] + +[[package]] +name = "ort-sys" +version = "2.0.0-rc.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e2aba9f5c7c479925205799216e7e5d07cc1d4fa76ea8058c60a9a30f6a4e890" +dependencies = [ + "flate2", + "pkg-config", + "sha2", + "tar", + "ureq", +] + +[[package]] +name = "ouroboros" +version = "0.18.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1e0f050db9c44b97a94723127e6be766ac5c340c48f2c4bb3ffa11713744be59" +dependencies = [ + "aliasable", + "ouroboros_macro", + "static_assertions", +] + +[[package]] +name = "ouroboros_macro" +version = "0.18.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3c7028bdd3d43083f6d8d4d5187680d0d3560d54df4cc9d752005268b41e64d0" +dependencies = [ + "heck 0.4.1", + "proc-macro2", + "proc-macro2-diagnostics", + "quote", + "syn", +] + [[package]] name = "parking" version = "2.2.1" @@ -1915,9 +3235,9 @@ checksum = "f38d5652c16fde515bb1ecef450ab0f6a219d619a7274976324d5e377f7dceba" [[package]] name = "parking_lot" -version = "0.12.4" +version = "0.12.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "70d58bf43669b5795d1576d0641cfb6fbb2057bf629506267a92807158584a13" +checksum = "93857453250e3077bd71ff98b6a65ea6621a19bb0f559a85248955ac12c45a1a" dependencies = [ "lock_api", "parking_lot_core", @@ -1925,15 +3245,15 @@ dependencies = [ [[package]] name = "parking_lot_core" -version = "0.9.11" +version = "0.9.12" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bc838d2a56b5b1a6c25f55575dfc605fabb63bb2365f6c2353ef9159aa69e4a5" +checksum = "2621685985a2ebf1c516881c026032ac7deafcda1a2c9b7850dc81e3dfcb64c1" dependencies = [ "cfg-if", "libc", "redox_syscall", - "smallvec", - "windows-targets 0.52.6", + "smallvec 1.15.1", + "windows-link", ] [[package]] @@ -1951,12 +3271,24 @@ version = "1.0.15" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "57c0d7b74b563b49d38dae00a0c37d4d6de9b432382b2892f0574ddcae73fd0a" +[[package]] +name = "pastey" +version = "0.1.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "35fb2e5f958ec131621fdd531e9fc186ed768cbe395337403ae56c17a74c68ec" + [[package]] name = "pathdiff" version = "0.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "df94ce210e5bc13cb6651479fa48d14f601d9858cfe0467f43ae157023b938d3" +[[package]] +name = "pdqselect" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4ec91767ecc0a0bbe558ce8c9da33c068066c57ecc8bb8477ef8c1ad3ef77c27" + [[package]] name = "pem-rfc7468" version = "0.7.0" @@ -1974,9 +3306,9 @@ checksum = "9b4f627cb1b25917193a259e49bdad08f671f8d9708acfd5fe0a8c1455d87220" [[package]] name = "pest" -version = "2.8.3" +version = "2.8.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "989e7521a040efde50c3ab6bbadafbe15ab6dc042686926be59ac35d74607df4" +checksum = "cbcfd20a6d4eeba40179f05735784ad32bdaef05ce8e8af05f180d45bb3e7e22" dependencies = [ "memchr", "ucd-trie", @@ -1984,108 +3316,325 @@ dependencies = [ [[package]] name = "pest_derive" -version = "2.8.3" +version = "2.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51f72981ade67b1ca6adc26ec221be9f463f2b5839c7508998daa17c23d94d7f" +dependencies = [ + "pest", + "pest_generator", +] + +[[package]] +name = "pest_generator" +version = "2.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dee9efd8cdb50d719a80088b76f81aec7c41ed6d522ee750178f83883d271625" +dependencies = [ + "pest", + "pest_meta", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "pest_meta" +version = "2.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bf1d70880e76bdc13ba52eafa6239ce793d85c8e43896507e43dd8984ff05b82" +dependencies = [ + "pest", + "sha2", +] + +[[package]] +name = "phf" +version = "0.13.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c1562dc717473dbaa4c1f85a36410e03c047b2e7df7f45ee938fbef64ae7fadf" +dependencies = [ + "phf_shared", + "serde", +] + +[[package]] +name = "phf_shared" +version = "0.13.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e57fef6bc5981e38c2ce2d63bfa546861309f875b8a75f092d1d54ae2d64f266" +dependencies = [ + "siphasher", +] + +[[package]] +name = "pin-project" +version = "1.1.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "677f1add503faace112b9f1373e43e9e054bfdd22ff1a63c1bc485eaec6a6a8a" +dependencies = [ + "pin-project-internal", +] + +[[package]] +name = "pin-project-internal" +version = "1.1.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e918e4ff8c4549eb882f14b3a4bc8c8bc93de829416eacf579f1207a8fbf861" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "pin-project-lite" +version = "0.2.16" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3b3cff922bd51709b605d9ead9aa71031d81447142d828eb4a6eba76fe619f9b" + +[[package]] +name = "pin-utils" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" + +[[package]] +name = "pkcs1" +version = "0.7.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c8ffb9f10fa047879315e6625af03c164b16962a5368d724ed16323b68ace47f" +dependencies = [ + "der", + "pkcs8", + "spki", +] + +[[package]] +name = "pkcs8" +version = "0.10.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f950b2377845cebe5cf8b5165cb3cc1a5e0fa5cfa3e1f7f55707d8fd82e0a7b7" +dependencies = [ + "der", + "spki", +] + +[[package]] +name = "pkg-config" +version = "0.3.32" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7edddbd0b52d732b21ad9a5fab5c704c14cd949e5e9a1ec5929a24fded1b904c" + +[[package]] +name = "png" +version = "0.18.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "97baced388464909d42d89643fe4361939af9b7ce7a31ee32a168f832a70f2a0" +dependencies = [ + "bitflags", + "crc32fast", + "fdeflate", + "flate2", + "miniz_oxide", +] + +[[package]] +name = "portable-atomic" +version = "1.11.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f84267b20a16ea918e43c6a88433c2d54fa145c92a811b5b047ccbe153674483" + +[[package]] +name = "portable-atomic-util" +version = "0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d8a2f0d8d040d7848a709caf78912debcc3f33ee4b3cac47d73d1e1069e83507" +dependencies = [ + "portable-atomic", +] + +[[package]] +name = "postgres-derive" +version = "0.4.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56df96f5394370d1b20e49de146f9e6c25aa9ae750f449c9d665eafecb3ccae6" +dependencies = [ + "heck 0.5.0", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "postgres-protocol" +version = "0.6.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fbef655056b916eb868048276cfd5d6a7dea4f81560dfd047f97c8c6fe3fcfd4" +dependencies = [ + "base64", + "byteorder", + "bytes", + "fallible-iterator", + "hmac", + "md-5", + "memchr", + "rand 0.9.2", + "sha2", + "stringprep", +] + +[[package]] +name = "postgres-types" +version = "0.2.11" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ef4605b7c057056dd35baeb6ac0c0338e4975b1f2bef0f65da953285eb007095" +dependencies = [ + "array-init", + "bytes", + "chrono", + "fallible-iterator", + "postgres-derive", + "postgres-protocol", + "serde_core", + "serde_json", + "uuid", +] + +[[package]] +name = "potential_utf" +version = "0.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b73949432f5e2a09657003c25bca5e19a0e9c84f8058ca374f49e0ebe605af77" +dependencies = [ + "zerovec", +] + +[[package]] +name = "powerfmt" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "439ee305def115ba05938db6eb1644ff94165c5ab5e9420d1c1bcedbba909391" + +[[package]] +name = "ppv-lite86" +version = "0.2.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "85eae3c4ed2f50dcfe72643da4befc30deadb458a9b590d720cde2f2b1e97da9" +dependencies = [ + "zerocopy", +] + +[[package]] +name = "pretty_assertions" +version = "1.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "187da9a3030dbafabbbfb20cb323b976dc7b7ce91fcd84f2f74d6e31d378e2de" +checksum = "3ae130e2f271fbc2ac3a40fb1d07180839cdbbe443c7a27e1e3c13c5cac0116d" dependencies = [ - "pest", - "pest_generator", + "diff", + "yansi", ] [[package]] -name = "pest_generator" -version = "2.8.3" +name = "prettyplease" +version = "0.2.37" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "49b401d98f5757ebe97a26085998d6c0eecec4995cad6ab7fc30ffdf4b052843" +checksum = "479ca8adacdd7ce8f1fb39ce9ecccbfe93a3f1344b3d0d97f20bc0196208f62b" dependencies = [ - "pest", - "pest_meta", "proc-macro2", - "quote", "syn", ] [[package]] -name = "pest_meta" -version = "2.8.3" +name = "proc-macro2" +version = "1.0.103" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "72f27a2cfee9f9039c4d86faa5af122a0ac3851441a34865b8a043b46be0065a" +checksum = "5ee95bc4ef87b8d5ba32e8b7714ccc834865276eab0aed5c9958d00ec45f49e8" dependencies = [ - "pest", - "sha2", + "unicode-ident", ] [[package]] -name = "pin-project-lite" -version = "0.2.16" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3b3cff922bd51709b605d9ead9aa71031d81447142d828eb4a6eba76fe619f9b" - -[[package]] -name = "pin-utils" -version = "0.1.0" +name = "proc-macro2-diagnostics" +version = "0.10.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" +checksum = "af066a9c399a26e020ada66a034357a868728e72cd426f3adcd35f80d88d88c8" +dependencies = [ + "proc-macro2", + "quote", + "syn", + "version_check", + "yansi", +] [[package]] -name = "pkcs1" -version = "0.7.5" +name = "profiling" +version = "1.0.17" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c8ffb9f10fa047879315e6625af03c164b16962a5368d724ed16323b68ace47f" +checksum = "3eb8486b569e12e2c32ad3e204dbaba5e4b5b216e9367044f25f1dba42341773" dependencies = [ - "der", - "pkcs8", - "spki", + "profiling-procmacros", ] [[package]] -name = "pkcs8" -version = "0.10.2" +name = "profiling-procmacros" +version = "1.0.17" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f950b2377845cebe5cf8b5165cb3cc1a5e0fa5cfa3e1f7f55707d8fd82e0a7b7" +checksum = "52717f9a02b6965224f95ca2a81e2e0c5c43baacd28ca057577988930b6c3d5b" dependencies = [ - "der", - "spki", + "quote", + "syn", ] [[package]] -name = "pkg-config" -version = "0.3.32" +name = "proj" +version = "0.28.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7edddbd0b52d732b21ad9a5fab5c704c14cd949e5e9a1ec5929a24fded1b904c" +checksum = "4fee58a47991424a46bd2219d3caeda1804e64a85094a52958ee7810fe9754f7" +dependencies = [ + "geo-types", + "libc", + "num-traits", + "proj-sys", + "thiserror 1.0.69", +] [[package]] -name = "potential_utf" -version = "0.1.3" +name = "proj-sys" +version = "0.25.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "84df19adbe5b5a0782edcab45899906947ab039ccf4573713735ee7de1e6b08a" +checksum = "533a4ed2ab59f7605ecea26db7ed76572d30aed9d2a6a90738bc7f7e7b5a11d8" dependencies = [ - "zerovec", + "cmake", + "flate2", + "libsqlite3-sys", + "link-cplusplus", + "pkg-config", + "tar", ] [[package]] -name = "powerfmt" -version = "0.2.0" +name = "pxfm" +version = "0.1.26" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "439ee305def115ba05938db6eb1644ff94165c5ab5e9420d1c1bcedbba909391" +checksum = "b3502d6155304a4173a5f2c34b52b7ed0dd085890326cb50fd625fdf39e86b3b" +dependencies = [ + "num-traits", +] [[package]] -name = "ppv-lite86" -version = "0.2.21" +name = "qoi" +version = "0.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "85eae3c4ed2f50dcfe72643da4befc30deadb458a9b590d720cde2f2b1e97da9" +checksum = "7f6d64c71eb498fe9eae14ce4ec935c555749aef511cca85b5568910d6e48001" dependencies = [ - "zerocopy", + "bytemuck", ] [[package]] -name = "proc-macro2" -version = "1.0.101" +name = "quick-error" +version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "89ae43fd86e4158d6db51ad8e2b80f313af9cc74f5c0e03ccb87de09998732de" -dependencies = [ - "unicode-ident", -] +checksum = "a993555f31e5a609f617c12db6250dedcac1b0a85076912c436e6fc9b2c8e6a3" [[package]] name = "quinn" @@ -2101,7 +3650,7 @@ dependencies = [ "rustc-hash", "rustls", "socket2", - "thiserror", + "thiserror 2.0.17", "tokio", "tracing", "web-time", @@ -2114,7 +3663,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f1906b49b0c3bc04b5fe5d86a77925ae6524a19b816ae38ce1e426255f1d8a31" dependencies = [ "bytes", - "getrandom 0.3.3", + "getrandom 0.3.4", "lru-slab", "rand 0.9.2", "ring", @@ -2122,7 +3671,7 @@ dependencies = [ "rustls", "rustls-pki-types", "slab", - "thiserror", + "thiserror 2.0.17", "tinyvec", "tracing", "web-time", @@ -2144,9 +3693,9 @@ dependencies = [ [[package]] name = "quote" -version = "1.0.41" +version = "1.0.42" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ce25767e7b499d1b604768e7cde645d14cc8584231ea6b295e9c9eb22c02e1d1" +checksum = "a338cc41d27e6cc6dce6cefc13a0729dfbb81c262b1f519331575dd80ef3067f" dependencies = [ "proc-macro2", ] @@ -2166,6 +3715,7 @@ dependencies = [ "libc", "rand_chacha 0.3.1", "rand_core 0.6.4", + "serde", ] [[package]] @@ -2205,6 +3755,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ec0be4795e2f6a28069bec0b5ff3e2ac9bafc99e6a9a7dc3547996c5c816922c" dependencies = [ "getrandom 0.2.16", + "serde", ] [[package]] @@ -2213,14 +3764,90 @@ version = "0.9.3" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "99d9a13982dcf210057a8a78572b2217b667c3beacbf3a0d8b454f6f82837d38" dependencies = [ - "getrandom 0.3.3", + "getrandom 0.3.4", +] + +[[package]] +name = "rav1e" +version = "0.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "43b6dd56e85d9483277cde964fd1bdb0428de4fec5ebba7540995639a21cb32b" +dependencies = [ + "aligned-vec", + "arbitrary", + "arg_enum_proc_macro", + "arrayvec", + "av-scenechange", + "av1-grain", + "bitstream-io", + "built", + "cfg-if", + "interpolate_name", + "itertools 0.14.0", + "libc", + "libfuzzer-sys", + "log", + "maybe-rayon", + "new_debug_unreachable", + "noop_proc_macro", + "num-derive", + "num-traits", + "paste", + "profiling", + "rand 0.9.2", + "rand_chacha 0.9.0", + "simd_helpers", + "thiserror 2.0.17", + "v_frame", + "wasm-bindgen", +] + +[[package]] +name = "ravif" +version = "0.12.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ef69c1990ceef18a116855938e74793a5f7496ee907562bd0857b6ac734ab285" +dependencies = [ + "avif-serialize", + "imgref", + "loop9", + "quick-error", + "rav1e", + "rayon", + "rgb", +] + +[[package]] +name = "rawpointer" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "60a357793950651c4ed0f3f52338f53b2f809f32d83a07f72909fa13e4c6c1e3" + +[[package]] +name = "rayon" +version = "1.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "368f01d005bf8fd9b1206fb6fa653e6c4a81ceb1466406b81792d87c5677a58f" +dependencies = [ + "either", + "rayon-core", +] + +[[package]] +name = "rayon-core" +version = "1.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "22e18b0f0062d30d4230b2e85ff77fdfe4326feb054b9783a3460d8435c8ab91" +dependencies = [ + "crossbeam-deque", + "crossbeam-utils", ] [[package]] name = "redox_syscall" -version = "0.5.17" +version = "0.5.18" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5407465600fb0548f1442edf71dd20683c6ed326200ace4b1ef0763521bb3b77" +checksum = "ed2bf2547551a7053d6fdfafda3f938979645c44812fbfcda098faae3f1a362d" dependencies = [ "bitflags", ] @@ -2247,9 +3874,9 @@ dependencies = [ [[package]] name = "regex" -version = "1.11.3" +version = "1.12.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8b5288124840bee7b386bc413c487869b360b2b4ec421ea56425128692f2a82c" +checksum = "843bc0191f75f3e22651ae5f1e72939ab2f72a4bc30fa80a066bd66edefc24d4" dependencies = [ "aho-corasick", "memchr", @@ -2259,9 +3886,9 @@ dependencies = [ [[package]] name = "regex-automata" -version = "0.4.11" +version = "0.4.13" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "833eb9ce86d40ef33cb1306d8accf7bc8ec2bfea4355cbdebb3df68b40925cad" +checksum = "5276caf25ac86c8d810222b3dbb938e512c55c6831a10f3e6ed1c93b84041f1c" dependencies = [ "aho-corasick", "memchr", @@ -2270,9 +3897,9 @@ dependencies = [ [[package]] name = "regex-syntax" -version = "0.8.6" +version = "0.8.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "caf4aa5b0f434c91fe5c7f1ecb6a5ece2130b02ad2a590589dda5146df959001" +checksum = "7a2d987857b319362043e95f5353c0535c1f58eec5336fdfcf626430af7def58" [[package]] name = "reqwest" @@ -2280,7 +3907,7 @@ version = "0.12.24" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9d0946410b9f7b082a427e4ef5c8ff541a88b357bc6c637c40db3a68ac70a36f" dependencies = [ - "base64 0.22.1", + "base64", "bytes", "futures-channel", "futures-core", @@ -2315,9 +3942,15 @@ dependencies = [ "wasm-bindgen", "wasm-bindgen-futures", "web-sys", - "webpki-roots 1.0.2", + "webpki-roots 1.0.4", ] +[[package]] +name = "rgb" +version = "0.8.52" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0c6a884d2998352bb4daf0183589aec883f16a6da1f4dde84d8e2e9a5409a1ce" + [[package]] name = "ring" version = "0.17.14" @@ -2341,7 +3974,7 @@ dependencies = [ "chrono", "chrono-humanize", "chrono-tz", - "indexmap 2.11.4", + "indexmap 2.12.1", "num-bigint", "num-rational", "num-traits", @@ -2350,23 +3983,31 @@ dependencies = [ "strsim 0.10.0", ] +[[package]] +name = "robust" +version = "1.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4e27ee8bb91ca0adcf0ecb116293afa12d393f9c2b9b9cd54d33e8078fe19839" + [[package]] name = "ron" -version = "0.8.1" +version = "0.12.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b91f7eff05f748767f183df4320a63d6936e9c6107d97c9e6bdd9784f4289c94" +checksum = "fd490c5b18261893f14449cbd28cb9c0b637aebf161cd77900bfdedaff21ec32" dependencies = [ - "base64 0.21.7", "bitflags", + "once_cell", "serde", "serde_derive", + "typeid", + "unicode-ident", ] [[package]] name = "rsa" -version = "0.9.8" +version = "0.9.9" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "78928ac1ed176a5ca1d17e578a1825f3d81ca54cf41053a592584b020cfd691b" +checksum = "40a0376c50d0358279d9d643e4bf7b7be212f1f4ff1da9070a7b54d22ef75c88" dependencies = [ "const-oid", "digest", @@ -2382,6 +4023,67 @@ dependencies = [ "zeroize", ] +[[package]] +name = "rstar" +version = "0.8.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3a45c0e8804d37e4d97e55c6f258bc9ad9c5ee7b07437009dd152d764949a27c" +dependencies = [ + "heapless 0.6.1", + "num-traits", + "pdqselect", + "serde", + "smallvec 1.15.1", +] + +[[package]] +name = "rstar" +version = "0.9.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b40f1bfe5acdab44bc63e6699c28b74f75ec43afb59f3eda01e145aff86a25fa" +dependencies = [ + "heapless 0.7.17", + "num-traits", + "serde", + "smallvec 1.15.1", +] + +[[package]] +name = "rstar" +version = "0.10.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1f39465655a1e3d8ae79c6d9e007f4953bfc5d55297602df9dc38f9ae9f1359a" +dependencies = [ + "heapless 0.7.17", + "num-traits", + "serde", + "smallvec 1.15.1", +] + +[[package]] +name = "rstar" +version = "0.11.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "73111312eb7a2287d229f06c00ff35b51ddee180f017ab6dec1f69d62ac098d6" +dependencies = [ + "heapless 0.7.17", + "num-traits", + "serde", + "smallvec 1.15.1", +] + +[[package]] +name = "rstar" +version = "0.12.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "421400d13ccfd26dfa5858199c30a5d76f9c54e0dba7575273025b43c5175dbb" +dependencies = [ + "heapless 0.8.0", + "num-traits", + "serde", + "smallvec 1.15.1", +] + [[package]] name = "rust-embed" version = "8.9.0" @@ -2432,6 +4134,15 @@ version = "2.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "357703d41365b4b27c590e3ed91eabb1b663f07c4c084095e60cbed4362dff0d" +[[package]] +name = "rustc_version" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cfcb3a22ef46e85b45de6ee7e79d063319ebb6594faafcf1c225ea92ab6e9b92" +dependencies = [ + "semver", +] + [[package]] name = "rustix" version = "1.1.2" @@ -2442,14 +4153,14 @@ dependencies = [ "errno", "libc", "linux-raw-sys", - "windows-sys 0.60.2", + "windows-sys 0.61.2", ] [[package]] name = "rustls" -version = "0.23.32" +version = "0.23.35" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cd3c25631629d034ce7cd9940adc9d45762d46de2b0f57193c4443b92c6d4d40" +checksum = "533f54bc6a7d4f647e46ad909549eda97bf5afc1585190ef692b4286b198bd8f" dependencies = [ "once_cell", "ring", @@ -2461,9 +4172,9 @@ dependencies = [ [[package]] name = "rustls-pki-types" -version = "1.12.0" +version = "1.13.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "229a4a4c221013e7e1f1a043678c5cc39fe5171437c88fb47151a21e6f5b5c79" +checksum = "708c0f9d5f54ba0272468c1d306a52c495b31fa155e91bc25371e6df7996908c" dependencies = [ "web-time", "zeroize", @@ -2471,9 +4182,9 @@ dependencies = [ [[package]] name = "rustls-webpki" -version = "0.103.7" +version = "0.103.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e10b3f4191e8a80e6b43eebabfac91e5dcecebb27a71f04e820c47ec41d314bf" +checksum = "2ffdfa2f5286e2247234e03f680868ac2815974dc39e00ea15adc445d0aafe52" dependencies = [ "ring", "rustls-pki-types", @@ -2507,7 +4218,7 @@ version = "0.1.28" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "891d81b926048e76efe18581bf793546b4c0eaf8448d72be8de2bbee5fd166e1" dependencies = [ - "windows-sys 0.61.1", + "windows-sys 0.61.2", ] [[package]] @@ -2576,6 +4287,12 @@ dependencies = [ "libc", ] +[[package]] +name = "semver" +version = "1.0.27" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d767eb0aabc880b29956c35734170f26ed551a859dbd361d140cdbeca61ab1e2" + [[package]] name = "serde" version = "1.0.228" @@ -2663,7 +4380,7 @@ dependencies = [ "percent-encoding", "ryu", "serde", - "thiserror", + "thiserror 2.0.17", ] [[package]] @@ -2679,9 +4396,9 @@ dependencies = [ [[package]] name = "serde_spanned" -version = "1.0.2" +version = "1.0.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5417783452c2be558477e104686f7de5dae53dba813c28435e0e70f82d9b04ee" +checksum = "e24345aa0fe688594e73770a5f6d1b216508b4f93484c0026d521acd30134392" dependencies = [ "serde_core", ] @@ -2700,19 +4417,18 @@ dependencies = [ [[package]] name = "serde_with" -version = "3.14.1" +version = "3.16.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c522100790450cf78eeac1507263d0a350d4d5b30df0c8e1fe051a10c22b376e" +checksum = "4fa237f2807440d238e0364a218270b98f767a00d3dada77b1c53ae88940e2e7" dependencies = [ - "base64 0.22.1", + "base64", "chrono", "hex", "indexmap 1.9.3", - "indexmap 2.11.4", + "indexmap 2.12.1", "schemars 0.9.0", "schemars 1.1.0", - "serde", - "serde_derive", + "serde_core", "serde_json", "serde_with_macros", "time", @@ -2720,9 +4436,9 @@ dependencies = [ [[package]] name = "serde_with_macros" -version = "3.14.1" +version = "3.16.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "327ada00f7d64abaac1e55a6911e90cf665aa051b9a561c7006c157f4633135e" +checksum = "52a8e3ca0ca629121f70ab50f95249e5a6f925cc0f6ffe8256c45b728875706c" dependencies = [ "darling", "proc-macro2", @@ -2736,7 +4452,7 @@ version = "0.9.34+deprecated" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6a8b1a1a2ebf674015cc02edccce75287f1a0130d394307b36743c2f5d504b47" dependencies = [ - "indexmap 2.11.4", + "indexmap 2.12.1", "itoa", "ryu", "serde", @@ -2754,6 +4470,12 @@ dependencies = [ "digest", ] +[[package]] +name = "sha1_smol" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbfa15b3dddfee50a0fff136974b3e1bde555604ba463834a7eb7deb6417705d" + [[package]] name = "sha2" version = "0.10.9" @@ -2782,9 +4504,9 @@ checksum = "0fda2ff0d084019ba4d7c6f371c95d8fd75ce3524c3cb8fb653a3023f6323e64" [[package]] name = "signal-hook-registry" -version = "1.4.6" +version = "1.4.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b2a4719bff48cee6b39d12c020eeb490953ad2443b7055bd0b21fca26bd8c28b" +checksum = "7664a098b8e616bdfcc2dc0e9ac44eb231eedf41db4e9fe95d8d32ec728dedad" dependencies = [ "libc", ] @@ -2805,6 +4527,27 @@ version = "0.3.7" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d66dc143e6b11c1eddc06d5c423cfc97062865baf299914ab64caa38182078fe" +[[package]] +name = "simd_helpers" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "95890f873bec569a0362c235787f3aca6e1e887302ba4840839bcc6459c42da6" +dependencies = [ + "quote", +] + +[[package]] +name = "simdutf8" +version = "0.1.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e3a9fe34e3e7a50316060351f37187a3f546bce95496156754b601a5fa71b76e" + +[[package]] +name = "siphasher" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56199f7ddabf13fe5074ce809e7d3f42b42ae711800501b5b16ea82ad029c39d" + [[package]] name = "slab" version = "0.4.11" @@ -2820,14 +4563,64 @@ dependencies = [ "serde", ] +[[package]] +name = "smallvec" +version = "2.0.0-alpha.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51d44cfb396c3caf6fbfd0ab422af02631b69ddd96d2eff0b0f0724f9024051b" + +[[package]] +name = "snafu" +version = "0.8.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6e84b3f4eacbf3a1ce05eac6763b4d629d60cbc94d632e4092c54ade71f1e1a2" +dependencies = [ + "snafu-derive", +] + +[[package]] +name = "snafu-derive" +version = "0.8.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c1c97747dbf44bb1ca44a561ece23508e99cb592e862f22222dcf42f51d1e451" +dependencies = [ + "heck 0.5.0", + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "socket2" -version = "0.6.0" +version = "0.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "17129e116933cf371d018bb80ae557e889637989d8638274fb25622827b03881" +dependencies = [ + "libc", + "windows-sys 0.60.2", +] + +[[package]] +name = "socks" +version = "0.3.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "233504af464074f9d066d7b5416c5f9b894a5862a6506e306f7b816cdd6f1807" +checksum = "f0c3dbbd9ae980613c6dd8e28a9407b50509d3803b57624d5dfe8315218cd58b" dependencies = [ + "byteorder", "libc", - "windows-sys 0.59.0", + "winapi", +] + +[[package]] +name = "spade" +version = "2.15.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fb313e1c8afee5b5647e00ee0fe6855e3d529eb863a0fdae1d60006c4d1e9990" +dependencies = [ + "hashbrown 0.15.5", + "num-traits", + "robust", + "smallvec 1.15.1", ] [[package]] @@ -2868,7 +4661,7 @@ version = "0.8.6" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ee6798b1838b6a0f69c007c133b8df5866302197e404e8b6ee8ed3e3a5e68dc6" dependencies = [ - "base64 0.22.1", + "base64", "bytes", "crc", "crossbeam-queue", @@ -2880,7 +4673,7 @@ dependencies = [ "futures-util", "hashbrown 0.15.5", "hashlink", - "indexmap 2.11.4", + "indexmap 2.12.1", "log", "memchr", "once_cell", @@ -2889,8 +4682,8 @@ dependencies = [ "serde", "serde_json", "sha2", - "smallvec", - "thiserror", + "smallvec 1.15.1", + "thiserror 2.0.17", "tokio", "tokio-stream", "tracing", @@ -2919,7 +4712,7 @@ checksum = "19a9c1841124ac5a61741f96e1d9e2ec77424bf323962dd894bdb93f37d5219b" dependencies = [ "dotenvy", "either", - "heck", + "heck 0.5.0", "hex", "once_cell", "proc-macro2", @@ -2943,7 +4736,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "aa003f0038df784eb8fecbbac13affe3da23b45194bd57dba231c8f48199c526" dependencies = [ "atoi", - "base64 0.22.1", + "base64", "bitflags", "byteorder", "bytes", @@ -2955,7 +4748,7 @@ dependencies = [ "futures-core", "futures-io", "futures-util", - "generic-array", + "generic-array 0.14.7", "hex", "hkdf", "hmac", @@ -2970,10 +4763,10 @@ dependencies = [ "serde", "sha1", "sha2", - "smallvec", + "smallvec 1.15.1", "sqlx-core", "stringprep", - "thiserror", + "thiserror 2.0.17", "tracing", "whoami", ] @@ -2985,7 +4778,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "db58fcd5a53cf07c184b154801ff91347e4c30d17a3562a635ff028ad5deda46" dependencies = [ "atoi", - "base64 0.22.1", + "base64", "bitflags", "byteorder", "crc", @@ -3007,10 +4800,10 @@ dependencies = [ "serde", "serde_json", "sha2", - "smallvec", + "smallvec 1.15.1", "sqlx-core", "stringprep", - "thiserror", + "thiserror 2.0.17", "tracing", "whoami", ] @@ -3034,16 +4827,33 @@ dependencies = [ "serde", "serde_urlencoded", "sqlx-core", - "thiserror", + "thiserror 2.0.17", "tracing", "url", ] [[package]] name = "stable_deref_trait" -version = "1.2.0" +version = "1.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6ce2be8dc25455e1f91df71bfa12ad37d7af1092ae736f3a6cd0e37bc7810596" + +[[package]] +name = "static_assertions" +version = "1.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a2eb9349b6444b326872e140eb1cf5e7c522154d69e7a0ffb0fb81c06b37543f" + +[[package]] +name = "stream-cancel" +version = "0.8.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a8f112729512f8e442d81f95a8a7ddf2b7c6b8a1a6f509a95864142b30cab2d3" +checksum = "5f9fbf9bd71e4cf18d68a8a0951c0e5b7255920c0cd992c4ff51cddd6ef514a3" +dependencies = [ + "futures-core", + "pin-project", + "tokio", +] [[package]] name = "stringprep" @@ -3060,13 +4870,34 @@ dependencies = [ name = "strsim" version = "0.10.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "73473c0e59e6d5812c5dfe2a064a6444949f089e20eec9a2e5506596494e4623" +checksum = "73473c0e59e6d5812c5dfe2a064a6444949f089e20eec9a2e5506596494e4623" + +[[package]] +name = "strsim" +version = "0.11.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7da8b5736845d9f2fcb837ea5d9e2628564b3b043a70948a3f0b778838c5fb4f" + +[[package]] +name = "strum" +version = "0.27.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "af23d6f6c1a224baef9d3f61e287d2761385a5b88fdab4eb4c6f11aeb54c4bcf" +dependencies = [ + "strum_macros", +] [[package]] -name = "strsim" -version = "0.11.1" +name = "strum_macros" +version = "0.27.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7da8b5736845d9f2fcb837ea5d9e2628564b3b043a70948a3f0b778838c5fb4f" +checksum = "7695ce3845ea4b33927c055a39dc438a45b059f7c1b3d91d38d10355fb8cbca7" +dependencies = [ + "heck 0.5.0", + "proc-macro2", + "quote", + "syn", +] [[package]] name = "subtle" @@ -3076,9 +4907,9 @@ checksum = "13c2bddecc57b384dee18652358fb23172facb8a2c51ccc10d74c157bdea3292" [[package]] name = "syn" -version = "2.0.106" +version = "2.0.111" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ede7c438028d4436d71104916910f5bb611972c5cfd7f89b8300a8186e6fada6" +checksum = "390cc9a294ab71bdb1aa2e99d13be9c753cd2d7bd6560c77118597410c4d2e87" dependencies = [ "proc-macro2", "quote", @@ -3105,6 +4936,17 @@ dependencies = [ "syn", ] +[[package]] +name = "tar" +version = "0.4.44" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1d863878d212c87a19c1a610eb53bb01fe12951c0501cf5a0d65f724914a667a" +dependencies = [ + "filetime", + "libc", + "xattr", +] + [[package]] name = "tempfile" version = "3.23.0" @@ -3112,10 +4954,19 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2d31c77bdf42a745371d260a26ca7163f1e0924b64afa0b688e61b5a9fa02f16" dependencies = [ "fastrand", - "getrandom 0.3.3", + "getrandom 0.3.4", "once_cell", "rustix", - "windows-sys 0.52.0", + "windows-sys 0.61.2", +] + +[[package]] +name = "thiserror" +version = "1.0.69" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b6aaf5339b578ea85b50e080feb250a3e8ae8cfcdff9a461c9ec2904bc923f52" +dependencies = [ + "thiserror-impl 1.0.69", ] [[package]] @@ -3124,7 +4975,18 @@ version = "2.0.17" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f63587ca0f12b72a0600bcba1d40081f830876000bb46dd2337a3051618f4fc8" dependencies = [ - "thiserror-impl", + "thiserror-impl 2.0.17", +] + +[[package]] +name = "thiserror-impl" +version = "1.0.69" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4fee6c4efc90059e10f81e6d42c60a18f76588c3d74cb83a0b242a2b6c7504c1" +dependencies = [ + "proc-macro2", + "quote", + "syn", ] [[package]] @@ -3147,6 +5009,20 @@ dependencies = [ "cfg-if", ] +[[package]] +name = "tiff" +version = "0.10.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "af9605de7fee8d9551863fd692cce7637f548dbd9db9180fcc07ccc6d26c336f" +dependencies = [ + "fax", + "flate2", + "half", + "quick-error", + "weezl", + "zune-jpeg 0.4.21", +] + [[package]] name = "time" version = "0.3.44" @@ -3189,9 +5065,9 @@ dependencies = [ [[package]] name = "tinystr" -version = "0.8.1" +version = "0.8.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5d4f6d1145dcb577acf783d4e601bc1d76a13337bb54e6233add580b07344c8b" +checksum = "42d3e9c45c09de15d06dd8acf5f4e0e399e85927b7f00711024eb7ae10fa4869" dependencies = [ "displaydoc", "zerovec", @@ -3226,7 +5102,7 @@ dependencies = [ "signal-hook-registry", "socket2", "tokio-macros", - "windows-sys 0.61.1", + "windows-sys 0.61.2", ] [[package]] @@ -3250,6 +5126,32 @@ dependencies = [ "tokio", ] +[[package]] +name = "tokio-postgres" +version = "0.7.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2b40d66d9b2cfe04b628173409368e58247e8eddbbd3b0e6c6ba1d09f20f6c9e" +dependencies = [ + "async-trait", + "byteorder", + "bytes", + "fallible-iterator", + "futures-channel", + "futures-util", + "log", + "parking_lot", + "percent-encoding", + "phf", + "pin-project-lite", + "postgres-protocol", + "postgres-types", + "rand 0.9.2", + "socket2", + "tokio", + "tokio-util", + "whoami", +] + [[package]] name = "tokio-rustls" version = "0.26.4" @@ -3273,9 +5175,9 @@ dependencies = [ [[package]] name = "tokio-util" -version = "0.7.16" +version = "0.7.17" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "14307c986784f72ef81c89db7d9e28d6ac26d16213b109ea501696195e6e3ce5" +checksum = "2efa149fe76073d6e8fd97ef4f4eca7b67f599660115591483572e406e165594" dependencies = [ "bytes", "futures-core", @@ -3286,9 +5188,9 @@ dependencies = [ [[package]] name = "toml" -version = "0.9.7" +version = "0.9.8" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "00e5e5d9bf2475ac9d4f0d9edab68cc573dc2fd644b0dba36b0c30a92dd9eaa0" +checksum = "f0dc8b1fb61449e27716ec0e1bdf0f6b8f3e8f6b05391e8497b8b6d7804ea6d8" dependencies = [ "serde_core", "serde_spanned", @@ -3299,18 +5201,18 @@ dependencies = [ [[package]] name = "toml_datetime" -version = "0.7.2" +version = "0.7.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "32f1085dec27c2b6632b04c80b3bb1b4300d6495d1e129693bdda7d91e72eec1" +checksum = "f2cdb639ebbc97961c51720f858597f7f24c4fc295327923af55b74c3c724533" dependencies = [ "serde_core", ] [[package]] name = "toml_parser" -version = "1.0.3" +version = "1.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4cf893c33be71572e0e9aa6dd15e6677937abd686b066eac3f8cd3531688a627" +checksum = "c0cbe268d35bdb4bb5a56a2de88d0ad0eb70af5384a99d648cd4b3d04039800e" dependencies = [ "winnow", ] @@ -3333,9 +5235,9 @@ dependencies = [ [[package]] name = "tower-http" -version = "0.6.6" +version = "0.6.7" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "adc82fd73de2a9722ac5da747f12383d2bfdb93591ee6c58486e0097890f05f2" +checksum = "9cf146f99d442e8e68e585f5d798ccd3cad9a7835b917e09728880a862706456" dependencies = [ "async-compression", "bitflags", @@ -3370,9 +5272,9 @@ checksum = "8df9b6e13f2d32c91b9bd719c00d1958837bc7dec474d94952798cc8e69eeec3" [[package]] name = "tracing" -version = "0.1.41" +version = "0.1.43" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "784e0ac535deb450455cbfa28a6f0df145ea1bb7ae51b821cf5e7927fdcfbdd0" +checksum = "2d15d90a0b5c19378952d479dc858407149d7bb45a14de0142f6c534b16fc647" dependencies = [ "log", "pin-project-lite", @@ -3382,9 +5284,9 @@ dependencies = [ [[package]] name = "tracing-attributes" -version = "0.1.30" +version = "0.1.31" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "81383ab64e72a7a8b8e13130c49e3dab29def6d0c7d76a03087b3cf71c5c6903" +checksum = "7490cfa5ec963746568740651ac6781f701c9c5ea257c58e057f3ba8cf69e8da" dependencies = [ "proc-macro2", "quote", @@ -3393,9 +5295,9 @@ dependencies = [ [[package]] name = "tracing-core" -version = "0.1.34" +version = "0.1.35" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b9d12581f227e93f094d3af2ae690a574abb8a2b9b7a96e7cfe9647b2b617678" +checksum = "7a04e24fab5c89c6a36eb8558c9656f30d81de51dfa4d3b45f26b21d61fa0a6c" dependencies = [ "once_cell", "valuable", @@ -3414,16 +5316,16 @@ dependencies = [ [[package]] name = "tracing-subscriber" -version = "0.3.20" +version = "0.3.22" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2054a14f5307d601f88daf0553e1cbf472acc4f2c51afab632431cdcd72124d5" +checksum = "2f30143827ddab0d256fd843b7a66d164e9f271cfa0dde49142c5ca0ca291f1e" dependencies = [ "matchers", "nu-ansi-term", "once_cell", "regex-automata", "sharded-slab", - "smallvec", + "smallvec 1.15.1", "thread_local", "tracing", "tracing-core", @@ -3436,6 +5338,12 @@ version = "0.2.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e421abadd41a4225275504ea4d6566923418b7f05506fbc9c0fe86ba7396114b" +[[package]] +name = "twox-hash" +version = "2.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9ea3136b675547379c4bd395ca6b938e5ad3c3d20fad76e7fe85f9e0d011419c" + [[package]] name = "typeid" version = "1.0.3" @@ -3448,6 +5356,30 @@ version = "1.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "562d481066bde0658276a35467c4af00bdc6ee726305698a55b86e61d7ad82bb" +[[package]] +name = "typetag" +version = "0.2.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "be2212c8a9b9bcfca32024de14998494cf9a5dfa59ea1b829de98bac374b86bf" +dependencies = [ + "erased-serde", + "inventory", + "once_cell", + "serde", + "typetag-impl", +] + +[[package]] +name = "typetag-impl" +version = "0.2.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "27a7a9b72ba121f6f1f6c3632b85604cac41aedb5ddc70accbebb6cac83de846" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "ucd-trie" version = "0.1.7" @@ -3468,24 +5400,24 @@ checksum = "5c1cb5db39152898a79168971543b1cb5020dff7fe43c8dc468b0885f5e29df5" [[package]] name = "unicode-ident" -version = "1.0.19" +version = "1.0.22" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f63a545481291138910575129486daeaf8ac54aee4387fe7906919f7830c7d9d" +checksum = "9312f7c4f6ff9069b165498234ce8be658059c6728633667c526e27dc2cf1df5" [[package]] name = "unicode-normalization" -version = "0.1.24" +version = "0.1.25" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5033c97c4262335cded6d6fc3e5c18ab755e1a3dc96376350f3d8e9f009ad956" +checksum = "5fd4f6878c9cb28d874b009da9e8d183b5abc80117c40bbd187a1fde336be6e8" dependencies = [ "tinyvec", ] [[package]] name = "unicode-properties" -version = "0.1.3" +version = "0.1.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e70f2a8b45122e719eb623c01822704c4e0907e7e426a05927e1a1cfff5b75d0" +checksum = "7df058c713841ad818f1dc5d3fd88063241cc61f49f5fbea4b951e8cf5a8d71d" [[package]] name = "unicode-segmentation" @@ -3505,6 +5437,36 @@ version = "0.9.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "8ecb6da28b8a351d773b68d5825ac39017e680750f980f3a1a85cd8dd28a47c1" +[[package]] +name = "ureq" +version = "3.1.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d39cb1dbab692d82a977c0392ffac19e188bd9186a9f32806f0aaa859d75585a" +dependencies = [ + "base64", + "der", + "log", + "native-tls", + "percent-encoding", + "rustls-pki-types", + "socks", + "ureq-proto", + "utf-8", + "webpki-root-certs", +] + +[[package]] +name = "ureq-proto" +version = "0.5.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d81f9efa9df032be5934a46a068815a10a042b494b6a58cb0a1a97bb5467ed6f" +dependencies = [ + "base64", + "http", + "httparse", + "log", +] + [[package]] name = "url" version = "2.5.7" @@ -3517,6 +5479,12 @@ dependencies = [ "serde", ] +[[package]] +name = "utf-8" +version = "0.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "09cc8ee72d2a9becf2f2febe0205bbed8fc6615b7cb429ad062dc7b7ddd036a9" + [[package]] name = "utf8_iter" version = "1.0.4" @@ -3535,7 +5503,7 @@ version = "5.4.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2fcc29c80c21c31608227e0912b2d7fddba57ad76b606890627ba8ee7964e993" dependencies = [ - "indexmap 2.11.4", + "indexmap 2.12.1", "serde", "serde_json", "utoipa-gen", @@ -3574,7 +5542,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d047458f1b5b65237c2f6dc6db136945667f40a7668627b3490b9513a3d43a55" dependencies = [ "axum", - "base64 0.22.1", + "base64", "mime_guess", "regex", "rust-embed", @@ -3587,13 +5555,25 @@ dependencies = [ [[package]] name = "uuid" -version = "1.18.1" +version = "1.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2f87b8aa10b915a06587d0dec516c282ff295b475d94abf425d62b57710070a2" +checksum = "e2e054861b4bd027cd373e18e8d8d8e6548085000e41290d95ce0c373a654b4a" dependencies = [ - "getrandom 0.3.3", + "getrandom 0.3.4", "js-sys", - "serde", + "serde_core", + "sha1_smol", + "wasm-bindgen", +] + +[[package]] +name = "v_frame" +version = "0.3.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "666b7727c8875d6ab5db9533418d7c764233ac9c0cff1d469aec8fa127597be2" +dependencies = [ + "aligned-vec", + "num-traits", "wasm-bindgen", ] @@ -3640,15 +5620,6 @@ version = "0.11.1+wasi-snapshot-preview1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ccf3ec651a847eb01de73ccad15eb7d99f80485de043efb2f370cd654f4ea44b" -[[package]] -name = "wasi" -version = "0.14.7+wasi-0.2.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "883478de20367e224c0090af9cf5f9fa85bed63a95c1abf3afc5c083ebc06e8c" -dependencies = [ - "wasip2", -] - [[package]] name = "wasip2" version = "1.0.1+wasi-0.2.4" @@ -3666,9 +5637,9 @@ checksum = "b8dad83b4f25e74f184f64c43b150b91efe7647395b42289f38e50566d82855b" [[package]] name = "wasm-bindgen" -version = "0.2.104" +version = "0.2.106" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c1da10c01ae9f1ae40cbfac0bac3b1e724b320abfcf52229f80b547c0d250e2d" +checksum = "0d759f433fa64a2d763d1340820e46e111a7a5ab75f993d1852d70b03dbb80fd" dependencies = [ "cfg-if", "once_cell", @@ -3677,25 +5648,11 @@ dependencies = [ "wasm-bindgen-shared", ] -[[package]] -name = "wasm-bindgen-backend" -version = "0.2.104" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "671c9a5a66f49d8a47345ab942e2cb93c7d1d0339065d4f8139c486121b43b19" -dependencies = [ - "bumpalo", - "log", - "proc-macro2", - "quote", - "syn", - "wasm-bindgen-shared", -] - [[package]] name = "wasm-bindgen-futures" -version = "0.4.54" +version = "0.4.56" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7e038d41e478cc73bae0ff9b36c60cff1c98b8f38f8d7e8061e79ee63608ac5c" +checksum = "836d9622d604feee9e5de25ac10e3ea5f2d65b41eac0d9ce72eb5deae707ce7c" dependencies = [ "cfg-if", "js-sys", @@ -3706,9 +5663,9 @@ dependencies = [ [[package]] name = "wasm-bindgen-macro" -version = "0.2.104" +version = "0.2.106" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7ca60477e4c59f5f2986c50191cd972e3a50d8a95603bc9434501cf156a9a119" +checksum = "48cb0d2638f8baedbc542ed444afc0644a29166f1595371af4fecf8ce1e7eeb3" dependencies = [ "quote", "wasm-bindgen-macro-support", @@ -3716,31 +5673,31 @@ dependencies = [ [[package]] name = "wasm-bindgen-macro-support" -version = "0.2.104" +version = "0.2.106" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9f07d2f20d4da7b26400c9f4a0511e6e0345b040694e8a75bd41d578fa4421d7" +checksum = "cefb59d5cd5f92d9dcf80e4683949f15ca4b511f4ac0a6e14d4e1ac60c6ecd40" dependencies = [ + "bumpalo", "proc-macro2", "quote", "syn", - "wasm-bindgen-backend", "wasm-bindgen-shared", ] [[package]] name = "wasm-bindgen-shared" -version = "0.2.104" +version = "0.2.106" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bad67dc8b2a1a6e5448428adec4c3e84c43e561d8c9ee8a9e5aabeb193ec41d1" +checksum = "cbc538057e648b67f72a982e708d485b2efa771e1ac05fec311f9f63e5800db4" dependencies = [ "unicode-ident", ] [[package]] name = "web-sys" -version = "0.3.81" +version = "0.3.83" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9367c417a924a74cae129e6a2ae3b47fabb1f8995595ab474029da749a8be120" +checksum = "9b32828d774c412041098d182a8b38b16ea816958e07cf40eec2bc080ae137ac" dependencies = [ "js-sys", "wasm-bindgen", @@ -3756,24 +5713,39 @@ dependencies = [ "wasm-bindgen", ] +[[package]] +name = "webpki-root-certs" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ee3e3b5f5e80bc89f30ce8d0343bf4e5f12341c51f3e26cbeecbc7c85443e85b" +dependencies = [ + "rustls-pki-types", +] + [[package]] name = "webpki-roots" version = "0.26.11" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "521bc38abb08001b01866da9f51eb7c5d647a19260e00054a8c7fd5f9e57f7a9" dependencies = [ - "webpki-roots 1.0.2", + "webpki-roots 1.0.4", ] [[package]] name = "webpki-roots" -version = "1.0.2" +version = "1.0.4" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7e8983c3ab33d6fb807cfcdad2491c4ea8cbc8ed839181c7dfd9c67c83e261b2" +checksum = "b2878ef029c47c6e8cf779119f20fcf52bde7ad42a731b2a304bc221df17571e" dependencies = [ "rustls-pki-types", ] +[[package]] +name = "weezl" +version = "0.1.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a28ac98ddc8b9274cb41bb4d9d4d5c425b6020c50c46f25559911905610b4a88" + [[package]] name = "whoami" version = "1.6.1" @@ -3782,22 +5754,45 @@ checksum = "5d4a4db5077702ca3015d3d02d74974948aba2ad9e12ab7df718ee64ccd7e97d" dependencies = [ "libredox", "wasite", + "web-sys", +] + +[[package]] +name = "winapi" +version = "0.3.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419" +dependencies = [ + "winapi-i686-pc-windows-gnu", + "winapi-x86_64-pc-windows-gnu", ] +[[package]] +name = "winapi-i686-pc-windows-gnu" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6" + [[package]] name = "winapi-util" version = "0.1.11" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "c2a7b1c03c876122aa43f3020e6c3c3ee5c05081c9a00739faf7503aeba10d22" dependencies = [ - "windows-sys 0.60.2", + "windows-sys 0.61.2", ] +[[package]] +name = "winapi-x86_64-pc-windows-gnu" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f" + [[package]] name = "windows-core" -version = "0.62.1" +version = "0.62.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6844ee5416b285084d3d3fffd743b925a6c9385455f64f6d4fa3031c4c2749a9" +checksum = "b8e83a14d34d0623b51dce9581199302a221863196a1dde71a7663a4c2be9deb" dependencies = [ "windows-implement", "windows-interface", @@ -3808,9 +5803,9 @@ dependencies = [ [[package]] name = "windows-implement" -version = "0.60.1" +version = "0.60.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "edb307e42a74fb6de9bf3a02d9712678b22399c87e6fa869d6dfcd8c1b7754e0" +checksum = "053e2e040ab57b9dc951b72c264860db7eb3b0200ba345b4e4c3b14f67855ddf" dependencies = [ "proc-macro2", "quote", @@ -3819,9 +5814,9 @@ dependencies = [ [[package]] name = "windows-interface" -version = "0.59.2" +version = "0.59.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c0abd1ddbc6964ac14db11c7213d6532ef34bd9aa042c2e5935f59d7908b46a5" +checksum = "3f316c4a2570ba26bbec722032c4099d8c8bc095efccdc15688708623367e358" dependencies = [ "proc-macro2", "quote", @@ -3830,24 +5825,24 @@ dependencies = [ [[package]] name = "windows-link" -version = "0.2.0" +version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "45e46c0661abb7180e7b9c281db115305d49ca1709ab8242adf09666d2173c65" +checksum = "f0805222e57f7521d6a62e36fa9163bc891acd422f971defe97d64e70d0a4fe5" [[package]] name = "windows-result" -version = "0.4.0" +version = "0.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7084dcc306f89883455a206237404d3eaf961e5bd7e0f312f7c91f57eb44167f" +checksum = "7781fa89eaf60850ac3d2da7af8e5242a5ea78d1a11c49bf2910bb5a73853eb5" dependencies = [ "windows-link", ] [[package]] name = "windows-strings" -version = "0.5.0" +version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7218c655a553b0bed4426cf54b20d7ba363ef543b52d515b3e48d7fd55318dda" +checksum = "7837d08f69c77cf6b07689544538e017c1bfcf57e34b4c0ff58e6c2cd3b37091" dependencies = [ "windows-link", ] @@ -3870,29 +5865,20 @@ dependencies = [ "windows-targets 0.52.6", ] -[[package]] -name = "windows-sys" -version = "0.59.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1e38bc4d79ed67fd075bcc251a1c39b32a1776bbe92e5bef1f0bf1f8c531853b" -dependencies = [ - "windows-targets 0.52.6", -] - [[package]] name = "windows-sys" version = "0.60.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f2f500e4d28234f72040990ec9d39e3a6b950f9f22d3dba18416c35882612bcb" dependencies = [ - "windows-targets 0.53.4", + "windows-targets 0.53.5", ] [[package]] name = "windows-sys" -version = "0.61.1" +version = "0.61.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6f109e41dd4a3c848907eb83d5a42ea98b3769495597450cf6d153507b166f0f" +checksum = "ae137229bcbd6cdf0f7b80a31df61766145077ddf49416a728b02cb3921ff3fc" dependencies = [ "windows-link", ] @@ -3930,19 +5916,19 @@ dependencies = [ [[package]] name = "windows-targets" -version = "0.53.4" +version = "0.53.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2d42b7b7f66d2a06854650af09cfdf8713e427a439c97ad65a6375318033ac4b" +checksum = "4945f9f551b88e0d65f3db0bc25c33b8acea4d9e41163edf90dcd0b19f9069f3" dependencies = [ "windows-link", - "windows_aarch64_gnullvm 0.53.0", - "windows_aarch64_msvc 0.53.0", - "windows_i686_gnu 0.53.0", - "windows_i686_gnullvm 0.53.0", - "windows_i686_msvc 0.53.0", - "windows_x86_64_gnu 0.53.0", - "windows_x86_64_gnullvm 0.53.0", - "windows_x86_64_msvc 0.53.0", + "windows_aarch64_gnullvm 0.53.1", + "windows_aarch64_msvc 0.53.1", + "windows_i686_gnu 0.53.1", + "windows_i686_gnullvm 0.53.1", + "windows_i686_msvc 0.53.1", + "windows_x86_64_gnu 0.53.1", + "windows_x86_64_gnullvm 0.53.1", + "windows_x86_64_msvc 0.53.1", ] [[package]] @@ -3959,9 +5945,9 @@ checksum = "32a4622180e7a0ec044bb555404c800bc9fd9ec262ec147edd5989ccd0c02cd3" [[package]] name = "windows_aarch64_gnullvm" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "86b8d5f90ddd19cb4a147a5fa63ca848db3df085e25fee3cc10b39b6eebae764" +checksum = "a9d8416fa8b42f5c947f8482c43e7d89e73a173cead56d044f6a56104a6d1b53" [[package]] name = "windows_aarch64_msvc" @@ -3977,9 +5963,9 @@ checksum = "09ec2a7bb152e2252b53fa7803150007879548bc709c039df7627cabbd05d469" [[package]] name = "windows_aarch64_msvc" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c7651a1f62a11b8cbd5e0d42526e55f2c99886c77e007179efff86c2b137e66c" +checksum = "b9d782e804c2f632e395708e99a94275910eb9100b2114651e04744e9b125006" [[package]] name = "windows_i686_gnu" @@ -3995,9 +5981,9 @@ checksum = "8e9b5ad5ab802e97eb8e295ac6720e509ee4c243f69d781394014ebfe8bbfa0b" [[package]] name = "windows_i686_gnu" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c1dc67659d35f387f5f6c479dc4e28f1d4bb90ddd1a5d3da2e5d97b42d6272c3" +checksum = "960e6da069d81e09becb0ca57a65220ddff016ff2d6af6a223cf372a506593a3" [[package]] name = "windows_i686_gnullvm" @@ -4007,9 +5993,9 @@ checksum = "0eee52d38c090b3caa76c563b86c3a4bd71ef1a819287c19d586d7334ae8ed66" [[package]] name = "windows_i686_gnullvm" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9ce6ccbdedbf6d6354471319e781c0dfef054c81fbc7cf83f338a4296c0cae11" +checksum = "fa7359d10048f68ab8b09fa71c3daccfb0e9b559aed648a8f95469c27057180c" [[package]] name = "windows_i686_msvc" @@ -4025,9 +6011,9 @@ checksum = "240948bc05c5e7c6dabba28bf89d89ffce3e303022809e73deaefe4f6ec56c66" [[package]] name = "windows_i686_msvc" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "581fee95406bb13382d2f65cd4a908ca7b1e4c2f1917f143ba16efe98a589b5d" +checksum = "1e7ac75179f18232fe9c285163565a57ef8d3c89254a30685b57d83a38d326c2" [[package]] name = "windows_x86_64_gnu" @@ -4043,9 +6029,9 @@ checksum = "147a5c80aabfbf0c7d901cb5895d1de30ef2907eb21fbbab29ca94c5b08b1a78" [[package]] name = "windows_x86_64_gnu" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2e55b5ac9ea33f2fc1716d1742db15574fd6fc8dadc51caab1c16a3d3b4190ba" +checksum = "9c3842cdd74a865a8066ab39c8a7a473c0778a3f29370b5fd6b4b9aa7df4a499" [[package]] name = "windows_x86_64_gnullvm" @@ -4061,9 +6047,9 @@ checksum = "24d5b23dc417412679681396f2b49f3de8c1473deb516bd34410872eff51ed0d" [[package]] name = "windows_x86_64_gnullvm" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0a6e035dd0599267ce1ee132e51c27dd29437f63325753051e71dd9e42406c57" +checksum = "0ffa179e2d07eee8ad8f57493436566c7cc30ac536a3379fdf008f47f6bb7ae1" [[package]] name = "windows_x86_64_msvc" @@ -4079,15 +6065,15 @@ checksum = "589f6da84c646204747d1270a2a5661ea66ed1cced2631d546fdfb155959f9ec" [[package]] name = "windows_x86_64_msvc" -version = "0.53.0" +version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "271414315aff87387382ec3d271b52d7ae78726f5d44ac98b4f4030c91880486" +checksum = "d6bbff5f0aada427a1e5a6da5f1f98158182f26556f345ac9e04d36d0ebed650" [[package]] name = "winnow" -version = "0.7.13" +version = "0.7.14" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "21a0236b59786fed61e2a80582dd500fe61f18b5dca67a4a067d0bc9039339cf" +checksum = "5a5364e9d77fcdeeaa6062ced926ee3381faa2ee02d3eb83a5c27a8825540829" dependencies = [ "memchr", ] @@ -4098,11 +6084,40 @@ version = "0.46.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f17a85883d4e6d00e8a97c586de764dabcc06133f7f1d55dce5cdc070ad7fe59" +[[package]] +name = "wkt" +version = "0.14.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "efb2b923ccc882312e559ffaa832a055ba9d1ac0cc8e86b3e25453247e4b81d7" +dependencies = [ + "geo-traits", + "geo-types", + "log", + "num-traits", + "thiserror 1.0.69", +] + [[package]] name = "writeable" -version = "0.6.1" +version = "0.6.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9edde0db4769d2dc68579893f2306b26c6ecfbe0ef499b013d731b7b9247e0b9" + +[[package]] +name = "xattr" +version = "1.6.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "32e45ad4206f6d2479085147f02bc2ef834ac85886624a23575ae137c8aa8156" +dependencies = [ + "libc", + "rustix", +] + +[[package]] +name = "y4m" +version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ea2f10b9bb0928dfb1b42b65e1f9e36f7f54dbdf08457afefb38afcdec4fa2bb" +checksum = "7a5a4b21e1a62b67a2970e6831bc091d7b87e119e7f9791aef9702e3bef04448" [[package]] name = "yaml-rust2" @@ -4115,13 +6130,18 @@ dependencies = [ "hashlink", ] +[[package]] +name = "yansi" +version = "1.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cfe53a6657fd280eaa890a3bc59152892ffa3e30101319d168b781ed6529b049" + [[package]] name = "yoke" -version = "0.8.0" +version = "0.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5f41bb01b8226ef4bfd589436a297c53d118f65921786300e427be8d487695cc" +checksum = "72d6e5c6afb84d73944e5cedb052c4680d5657337201555f9f2a16b7406d4954" dependencies = [ - "serde", "stable_deref_trait", "yoke-derive", "zerofrom", @@ -4129,9 +6149,9 @@ dependencies = [ [[package]] name = "yoke-derive" -version = "0.8.0" +version = "0.8.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "38da3c9736e16c5d3c8c597a9aaa5d1fa565d0532ae05e27c24aa62fb32c0ab6" +checksum = "b659052874eb698efe5b9e8cf382204678a0086ebf46982b79d6ca3182927e5d" dependencies = [ "proc-macro2", "quote", @@ -4141,18 +6161,18 @@ dependencies = [ [[package]] name = "zerocopy" -version = "0.8.27" +version = "0.8.31" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0894878a5fa3edfd6da3f88c4805f4c8558e2b996227a3d864f47fe11e38282c" +checksum = "fd74ec98b9250adb3ca554bdde269adf631549f51d8a8f8f0a10b50f1cb298c3" dependencies = [ "zerocopy-derive", ] [[package]] name = "zerocopy-derive" -version = "0.8.27" +version = "0.8.31" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "88d2b8d9c68ad2b9e4340d7832716a4d21a22a1154777ad56ea55c51a9cf3831" +checksum = "d8a8d209fdf45cf5138cbb5a506f6b52522a25afccc534d1475dad8e31105c6a" dependencies = [ "proc-macro2", "quote", @@ -4188,9 +6208,9 @@ checksum = "b97154e67e32c85465826e8bcc1c59429aaaf107c1e4a9e53c8d8ccd5eff88d0" [[package]] name = "zerotrie" -version = "0.2.2" +version = "0.2.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "36f0bbd478583f79edad978b407914f61b2972f5af6fa089686016be8f9af595" +checksum = "2a59c17a5562d507e4b54960e8569ebee33bee890c70aa3fe7b97e85a9fd7851" dependencies = [ "displaydoc", "yoke", @@ -4199,9 +6219,9 @@ dependencies = [ [[package]] name = "zerovec" -version = "0.11.4" +version = "0.11.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e7aa2bd55086f1ab526693ecbe444205da57e25f4489879da80635a46d90e73b" +checksum = "6c28719294829477f525be0186d13efa9a3c602f7ec202ca9e353d310fb9a002" dependencies = [ "yoke", "zerofrom", @@ -4210,9 +6230,9 @@ dependencies = [ [[package]] name = "zerovec-derive" -version = "0.11.1" +version = "0.11.2" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5b96237efa0c878c64bd89c436f661be4e46b2f3eff1ebb976f7ef2321d2f58f" +checksum = "eadce39539ca5cb3985590102671f2567e659fca9666581ad3411d59207951f3" dependencies = [ "proc-macro2", "quote", @@ -4228,7 +6248,7 @@ dependencies = [ "arbitrary", "crc32fast", "flate2", - "indexmap 2.11.4", + "indexmap 2.12.1", "memchr", "zopfli", ] @@ -4250,3 +6270,70 @@ dependencies = [ "log", "simd-adler32", ] + +[[package]] +name = "zstd" +version = "0.13.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e91ee311a569c327171651566e07972200e76fcfe2242a4fa446149a3881c08a" +dependencies = [ + "zstd-safe", +] + +[[package]] +name = "zstd-safe" +version = "7.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8f49c4d5f0abb602a93fb8736af2a4f4dd9512e36f7f570d66e65ff867ed3b9d" +dependencies = [ + "zstd-sys", +] + +[[package]] +name = "zstd-sys" +version = "2.0.16+zstd.1.5.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "91e19ebc2adc8f83e43039e79776e3fda8ca919132d68a1fed6a5faca2683748" +dependencies = [ + "cc", + "pkg-config", +] + +[[package]] +name = "zune-core" +version = "0.4.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3f423a2c17029964870cfaabb1f13dfab7d092a62a29a89264f4d36990ca414a" + +[[package]] +name = "zune-core" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "111f7d9820f05fd715df3144e254d6fc02ee4088b0644c0ffd0efc9e6d9d2773" + +[[package]] +name = "zune-inflate" +version = "0.2.54" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "73ab332fe2f6680068f3582b16a24f90ad7096d5d39b974d1c0aff0125116f02" +dependencies = [ + "simd-adler32", +] + +[[package]] +name = "zune-jpeg" +version = "0.4.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "29ce2c8a9384ad323cf564b67da86e21d3cfdff87908bc1223ed5c99bc792713" +dependencies = [ + "zune-core 0.4.12", +] + +[[package]] +name = "zune-jpeg" +version = "0.5.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dc6fb7703e32e9a07fb3f757360338b3a567a5054f21b5f52a666752e333d58e" +dependencies = [ + "zune-core 0.5.0", +] diff --git a/backend/Cargo.toml b/backend/Cargo.toml index 2c0f125..0873194 100644 --- a/backend/Cargo.toml +++ b/backend/Cargo.toml @@ -55,13 +55,17 @@ axum-extra = { version = "0.10.1" } clap = { version = "4.5", features = ["derive"] } clap_derive = "4.5" config = "0.15" +geoengine-datatypes = { git = "https://github.com/geo-engine/geoengine", branch = "main" } +geoengine-operators = { git = "https://github.com/geo-engine/geoengine", branch = "main" } geoengine-openapi-client = { git = "https://github.com/geo-engine/openapi-client", branch = "rust" } +indoc = "2" ogcapi = { git = "https://github.com/georust/ogcapi", branch = "changes-along-the-way", features = [ "services", "common", "processes", "types", ] } +pretty_assertions = "1.4" schemars = "1.1" serde = { version = "1.0", features = ["derive", "rc"] } serde_json = "1.0" diff --git a/backend/src/main.rs b/backend/src/main.rs index d30dca3..5a61c11 100644 --- a/backend/src/main.rs +++ b/backend/src/main.rs @@ -7,6 +7,7 @@ use utoipa_axum::router::OpenApiRouter; mod config; mod processes; +mod util; #[tokio::main] async fn main() -> anyhow::Result<()> { diff --git a/backend/src/processes/ndvi.rs b/backend/src/processes/ndvi.rs index 9beee4b..56315a0 100644 --- a/backend/src/processes/ndvi.rs +++ b/backend/src/processes/ndvi.rs @@ -1,14 +1,28 @@ use anyhow::{Context, Result}; +use geoengine_datatypes::{ + dataset::NamedData, + primitives::{Coordinate2D, Measurement}, + raster::RasterDataType, +}; use geoengine_openapi_client::{ apis::{ configuration::Configuration, ogcwfs_api::wfs_feature_handler, session_api::anonymous_handler, uploads_api::upload_handler, workflows_api::register_workflow_handler, }, - models::{ - GeoJson, GetFeatureRequest, SpatialPartition2D, TypedOperatorOperator, WfsService, - Workflow, workflow::Type as WorkflowType, + models::{GeoJson, GetFeatureRequest, SpatialPartition2D, WfsService}, +}; +use geoengine_operators::{ + engine::{ + RasterBandDescriptor, RasterOperator, SingleVectorMultipleRasterSources, TypedOperator, + VectorOperator, + }, + mock::{MockPointSource, MockPointSourceParams}, + processing::{ + ColumnNames, Expression, ExpressionParams, FeatureAggregationMethod, RasterVectorJoin, + RasterVectorJoinParams, TemporalAggregationMethod, }, + source::{GdalSource, GdalSourceParameters}, }; use ogcapi::{ processes::Processor, @@ -25,7 +39,7 @@ use schemars::{JsonSchema, generate::SchemaSettings}; use serde::{Deserialize, Serialize}; use std::collections::HashMap; -use crate::config::CONFIG; +use crate::{config::CONFIG, util::to_api_workflow}; /// Calculates the Normalized Difference Vegetation Index (NDVI) and the corrected NDVI (kNDVI) from satellite imagery. #[derive(Debug, Clone)] @@ -135,6 +149,10 @@ impl Processor for NDVIProcess { "0.1.0" } + #[allow( + clippy::too_many_lines, + reason = "description is long but better understood this way" + )] fn process(&self) -> Result { let mut settings = SchemaSettings::default(); settings.meta_schema = None; @@ -316,18 +334,21 @@ async fn compute_ndvi( // TODO: upload data instead of mocking it // let upload_data_id: String = upload_data(&configuration, coordinate)?; - let vector_source = serde_json::json!({ - "type": "MockPointSource", - "params": { - "points": [coordinate] - } - }); + let vector_source = MockPointSource { + params: MockPointSourceParams { + points: vec![Coordinate2D::new(coordinate[0], coordinate[1])], + }, + } + .boxed(); - let (names, inputs): (Vec<&str>, Vec) = + let (names, inputs): (Vec, Vec>) = match (should_compute_ndvi, should_compute_k_ndvi) { - (true, true) => (vec![NDVI, K_NDVI], vec![ndvi_source(), k_ndvi_source()]), - (true, false) => (vec![NDVI], vec![ndvi_source()]), - (false, true) => (vec![K_NDVI], vec![k_ndvi_source()]), + (true, true) => ( + vec![NDVI.into(), K_NDVI.into()], + vec![ndvi_source(), k_ndvi_source()], + ), + (true, false) => (vec![NDVI.into()], vec![ndvi_source()]), + (false, true) => (vec![K_NDVI.into()], vec![k_ndvi_source()]), (false, false) => { return Ok(NDVIProcessOutputs { ndvi: None, @@ -335,43 +356,22 @@ async fn compute_ndvi( }); } }; - let workflow = Workflow { - operator: Box::new(TypedOperatorOperator { - params: Some(serde_json::json!({ - "names": { - "type": "names", - "values": names, - }, - "featureAggregation": "first", - "temporalAggregation": "none", - "featureAggregationIgnoreNoData": true, - "temporalAggregationIgnoreNoData": true - })), - sources: Some(serde_json::json!({ - // "vector": { - // "type": "OgrSource", - // "params": { - // "data": upload_data_id - // } - // }, - "vector": vector_source, - "rasters": [{ - "type": "RasterStacker", - "params": { - "renameBands": { - "type": "rename", - "values": names - } - }, - "sources": { - "rasters": inputs - } - }] - })), - r#type: "RasterVectorJoin".into(), - }), - r#type: WorkflowType::Vector, - }; + let workflow = to_api_workflow(&TypedOperator::Vector( + RasterVectorJoin { + params: RasterVectorJoinParams { + names: ColumnNames::Names(names), + feature_aggregation: FeatureAggregationMethod::First, + feature_aggregation_ignore_no_data: true, + temporal_aggregation: TemporalAggregationMethod::None, + temporal_aggregation_ignore_no_data: true, + }, + sources: SingleVectorMultipleRasterSources { + vector: vector_source, + rasters: inputs, + }, + } + .boxed(), + ))?; // eprintln!("{}", serde_json::to_string_pretty(&workflow).unwrap()); @@ -457,54 +457,49 @@ fn outputs_from_feature_collection( Ok(result) } -fn ndvi_source() -> serde_json::Value { - serde_json::json!({ - "type": "Expression", - "params": { - "expression": "min((A / (127.50)) - 1, 1)", - "outputType": "F64", - "outputBand": { - "name": "kNDVI", - "measurement": { - "type": "unitless" - } +fn ndvi_source() -> Box { + Expression { + params: ExpressionParams { + expression: "min((A / (127.50)) - 1, 1)".into(), + output_type: RasterDataType::F64, + output_band: Some(RasterBandDescriptor { + name: "NDVI".into(), + measurement: Measurement::Unitless, + }), + map_no_data: false, }, - "mapNoData": false - }, - "sources": { - "raster": ndvi_u8_source() - } - }) + sources: ndvi_u8_source().into(), + } + .boxed() } -fn ndvi_u8_source() -> serde_json::Value { - serde_json::json!( { - "type": "GdalSource", - "params": { - "data": "ndvi" - } - }) +fn ndvi_u8_source() -> Box { + GdalSource { + params: GdalSourceParameters { + data: NamedData::with_system_name("ndvi"), + }, + } + .boxed() } -fn k_ndvi_source() -> serde_json::Value { - serde_json::json!({ - "type": "Expression", - "params": { - "expression": "let ndvi = min((A / (127.50)) - 1, 1);\ - tanh(pow(ndvi, 2))", - "outputType": "F64", - "outputBand": { - "name": "kNDVI", - "measurement": { - "type": "unitless" - } +fn k_ndvi_source() -> Box { + Expression { + params: ExpressionParams { + expression: indoc::indoc! {" + let ndvi = min((A / (127.50)) - 1, 1); + tanh(pow(ndvi, 2)) + "} + .into(), + output_type: RasterDataType::F64, + output_band: Some(RasterBandDescriptor { + name: "kNDVI".into(), + measurement: Measurement::Unitless, + }), + map_no_data: false, }, - "mapNoData": false - }, - "sources": { - "raster": ndvi_u8_source() - } - }) + sources: ndvi_u8_source().into(), + } + .boxed() } async fn configuration() -> Result { diff --git a/backend/src/util.rs b/backend/src/util.rs new file mode 100644 index 0000000..a4ce225 --- /dev/null +++ b/backend/src/util.rs @@ -0,0 +1,93 @@ +use anyhow::{Context, Result}; + +/// Converts a Geo Engine operator to an Geo Engine OpenAPI workflow. +pub fn to_api_workflow( + operator: &geoengine_operators::engine::TypedOperator, +) -> Result { + use geoengine_openapi_client::models::{ + TypedOperatorOperator, Workflow, workflow::Type as WorkflowType, + }; + use geoengine_operators::engine::TypedOperator; + + let serde_json::Value::Object(mut json_object) = serde_json::to_value(operator)? else { + anyhow::bail!("expected operator to serialize `TypedOperator` to a JSON object"); + }; + let serde_json::Value::Object(mut json_object) = json_object + .remove("operator") + .context("missing `operator` field")? + else { + anyhow::bail!("`operator` field is not a JSON object"); + }; + let serde_json::Value::String(r#type) = + json_object.remove("type").context("missing `type` field")? + else { + anyhow::bail!("`type` field is not a string"); + }; + + Ok(Workflow { + operator: Box::new(TypedOperatorOperator { + params: json_object.remove("params"), + sources: json_object.remove("sources"), + r#type, + }), + r#type: match operator { + TypedOperator::Vector(..) => WorkflowType::Vector, + TypedOperator::Raster(..) => WorkflowType::Raster, + TypedOperator::Plot(..) => WorkflowType::Plot, + }, + }) +} + +#[cfg(test)] +mod tests { + + use super::*; + use pretty_assertions::assert_eq; + + #[test] + fn it_converts_operator_to_api_workflow() { + use geoengine_datatypes::{dataset::NamedData, raster::RasterDataType}; + use geoengine_operators::engine::{RasterOperator, TypedOperator}; + use geoengine_operators::processing::{RasterTypeConversion, RasterTypeConversionParams}; + use geoengine_operators::source::{GdalSource, GdalSourceParameters}; + + let gdal_source = TypedOperator::Raster( + RasterTypeConversion { + params: RasterTypeConversionParams { + output_data_type: RasterDataType::F32, + }, + sources: GdalSource { + params: GdalSourceParameters { + data: NamedData::with_system_name("ndvi"), + }, + } + .boxed() + .into(), + } + .boxed(), + ); + + let api_workflow = to_api_workflow(&gdal_source).unwrap(); + + assert_eq!( + serde_json::to_value(api_workflow).unwrap(), + serde_json::json!({ + "type": "Raster", + "operator": { + "type": "RasterTypeConversion", + "params": { + "outputDataType": "F32" + }, + "sources": { + "raster": { + "type": "GdalSource", + "params": { + "data": "ndvi" + } + } + } + } + }) + ); + } +} From cabf036fa1fa7ab1d0f0ac0f41f8d0f5afd30c26 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Wed, 21 Jan 2026 17:57:16 +0100 Subject: [PATCH 04/19] feat: jobs --- .gitignore | 2 + backend/Cargo.lock | 162 +++++++- backend/Cargo.toml | 15 +- backend/build.rs | 3 + backend/conf/default.toml | 2 +- backend/diesel.toml | 9 + backend/migrations/.diesel_lock | 0 backend/migrations/.keep | 0 .../down.sql | 5 + .../2026-01-16-132117-0000_create_jobs/up.sql | 45 +++ backend/src/auth.rs | 142 +++++++ backend/src/db/mapping.rs | 115 ++++++ backend/src/db/mod.rs | 87 +++++ backend/src/db/model.rs | 172 ++++++++ backend/src/db/schema.rs | 70 ++++ backend/src/jobs.rs | 367 ++++++++++++++++++ backend/src/main.rs | 111 ++---- backend/src/processes/ndvi.rs | 26 +- backend/src/state.rs | 102 +++++ backend/src/util.rs | 54 +++ clippy.toml | 7 + rust-toolchain.toml | 2 +- test-client/call-process.ipynb | 90 ++--- test-client/call.http | 42 ++ 24 files changed, 1460 insertions(+), 170 deletions(-) create mode 100644 backend/build.rs create mode 100644 backend/diesel.toml create mode 100644 backend/migrations/.diesel_lock create mode 100644 backend/migrations/.keep create mode 100644 backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql create mode 100644 backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql create mode 100644 backend/src/auth.rs create mode 100644 backend/src/db/mapping.rs create mode 100644 backend/src/db/mod.rs create mode 100644 backend/src/db/model.rs create mode 100644 backend/src/db/schema.rs create mode 100644 backend/src/jobs.rs create mode 100644 backend/src/state.rs create mode 100644 clippy.toml diff --git a/.gitignore b/.gitignore index ad67955..4011c7a 100644 --- a/.gitignore +++ b/.gitignore @@ -19,3 +19,5 @@ target # and can be added to the global gitignore or merged into this file. For a more nuclear # option (not recommended) you can uncomment the following to ignore the entire idea folder. #.idea/ + +.env diff --git a/backend/Cargo.lock b/backend/Cargo.lock index 3e13d22..489ebe8 100644 --- a/backend/Cargo.lock +++ b/backend/Cargo.lock @@ -10,13 +10,19 @@ dependencies = [ "async-trait", "axum", "axum-extra", + "chrono", "clap", "clap_derive", "config", + "diesel", + "diesel-derive-enum", + "diesel_migrations", + "futures", "geoengine-datatypes", "geoengine-openapi-client", "geoengine-operators", "indoc", + "nom", "ogcapi", "pretty_assertions", "schemars 1.1.0", @@ -30,6 +36,7 @@ dependencies = [ "url", "utoipa", "utoipa-axum", + "uuid", ] [[package]] @@ -549,6 +556,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "5b098575ebe77cb6d14fc7f32749631a6e44edbef6b796f89b020e99ba20d425" dependencies = [ "axum-core", + "axum-macros", "bytes", "form_urlencoded", "futures-util", @@ -617,6 +625,17 @@ dependencies = [ "tracing", ] +[[package]] +name = "axum-macros" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "604fde5e028fea851ce1d8570bbdc034bec850d157f7569d10f347d06808c05c" +dependencies = [ + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "base64" version = "0.22.1" @@ -1122,6 +1141,69 @@ dependencies = [ "syn", ] +[[package]] +name = "diesel" +version = "2.3.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e130c806dccc85428c564f2dc5a96e05b6615a27c9a28776bd7761a9af4bb552" +dependencies = [ + "bitflags", + "byteorder", + "chrono", + "diesel_derives", + "downcast-rs", + "itoa", + "pq-sys", + "r2d2", + "serde_json", + "uuid", +] + +[[package]] +name = "diesel-derive-enum" +version = "3.0.0-beta.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "50a8c082045d01debc8589f8a0db9f2855a37c99c9b031325c856b5b98e1625f" +dependencies = [ + "heck 0.4.1", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "diesel_derives" +version = "2.3.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c30b2969f923fa1f73744b92bb7df60b858df8832742d9a3aceb79236c0be1d2" +dependencies = [ + "diesel_table_macro_syntax", + "dsl_auto_type", + "proc-macro2", + "quote", + "syn", +] + +[[package]] +name = "diesel_migrations" +version = "2.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "745fd255645f0f1135f9ec55c7b00e0882192af9683ab4731e4bba3da82b8f9c" +dependencies = [ + "diesel", + "migrations_internals", + "migrations_macros", +] + +[[package]] +name = "diesel_table_macro_syntax" +version = "0.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fe2444076b48641147115697648dc743c2c00b61adade0f01ce67133c7babe8c" +dependencies = [ + "syn", +] + [[package]] name = "diff" version = "0.1.13" @@ -1166,6 +1248,26 @@ version = "0.15.7" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1aaf95b3e5c8f23aa320147307562d361db0ae0d51242340f558153b4eb2439b" +[[package]] +name = "downcast-rs" +version = "2.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "117240f60069e65410b3ae1bb213295bd828f707b5bec6596a1afc8793ce0cbc" + +[[package]] +name = "dsl_auto_type" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd122633e4bef06db27737f21d3738fb89c8f6d5360d6d9d7635dda142a7757e" +dependencies = [ + "darling", + "either", + "heck 0.5.0", + "proc-macro2", + "quote", + "syn", +] + [[package]] name = "dyn-clone" version = "1.0.20" @@ -2742,6 +2844,27 @@ version = "2.7.6" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f52b00d39961fc5b2736ea853c9cc86238e165017a493d1d5c8eac6bdc4cc273" +[[package]] +name = "migrations_internals" +version = "2.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "36c791ecdf977c99f45f23280405d7723727470f6689a5e6dbf513ac547ae10d" +dependencies = [ + "serde", + "toml", +] + +[[package]] +name = "migrations_macros" +version = "2.3.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "36fc5ac76be324cfd2d3f2cf0fdf5d5d3c4f14ed8aaebadb09e304ba42282703" +dependencies = [ + "migrations_internals", + "proc-macro2", + "quote", +] + [[package]] name = "mime" version = "0.3.17" @@ -2981,7 +3104,6 @@ dependencies = [ [[package]] name = "ogcapi" version = "0.3.1" -source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "ogcapi-client", "ogcapi-drivers", @@ -2993,7 +3115,6 @@ dependencies = [ [[package]] name = "ogcapi-client" version = "0.3.0" -source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "geojson", "log", @@ -3009,7 +3130,6 @@ dependencies = [ [[package]] name = "ogcapi-drivers" version = "0.3.0" -source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "anyhow", "async-trait", @@ -3024,7 +3144,6 @@ dependencies = [ [[package]] name = "ogcapi-processes" version = "0.3.0" -source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "anyhow", "async-trait", @@ -3041,7 +3160,6 @@ dependencies = [ [[package]] name = "ogcapi-services" version = "0.3.0" -source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "anyhow", "axum", @@ -3076,7 +3194,6 @@ dependencies = [ [[package]] name = "ogcapi-types" version = "0.3.0" -source = "git+https://github.com/georust/ogcapi?branch=changes-along-the-way#873ff3d8e1377b356c4f45c32eca5fe90252c6df" dependencies = [ "chrono", "geojson", @@ -3524,6 +3641,17 @@ dependencies = [ "zerocopy", ] +[[package]] +name = "pq-sys" +version = "0.7.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "574ddd6a267294433f140b02a726b0640c43cf7c6f717084684aaa3b285aba61" +dependencies = [ + "libc", + "pkg-config", + "vcpkg", +] + [[package]] name = "pretty_assertions" version = "1.4.1" @@ -3706,6 +3834,17 @@ version = "5.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "69cdb34c158ceb288df11e18b4bd39de994f6657d83847bdffdbd7f346754b0f" +[[package]] +name = "r2d2" +version = "0.8.10" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51de85fb3fb6524929c8a2eb85e6b6d363de4e8c48f9e2c2eac4944abc181c93" +dependencies = [ + "log", + "parking_lot", + "scheduled-thread-pool", +] + [[package]] name = "rand" version = "0.8.5" @@ -4221,6 +4360,15 @@ dependencies = [ "windows-sys 0.61.2", ] +[[package]] +name = "scheduled-thread-pool" +version = "0.2.7" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3cbc66816425a074528352f5789333ecff06ca41b36b0b0efdfbb29edc391a19" +dependencies = [ + "parking_lot", +] + [[package]] name = "schemars" version = "0.9.0" @@ -5240,6 +5388,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9cf146f99d442e8e68e585f5d798ccd3cad9a7835b917e09728880a862706456" dependencies = [ "async-compression", + "base64", "bitflags", "bytes", "futures-core", @@ -5248,6 +5397,7 @@ dependencies = [ "http-body", "http-body-util", "iri-string", + "mime", "pin-project-lite", "tokio", "tokio-util", diff --git a/backend/Cargo.toml b/backend/Cargo.toml index 0873194..1f75c80 100644 --- a/backend/Cargo.toml +++ b/backend/Cargo.toml @@ -50,16 +50,22 @@ multiple_crate_versions = { level = "allow", priority = 1 } [dependencies] anyhow = "1.0" async-trait = "0.1" -axum = { version = "0.8.4", features = ["multipart"] } -axum-extra = { version = "0.10.1" } +axum = { version = "0.8", features = ["multipart"] } +axum-extra = { version = "0.10" } +chrono = { version = "0.4", features = ["serde"] } clap = { version = "4.5", features = ["derive"] } clap_derive = "4.5" config = "0.15" +diesel = { version = "2.3", features = ["postgres", "chrono", "uuid", "r2d2", "serde_json"] } +diesel-derive-enum = { version = "3.0.0-beta.1", features = ["postgres"] } +diesel_migrations = "2.3" +futures = "0.3" geoengine-datatypes = { git = "https://github.com/geo-engine/geoengine", branch = "main" } geoengine-operators = { git = "https://github.com/geo-engine/geoengine", branch = "main" } geoengine-openapi-client = { git = "https://github.com/geo-engine/openapi-client", branch = "rust" } -indoc = "2" -ogcapi = { git = "https://github.com/georust/ogcapi", branch = "changes-along-the-way", features = [ +indoc = "2.0" +nom = "8.0" +ogcapi = { path = "../../../ogcapi/ogcapi", features = [ "services", "common", "processes", @@ -75,5 +81,6 @@ tracing-subscriber = { version = "0.3.19", features = ["env-filter"] } url = "2.4" utoipa = "5.3" utoipa-axum = "0.2" +uuid = { version = "1.19", features = ["v7"] } tower = "0.5" tower-http = { version = "0.6", features = ["compression-gzip", "catch-panic", "cors", "request-id", "sensitive-headers", "trace", "util"] } diff --git a/backend/build.rs b/backend/build.rs new file mode 100644 index 0000000..3a8149e --- /dev/null +++ b/backend/build.rs @@ -0,0 +1,3 @@ +fn main() { + println!("cargo:rerun-if-changed=migrations"); +} diff --git a/backend/conf/default.toml b/backend/conf/default.toml index 3b405d0..439f5f5 100644 --- a/backend/conf/default.toml +++ b/backend/conf/default.toml @@ -7,7 +7,7 @@ port = 4040 host = "localhost" port = 5432 database = "biois" -schema = "geoengine" +schema = "biois" user = "geoengine" password = "geoengine" # Set to `true` to start with a fresh database each time. diff --git a/backend/diesel.toml b/backend/diesel.toml new file mode 100644 index 0000000..bb1d1f7 --- /dev/null +++ b/backend/diesel.toml @@ -0,0 +1,9 @@ +# For documentation on how to configure this file, +# see https://diesel.rs/guides/configuring-diesel-cli + +[print_schema] +file = "src/db/schema.rs" +custom_type_derives = ["diesel::query_builder::QueryId", "Clone"] + +[migrations_directory] +dir = "migrations" diff --git a/backend/migrations/.diesel_lock b/backend/migrations/.diesel_lock new file mode 100644 index 0000000..e69de29 diff --git a/backend/migrations/.keep b/backend/migrations/.keep new file mode 100644 index 0000000..e69de29 diff --git a/backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql b/backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql new file mode 100644 index 0000000..a6655a7 --- /dev/null +++ b/backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql @@ -0,0 +1,5 @@ +DROP TABLE jobs; +DROP TYPE IF EXISTS Link CASCADE; +DROP TYPE IF EXISTS Response CASCADE; +DROP TYPE IF EXISTS JobType CASCADE; +DROP TYPE IF EXISTS StatusCode CASCADE; diff --git a/backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql b/backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql new file mode 100644 index 0000000..ef6fe84 --- /dev/null +++ b/backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql @@ -0,0 +1,45 @@ +CREATE TYPE Link AS ( + href TEXT, + rel TEXT, + type TEXT, + hreflang TEXT, + title TEXT, + length BIGINT +); + +CREATE TYPE Response AS ENUM ( + 'raw', + 'document' +); + +CREATE TYPE JobType AS ENUM ( + 'process' +); + +CREATE TYPE StatusCode AS ENUM ( + 'accepted', + 'running', + 'successful', + 'failed', + 'dismissed' +); + +CREATE TABLE jobs ( + -- StatusInfo + job_id TEXT PRIMARY KEY, + process_id TEXT, + type JobType NOT NULL, + status StatusCode NOT NULL, + message TEXT, + created TIMESTAMPTZ NOT NULL, + finished TIMESTAMPTZ, + updated TIMESTAMPTZ NOT NULL, + progress SMALLINT CHECK (progress >= 0 AND progress <= 100), + links Link[] NOT NULL CHECK (array_position(links, NULL) IS NULL) DEFAULT ARRAY[]::Link[], + -- Response + response Response NOT NULL, + -- Results + results JSONB, -- TODO: define structure + -- User + user_id UUID NOT NULL +); diff --git a/backend/src/auth.rs b/backend/src/auth.rs new file mode 100644 index 0000000..cb95ec0 --- /dev/null +++ b/backend/src/auth.rs @@ -0,0 +1,142 @@ +use crate::{config::CONFIG, util::Secret}; +use anyhow::{Context, Result}; +use axum::{ + extract::Request, + http::{Response, StatusCode}, +}; +use futures::future::BoxFuture; +use geoengine_openapi_client::apis::{configuration, session_api::session_handler}; +use nom::{ + IResult, Parser, + bytes::{complete::tag_no_case, take}, + character::complete::space1, + combinator::{all_consuming, map_res}, + sequence::separated_pair, +}; +use tower_http::auth::AsyncAuthorizeRequest; +use uuid::Uuid; + +#[derive(Clone, Debug)] +pub struct User { + pub id: Uuid, + pub session_token: Secret, +} + +#[derive(Clone, Debug)] +pub struct GeoEngineAuthMiddleware { + configuration: configuration::Configuration, + whitelisted_paths: WhitelistedPaths, +} + +#[derive(Clone, Debug)] +struct WhitelistedPaths { + exact: Vec<&'static str>, + prefix: Vec<&'static str>, +} + +impl WhitelistedPaths { + fn contains(&self, path: &str) -> bool { + self.exact.contains(&path) || self.prefix.iter().any(|&p| path.starts_with(p)) + } +} + +impl GeoEngineAuthMiddleware { + pub fn new() -> Self { + let mut configuration = configuration::Configuration::new(); + configuration.base_path = CONFIG.geoengine.base_url.to_string(); + Self { + configuration, + whitelisted_paths: WhitelistedPaths { + exact: vec![ + "/", + "/conformance", + "/health", + "/processes", + "/processes/echo", + "/processes/ndvi", + ], + prefix: vec!["/api", "/swagger"], + }, + } + } + + fn path_is_whitelisted(&self, path: &str) -> bool { + self.whitelisted_paths.contains(path) + } +} + +impl AsyncAuthorizeRequest for GeoEngineAuthMiddleware { + type RequestBody = axum::body::Body; + type ResponseBody = axum::body::Body; + type Future = + BoxFuture<'static, Result, Response>>; + + fn authorize(&mut self, mut request: Request) -> Self::Future { + if self.path_is_whitelisted(request.uri().path()) { + return Box::pin(async move { Ok(request) }); + } + + let mut configuration = self.configuration.clone(); + Box::pin(async move { + let Some(auth_header) = request + .headers() + .get("Authorization") + .and_then(|h| h.to_str().ok()) + .and_then(|h| parse_bearer_token(h).ok()) + else { + return Err(Response::builder() + .status(StatusCode::UNAUTHORIZED) + .body(Default::default()) + .expect("to build empty response")); + }; + + configuration.bearer_access_token = Some(auth_header.to_string()); + + let Ok(session) = session_handler(&configuration).await else { + return Err(Response::builder() + .status(StatusCode::FORBIDDEN) + .body(Default::default()) + .expect("to build empty response")); + }; + + let user = User { + id: session.user.id, + session_token: session.id.into(), + }; + request.extensions_mut().insert(user); + + Ok(request) + }) + } +} + +fn parse_bearer_token(header_value: &str) -> Result { + bearer_token_parser(header_value) + .map(|(_, token)| token) + .map_err(|e| e.map_input(ToString::to_string)) + .context("Failed to parse bearer token") +} + +fn bearer_token_parser(header_value: &str) -> IResult<&str, Uuid> { + let (_, (_, token)) = all_consuming(separated_pair(tag_no_case("Bearer"), space1, uuid_parser)) + .parse(header_value)?; + Ok((header_value, token)) +} + +fn uuid_parser(input: &str) -> IResult<&str, Uuid> { + // A standard hyphenated UUID is exactly 36 characters + map_res(take(36usize), Uuid::parse_str).parse(input) +} + +#[cfg(test)] +mod tests { + use super::*; + + #[test] + fn it_parses_bearer_tokens() { + let token = Uuid::new_v4(); + let header_value = format!("Bearer {token}"); + let parsed_token = parse_bearer_token(&header_value).expect("to parse token"); + assert_eq!(parsed_token, token); + } +} diff --git a/backend/src/db/mapping.rs b/backend/src/db/mapping.rs new file mode 100644 index 0000000..95b67f8 --- /dev/null +++ b/backend/src/db/mapping.rs @@ -0,0 +1,115 @@ +//! Mapping between database models and OGC API types + +use crate::db::model::{JobType, Link, Response, StatusCode, StatusInfo}; +use ogcapi::types::{ + common::Link as OgcApiLink, + processes::{ + JobType as OgcApiJobType, Response as OgcApiResponse, StatusCode as OgcApiStatusCode, + StatusInfo as OgcApiStatusInfo, + }, +}; + +impl From for OgcApiResponse { + fn from(response: Response) -> Self { + match response { + Response::Raw => OgcApiResponse::Raw, + Response::Document => OgcApiResponse::Document, + } + } +} + +impl From for Response { + fn from(response: OgcApiResponse) -> Self { + match response { + OgcApiResponse::Raw => Self::Raw, + OgcApiResponse::Document => Self::Document, + } + } +} + +impl From for Link { + fn from(link: OgcApiLink) -> Self { + Link { + href: link.href, + rel: link.rel, + r#type: link.r#type, + hreflang: link.hreflang, + title: link.title, + length: link.length, + } + } +} + +impl From for OgcApiLink { + fn from(link: Link) -> Self { + OgcApiLink { + href: link.href, + rel: link.rel, + r#type: link.r#type, + hreflang: link.hreflang, + title: link.title, + length: link.length, + } + } +} + +impl From for OgcApiJobType { + fn from(job_type: JobType) -> Self { + match job_type { + JobType::Process => Self::Process, + } + } +} + +impl From for JobType { + fn from(job_type: OgcApiJobType) -> Self { + match job_type { + OgcApiJobType::Process => Self::Process, + } + } +} + +impl From for OgcApiStatusCode { + fn from(status: StatusCode) -> Self { + match status { + StatusCode::Accepted => OgcApiStatusCode::Accepted, + StatusCode::Running => OgcApiStatusCode::Running, + StatusCode::Successful => OgcApiStatusCode::Successful, + StatusCode::Failed => OgcApiStatusCode::Failed, + StatusCode::Dismissed => OgcApiStatusCode::Dismissed, + } + } +} + +impl From for StatusCode { + fn from(status: OgcApiStatusCode) -> Self { + match status { + OgcApiStatusCode::Accepted => StatusCode::Accepted, + OgcApiStatusCode::Running => StatusCode::Running, + OgcApiStatusCode::Successful => StatusCode::Successful, + OgcApiStatusCode::Failed => StatusCode::Failed, + OgcApiStatusCode::Dismissed => StatusCode::Dismissed, + } + } +} + +impl From for OgcApiStatusInfo { + fn from(status: StatusInfo) -> Self { + OgcApiStatusInfo { + process_id: status.process_id, + r#type: status.type_.into(), + job_id: status.job_id, + status: status.status.into(), + message: status.message, + created: Some(status.created), + finished: status.finished, + updated: Some(status.updated), + progress: status.progress.map(|p| p as u8), + links: status + .links + .into_iter() + .filter_map(|l| l.map(Into::into)) + .collect(), + } + } +} diff --git a/backend/src/db/mod.rs b/backend/src/db/mod.rs new file mode 100644 index 0000000..475f314 --- /dev/null +++ b/backend/src/db/mod.rs @@ -0,0 +1,87 @@ +use anyhow::{Context, Result}; +use diesel::{ + PgConnection, + connection::SimpleConnection, + r2d2::{ConnectionManager, CustomizeConnection, Pool}, +}; +use diesel_migrations::{EmbeddedMigrations, MigrationHarness, embed_migrations}; +use tracing::info; + +mod mapping; +pub mod model; +pub mod schema; // auto-generated by diesel + +pub type DbPool = Pool>; + +const MIGRATIONS: EmbeddedMigrations = embed_migrations!("migrations"); + +fn run_migrations(connection: &mut PgConnection) -> Result<()> { + let versions = connection + .run_pending_migrations(MIGRATIONS) + .map_err(anyhow::Error::from_boxed) + .context("Failed to run database migrations")?; + + for version in versions { + info!("Applied migration: {version}"); + } + + Ok(()) +} + +/// Create a database pool and run migrations +pub fn setup_db(config: &crate::config::Database) -> Result { + let manager = ConnectionManager::::new(config.connection_string()?); + + let db_pool_builder = Pool::builder(); + + let db_pool_builder = if cfg!(test) { + db_pool_builder + .max_size(1) // Use a single connection for tests + .connection_customizer(Box::new(diesel::r2d2::TestCustomizer)) + } else { + db_pool_builder + .max_size(8) // TODO: investigate a good size + .connection_customizer(Box::new(SchemaSettingConnectionCustomizer { + schema: config.schema.clone(), + })) + }; + + let db_pool = db_pool_builder + .build(manager) + .context("Failed to create db pool.")?; + + let mut db_connection = db_pool.get()?; + let schema = config.schema.as_str(); + + if config.clear_database_on_start { + // TODO: prohibit deletion in production environments, + // e.g., not deleting when `clear_database_on_start` was previously `false` + + info!("Clearing database schema '{schema}'"); + + db_connection + .batch_execute(&format!("DROP SCHEMA IF EXISTS {schema} CASCADE;")) + .context("Failed to clear database schema")?; + } + + db_connection + .batch_execute(&format!("CREATE SCHEMA IF NOT EXISTS {schema};")) + .context("Failed to create database schema")?; + + run_migrations(&mut db_connection)?; + + Ok(db_pool) +} + +/// A connection customizer that sets the `search_path` to a specific schema upon acquiring a connection. +#[derive(Debug)] +struct SchemaSettingConnectionCustomizer { + schema: String, +} +impl CustomizeConnection for SchemaSettingConnectionCustomizer { + fn on_acquire(&self, conn: &mut PgConnection) -> Result<(), diesel::r2d2::Error> { + let schema = self.schema.as_str(); + conn.batch_execute(&format!("SET search_path TO {schema};")) + .map_err(diesel::r2d2::Error::QueryError) + } +} diff --git a/backend/src/db/model.rs b/backend/src/db/model.rs new file mode 100644 index 0000000..0978b3a --- /dev/null +++ b/backend/src/db/model.rs @@ -0,0 +1,172 @@ +use super::schema::{jobs, sql_types}; +use chrono::{DateTime, Utc}; +use diesel::{ + deserialize::{FromSql, FromSqlRow}, + expression::AsExpression, + pg::{Pg, PgValue}, + prelude::*, + serialize::{Output, ToSql, WriteTuple}, + sql_types::{BigInt, Nullable, SqlType, Text}, +}; +use diesel_derive_enum::DbEnum; +use serde::Deserialize; + +#[derive(Debug, Deserialize, Insertable)] +#[diesel(table_name = jobs)] +pub struct NewJob<'a> { + pub job_id: &'a str, + pub process_id: Option<&'a str>, + pub status: StatusCode, + pub message: Option<&'a str>, + pub type_: JobType, + pub created: DateTime, + pub updated: DateTime, + pub progress: Option, + pub links: Vec, + pub response: Response, + pub user_id: uuid::Uuid, +} + +#[derive(Debug, Deserialize, AsChangeset)] +#[diesel(table_name = jobs)] +pub struct UpdateJob<'a> { + pub status: StatusCode, + pub message: Option<&'a str>, + pub updated: DateTime, + pub progress: Option, + pub links: Vec, +} + +#[derive(Debug, Deserialize, AsChangeset)] +#[diesel(table_name = jobs)] +pub struct FinishJob<'a> { + pub status: StatusCode, + pub message: Option<&'a str>, + pub updated: DateTime, + pub finished: DateTime, + pub progress: Option, + pub links: Vec, + pub results: Option, +} + +#[derive(Debug, Deserialize, AsChangeset)] +#[diesel(table_name = jobs)] +pub struct DismissJob<'a> { + pub status: StatusCode, + pub message: Option<&'a str>, + pub updated: DateTime, +} + +#[derive(Debug, Deserialize, HasQuery)] +#[diesel(table_name = jobs)] +pub struct StatusInfo { + pub job_id: String, + pub process_id: Option, + pub status: StatusCode, + pub message: Option, + pub type_: JobType, + pub created: DateTime, + pub updated: DateTime, + pub finished: Option>, + pub progress: Option, + pub links: Vec>, + pub response: Response, +} + +#[derive(Debug, Deserialize, DbEnum, SqlType)] +#[db_enum(existing_type_path = "crate::db::schema::sql_types::Jobtype")] +pub enum JobType { + Process, +} + +#[derive(Debug, Deserialize, DbEnum, SqlType)] +#[db_enum(existing_type_path = "crate::db::schema::sql_types::Statuscode")] +pub enum StatusCode { + Accepted, + Running, + Successful, + Failed, + Dismissed, +} + +#[derive(Debug, Deserialize, AsExpression, FromSqlRow)] +#[diesel(sql_type = sql_types::Link, postgres_type(name = "Link"))] +pub struct Link { + pub href: String, + pub rel: String, + pub r#type: Option, + pub hreflang: Option, + pub title: Option, + pub length: Option, +} + +impl ToSql for Link { + fn to_sql<'b>(&'b self, out: &mut Output<'b, '_, Pg>) -> diesel::serialize::Result { + // Write the fields in the order: href TEXT, rel TEXT, type TEXT, hreflang TEXT, title TEXT, length BIGINT + WriteTuple::<( + Text, + Text, + Nullable, + Nullable, + Nullable, + Nullable, + )>::write_tuple( + &( + &self.href, + &self.rel, + self.r#type.as_ref(), + self.hreflang.as_ref(), + self.title.as_ref(), + self.length.as_ref(), + ), + &mut out.reborrow(), + ) + } +} + +impl FromSql for Link { + fn from_sql(bytes: PgValue<'_>) -> diesel::deserialize::Result { + // Use the tuple implementation to extract the fields + let (href, rel, r#type, hreflang, title, length): ( + String, + String, + Option, + Option, + Option, + Option, + ) = <( + String, + String, + Option, + Option, + Option, + Option, + ) as FromSql< + diesel::sql_types::Record<( + Text, + Text, + Nullable, + Nullable, + Nullable, + Nullable, + )>, + Pg, + >>::from_sql(bytes)?; + + Ok(Link { + href, + rel, + r#type, + hreflang, + title, + length, + }) + } +} + +#[derive(Debug, Deserialize, SqlType, DbEnum)] +#[db_enum(existing_type_path = "crate::db::schema::sql_types::Response")] +pub enum Response { + Raw, + Document, +} diff --git a/backend/src/db/schema.rs b/backend/src/db/schema.rs new file mode 100644 index 0000000..7b71be0 --- /dev/null +++ b/backend/src/db/schema.rs @@ -0,0 +1,70 @@ +// @generated automatically by Diesel CLI. + +pub mod sql_types { + #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "jobtype"))] + pub struct Jobtype; + + #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "link"))] + pub struct Link; + + #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "response"))] + pub struct Response; + + #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "statuscode"))] + pub struct Statuscode; +} + +diesel::table! { + _sqlx_migrations (version) { + version -> Int8, + description -> Text, + installed_on -> Timestamptz, + success -> Bool, + checksum -> Bytea, + execution_time -> Int8, + } +} + +diesel::table! { + use diesel::sql_types::*; + use super::sql_types::Jobtype; + use super::sql_types::Statuscode; + use super::sql_types::Link; + use super::sql_types::Response; + + jobs (job_id) { + job_id -> Text, + process_id -> Nullable, + #[sql_name = "type"] + type_ -> Jobtype, + status -> Statuscode, + message -> Nullable, + created -> Timestamptz, + finished -> Nullable, + updated -> Timestamptz, + progress -> Nullable, + links -> Array>, + response -> Response, + results -> Nullable, + user_id -> Uuid, + } +} + +diesel::table! { + spatial_ref_sys (srid) { + srid -> Int4, + #[max_length = 256] + auth_name -> Nullable, + auth_srid -> Nullable, + #[max_length = 2048] + srtext -> Nullable, + #[max_length = 2048] + proj4text -> Nullable, + } +} + +diesel::allow_tables_to_appear_in_same_query!(_sqlx_migrations, jobs, spatial_ref_sys,); diff --git a/backend/src/jobs.rs b/backend/src/jobs.rs new file mode 100644 index 0000000..d5a692b --- /dev/null +++ b/backend/src/jobs.rs @@ -0,0 +1,367 @@ +use crate::{ + auth::User, + db::{ + DbPool, + model::{self, DismissJob, NewJob, UpdateJob}, + schema::jobs, + }, +}; +use anyhow::Context; +use chrono::Utc; +use diesel::{ + ExpressionMethods, HasQuery, OptionalExtension, QueryDsl, RunQueryDsl, SelectableHelper, +}; +use ogcapi::{ + drivers::ProcessResult, + types::{ + common::Link, + processes::{ExecuteResults, Response, StatusCode, StatusInfo}, + }, +}; + +pub struct JobHandler { + pub(crate) connection: DbPool, +} + +#[async_trait::async_trait] +impl ogcapi::drivers::JobHandler for JobHandler { + type User = User; + + async fn register( + &self, + job: &StatusInfo, + response_mode: Response, + user: &Self::User, + ) -> anyhow::Result { + let job_id = if job.job_id.is_empty() { + uuid::Uuid::now_v7().to_string() + } else { + job.job_id.clone() + }; + + let new_job = NewJob { + job_id: &job_id, + process_id: job.process_id.as_deref(), + status: job.status.clone().into(), + message: job.message.as_deref(), + type_: job.r#type.clone().into(), + created: job.created.unwrap_or_else(Utc::now), + updated: job.updated.unwrap_or_else(Utc::now), + progress: job.progress.map(Into::into), + links: job.links.iter().map(|l| l.clone().into()).collect(), + response: response_mode.into(), + user_id: user.id, + }; + + let mut connection = self + .connection + .get() + .context("could not get db connection from pool")?; + + let job_id: String = diesel::insert_into(jobs::table) + .values(new_job) + .returning(jobs::job_id) + .get_result(&mut connection) + .context("Failed to insert job into database")?; + + Ok(job_id) + } + + async fn update(&self, job: &StatusInfo, user: &Self::User) -> anyhow::Result<()> { + let update = UpdateJob { + status: job.status.clone().into(), + message: job.message.as_deref(), + updated: job.updated.unwrap_or_else(Utc::now), + progress: job.progress.map(Into::into), + links: job.links.iter().map(|l| l.clone().into()).collect(), + }; + + let mut connection = self + .connection + .get() + .context("could not get db connection from pool")?; + + diesel::update(jobs::table) + .filter(jobs::job_id.eq(&job.job_id)) + .filter(jobs::user_id.eq(user.id)) + .set(update) + .execute(&mut connection) + .context("Failed to update job in database")?; + + Ok(()) + } + + async fn status_list( + &self, + offset: usize, + limit: usize, + user: &Self::User, + ) -> anyhow::Result> { + let mut connection = self + .connection + .get() + .context("could not get db connection from pool")?; + + let result = model::StatusInfo::query() + .filter(jobs::user_id.eq(user.id)) + .offset(offset as i64) + .limit(limit as i64) + .load::(&mut connection) + .context("Failed to query job status list from database")?; + + Ok(result + .into_iter() + .map(Into::into) + .collect::>()) + } + + async fn status(&self, id: &str, user: &Self::User) -> anyhow::Result> { + let mut connection = self + .connection + .get() + .context("could not get db connection from pool")?; + + model::StatusInfo::query() + .filter(jobs::job_id.eq(id)) + .filter(jobs::user_id.eq(user.id)) + .first(&mut connection) + .optional() + .map(|s| s.map(Into::into)) + .context("Failed to query job status from database") + } + + async fn finish( + &self, + job_id: &str, + status: &StatusCode, + message: Option, + links: Vec, + results: Option, + user: &Self::User, + ) -> anyhow::Result<()> { + let finish = crate::db::model::FinishJob { + status: status.clone().into(), + message: message.as_deref(), + updated: Utc::now(), + finished: Utc::now(), + progress: Some(100), + links: links.iter().map(|l| l.clone().into()).collect(), + results: results.map(serde_json::to_value).transpose()?, + }; + + let mut connection = self + .connection + .get() + .context("could not get db connection from pool")?; + + diesel::update( + jobs::table + .filter(jobs::job_id.eq(job_id)) + .filter(jobs::user_id.eq(user.id)), + ) + .set(finish) + .execute(&mut connection) + .context("Failed write finished job to database")?; + + Ok(()) + } + + async fn dismiss(&self, id: &str, user: &Self::User) -> anyhow::Result> { + let mut connection = self + .connection + .get() + .context("could not get db connection from pool")?; + + let returned: Option = diesel::update(jobs::table) + .filter(jobs::job_id.eq(id)) + .filter(jobs::user_id.eq(user.id)) + .set(DismissJob { + status: StatusCode::Dismissed.into(), + message: Some("Job dismissed by user"), + updated: Utc::now(), + }) + .returning(model::StatusInfo::as_returning()) + .get_result(&mut connection) + .optional() + .context("Failed to dismiss job in database")?; + + Ok(returned.map(Into::into)) + } + + async fn results(&self, id: &str, user: &Self::User) -> anyhow::Result { + let mut connection = self + .connection + .get() + .context("could not get db connection from pool")?; + + let results: Option<(Option, model::Response)> = jobs::table + .select((jobs::results, jobs::response)) + .filter(jobs::job_id.eq(id)) + .filter(jobs::user_id.eq(user.id)) + .first(&mut connection) + .optional() + .context("Failed to query job results from database")?; + + let Some((results, response_mode)) = results else { + return Ok(ProcessResult::NoSuchJob); + }; + + let Some(results) = results else { + return Ok(ProcessResult::NotReady); + }; + + let results: ExecuteResults = serde_json::from_value(results)?; + + Ok(ProcessResult::Results { + results, + response_mode: response_mode.into(), + }) + } +} + +#[cfg(test)] +mod tests { + use super::*; + use crate::{config::CONFIG, db::setup_db}; + use ogcapi::drivers::JobHandler as _; + + fn mock_db_pool() -> DbPool { + setup_db(&CONFIG.database).unwrap() + } + + fn mock_user() -> User { + User { + id: uuid::Uuid::from_u128(0xabcd_efab_cdef_abcd_efab_cdef_abcd_efab), + session_token: uuid::Uuid::from_u128(0x1234_5678_90ab_cdef_1234_5678_90ab_cdef).into(), + } + } + + fn mock_status_info(job_id: &str) -> StatusInfo { + StatusInfo { + job_id: job_id.to_string(), + process_id: Some("proc".to_string()), + status: StatusCode::Accepted, + message: Some("msg".to_string()), + r#type: Default::default(), + created: Some(Utc::now()), + updated: Some(Utc::now()), + progress: Some(10), + links: vec![], + finished: None, + } + } + + #[tokio::test] + async fn test_register() { + let pool = mock_db_pool(); + let handler = JobHandler { connection: pool }; + let user = mock_user(); + let status_info = mock_status_info(""); + let result = handler.register(&status_info, Response::Raw, &user).await; + assert!(result.is_ok()); + let job_id = result.unwrap(); + assert!(!job_id.is_empty()); + } + + #[tokio::test] + async fn test_update() { + let pool = mock_db_pool(); + let handler = JobHandler { connection: pool }; + let user = mock_user(); + let status_info = mock_status_info("job1"); + // Register first + handler + .register(&status_info, Response::Raw, &user) + .await + .unwrap(); + // Update + let mut updated_info = status_info.clone(); + updated_info.status = StatusCode::Running; + let result = handler.update(&updated_info, &user).await; + assert!(result.is_ok()); + } + + #[tokio::test] + async fn test_status_list() { + let pool = mock_db_pool(); + let handler = JobHandler { connection: pool }; + let user = mock_user(); + // Register a job + let status_info = mock_status_info("job2"); + handler + .register(&status_info, Response::Raw, &user) + .await + .unwrap(); + // List + let result = handler.status_list(0, 10, &user).await; + assert!(result.is_ok()); + let list = result.unwrap(); + assert!(!list.is_empty()); + } + + #[tokio::test] + async fn test_status() { + let pool = mock_db_pool(); + let handler = JobHandler { connection: pool }; + let user = mock_user(); + let status_info = mock_status_info("job3"); + handler + .register(&status_info, Response::Raw, &user) + .await + .unwrap(); + let result = handler.status("job3", &user).await; + assert!(result.is_ok()); + let status = result.unwrap(); + assert!(status.is_some()); + assert_eq!(status.unwrap().job_id, "job3"); + } + + #[tokio::test] + async fn test_finish() { + let pool = mock_db_pool(); + let handler = JobHandler { connection: pool }; + let user = mock_user(); + let status_info = mock_status_info("job4"); + handler + .register(&status_info, Response::Raw, &user) + .await + .unwrap(); + let result = handler + .finish( + "job4", + &StatusCode::Successful, + Some("done".to_string()), + vec![], + None, + &user, + ) + .await; + assert!(result.is_ok()); + } + + #[tokio::test] + async fn test_dismiss() { + let pool = mock_db_pool(); + let handler = JobHandler { connection: pool }; + let user = mock_user(); + let status_info = mock_status_info("job5"); + handler + .register(&status_info, Response::Raw, &user) + .await + .unwrap(); + let result = handler.dismiss("job5", &user).await; + assert!(result.is_ok()); + let dismissed = result.unwrap(); + assert!(dismissed.is_some()); + assert_eq!(dismissed.unwrap().status, StatusCode::Dismissed); + } + + #[tokio::test] + async fn test_results_no_job() { + let pool = mock_db_pool(); + let handler = JobHandler { connection: pool }; + let user = mock_user(); + let result = handler.results("no_such_job", &user).await; + assert!(matches!(result.unwrap(), ProcessResult::NoSuchJob)); + } +} diff --git a/backend/src/main.rs b/backend/src/main.rs index 5a61c11..d68b28b 100644 --- a/backend/src/main.rs +++ b/backend/src/main.rs @@ -1,112 +1,55 @@ -use axum::routing::get; +use crate::db::setup_db; +use crate::state::{AppState, BoxedProcessor}; use config::CONFIG; use ogcapi::{processes as ogcapi_processes, services as ogcapi_services}; use tracing::level_filters::LevelFilter; use tracing_subscriber::{EnvFilter, layer::SubscriberExt, util::SubscriberInitExt}; -use utoipa_axum::router::OpenApiRouter; +mod auth; mod config; +mod db; +mod jobs; mod processes; +mod state; mod util; #[tokio::main] async fn main() -> anyhow::Result<()> { - // setup tracing - tracing_subscriber::registry() - .with( - EnvFilter::builder() - .with_default_directive(LevelFilter::INFO.into()) - .from_env_lossy(), - ) - .with(tracing_subscriber::fmt::layer().pretty()) - .init(); + setup_tracing(); - // Application state let ogcapi_config = ogcapi::services::Config { host: CONFIG.server.host.clone(), port: CONFIG.server.port, openapi: None, database_url: CONFIG.database.connection_string()?, }; - let ogcapi_state = ogcapi_services::AppState::new_from(&ogcapi_config).await; - // Register processes/processors - let ogcapi_state = ogcapi_state.processors(vec![ - Box::new(ogcapi_processes::echo::Echo), + let db_pool = setup_db(&CONFIG.database)?; + + let ogcapi_state = AppState::new(db_pool).with_processors([ + Box::new(ogcapi_processes::echo::Echo::default()), Box::new(processes::NDVIProcess), - // Box::new(HelloProcess), - // Box::new(Echo), - // Box::new(GeoJsonLoader), - // Box::new(GdalLoader), - ]); + ] as [BoxedProcessor; _]); // Build & run with hyper - let mut ogcapi_service = ogcapi_services::Service::new_with(&ogcapi_config, ogcapi_state).await; - - // let router = OpenApiRouter::::with_openapi(ApiDoc::openapi()); - // let router = OpenApiRouter::::new(); - - let router = OpenApiRouter::::new(); - let (router, api) = router.split_for_parts(); - - let router = router.route("/", get(|| async { "Hello, World!" })); - - ogcapi_service.router = ogcapi_service - .router - .nest("/test", router.with_state(AppState {}.clone())); + let ogcapi_service = ogcapi_services::Service::new_with(&ogcapi_config, ogcapi_state) + .await + .with_processes() + .await; ogcapi_service.serve().await; - // middleware stack - // let router = router.layer( - // ServiceBuilder::new() - // .set_x_request_id(MakeRequestUuid) - // .layer(SetSensitiveRequestHeadersLayer::new([ - // AUTHORIZATION, - // PROXY_AUTHORIZATION, - // COOKIE, - // SET_COOKIE, - // ])) - // .layer(TraceLayer::new_for_http().make_span_with(DefaultMakeSpan::new())) - // .layer(CompressionLayer::new()) - // .layer(CorsLayer::permissive()) - // // .layer(CatchPanicLayer::custom(handle_panic)) - // .propagate_x_request_id(), - // ); - - // let listener = TcpListener::bind((CONFIG.server.host.as_str(), CONFIG.server.port)) - // .await - // .expect("create listener"); - - // axum::serve::serve(listener, router.with_state(AppState {}.clone())) - // // .with_graceful_shutdown(shutdown_signal()) - // .await?; - Ok(()) } -#[derive(Debug, Clone)] -struct AppState {} - -// /// Custom panic handler -// fn handle_panic(err: Box) -> Response { -// let details = if let Some(s) = err.downcast_ref::() { -// s.clone() -// } else if let Some(s) = err.downcast_ref::<&str>() { -// s.to_string() -// } else { -// "Unknown panic message".to_string() -// }; - -// // let body = -// // Exception::new_from_status(StatusCode::INTERNAL_SERVER_ERROR.as_u16()).detail(details); - -// // let body = serde_json::to_string(&body).unwrap(); - -// Response::builder() -// .status(StatusCode::INTERNAL_SERVER_ERROR) -// .header(CONTENT_TYPE, "application/json") -// // .body(Body::from(body)) -// .body(Body::from(details)) -// .unwrap() -// } +fn setup_tracing() { + // setup tracing + tracing_subscriber::registry() + .with( + EnvFilter::builder() + .with_default_directive(LevelFilter::INFO.into()) + .from_env_lossy(), + ) + .with(tracing_subscriber::fmt::layer().pretty()) + .init(); +} diff --git a/backend/src/processes/ndvi.rs b/backend/src/processes/ndvi.rs index 56315a0..f2cf4d2 100644 --- a/backend/src/processes/ndvi.rs +++ b/backend/src/processes/ndvi.rs @@ -6,8 +6,7 @@ use geoengine_datatypes::{ }; use geoengine_openapi_client::{ apis::{ - configuration::Configuration, ogcwfs_api::wfs_feature_handler, - session_api::anonymous_handler, uploads_api::upload_handler, + configuration::Configuration, ogcwfs_api::wfs_feature_handler, uploads_api::upload_handler, workflows_api::register_workflow_handler, }, models::{GeoJson, GetFeatureRequest, SpatialPartition2D, WfsService}, @@ -39,7 +38,7 @@ use schemars::{JsonSchema, generate::SchemaSettings}; use serde::{Deserialize, Serialize}; use std::collections::HashMap; -use crate::{config::CONFIG, util::to_api_workflow}; +use crate::{auth::User, config::CONFIG, util::to_api_workflow}; /// Calculates the Normalized Difference Vegetation Index (NDVI) and the corrected NDVI (kNDVI) from satellite imagery. #[derive(Debug, Clone)] @@ -141,6 +140,8 @@ impl From for ExecuteResults { #[async_trait::async_trait] impl Processor for NDVIProcess { + type User = User; + fn id(&self) -> &'static str { "ndvi" } @@ -282,7 +283,7 @@ impl Processor for NDVIProcess { }) } - async fn execute(&self, execute: Execute) -> Result { + async fn execute(&self, execute: Execute, user: &Self::User) -> Result { let value = serde_json::to_value(execute.inputs)?; let inputs: NDVIProcessInputs = serde_json::from_value(value)?; @@ -298,7 +299,10 @@ impl Processor for NDVIProcess { } } + let configuration = configuration(user); + compute_ndvi( + &configuration, &inputs.coordinate.value.coordinates, inputs.year, inputs.month, @@ -321,6 +325,7 @@ fn validate_date(Year(year): Year, Month(month): Month) -> Result<()> { } async fn compute_ndvi( + configuration: &Configuration, coordinate: &Coordinate, Year(year): Year, Month(month): Month, @@ -330,8 +335,6 @@ async fn compute_ndvi( const NDVI: &str = "NDVI"; const K_NDVI: &str = "kNDVI"; - let configuration = configuration().await?; - // TODO: upload data instead of mocking it // let upload_data_id: String = upload_data(&configuration, coordinate)?; let vector_source = MockPointSource { @@ -375,7 +378,7 @@ async fn compute_ndvi( // eprintln!("{}", serde_json::to_string_pretty(&workflow).unwrap()); - let workflow_id = register_workflow_handler(&configuration, workflow).await?; + let workflow_id = register_workflow_handler(configuration, workflow).await?; let workflow_id = workflow_id.id.to_string(); // eprintln!("Registered workflow with ID: {workflow_id}"); @@ -392,7 +395,7 @@ async fn compute_ndvi( ); let feature_collection = wfs_feature_handler( - &configuration, + configuration, &workflow_id, WfsService::Wfs, GetFeatureRequest::GetFeature, @@ -502,14 +505,13 @@ fn k_ndvi_source() -> Box { .boxed() } -async fn configuration() -> Result { +fn configuration(user: &User) -> Configuration { let mut configuration = Configuration::new(); configuration.base_path = CONFIG.geoengine.base_url.to_string(); - let session = anonymous_handler(&configuration).await?; - configuration.bearer_access_token = Some(session.id.to_string()); + configuration.bearer_access_token = Some(user.session_token.to_string()); - Ok(configuration) + configuration } #[cfg(test)] diff --git a/backend/src/state.rs b/backend/src/state.rs new file mode 100644 index 0000000..c8e800f --- /dev/null +++ b/backend/src/state.rs @@ -0,0 +1,102 @@ +use crate::{ + auth::{GeoEngineAuthMiddleware, User}, + db::DbPool, + jobs::JobHandler, + util::write_lock, +}; +use ogcapi::{ + processes::Processor, + services::{OgcApiProcessesState, OgcApiState}, + types::common::{Conformance, LandingPage, Link}, +}; +use std::{ + collections::HashMap, + sync::{Arc, RwLock}, +}; + +pub type BoxedProcessor = Box>; + +#[derive(Clone)] +pub struct AppState { + pub root: Arc>, + pub conformance: Arc>, + pub jobs: Arc, + pub processors: Arc>>, +} + +impl AppState { + pub fn new(database_pool: DbPool) -> Self { + Self { + root: Arc::new(RwLock::new(LandingPage::default())), + conformance: Arc::new(RwLock::new(Conformance::default())), + jobs: Arc::new(JobHandler { + connection: database_pool, + }), + processors: Arc::new(RwLock::new(HashMap::new())), + } + } + + pub fn with_processors(self, processors: impl IntoIterator) -> Self { + { + let mut proc_map = write_lock(&self.processors); + for processor in processors { + proc_map.insert(processor.id().to_string(), processor); + } + } + self + } +} + +impl OgcApiState for AppState { + type User = User; + type AuthLayer = GeoEngineAuthMiddleware; + + fn root(&self) -> LandingPage { + use crate::util::read_lock; + + read_lock(self.root.as_ref()).to_owned() + } + + fn add_links(&mut self, links: impl IntoIterator) { + use crate::util::write_lock; + + write_lock(&self.root).links.extend(links); + } + + fn conformance(&self) -> Conformance { + use crate::util::read_lock; + + read_lock(self.conformance.as_ref()).to_owned() + } + + fn extend_conformance(&self, items: &[&str]) { + use crate::util::write_lock; + + write_lock(&self.conformance).extend(items); + } + + fn auth_middleware(&self) -> Self::AuthLayer { + GeoEngineAuthMiddleware::new() + } +} + +impl OgcApiProcessesState for AppState { + fn processors(&self) -> Vec>> { + use crate::util::read_lock; + + read_lock(self.processors.as_ref()) + .values() + .cloned() + .collect() + } + + fn processor(&self, id: &str) -> Option>> { + use crate::util::read_lock; + + read_lock(self.processors.as_ref()).get(id).cloned() + } + + fn jobs(&self) -> &dyn ogcapi::drivers::JobHandler { + &*self.jobs + } +} diff --git a/backend/src/util.rs b/backend/src/util.rs index a4ce225..f0ab2c6 100644 --- a/backend/src/util.rs +++ b/backend/src/util.rs @@ -1,4 +1,7 @@ +use std::ops::Deref; + use anyhow::{Context, Result}; +use tracing::error; /// Converts a Geo Engine operator to an Geo Engine OpenAPI workflow. pub fn to_api_workflow( @@ -38,6 +41,57 @@ pub fn to_api_workflow( }) } +/// Helper function to read-lock a `RwLock`, recovering from poisoning if necessary. +pub(crate) fn read_lock(mutex: &std::sync::RwLock) -> std::sync::RwLockReadGuard<'_, T> { + match mutex.read() { + Ok(guard) => guard, + Err(poisoned) => { + error!("Mutex was poisoned, attempting to recover."); + poisoned.into_inner() + } + } +} + +/// Helper function to write-lock a `RwLock`, recovering from poisoning if necessary. +pub(crate) fn write_lock(mutex: &std::sync::RwLock) -> std::sync::RwLockWriteGuard<'_, T> { + match mutex.write() { + Ok(guard) => guard, + Err(poisoned) => { + error!("Mutex was poisoned, attempting to recover."); + poisoned.into_inner() + } + } +} + +/// A wrapper type to hide sensitive information in Debug implementations. +pub struct Secret(pub T); + +impl std::fmt::Debug for Secret { + fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { + write!(f, "********") + } +} + +impl Deref for Secret { + type Target = T; + + fn deref(&self) -> &Self::Target { + &self.0 + } +} + +impl Clone for Secret { + fn clone(&self) -> Self { + Secret(self.0.clone()) + } +} + +impl From for Secret { + fn from(value: T) -> Self { + Secret(value) + } +} + #[cfg(test)] mod tests { diff --git a/clippy.toml b/clippy.toml new file mode 100644 index 0000000..b6ab763 --- /dev/null +++ b/clippy.toml @@ -0,0 +1,7 @@ +avoid-breaking-exported-api = false + +# Adding "OpenAPI" is necessary because the word is used in a doc string in geoengine_services::api. +doc-valid-idents = ["OpenAPI", "PostgreSQL", "OpenId", "WildLIVE"] + +# It is okay to being able to easily write tests. +allow-unwrap-in-tests = true diff --git a/rust-toolchain.toml b/rust-toolchain.toml index 159e501..11aa3e1 100644 --- a/rust-toolchain.toml +++ b/rust-toolchain.toml @@ -1,3 +1,3 @@ [toolchain] -channel = "1.91.0" +channel = "1.92.0" components = ["cargo", "rustfmt", "rust-src", "clippy", "llvm-tools"] diff --git a/test-client/call-process.ipynb b/test-client/call-process.ipynb index 87bd06c..633ca78 100644 --- a/test-client/call-process.ipynb +++ b/test-client/call-process.ipynb @@ -2,7 +2,7 @@ "cells": [ { "cell_type": "code", - "execution_count": 55, + "execution_count": 1, "id": "d941b7e8", "metadata": {}, "outputs": [], @@ -15,7 +15,7 @@ }, { "cell_type": "code", - "execution_count": 42, + "execution_count": 2, "id": "4b9feaee", "metadata": {}, "outputs": [], @@ -37,55 +37,21 @@ }, { "cell_type": "code", - "execution_count": null, + "execution_count": 5, "id": "37d5d37a", "metadata": {}, "outputs": [ { - "name": "stdout", - "output_type": "stream", - "text": [ - "[\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"id\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobControlOptions\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[33m\"sync-execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[33m\"async-execute\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/processes/ndvi\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"self\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"process description\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputTransmission\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[33m\"value\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"version\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"0.1.0\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"id\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"echo\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobControlOptions\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[33m\"sync-execute\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[33m\"async-execute\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/processes/echo\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"self\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"process description\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"outputTransmission\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[33m\"value\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m],\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"version\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"1.0.0\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", - "]\u001b[37m\u001b[39;49;00m\n", - "\n" + "ename": "RuntimeError", + "evalue": "{\"type\":\"404\",\"detail\":\"not found\"}", + "output_type": "error", + "traceback": [ + "\u001b[0;31m---------------------------------------------------------------------------\u001b[0m", + "\u001b[0;31mRuntimeError\u001b[0m Traceback (most recent call last)", + "Cell \u001b[0;32mIn[5], line 3\u001b[0m\n\u001b[1;32m 1\u001b[0m p \u001b[38;5;241m=\u001b[39m Processes(SERVICE_URL)\n\u001b[0;32m----> 3\u001b[0m pprint_json(\u001b[43mp\u001b[49m\u001b[38;5;241;43m.\u001b[39;49m\u001b[43mprocesses\u001b[49m\u001b[43m(\u001b[49m\u001b[43m)\u001b[49m)\n", + "File \u001b[0;32m~/git/geo-engine/BioIS/.venv/lib/python3.10/site-packages/owslib/ogcapi/processes.py:33\u001b[0m, in \u001b[0;36mProcesses.processes\u001b[0;34m(self)\u001b[0m\n\u001b[1;32m 26\u001b[0m \u001b[38;5;250m\u001b[39m\u001b[38;5;124;03m\"\"\"\u001b[39;00m\n\u001b[1;32m 27\u001b[0m \u001b[38;5;124;03mimplements /processes\u001b[39;00m\n\u001b[1;32m 28\u001b[0m \n\u001b[1;32m 29\u001b[0m \u001b[38;5;124;03m@returns: `list` of available processes\u001b[39;00m\n\u001b[1;32m 30\u001b[0m \u001b[38;5;124;03m\"\"\"\u001b[39;00m\n\u001b[1;32m 32\u001b[0m path \u001b[38;5;241m=\u001b[39m \u001b[38;5;124m'\u001b[39m\u001b[38;5;124mprocesses\u001b[39m\u001b[38;5;124m'\u001b[39m\n\u001b[0;32m---> 33\u001b[0m \u001b[38;5;28;01mreturn\u001b[39;00m \u001b[38;5;28;43mself\u001b[39;49m\u001b[38;5;241;43m.\u001b[39;49m\u001b[43m_request\u001b[49m\u001b[43m(\u001b[49m\u001b[43mpath\u001b[49m\u001b[38;5;241;43m=\u001b[39;49m\u001b[43mpath\u001b[49m\u001b[43m)\u001b[49m[\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mprocesses\u001b[39m\u001b[38;5;124m'\u001b[39m]\n", + "File \u001b[0;32m~/git/geo-engine/BioIS/.venv/lib/python3.10/site-packages/owslib/ogcapi/__init__.py:196\u001b[0m, in \u001b[0;36mAPI._request\u001b[0;34m(self, method, path, data, as_dict, kwargs)\u001b[0m\n\u001b[1;32m 193\u001b[0m LOGGER\u001b[38;5;241m.\u001b[39mdebug(\u001b[38;5;124mf\u001b[39m\u001b[38;5;124m'\u001b[39m\u001b[38;5;124mResponse status code: \u001b[39m\u001b[38;5;132;01m{\u001b[39;00mresponse\u001b[38;5;241m.\u001b[39mstatus_code\u001b[38;5;132;01m}\u001b[39;00m\u001b[38;5;124m'\u001b[39m)\n\u001b[1;32m 195\u001b[0m \u001b[38;5;28;01mif\u001b[39;00m \u001b[38;5;129;01mnot\u001b[39;00m response:\n\u001b[0;32m--> 196\u001b[0m \u001b[38;5;28;01mraise\u001b[39;00m \u001b[38;5;167;01mRuntimeError\u001b[39;00m(response\u001b[38;5;241m.\u001b[39mtext)\n\u001b[1;32m 198\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mrequest \u001b[38;5;241m=\u001b[39m response\u001b[38;5;241m.\u001b[39murl\n\u001b[1;32m 199\u001b[0m \u001b[38;5;28mself\u001b[39m\u001b[38;5;241m.\u001b[39mresponse_headers \u001b[38;5;241m=\u001b[39m response\u001b[38;5;241m.\u001b[39mheaders\n", + "\u001b[0;31mRuntimeError\u001b[0m: {\"type\":\"404\",\"detail\":\"not found\"}" ] } ], @@ -185,7 +151,7 @@ }, { "cell_type": "code", - "execution_count": 48, + "execution_count": 5, "id": "28fe4c46", "metadata": {}, "outputs": [ @@ -479,7 +445,7 @@ }, { "cell_type": "code", - "execution_count": 50, + "execution_count": 6, "id": "5f23cd96", "metadata": {}, "outputs": [ @@ -511,7 +477,7 @@ }, { "cell_type": "code", - "execution_count": 53, + "execution_count": 7, "id": "9ad4d352", "metadata": {}, "outputs": [ @@ -520,10 +486,10 @@ "output_type": "stream", "text": [ "{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"ef831121-03d0-486b-97ef-16f7ce869681\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/ef831121-03d0-486b-97ef-16f7ce869681\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Job status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", @@ -539,10 +505,10 @@ { "data": { "text/plain": [ - "'8a0998d8-02fe-431f-b265-4d7c20bc259e'" + "'ef831121-03d0-486b-97ef-16f7ce869681'" ] }, - "execution_count": 53, + "execution_count": 7, "metadata": {}, "output_type": "execute_result" } @@ -571,7 +537,7 @@ }, { "cell_type": "code", - "execution_count": 57, + "execution_count": 8, "id": "ab090a48", "metadata": {}, "outputs": [ @@ -580,18 +546,18 @@ "output_type": "stream", "text": [ "{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"created\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-13T12:49:43.096513Z\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"finished\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-13T12:49:43.426696Z\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"created\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-14T12:29:37.785664Z\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"finished\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-14T12:29:38.170090Z\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"jobID\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"ef831121-03d0-486b-97ef-16f7ce869681\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"links\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m[\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/8a0998d8-02fe-431f-b265-4d7c20bc259e\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/ef831121-03d0-486b-97ef-16f7ce869681\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Job status\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"application/json\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m},\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m{\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/8a0998d8-02fe-431f-b265-4d7c20bc259e/results\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"href\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://localhost:4040/jobs/ef831121-03d0-486b-97ef-16f7ce869681/results\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"rel\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"http://www.opengis.net/def/rel/ogc/1.0/results\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"title\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"Job result\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m}\u001b[37m\u001b[39;49;00m\n", @@ -601,7 +567,7 @@ "\u001b[37m \u001b[39;49;00m\u001b[94m\"progress\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[34m100\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"status\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"successful\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", "\u001b[37m \u001b[39;49;00m\u001b[94m\"type\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"process\"\u001b[39;49;00m,\u001b[37m\u001b[39;49;00m\n", - "\u001b[37m \u001b[39;49;00m\u001b[94m\"updated\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-13T12:49:43.426696Z\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", + "\u001b[37m \u001b[39;49;00m\u001b[94m\"updated\"\u001b[39;49;00m:\u001b[37m \u001b[39;49;00m\u001b[33m\"2025-11-14T12:29:38.170090Z\"\u001b[39;49;00m\u001b[37m\u001b[39;49;00m\n", "}\u001b[37m\u001b[39;49;00m\n", "\n" ] @@ -615,7 +581,7 @@ }, { "cell_type": "code", - "execution_count": 58, + "execution_count": 9, "id": "e20973b7", "metadata": {}, "outputs": [ diff --git a/test-client/call.http b/test-client/call.http index b70d841..9c8384f 100644 --- a/test-client/call.http +++ b/test-client/call.http @@ -1,8 +1,15 @@ +# @name anonymousSession +POST http://localhost:3030/api/anonymous + +### + GET http://localhost:4040/processes/ndvi +Authorization: Bearer {{anonymousSession.response.body.$.id}} ### POST http://localhost:4040/processes/ndvi/execution +Authorization: Bearer {{anonymousSession.response.body.$.id}} Content-Type: application/json { @@ -22,6 +29,41 @@ Content-Type: application/json ### +# @name process +POST http://localhost:4040/processes/ndvi/execution +Authorization: Bearer {{anonymousSession.response.body.$.id}} +Content-Type: application/json +Prefer: respond-async + +{ + "inputs": { + "coordinate": { + "value": { + "type": "Point", + "coordinates": [9.77, 49.54] + }, + "mediaType": "application/geo+json" + }, + "year": 2014, + "month": 3 + }, + "response": "document" +} + +### + +GET http://localhost:4040/jobs/{{process.response.body.jobID}} +Authorization: Bearer {{anonymousSession.response.body.$.id}} +Content-Type: application/json + +### + +GET http://localhost:4040/jobs/{{process.response.body.jobID}}/results +Authorization: Bearer {{anonymousSession.response.body.$.id}} +Content-Type: application/json + +### + POST http://localhost:4040/processes/ndvi/execution Content-Type: application/json From 7cbb8bede3b38b9f270fee28d91e9a7ecdbebe3a Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Thu, 22 Jan 2026 12:09:51 +0100 Subject: [PATCH 05/19] linting --- .github/workflows/ci.yml | 49 +++++++ backend/.sqlfluff | 10 ++ backend/.sqlfluffignore | 1 + backend/diesel-guard.toml | 40 +++++ backend/diesel.toml | 6 +- backend/lint.sh | 53 +++++++ .../down.sql | 10 +- .../2026-01-16-132117-0000_create_jobs/up.sql | 17 ++- backend/src/db/mapping.rs | 2 +- backend/src/db/model.rs | 8 +- backend/src/db/schema.rs | 138 ++++++++++++------ backend/src/jobs.rs | 2 +- 12 files changed, 276 insertions(+), 60 deletions(-) create mode 100644 .github/workflows/ci.yml create mode 100644 backend/.sqlfluff create mode 100644 backend/.sqlfluffignore create mode 100644 backend/diesel-guard.toml create mode 100755 backend/lint.sh diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml new file mode 100644 index 0000000..ef15dbf --- /dev/null +++ b/.github/workflows/ci.yml @@ -0,0 +1,49 @@ +name: CI + +on: + pull_request: + merge_group: + # Allows you to run this workflow manually from the Actions tab + workflow_dispatch: + +jobs: + lint-backend: + name: Lint Backend + + runs-on: ubuntu-24.04 + container: quay.io/geoengine/devcontainer:latest + + permissions: + contents: read + + defaults: + run: + working-directory: ./backend + + steps: + - name: Checkout code + uses: actions/checkout@v6 + - name: Init rustup toolchain + run: rustup show + - name: setup rust build cache + uses: Swatinem/rust-cache@v2 + with: + # An explicit cache key that is used instead of the automatic `job`-based + # cache key and is thus stable across jobs. + # Default: empty + shared-key: "" + + # An additional cache key that is added alongside the automatic `job`-based + # cache key and can be used to further differentiate jobs. + # Default: empty + key: ci_test_ + - name: Rustfmt + run: ./lint.sh rustfmt + - name: Clippy + run: ./lint.sh clippy + - name: SQLFluff + run: ./lint.sh sqlfluff + - name: Diesel Check + run: | + service postgresql start + ./lint.sh diesel_cli --with-install diff --git a/backend/.sqlfluff b/backend/.sqlfluff new file mode 100644 index 0000000..3517875 --- /dev/null +++ b/backend/.sqlfluff @@ -0,0 +1,10 @@ +[sqlfluff] +dialect = postgres +templater = jinja +sql_file_exts = .sql +large_file_skip_byte_limit = 40000 + +[sqlfluff:rules:references.keywords] +# Words that are not-reserved in +ignore_words = + name diff --git a/backend/.sqlfluffignore b/backend/.sqlfluffignore new file mode 100644 index 0000000..9f97022 --- /dev/null +++ b/backend/.sqlfluffignore @@ -0,0 +1 @@ +target/ \ No newline at end of file diff --git a/backend/diesel-guard.toml b/backend/diesel-guard.toml new file mode 100644 index 0000000..8546349 --- /dev/null +++ b/backend/diesel-guard.toml @@ -0,0 +1,40 @@ +# diesel-guard configuration file +# Copy this file to diesel-guard.toml and customize as needed + +# Framework configuration (REQUIRED) +# Specify which migration framework you're using +# Valid values: "diesel" or "sqlx" +framework = "diesel" +# framework = "sqlx" + +# Skip checking migrations created before this timestamp +# Useful for retrofitting diesel-guard into existing projects +# +# Timestamp format depends on your framework: +# Diesel: YYYYMMDDHHMMSS, YYYY_MM_DD_HHMMSS, or YYYY-MM-DD-HHMMSS +# Examples: 20240101000000, 2024_01_01_000000, 2024-01-01-000000 +# SQLx: YYYYMMDDHHMMSS (14 digits, no separators) +# Example: 20240101000000 +# +# Works with any format - diesel-guard normalizes timestamps for comparison +# start_after = "20240101000000" + +# Check rollback migrations (down.sql files or -- migrate:down sections) +# Default: false (only checks forward migrations) +# +# Set to true if you want to ensure rollback migrations are also safe +check_down = true + +# Disable specific safety checks +# Valid check names: +# - AddColumnCheck (ADD COLUMN with DEFAULT) +# - AddIndexCheck (CREATE INDEX without CONCURRENTLY) +# - AddNotNullCheck (ALTER COLUMN SET NOT NULL) +# - AlterColumnTypeCheck (ALTER COLUMN TYPE) +# - DropColumnCheck (DROP COLUMN) +# +# Example: Disable checking for ADD COLUMN and DROP COLUMN operations +# disable_checks = ["AddColumnCheck", "DropColumnCheck"] +# +# Default: [] (all checks enabled) +# disable_checks = [] diff --git a/backend/diesel.toml b/backend/diesel.toml index bb1d1f7..8eb32ae 100644 --- a/backend/diesel.toml +++ b/backend/diesel.toml @@ -3,7 +3,11 @@ [print_schema] file = "src/db/schema.rs" -custom_type_derives = ["diesel::query_builder::QueryId", "Clone"] +import_types = [] +custom_type_derives = ["Debug"] +with_docs = true +allow_tables_to_appear_in_same_query_config = "fk_related_tables" +filter = { except_tables = ["_sqlx_migrations", "spatial_ref_sys"] } [migrations_directory] dir = "migrations" diff --git a/backend/lint.sh b/backend/lint.sh new file mode 100755 index 0000000..e0a9b83 --- /dev/null +++ b/backend/lint.sh @@ -0,0 +1,53 @@ +#!/bin/env bash + +set -euo pipefail + +function rustfmt { + cargo fmt --all -- --check +} + +function clippy { + cargo clippy --all-targets --locked -- -D warnings +} + +function sqlfluff { + pipx run sqlfluff==3.5.0 lint +} + +function diesel_cli { + local should_install=${1:-} + + if [ "$should_install" == "--with-install" ]; then + echo "Installing Diesel CLI and Diesel Guard…" + cargo install diesel_cli --no-default-features --features postgres + cargo install diesel-guard --no-default-features + fi + + diesel migration run --locked-schema + diesel-guard check migrations +} + +function all { + echo "Running rustfmt…" + rustfmt + echo "Running clippy…" + clippy + echo "Running sqlfluff…" + sqlfluff + echo "Running Diesel CLI…" + diesel_cli $@ +} + +function help { + echo "$0 " + echo "Tasks:" + compgen -A function | grep -e '^_' -v | cat -n + echo "Args:" + echo " --with-install Install Diesel CLI and Diesel Guard before running migrations" +} + +function _default { + help +} + +${@:-_default} diff --git a/backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql b/backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql index a6655a7..d835ba7 100644 --- a/backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql +++ b/backend/migrations/2026-01-16-132117-0000_create_jobs/down.sql @@ -1,5 +1,7 @@ +-- safety-assured:start DROP TABLE jobs; -DROP TYPE IF EXISTS Link CASCADE; -DROP TYPE IF EXISTS Response CASCADE; -DROP TYPE IF EXISTS JobType CASCADE; -DROP TYPE IF EXISTS StatusCode CASCADE; +-- safety-assured:end +DROP TYPE IF EXISTS "Link" CASCADE; +DROP TYPE IF EXISTS "Response" CASCADE; +DROP TYPE IF EXISTS "JobType" CASCADE; +DROP TYPE IF EXISTS "StatusCode" CASCADE; diff --git a/backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql b/backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql index ef6fe84..37d906e 100644 --- a/backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql +++ b/backend/migrations/2026-01-16-132117-0000_create_jobs/up.sql @@ -1,4 +1,4 @@ -CREATE TYPE Link AS ( +CREATE TYPE "Link" AS ( href TEXT, rel TEXT, type TEXT, @@ -7,16 +7,16 @@ CREATE TYPE Link AS ( length BIGINT ); -CREATE TYPE Response AS ENUM ( +CREATE TYPE "Response" AS ENUM ( 'raw', 'document' ); -CREATE TYPE JobType AS ENUM ( +CREATE TYPE "JobType" AS ENUM ( 'process' ); -CREATE TYPE StatusCode AS ENUM ( +CREATE TYPE "StatusCode" AS ENUM ( 'accepted', 'running', 'successful', @@ -28,16 +28,17 @@ CREATE TABLE jobs ( -- StatusInfo job_id TEXT PRIMARY KEY, process_id TEXT, - type JobType NOT NULL, - status StatusCode NOT NULL, + job_type "JobType" NOT NULL, + status "StatusCode" NOT NULL, message TEXT, created TIMESTAMPTZ NOT NULL, finished TIMESTAMPTZ, updated TIMESTAMPTZ NOT NULL, progress SMALLINT CHECK (progress >= 0 AND progress <= 100), - links Link[] NOT NULL CHECK (array_position(links, NULL) IS NULL) DEFAULT ARRAY[]::Link[], + links "Link" [] NOT NULL + CHECK (array_position(links, NULL) IS NULL) DEFAULT ARRAY[]::"Link" [], -- Response - response Response NOT NULL, + response "Response" NOT NULL, -- Results results JSONB, -- TODO: define structure -- User diff --git a/backend/src/db/mapping.rs b/backend/src/db/mapping.rs index 95b67f8..9e253c0 100644 --- a/backend/src/db/mapping.rs +++ b/backend/src/db/mapping.rs @@ -97,7 +97,7 @@ impl From for OgcApiStatusInfo { fn from(status: StatusInfo) -> Self { OgcApiStatusInfo { process_id: status.process_id, - r#type: status.type_.into(), + r#type: status.job_type.into(), job_id: status.job_id, status: status.status.into(), message: status.message, diff --git a/backend/src/db/model.rs b/backend/src/db/model.rs index 0978b3a..3d778a4 100644 --- a/backend/src/db/model.rs +++ b/backend/src/db/model.rs @@ -18,7 +18,7 @@ pub struct NewJob<'a> { pub process_id: Option<&'a str>, pub status: StatusCode, pub message: Option<&'a str>, - pub type_: JobType, + pub job_type: JobType, pub created: DateTime, pub updated: DateTime, pub progress: Option, @@ -64,7 +64,7 @@ pub struct StatusInfo { pub process_id: Option, pub status: StatusCode, pub message: Option, - pub type_: JobType, + pub job_type: JobType, pub created: DateTime, pub updated: DateTime, pub finished: Option>, @@ -74,13 +74,13 @@ pub struct StatusInfo { } #[derive(Debug, Deserialize, DbEnum, SqlType)] -#[db_enum(existing_type_path = "crate::db::schema::sql_types::Jobtype")] +#[db_enum(existing_type_path = "crate::db::schema::sql_types::JobType")] pub enum JobType { Process, } #[derive(Debug, Deserialize, DbEnum, SqlType)] -#[db_enum(existing_type_path = "crate::db::schema::sql_types::Statuscode")] +#[db_enum(existing_type_path = "crate::db::schema::sql_types::StatusCode")] pub enum StatusCode { Accepted, Running, diff --git a/backend/src/db/schema.rs b/backend/src/db/schema.rs index 7b71be0..422e2df 100644 --- a/backend/src/db/schema.rs +++ b/backend/src/db/schema.rs @@ -1,70 +1,126 @@ // @generated automatically by Diesel CLI. +/// A module containing custom SQL type definitions +/// +/// (Automatically generated by Diesel.) pub mod sql_types { - #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] - #[diesel(postgres_type(name = "jobtype"))] - pub struct Jobtype; + /// The `JobType` SQL type + /// + /// (Automatically generated by Diesel.) + #[derive(Debug, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "JobType"))] + pub struct JobType; - #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] - #[diesel(postgres_type(name = "link"))] + /// The `Link` SQL type + /// + /// (Automatically generated by Diesel.) + #[derive(Debug, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "Link"))] pub struct Link; - #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] - #[diesel(postgres_type(name = "response"))] + /// The `Response` SQL type + /// + /// (Automatically generated by Diesel.) + #[derive(Debug, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "Response"))] pub struct Response; - #[derive(diesel::query_builder::QueryId, Clone, diesel::sql_types::SqlType)] - #[diesel(postgres_type(name = "statuscode"))] - pub struct Statuscode; -} - -diesel::table! { - _sqlx_migrations (version) { - version -> Int8, - description -> Text, - installed_on -> Timestamptz, - success -> Bool, - checksum -> Bytea, - execution_time -> Int8, - } + /// The `StatusCode` SQL type + /// + /// (Automatically generated by Diesel.) + #[derive(Debug, diesel::sql_types::SqlType)] + #[diesel(postgres_type(name = "StatusCode"))] + pub struct StatusCode; } diesel::table! { use diesel::sql_types::*; - use super::sql_types::Jobtype; - use super::sql_types::Statuscode; + use super::sql_types::JobType; + use super::sql_types::StatusCode; use super::sql_types::Link; use super::sql_types::Response; + /// Representation of the `jobs` table. + /// + /// (Automatically generated by Diesel.) jobs (job_id) { + /// The `job_id` column of the `jobs` table. + /// + /// Its SQL type is `Text`. + /// + /// (Automatically generated by Diesel.) job_id -> Text, + /// The `process_id` column of the `jobs` table. + /// + /// Its SQL type is `Nullable`. + /// + /// (Automatically generated by Diesel.) process_id -> Nullable, - #[sql_name = "type"] - type_ -> Jobtype, - status -> Statuscode, + /// The `job_type` column of the `jobs` table. + /// + /// Its SQL type is `JobType`. + /// + /// (Automatically generated by Diesel.) + job_type -> JobType, + /// The `status` column of the `jobs` table. + /// + /// Its SQL type is `StatusCode`. + /// + /// (Automatically generated by Diesel.) + status -> StatusCode, + /// The `message` column of the `jobs` table. + /// + /// Its SQL type is `Nullable`. + /// + /// (Automatically generated by Diesel.) message -> Nullable, + /// The `created` column of the `jobs` table. + /// + /// Its SQL type is `Timestamptz`. + /// + /// (Automatically generated by Diesel.) created -> Timestamptz, + /// The `finished` column of the `jobs` table. + /// + /// Its SQL type is `Nullable`. + /// + /// (Automatically generated by Diesel.) finished -> Nullable, + /// The `updated` column of the `jobs` table. + /// + /// Its SQL type is `Timestamptz`. + /// + /// (Automatically generated by Diesel.) updated -> Timestamptz, + /// The `progress` column of the `jobs` table. + /// + /// Its SQL type is `Nullable`. + /// + /// (Automatically generated by Diesel.) progress -> Nullable, + /// The `links` column of the `jobs` table. + /// + /// Its SQL type is `Array>`. + /// + /// (Automatically generated by Diesel.) links -> Array>, + /// The `response` column of the `jobs` table. + /// + /// Its SQL type is `Response`. + /// + /// (Automatically generated by Diesel.) response -> Response, + /// The `results` column of the `jobs` table. + /// + /// Its SQL type is `Nullable`. + /// + /// (Automatically generated by Diesel.) results -> Nullable, + /// The `user_id` column of the `jobs` table. + /// + /// Its SQL type is `Uuid`. + /// + /// (Automatically generated by Diesel.) user_id -> Uuid, } } - -diesel::table! { - spatial_ref_sys (srid) { - srid -> Int4, - #[max_length = 256] - auth_name -> Nullable, - auth_srid -> Nullable, - #[max_length = 2048] - srtext -> Nullable, - #[max_length = 2048] - proj4text -> Nullable, - } -} - -diesel::allow_tables_to_appear_in_same_query!(_sqlx_migrations, jobs, spatial_ref_sys,); diff --git a/backend/src/jobs.rs b/backend/src/jobs.rs index d5a692b..ade5154 100644 --- a/backend/src/jobs.rs +++ b/backend/src/jobs.rs @@ -44,7 +44,7 @@ impl ogcapi::drivers::JobHandler for JobHandler { process_id: job.process_id.as_deref(), status: job.status.clone().into(), message: job.message.as_deref(), - type_: job.r#type.clone().into(), + job_type: job.r#type.clone().into(), created: job.created.unwrap_or_else(Utc::now), updated: job.updated.unwrap_or_else(Utc::now), progress: job.progress.map(Into::into), From 0cab1f451214404371d5f72b39a26d5f8f974c1d Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Thu, 22 Jan 2026 13:25:34 +0100 Subject: [PATCH 06/19] tests --- .github/workflows/ci.yml | 53 ++++++++++++++++++++++++++++++++++++++++ 1 file changed, 53 insertions(+) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index ef15dbf..adeefea 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -47,3 +47,56 @@ jobs: run: | service postgresql start ./lint.sh diesel_cli --with-install + + test-backend: + name: Test Backend + + runs-on: ubuntu-24.04 + container: quay.io/geoengine/devcontainer:latest + + permissions: + contents: read + + defaults: + run: + working-directory: ./backend + + steps: + - name: Checkout code + uses: actions/checkout@v6 + - name: Init rustup toolchain + run: rustup show + + - name: Start PostgreSQL + run: service postgresql start + - name: setup rust build cache + uses: Swatinem/rust-cache@v2 + with: + # An explicit cache key that is used instead of the automatic `job`-based + # cache key and is thus stable across jobs. + # Default: empty + shared-key: "" + + # An additional cache key that is added alongside the automatic `job`-based + # cache key and can be used to further differentiate jobs. + # Default: empty + key: ci_test_ + - name: Test + run: | + cargo install --locked cargo-llvm-cov + + cargo llvm-cov \ + --locked \ + --all-features \ + --profile ci \ + --lcov \ + --output-path lcov.info + + # Doc-tests are not covered by llvm-cov, so we run them separately + # cf. https://github.com/taiki-e/cargo-llvm-cov/issues/2 + cargo test --doc --all-features --locked + - name: Upload coverage to Coveralls + uses: coverallsapp/github-action@v2 + with: + github-token: ${{ secrets.GITHUB_TOKEN }} + file: lcov.info From c30673603217714b0a88cde6057646ea956e0655 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Thu, 22 Jan 2026 16:29:58 +0100 Subject: [PATCH 07/19] use upstream version --- backend/Cargo.lock | 47 +++++++++++++++++++++++++++++++++++++-- backend/Cargo.toml | 2 +- backend/src/db/mapping.rs | 2 ++ backend/src/main.rs | 8 +++---- 4 files changed, 51 insertions(+), 8 deletions(-) diff --git a/backend/Cargo.lock b/backend/Cargo.lock index 489ebe8..2d1c2cc 100644 --- a/backend/Cargo.lock +++ b/backend/Cargo.lock @@ -9,7 +9,7 @@ dependencies = [ "anyhow", "async-trait", "axum", - "axum-extra", + "axum-extra 0.10.3", "chrono", "clap", "clap_derive", @@ -625,6 +625,27 @@ dependencies = [ "tracing", ] +[[package]] +name = "axum-extra" +version = "0.12.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dbfe9f610fe4e99cf0cfcd03ccf8c63c28c616fe714d80475ef731f3b13dd21b" +dependencies = [ + "axum", + "axum-core", + "bytes", + "futures-core", + "futures-util", + "http", + "http-body", + "http-body-util", + "mime", + "pin-project-lite", + "tower-layer", + "tower-service", + "tracing", +] + [[package]] name = "axum-macros" version = "0.5.0" @@ -1109,6 +1130,20 @@ dependencies = [ "syn", ] +[[package]] +name = "dashmap" +version = "6.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5041cc499144891f3790297212f32a74fb938e5136a14943f338ef9e0ae276cf" +dependencies = [ + "cfg-if", + "crossbeam-utils", + "hashbrown 0.14.5", + "lock_api", + "once_cell", + "parking_lot_core", +] + [[package]] name = "der" version = "0.7.10" @@ -3104,6 +3139,7 @@ dependencies = [ [[package]] name = "ogcapi" version = "0.3.1" +source = "git+https://github.com/georust/ogcapi?branch=user-auth#cbbc81f91b2c327ddb6bdca8e90cb644233e113e" dependencies = [ "ogcapi-client", "ogcapi-drivers", @@ -3115,6 +3151,7 @@ dependencies = [ [[package]] name = "ogcapi-client" version = "0.3.0" +source = "git+https://github.com/georust/ogcapi?branch=user-auth#cbbc81f91b2c327ddb6bdca8e90cb644233e113e" dependencies = [ "geojson", "log", @@ -3130,6 +3167,7 @@ dependencies = [ [[package]] name = "ogcapi-drivers" version = "0.3.0" +source = "git+https://github.com/georust/ogcapi?branch=user-auth#cbbc81f91b2c327ddb6bdca8e90cb644233e113e" dependencies = [ "anyhow", "async-trait", @@ -3144,6 +3182,7 @@ dependencies = [ [[package]] name = "ogcapi-processes" version = "0.3.0" +source = "git+https://github.com/georust/ogcapi?branch=user-auth#cbbc81f91b2c327ddb6bdca8e90cb644233e113e" dependencies = [ "anyhow", "async-trait", @@ -3160,11 +3199,13 @@ dependencies = [ [[package]] name = "ogcapi-services" version = "0.3.0" +source = "git+https://github.com/georust/ogcapi?branch=user-auth#cbbc81f91b2c327ddb6bdca8e90cb644233e113e" dependencies = [ "anyhow", "axum", - "axum-extra", + "axum-extra 0.12.2", "clap", + "dashmap", "dotenvy", "dyn-clone", "futures", @@ -3174,6 +3215,7 @@ dependencies = [ "ogcapi-processes", "ogcapi-types", "openapiv3", + "reqwest", "schemars 1.1.0", "serde", "serde_json", @@ -3194,6 +3236,7 @@ dependencies = [ [[package]] name = "ogcapi-types" version = "0.3.0" +source = "git+https://github.com/georust/ogcapi?branch=user-auth#cbbc81f91b2c327ddb6bdca8e90cb644233e113e" dependencies = [ "chrono", "geojson", diff --git a/backend/Cargo.toml b/backend/Cargo.toml index 1f75c80..5bb1849 100644 --- a/backend/Cargo.toml +++ b/backend/Cargo.toml @@ -65,7 +65,7 @@ geoengine-operators = { git = "https://github.com/geo-engine/geoengine", branch geoengine-openapi-client = { git = "https://github.com/geo-engine/openapi-client", branch = "rust" } indoc = "2.0" nom = "8.0" -ogcapi = { path = "../../../ogcapi/ogcapi", features = [ +ogcapi = { git = "https://github.com/georust/ogcapi", branch = "user-auth", features = [ "services", "common", "processes", diff --git a/backend/src/db/mapping.rs b/backend/src/db/mapping.rs index 9e253c0..6186b2c 100644 --- a/backend/src/db/mapping.rs +++ b/backend/src/db/mapping.rs @@ -49,6 +49,8 @@ impl From for OgcApiLink { hreflang: link.hreflang, title: link.title, length: link.length, + templated: None, + var_base: None, } } } diff --git a/backend/src/main.rs b/backend/src/main.rs index d68b28b..520430f 100644 --- a/backend/src/main.rs +++ b/backend/src/main.rs @@ -21,7 +21,6 @@ async fn main() -> anyhow::Result<()> { host: CONFIG.server.host.clone(), port: CONFIG.server.port, openapi: None, - database_url: CONFIG.database.connection_string()?, }; let db_pool = setup_db(&CONFIG.database)?; @@ -32,10 +31,9 @@ async fn main() -> anyhow::Result<()> { ] as [BoxedProcessor; _]); // Build & run with hyper - let ogcapi_service = ogcapi_services::Service::new_with(&ogcapi_config, ogcapi_state) - .await - .with_processes() - .await; + let ogcapi_service = ogcapi_services::Service::try_new_with(&ogcapi_config, ogcapi_state) + .await? + .with_processes(); ogcapi_service.serve().await; From 4239d0142acb45075312dde43ac0cfe9034d6ef9 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Thu, 22 Jan 2026 16:37:54 +0100 Subject: [PATCH 08/19] ci fixes --- .github/workflows/ci.yml | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index adeefea..9885a36 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -47,6 +47,8 @@ jobs: run: | service postgresql start ./lint.sh diesel_cli --with-install + env: + DIESEL_DATABASE_URL: postgresql://geoengine@geoengine/biois test-backend: name: Test Backend @@ -88,7 +90,6 @@ jobs: cargo llvm-cov \ --locked \ --all-features \ - --profile ci \ --lcov \ --output-path lcov.info From 0775edb5c03d9ebe2c247894220401e3a5f4eb2b Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Thu, 22 Jan 2026 16:38:12 +0100 Subject: [PATCH 09/19] fix ci --- .github/workflows/ci.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 9885a36..25ee326 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -48,7 +48,7 @@ jobs: service postgresql start ./lint.sh diesel_cli --with-install env: - DIESEL_DATABASE_URL: postgresql://geoengine@geoengine/biois + DATABASE_URL: postgresql://geoengine@geoengine/biois test-backend: name: Test Backend From 2eb1b3df5210adefd2a8bbd2fac2a160e6c06b77 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Thu, 22 Jan 2026 16:45:11 +0100 Subject: [PATCH 10/19] fix ci --- .github/workflows/ci.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 25ee326..3077066 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -48,7 +48,7 @@ jobs: service postgresql start ./lint.sh diesel_cli --with-install env: - DATABASE_URL: postgresql://geoengine@geoengine/biois + DATABASE_URL: postgres://geoengine:geoengine@localhost/biois test-backend: name: Test Backend From 68e6b9b9b59a29409cc2f7a5a5a2424bb96bbb7b Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Thu, 22 Jan 2026 16:51:16 +0100 Subject: [PATCH 11/19] fix ci --- .github/workflows/ci.yml | 10 +++++++--- 1 file changed, 7 insertions(+), 3 deletions(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 3077066..cd486ea 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -43,10 +43,12 @@ jobs: run: ./lint.sh clippy - name: SQLFluff run: ./lint.sh sqlfluff - - name: Diesel Check + - name: Start PostgreSQL run: | service postgresql start - ./lint.sh diesel_cli --with-install + psql postgres://geoengine:geoengine@localhost -c "CREATE DATABASE biois;" + - name: Diesel Check + run: ./lint.sh diesel_cli --with-install env: DATABASE_URL: postgres://geoengine:geoengine@localhost/biois @@ -70,7 +72,9 @@ jobs: run: rustup show - name: Start PostgreSQL - run: service postgresql start + run: | + service postgresql start + psql postgres://geoengine:geoengine@localhost -c "CREATE DATABASE biois;" - name: setup rust build cache uses: Swatinem/rust-cache@v2 with: From 1e1a9b0633e6fd6bbf82caf300d47cee49120ece Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 07:46:28 +0100 Subject: [PATCH 12/19] ci --- .github/workflows/ci.yml | 4 ---- backend/src/util.rs | 13 +++++++++++++ 2 files changed, 13 insertions(+), 4 deletions(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index cd486ea..cc5b0b7 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -96,10 +96,6 @@ jobs: --all-features \ --lcov \ --output-path lcov.info - - # Doc-tests are not covered by llvm-cov, so we run them separately - # cf. https://github.com/taiki-e/cargo-llvm-cov/issues/2 - cargo test --doc --all-features --locked - name: Upload coverage to Coveralls uses: coverallsapp/github-action@v2 with: diff --git a/backend/src/util.rs b/backend/src/util.rs index f0ab2c6..99548d7 100644 --- a/backend/src/util.rs +++ b/backend/src/util.rs @@ -72,6 +72,12 @@ impl std::fmt::Debug for Secret { } } +impl std::fmt::Display for Secret { + fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { + write!(f, "********") + } +} + impl Deref for Secret { type Target = T; @@ -144,4 +150,11 @@ mod tests { }) ); } + + #[test] + fn it_hides_secret_in_debug_and_display() { + let secret = Secret("my_password".to_string()); + assert_eq!(format!("{:?}", secret), "********"); + assert_eq!(format!("{}", secret), "********"); + } } From 09b58876241b8259c787dc71ec5ea92cfd594bad Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 08:05:04 +0100 Subject: [PATCH 13/19] some tests --- backend/src/auth.rs | 39 ++++++++++++++++ backend/src/state.rs | 106 +++++++++++++++++++++++++++++++++++++++++++ backend/src/util.rs | 62 +++++++++++++++++++++++++ 3 files changed, 207 insertions(+) diff --git a/backend/src/auth.rs b/backend/src/auth.rs index cb95ec0..6e465b1 100644 --- a/backend/src/auth.rs +++ b/backend/src/auth.rs @@ -139,4 +139,43 @@ mod tests { let parsed_token = parse_bearer_token(&header_value).expect("to parse token"); assert_eq!(parsed_token, token); } + + #[test] + fn it_parses_bearer_case_insensitive() { + let token = Uuid::new_v4(); + let header_value = format!("bearer {token}"); + let parsed_token = parse_bearer_token(&header_value).expect("to parse token"); + assert_eq!(parsed_token, token); + } + + #[test] + fn parse_fails_on_invalid_token() { + let header_value = "Bearer not-a-uuid"; + let err = parse_bearer_token(header_value).unwrap_err(); + assert!(err.to_string().contains("Failed to parse bearer token")); + } + + #[test] + fn uuid_parser_rejects_short_input() { + let input = "123"; + let res = uuid_parser(input); + assert!(res.is_err()); + } + + #[test] + fn whitelisted_paths_match_exact_and_prefix() { + let middleware = GeoEngineAuthMiddleware::new(); + + // exact + assert!(middleware.path_is_whitelisted("/")); + assert!(middleware.path_is_whitelisted("/health")); + assert!(middleware.path_is_whitelisted("/processes/echo")); + + // prefix + assert!(middleware.path_is_whitelisted("/api/some/resource")); + assert!(middleware.path_is_whitelisted("/swagger/index.html")); + + // not whitelisted + assert!(!middleware.path_is_whitelisted("/private")); + } } diff --git a/backend/src/state.rs b/backend/src/state.rs index c8e800f..ad0f40c 100644 --- a/backend/src/state.rs +++ b/backend/src/state.rs @@ -100,3 +100,109 @@ impl OgcApiProcessesState for AppState { &*self.jobs } } + +#[cfg(test)] +mod tests { + use super::*; + use crate::{ + config::CONFIG, + db::{DbPool, setup_db}, + util::Secret, + }; + use ogcapi::{processes::echo::Echo, types::common::Link}; + + fn dummy_db_pool() -> DbPool { + setup_db(&CONFIG.database).unwrap() + } + + #[test] + fn test_app_state_new_initializes_fields() { + let db_pool = dummy_db_pool(); + let state = AppState::new(db_pool); + + assert_eq!(state.root.read().unwrap().links.len(), 0); + assert_eq!(state.conformance.read().unwrap().conforms_to.len(), 0); + assert!(state.processors.read().unwrap().is_empty()); + } + + #[test] + fn test_with_processors_adds_processor() { + let db_pool = dummy_db_pool(); + let state = AppState::new(db_pool); + let processor: BoxedProcessor = Box::>::default(); + + let state = state.with_processors(vec![processor]); + let processors = state.processors.read().unwrap(); + assert!(processors.contains_key("echo")); + } + + #[test] + fn test_add_links_extends_landing_page_links() { + let db_pool = dummy_db_pool(); + let mut state = AppState::new(db_pool); + + let links = vec![Link::new("a", "self"), Link::new("b", "alternate")]; + state.add_links(links.clone()); + + let root = state.root.read().unwrap(); + assert!(root.links.iter().any(|l| l.href == "a")); + assert!(root.links.iter().any(|l| l.href == "b")); + } + + #[test] + fn test_extend_conformance_adds_items() { + let db_pool = dummy_db_pool(); + let state = AppState::new(db_pool); + + state.extend_conformance(&["http://example.com/spec1", "http://example.com/spec2"]); + let conformance = state.conformance.read().unwrap(); + assert!( + conformance + .conforms_to + .contains(&"http://example.com/spec1".to_string()) + ); + assert!( + conformance + .conforms_to + .contains(&"http://example.com/spec2".to_string()) + ); + } + + #[test] + fn test_processor_and_processors_methods() { + let db_pool = dummy_db_pool(); + let state = AppState::new(db_pool); + let processor: BoxedProcessor = Box::>::default(); + + let state = state.with_processors(vec![processor]); + let all = state.processors(); + assert_eq!(all.len(), 1); + assert_eq!(all[0].id(), "echo"); + + let found = state.processor("echo"); + assert!(found.is_some()); + assert_eq!(found.unwrap().id(), "echo"); + + let not_found = state.processor("not_found"); + assert!(not_found.is_none()); + } + + #[tokio::test] + async fn test_jobs_returns_job_handler() { + let db_pool = dummy_db_pool(); + let state = AppState::new(db_pool); + + let jobs = state.jobs(); + + jobs.status_list( + 0, + 1, + &User { + id: Default::default(), + session_token: Secret(Default::default()), + }, + ) + .await + .unwrap(); + } +} diff --git a/backend/src/util.rs b/backend/src/util.rs index 99548d7..b9d2ad6 100644 --- a/backend/src/util.rs +++ b/backend/src/util.rs @@ -103,6 +103,7 @@ mod tests { use super::*; use pretty_assertions::assert_eq; + use std::sync::{Arc, RwLock}; #[test] fn it_converts_operator_to_api_workflow() { @@ -157,4 +158,65 @@ mod tests { assert_eq!(format!("{:?}", secret), "********"); assert_eq!(format!("{}", secret), "********"); } + + #[test] + fn it_recovers_from_poisoned_read_lock() { + let lock = Arc::new(RwLock::new(42)); + + // Poison the lock by panicking while holding a write lock + { + let lock = Arc::clone(&lock); + let _ = std::thread::spawn(move || { + let _guard = lock.write().unwrap(); + panic!("poison!"); + }) + .join(); + } + + // Should recover and read the value + let value = *read_lock(&lock); + assert_eq!(value, 42); + } + + #[test] + fn it_recovers_from_poisoned_write_lock() { + let lock = Arc::new(RwLock::new(100)); + + // Poison the lock by panicking while holding a write lock + { + let lock = Arc::clone(&lock); + let _ = std::thread::spawn(move || { + let _guard = lock.write().unwrap(); + panic!("poison!"); + }) + .join(); + } + + // Should recover and allow writing + { + let mut guard = write_lock(&lock); + *guard = 200; + } + assert_eq!(*read_lock(&lock), 200); + } + + #[test] + fn it_reads_and_writes_with_unpoisoned_lock() { + let lock = RwLock::new(5); + + { + let guard = read_lock(&lock); + assert_eq!(*guard, 5); + } + + { + let mut guard = write_lock(&lock); + *guard = 10; + } + + { + let guard = read_lock(&lock); + assert_eq!(*guard, 10); + } + } } From d82cc6825f51a633c5e271c91ff61b500888cd5a Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 16:29:39 +0100 Subject: [PATCH 14/19] more tests --- backend/Cargo.lock | 45 +++++++++++++++++++ backend/Cargo.toml | 3 ++ backend/src/auth.rs | 76 ++++++++++++++++++++++++++++++++ backend/src/db/model.rs | 35 +++++++++++++++ backend/src/processes/ndvi.rs | 82 +++++++++++++++++++++++++++++++++++ 5 files changed, 241 insertions(+) diff --git a/backend/Cargo.lock b/backend/Cargo.lock index 2d1c2cc..afd8fbf 100644 --- a/backend/Cargo.lock +++ b/backend/Cargo.lock @@ -21,6 +21,7 @@ dependencies = [ "geoengine-datatypes", "geoengine-openapi-client", "geoengine-operators", + "httptest", "indoc", "nom", "ogcapi", @@ -725,6 +726,17 @@ dependencies = [ "generic-array 0.14.7", ] +[[package]] +name = "bstr" +version = "1.12.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "63044e1ae8e69f3b5a92c736ca6269b8d12fa7efe39bf34ddb06d102cf0e2cab" +dependencies = [ + "memchr", + "regex-automata", + "serde", +] + [[package]] name = "built" version = "0.8.0" @@ -1024,6 +1036,15 @@ version = "1.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "790eea4361631c5e7d22598ecd5723ff611904e3344ce8720784c93e3d83d40b" +[[package]] +name = "crossbeam-channel" +version = "0.5.15" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "82b8f8f868b36967f9606790d1903570de9ceaf870a7bf9fbbd3016d636a2cb2" +dependencies = [ + "crossbeam-utils", +] + [[package]] name = "crossbeam-deque" version = "0.8.6" @@ -2183,6 +2204,30 @@ version = "1.0.3" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "df3b46402a9d5adb4c86a0cf463f42e19994e3ee891101b1841f30a545cb49a9" +[[package]] +name = "httptest" +version = "0.16.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a422b4c865d103368628ae1247be6159ad8041f803eb9e2176cf69ad7d13da40" +dependencies = [ + "bstr", + "bytes", + "crossbeam-channel", + "form_urlencoded", + "futures", + "http", + "http-body-util", + "hyper", + "hyper-util", + "log", + "once_cell", + "regex", + "serde", + "serde_json", + "serde_urlencoded", + "tokio", +] + [[package]] name = "hyper" version = "1.8.1" diff --git a/backend/Cargo.toml b/backend/Cargo.toml index 5bb1849..644e97b 100644 --- a/backend/Cargo.toml +++ b/backend/Cargo.toml @@ -84,3 +84,6 @@ utoipa-axum = "0.2" uuid = { version = "1.19", features = ["v7"] } tower = "0.5" tower-http = { version = "0.6", features = ["compression-gzip", "catch-panic", "cors", "request-id", "sensitive-headers", "trace", "util"] } + +[dev-dependencies] +httptest = "0.16" diff --git a/backend/src/auth.rs b/backend/src/auth.rs index 6e465b1..da26d38 100644 --- a/backend/src/auth.rs +++ b/backend/src/auth.rs @@ -44,6 +44,10 @@ impl GeoEngineAuthMiddleware { pub fn new() -> Self { let mut configuration = configuration::Configuration::new(); configuration.base_path = CONFIG.geoengine.base_url.to_string(); + Self::from_configuration(configuration) + } + + fn from_configuration(configuration: configuration::Configuration) -> Self { Self { configuration, whitelisted_paths: WhitelistedPaths { @@ -131,6 +135,12 @@ fn uuid_parser(input: &str) -> IResult<&str, Uuid> { #[cfg(test)] mod tests { use super::*; + use axum::body::Body; + use axum::http::Request as HttpRequest; + use httptest::matchers::*; + use httptest::responders::*; + use httptest::{Expectation, Server}; + use serde_json::json; #[test] fn it_parses_bearer_tokens() { @@ -178,4 +188,70 @@ mod tests { // not whitelisted assert!(!middleware.path_is_whitelisted("/private")); } + + #[tokio::test] + async fn authorize_returns_unauthorized_for_missing_header() { + let mut middleware = GeoEngineAuthMiddleware::new(); + + let http_req: HttpRequest = HttpRequest::builder() + .uri("/private") + .body(Body::empty()) + .expect("to build http request"); + + let result = middleware.authorize(http_req).await; + + assert!( + result.is_err(), + "expected an Err(Response) when header missing" + ); + let resp = result.unwrap_err(); + assert_eq!(resp.status(), StatusCode::UNAUTHORIZED); + } + + #[tokio::test] + async fn authorize_with_valid_header_inserts_user_extension() { + // start mock auth service using `httptest` + let server = Server::run(); + + // Respond with a valid session for any GET (works regardless of path formatting) + server.expect( + Expectation::matching(request::method("GET")) + .respond_with(json_encoded(json!({ + "id": "00000000-0000-0000-0000-000000000002", + "user": { "id": "00000000-0000-0000-0000-000000000001", "email": null, "realName": null }, + "created": "2021-01-01T00:00:00Z", + "validUntil": "2022-01-01T00:00:00Z", + "project": null, + "view": null, + "roles": [] + }))) + ); + + let mut configuration = configuration::Configuration::new(); + configuration.base_path = server.url_str(""); + let mut middleware = GeoEngineAuthMiddleware::from_configuration(configuration); + + let token = Uuid::parse_str("00000000-0000-0000-0000-000000000002").unwrap(); + let header_value = format!("Bearer {token}"); + + let http_req: HttpRequest = HttpRequest::builder() + .uri("/private") + .header("Authorization", header_value) + .body(Body::empty()) + .expect("to build http request"); + + let result = middleware.authorize(http_req).await; + assert!(result.is_ok(), "expected Ok(Request) for valid session"); + + let req = result.unwrap(); + let user = req.extensions().get::().expect("user in extensions"); + + let expected_user_id = Uuid::parse_str("00000000-0000-0000-0000-000000000001").unwrap(); + let expected_session_id = Uuid::parse_str("00000000-0000-0000-0000-000000000002").unwrap(); + + assert_eq!(user.id, expected_user_id); + assert_eq!(*user.session_token, expected_session_id); + + // `httptest::Server` stops when dropped at test end + } } diff --git a/backend/src/db/model.rs b/backend/src/db/model.rs index 3d778a4..efa6437 100644 --- a/backend/src/db/model.rs +++ b/backend/src/db/model.rs @@ -170,3 +170,38 @@ pub enum Response { Raw, Document, } + +#[cfg(test)] +mod tests { + use super::*; + + #[test] + fn deserialize_jobtype_from_string() { + let v: JobType = serde_json::from_str("\"Process\"").expect("to deserialize JobType"); + assert!(matches!(v, JobType::Process)); + } + + #[test] + fn deserialize_statuscode_variants() { + let s = serde_json::from_str::("\"Accepted\"").expect("accepted"); + assert!(matches!(s, StatusCode::Accepted)); + + let s = serde_json::from_str::("\"Running\"").expect("running"); + assert!(matches!(s, StatusCode::Running)); + + let s = serde_json::from_str::("\"Successful\"").expect("successful"); + assert!(matches!(s, StatusCode::Successful)); + + let s = serde_json::from_str::("\"Failed\"").expect("failed"); + assert!(matches!(s, StatusCode::Failed)); + + let s = serde_json::from_str::("\"Dismissed\"").expect("dismissed"); + assert!(matches!(s, StatusCode::Dismissed)); + } + + #[test] + fn deserialize_response_enum() { + let r: Response = serde_json::from_str("\"Raw\"").expect("raw"); + assert!(matches!(r, Response::Raw)); + } +} diff --git a/backend/src/processes/ndvi.rs b/backend/src/processes/ndvi.rs index f2cf4d2..8fc259e 100644 --- a/backend/src/processes/ndvi.rs +++ b/backend/src/processes/ndvi.rs @@ -517,7 +517,12 @@ fn configuration(user: &User) -> Configuration { #[cfg(test)] mod tests { use super::*; + use geoengine_openapi_client::apis::configuration::Configuration as ApiConfiguration; + use httptest::matchers::*; + use httptest::responders::*; + use httptest::{Expectation, Server}; use ogcapi::types::processes::Input; + use serde_json::json; #[test] fn it_deserializes_the_input() { @@ -539,4 +544,81 @@ mod tests { let _inputs: NDVIProcessInputs = serde_json::from_value(json).unwrap(); } + + #[tokio::test] + async fn compute_ndvi_integration_with_mock_backend() { + // Start httptest server and mock the external Geo Engine endpoints + let server = Server::run(); + + // Mock workflow registration (POST /workflow -> { id: "..." }) + server.expect( + Expectation::matching(request::method("POST")).respond_with(json_encoded( + json!({ "id": "00000000-0000-0000-0000-000000000003" }), + )), + ); + + // Mock WFS feature handler (GET /wfs/{workflow} -> GeoJSON with NDVI properties) + server.expect( + Expectation::matching(request::method("GET")).respond_with(json_encoded(json!({ + "type": "FeatureCollection", + "features": [ + { "type": "Feature", "properties": { "NDVI": 0.123, "kNDVI": 0.456 } } + ] + }))), + ); + + // Build API configuration pointing to the mock server + let mut api_config = ApiConfiguration::new(); + api_config.base_path = server.url_str(""); + + // Call compute_ndvi with both outputs requested + let coord: Coordinate = [12.34, 56.78]; + + let outputs = compute_ndvi(&api_config, &coord, Year(2014), Month(1), true, true) + .await + .expect("compute_ndvi should succeed"); + + assert!(outputs.ndvi.is_some()); + assert!(outputs.k_ndvi.is_some()); + let ndvi = outputs.ndvi.unwrap(); + let k_ndvi = outputs.k_ndvi.unwrap(); + assert!((ndvi - 0.123).abs() < 1e-12); + assert!((k_ndvi - 0.456).abs() < 1e-12); + } + + #[test] + fn process_summary_has_expected_inputs_and_outputs() { + let p = NDVIProcess; + let process = p.process().expect("to produce process description"); + + // summary id / version + assert_eq!(process.summary.id, "ndvi"); + assert_eq!(process.summary.version, "0.1.0"); + + // job control options contain sync and async execute + let mut has_sync = false; + let mut has_async = false; + for opt in &process.summary.job_control_options { + match opt { + JobControlOptions::SyncExecute => has_sync = true, + JobControlOptions::AsyncExecute => has_async = true, + JobControlOptions::Dismiss => todo!(), + } + } + assert!(has_sync, "expected SyncExecute in job_control_options"); + assert!(has_async, "expected AsyncExecute in job_control_options"); + + // inputs contain coordinate, year, month + assert!(process.inputs.contains_key("coordinate")); + assert!(process.inputs.contains_key("year")); + assert!(process.inputs.contains_key("month")); + + // outputs contain ndvi and k_ndvi + assert!(process.outputs.contains_key("ndvi")); + assert!(process.outputs.contains_key("k_ndvi")); + + // some basic checks for descriptions and schema presence + let ndvi_output = &process.outputs["ndvi"]; + assert!(ndvi_output.schema.is_object()); + } } From 5e7e3eeab5dbbcc4761aaa84593f8d1eedc16307 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 16:42:39 +0100 Subject: [PATCH 15/19] complicated CI for coverage --- .github/workflows/ci.yml | 31 ++++++++++++++++++++++++++++++- 1 file changed, 30 insertions(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index cc5b0b7..3af55f8 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -61,6 +61,9 @@ jobs: permissions: contents: read + outputs: + coverage-artifact-id: ${{ steps.upload-artifact.outputs.artifact-id }} + defaults: run: working-directory: ./backend @@ -96,8 +99,34 @@ jobs: --all-features \ --lcov \ --output-path lcov.info + - id: upload-artifact + uses: actions/upload-artifact@v6 + with: + name: lcov-report-backend-${{ github.run_id }}-${{ github.run_attempt }} + path: lcov.info + compression-level: 9 + retention-days: 1 + if-no-files-found: error + + upload-coverage: + name: Upload Coverage Report + + runs-on: ubuntu-24.04 + + permissions: + contents: read + + needs: + - test-backend + + steps: + - name: Download Backend Coverage Report + uses: actions/download-artifact@v7 + with: + artifact-ids: ${{ needs.test-backend.outputs.coverage-artifact-id }} + path: lcov-backend.info - name: Upload coverage to Coveralls uses: coverallsapp/github-action@v2 with: github-token: ${{ secrets.GITHUB_TOKEN }} - file: lcov.info + file: lcov-backend.info \ No newline at end of file From 1a61f7f02b4180056772e39e5accba300e56a882 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 16:53:18 +0100 Subject: [PATCH 16/19] paths --- .github/workflows/ci.yml | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 3af55f8..bbeb134 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -98,12 +98,12 @@ jobs: --locked \ --all-features \ --lcov \ - --output-path lcov.info + --output-path /lcov.info - id: upload-artifact uses: actions/upload-artifact@v6 with: name: lcov-report-backend-${{ github.run_id }}-${{ github.run_attempt }} - path: lcov.info + path: /lcov.info compression-level: 9 retention-days: 1 if-no-files-found: error From 7ee86337d64aafd45e952a9e30cb24c079da7f53 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 17:06:42 +0100 Subject: [PATCH 17/19] paths --- .github/workflows/ci.yml | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index bbeb134..12cd7bd 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -124,9 +124,9 @@ jobs: uses: actions/download-artifact@v7 with: artifact-ids: ${{ needs.test-backend.outputs.coverage-artifact-id }} - path: lcov-backend.info + path: coverages/backend/ - name: Upload coverage to Coveralls uses: coverallsapp/github-action@v2 with: github-token: ${{ secrets.GITHUB_TOKEN }} - file: lcov-backend.info \ No newline at end of file + file: coverages/backend/lcov-backend.info \ No newline at end of file From 9826e1b237af549b6cc10a022eb5df0798d1a672 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 17:07:03 +0100 Subject: [PATCH 18/19] paths --- .github/workflows/ci.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 12cd7bd..f2780e1 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -129,4 +129,4 @@ jobs: uses: coverallsapp/github-action@v2 with: github-token: ${{ secrets.GITHUB_TOKEN }} - file: coverages/backend/lcov-backend.info \ No newline at end of file + file: coverages/backend/lcov.info \ No newline at end of file From 34be3a554810fcc41fa313bfc4422d30817da420 Mon Sep 17 00:00:00 2001 From: Christian Beilschmidt Date: Fri, 23 Jan 2026 17:16:12 +0100 Subject: [PATCH 19/19] checkout code --- .github/workflows/ci.yml | 2 ++ 1 file changed, 2 insertions(+) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index f2780e1..7bfb7d4 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -120,6 +120,8 @@ jobs: - test-backend steps: + - name: Checkout code + uses: actions/checkout@v6 - name: Download Backend Coverage Report uses: actions/download-artifact@v7 with: